diff --git a/.gitignore b/.gitignore index 40b878d..66be152 100644 --- a/.gitignore +++ b/.gitignore @@ -1 +1,2 @@ -node_modules/ \ No newline at end of file +node_modules/ +yarn-*.cjs \ No newline at end of file diff --git a/TypeScript/day7/.yarn/releases/yarn-1.22.10.cjs b/TypeScript/day7/.yarn/releases/yarn-1.22.10.cjs deleted file mode 100644 index 68b1990..0000000 --- a/TypeScript/day7/.yarn/releases/yarn-1.22.10.cjs +++ /dev/null @@ -1,147392 +0,0 @@ -#!/usr/bin/env node -module.exports = -/******/ (function(modules) { // webpackBootstrap -/******/ // The module cache -/******/ var installedModules = {}; -/******/ -/******/ // The require function -/******/ function __webpack_require__(moduleId) { -/******/ -/******/ // Check if module is in cache -/******/ if(installedModules[moduleId]) { -/******/ return installedModules[moduleId].exports; -/******/ } -/******/ // Create a new module (and put it into the cache) -/******/ var module = installedModules[moduleId] = { -/******/ i: moduleId, -/******/ l: false, -/******/ exports: {} -/******/ }; -/******/ -/******/ // Execute the module function -/******/ modules[moduleId].call(module.exports, module, module.exports, __webpack_require__); -/******/ -/******/ // Flag the module as loaded -/******/ module.l = true; -/******/ -/******/ // Return the exports of the module -/******/ return module.exports; -/******/ } -/******/ -/******/ -/******/ // expose the modules object (__webpack_modules__) -/******/ __webpack_require__.m = modules; -/******/ -/******/ // expose the module cache -/******/ __webpack_require__.c = installedModules; -/******/ -/******/ // identity function for calling harmony imports with the correct context -/******/ __webpack_require__.i = function(value) { return value; }; -/******/ -/******/ // define getter function for harmony exports -/******/ __webpack_require__.d = function(exports, name, getter) { -/******/ if(!__webpack_require__.o(exports, name)) { -/******/ Object.defineProperty(exports, name, { -/******/ configurable: false, -/******/ enumerable: true, -/******/ get: getter -/******/ }); -/******/ } -/******/ }; -/******/ -/******/ // getDefaultExport function for compatibility with non-harmony modules -/******/ __webpack_require__.n = function(module) { -/******/ var getter = module && module.__esModule ? -/******/ function getDefault() { return module['default']; } : -/******/ function getModuleExports() { return module; }; -/******/ __webpack_require__.d(getter, 'a', getter); -/******/ return getter; -/******/ }; -/******/ -/******/ // Object.prototype.hasOwnProperty.call -/******/ __webpack_require__.o = function(object, property) { return Object.prototype.hasOwnProperty.call(object, property); }; -/******/ -/******/ // __webpack_public_path__ -/******/ __webpack_require__.p = ""; -/******/ -/******/ // Load entry module and return exports -/******/ return __webpack_require__(__webpack_require__.s = 549); -/******/ }) -/************************************************************************/ -/******/ ([ -/* 0 */ -/***/ (function(module, exports) { - -module.exports = require("path"); - -/***/ }), -/* 1 */ -/***/ (function(module, __webpack_exports__, __webpack_require__) { - -"use strict"; -/* harmony export (immutable) */ __webpack_exports__["a"] = __extends; -/* unused harmony export __assign */ -/* unused harmony export __rest */ -/* unused harmony export __decorate */ -/* unused harmony export __param */ -/* unused harmony export __metadata */ -/* unused harmony export __awaiter */ -/* unused harmony export __generator */ -/* unused harmony export __exportStar */ -/* unused harmony export __values */ -/* unused harmony export __read */ -/* unused harmony export __spread */ -/* unused harmony export __await */ -/* unused harmony export __asyncGenerator */ -/* unused harmony export __asyncDelegator */ -/* unused harmony export __asyncValues */ -/* unused harmony export __makeTemplateObject */ -/* unused harmony export __importStar */ -/* unused harmony export __importDefault */ -/*! ***************************************************************************** -Copyright (c) Microsoft Corporation. All rights reserved. -Licensed under the Apache License, Version 2.0 (the "License"); you may not use -this file except in compliance with the License. You may obtain a copy of the -License at http://www.apache.org/licenses/LICENSE-2.0 - -THIS CODE IS PROVIDED ON AN *AS IS* BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY -KIND, EITHER EXPRESS OR IMPLIED, INCLUDING WITHOUT LIMITATION ANY IMPLIED -WARRANTIES OR CONDITIONS OF TITLE, FITNESS FOR A PARTICULAR PURPOSE, -MERCHANTABLITY OR NON-INFRINGEMENT. - -See the Apache Version 2.0 License for specific language governing permissions -and limitations under the License. -***************************************************************************** */ -/* global Reflect, Promise */ - -var extendStatics = function(d, b) { - extendStatics = Object.setPrototypeOf || - ({ __proto__: [] } instanceof Array && function (d, b) { d.__proto__ = b; }) || - function (d, b) { for (var p in b) if (b.hasOwnProperty(p)) d[p] = b[p]; }; - return extendStatics(d, b); -}; - -function __extends(d, b) { - extendStatics(d, b); - function __() { this.constructor = d; } - d.prototype = b === null ? Object.create(b) : (__.prototype = b.prototype, new __()); -} - -var __assign = function() { - __assign = Object.assign || function __assign(t) { - for (var s, i = 1, n = arguments.length; i < n; i++) { - s = arguments[i]; - for (var p in s) if (Object.prototype.hasOwnProperty.call(s, p)) t[p] = s[p]; - } - return t; - } - return __assign.apply(this, arguments); -} - -function __rest(s, e) { - var t = {}; - for (var p in s) if (Object.prototype.hasOwnProperty.call(s, p) && e.indexOf(p) < 0) - t[p] = s[p]; - if (s != null && typeof Object.getOwnPropertySymbols === "function") - for (var i = 0, p = Object.getOwnPropertySymbols(s); i < p.length; i++) if (e.indexOf(p[i]) < 0) - t[p[i]] = s[p[i]]; - return t; -} - -function __decorate(decorators, target, key, desc) { - var c = arguments.length, r = c < 3 ? target : desc === null ? desc = Object.getOwnPropertyDescriptor(target, key) : desc, d; - if (typeof Reflect === "object" && typeof Reflect.decorate === "function") r = Reflect.decorate(decorators, target, key, desc); - else for (var i = decorators.length - 1; i >= 0; i--) if (d = decorators[i]) r = (c < 3 ? d(r) : c > 3 ? d(target, key, r) : d(target, key)) || r; - return c > 3 && r && Object.defineProperty(target, key, r), r; -} - -function __param(paramIndex, decorator) { - return function (target, key) { decorator(target, key, paramIndex); } -} - -function __metadata(metadataKey, metadataValue) { - if (typeof Reflect === "object" && typeof Reflect.metadata === "function") return Reflect.metadata(metadataKey, metadataValue); -} - -function __awaiter(thisArg, _arguments, P, generator) { - return new (P || (P = Promise))(function (resolve, reject) { - function fulfilled(value) { try { step(generator.next(value)); } catch (e) { reject(e); } } - function rejected(value) { try { step(generator["throw"](value)); } catch (e) { reject(e); } } - function step(result) { result.done ? resolve(result.value) : new P(function (resolve) { resolve(result.value); }).then(fulfilled, rejected); } - step((generator = generator.apply(thisArg, _arguments || [])).next()); - }); -} - -function __generator(thisArg, body) { - var _ = { label: 0, sent: function() { if (t[0] & 1) throw t[1]; return t[1]; }, trys: [], ops: [] }, f, y, t, g; - return g = { next: verb(0), "throw": verb(1), "return": verb(2) }, typeof Symbol === "function" && (g[Symbol.iterator] = function() { return this; }), g; - function verb(n) { return function (v) { return step([n, v]); }; } - function step(op) { - if (f) throw new TypeError("Generator is already executing."); - while (_) try { - if (f = 1, y && (t = op[0] & 2 ? y["return"] : op[0] ? y["throw"] || ((t = y["return"]) && t.call(y), 0) : y.next) && !(t = t.call(y, op[1])).done) return t; - if (y = 0, t) op = [op[0] & 2, t.value]; - switch (op[0]) { - case 0: case 1: t = op; break; - case 4: _.label++; return { value: op[1], done: false }; - case 5: _.label++; y = op[1]; op = [0]; continue; - case 7: op = _.ops.pop(); _.trys.pop(); continue; - default: - if (!(t = _.trys, t = t.length > 0 && t[t.length - 1]) && (op[0] === 6 || op[0] === 2)) { _ = 0; continue; } - if (op[0] === 3 && (!t || (op[1] > t[0] && op[1] < t[3]))) { _.label = op[1]; break; } - if (op[0] === 6 && _.label < t[1]) { _.label = t[1]; t = op; break; } - if (t && _.label < t[2]) { _.label = t[2]; _.ops.push(op); break; } - if (t[2]) _.ops.pop(); - _.trys.pop(); continue; - } - op = body.call(thisArg, _); - } catch (e) { op = [6, e]; y = 0; } finally { f = t = 0; } - if (op[0] & 5) throw op[1]; return { value: op[0] ? op[1] : void 0, done: true }; - } -} - -function __exportStar(m, exports) { - for (var p in m) if (!exports.hasOwnProperty(p)) exports[p] = m[p]; -} - -function __values(o) { - var m = typeof Symbol === "function" && o[Symbol.iterator], i = 0; - if (m) return m.call(o); - return { - next: function () { - if (o && i >= o.length) o = void 0; - return { value: o && o[i++], done: !o }; - } - }; -} - -function __read(o, n) { - var m = typeof Symbol === "function" && o[Symbol.iterator]; - if (!m) return o; - var i = m.call(o), r, ar = [], e; - try { - while ((n === void 0 || n-- > 0) && !(r = i.next()).done) ar.push(r.value); - } - catch (error) { e = { error: error }; } - finally { - try { - if (r && !r.done && (m = i["return"])) m.call(i); - } - finally { if (e) throw e.error; } - } - return ar; -} - -function __spread() { - for (var ar = [], i = 0; i < arguments.length; i++) - ar = ar.concat(__read(arguments[i])); - return ar; -} - -function __await(v) { - return this instanceof __await ? (this.v = v, this) : new __await(v); -} - -function __asyncGenerator(thisArg, _arguments, generator) { - if (!Symbol.asyncIterator) throw new TypeError("Symbol.asyncIterator is not defined."); - var g = generator.apply(thisArg, _arguments || []), i, q = []; - return i = {}, verb("next"), verb("throw"), verb("return"), i[Symbol.asyncIterator] = function () { return this; }, i; - function verb(n) { if (g[n]) i[n] = function (v) { return new Promise(function (a, b) { q.push([n, v, a, b]) > 1 || resume(n, v); }); }; } - function resume(n, v) { try { step(g[n](v)); } catch (e) { settle(q[0][3], e); } } - function step(r) { r.value instanceof __await ? Promise.resolve(r.value.v).then(fulfill, reject) : settle(q[0][2], r); } - function fulfill(value) { resume("next", value); } - function reject(value) { resume("throw", value); } - function settle(f, v) { if (f(v), q.shift(), q.length) resume(q[0][0], q[0][1]); } -} - -function __asyncDelegator(o) { - var i, p; - return i = {}, verb("next"), verb("throw", function (e) { throw e; }), verb("return"), i[Symbol.iterator] = function () { return this; }, i; - function verb(n, f) { i[n] = o[n] ? function (v) { return (p = !p) ? { value: __await(o[n](v)), done: n === "return" } : f ? f(v) : v; } : f; } -} - -function __asyncValues(o) { - if (!Symbol.asyncIterator) throw new TypeError("Symbol.asyncIterator is not defined."); - var m = o[Symbol.asyncIterator], i; - return m ? m.call(o) : (o = typeof __values === "function" ? __values(o) : o[Symbol.iterator](), i = {}, verb("next"), verb("throw"), verb("return"), i[Symbol.asyncIterator] = function () { return this; }, i); - function verb(n) { i[n] = o[n] && function (v) { return new Promise(function (resolve, reject) { v = o[n](v), settle(resolve, reject, v.done, v.value); }); }; } - function settle(resolve, reject, d, v) { Promise.resolve(v).then(function(v) { resolve({ value: v, done: d }); }, reject); } -} - -function __makeTemplateObject(cooked, raw) { - if (Object.defineProperty) { Object.defineProperty(cooked, "raw", { value: raw }); } else { cooked.raw = raw; } - return cooked; -}; - -function __importStar(mod) { - if (mod && mod.__esModule) return mod; - var result = {}; - if (mod != null) for (var k in mod) if (Object.hasOwnProperty.call(mod, k)) result[k] = mod[k]; - result.default = mod; - return result; -} - -function __importDefault(mod) { - return (mod && mod.__esModule) ? mod : { default: mod }; -} - - -/***/ }), -/* 2 */ -/***/ (function(module, exports, __webpack_require__) { - -"use strict"; - - -exports.__esModule = true; - -var _promise = __webpack_require__(227); - -var _promise2 = _interopRequireDefault(_promise); - -function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; } - -exports.default = function (fn) { - return function () { - var gen = fn.apply(this, arguments); - return new _promise2.default(function (resolve, reject) { - function step(key, arg) { - try { - var info = gen[key](arg); - var value = info.value; - } catch (error) { - reject(error); - return; - } - - if (info.done) { - resolve(value); - } else { - return _promise2.default.resolve(value).then(function (value) { - step("next", value); - }, function (err) { - step("throw", err); - }); - } - } - - return step("next"); - }); - }; -}; - -/***/ }), -/* 3 */ -/***/ (function(module, exports) { - -module.exports = require("util"); - -/***/ }), -/* 4 */ -/***/ (function(module, exports, __webpack_require__) { - -"use strict"; - - -Object.defineProperty(exports, "__esModule", { - value: true -}); -exports.getFirstSuitableFolder = exports.readFirstAvailableStream = exports.makeTempDir = exports.hardlinksWork = exports.writeFilePreservingEol = exports.getFileSizeOnDisk = exports.walk = exports.symlink = exports.find = exports.readJsonAndFile = exports.readJson = exports.readFileAny = exports.hardlinkBulk = exports.copyBulk = exports.unlink = exports.glob = exports.link = exports.chmod = exports.lstat = exports.exists = exports.mkdirp = exports.stat = exports.access = exports.rename = exports.readdir = exports.realpath = exports.readlink = exports.writeFile = exports.open = exports.readFileBuffer = exports.lockQueue = exports.constants = undefined; - -var _asyncToGenerator2; - -function _load_asyncToGenerator() { - return _asyncToGenerator2 = _interopRequireDefault(__webpack_require__(2)); -} - -let buildActionsForCopy = (() => { - var _ref = (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* (queue, events, possibleExtraneous, reporter) { - - // - let build = (() => { - var _ref5 = (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* (data) { - const src = data.src, - dest = data.dest, - type = data.type; - - const onFresh = data.onFresh || noop; - const onDone = data.onDone || noop; - - // TODO https://github.com/yarnpkg/yarn/issues/3751 - // related to bundled dependencies handling - if (files.has(dest.toLowerCase())) { - reporter.verbose(`The case-insensitive file ${dest} shouldn't be copied twice in one bulk copy`); - } else { - files.add(dest.toLowerCase()); - } - - if (type === 'symlink') { - yield mkdirp((_path || _load_path()).default.dirname(dest)); - onFresh(); - actions.symlink.push({ - dest, - linkname: src - }); - onDone(); - return; - } - - if (events.ignoreBasenames.indexOf((_path || _load_path()).default.basename(src)) >= 0) { - // ignored file - return; - } - - const srcStat = yield lstat(src); - let srcFiles; - - if (srcStat.isDirectory()) { - srcFiles = yield readdir(src); - } - - let destStat; - try { - // try accessing the destination - destStat = yield lstat(dest); - } catch (e) { - // proceed if destination doesn't exist, otherwise error - if (e.code !== 'ENOENT') { - throw e; - } - } - - // if destination exists - if (destStat) { - const bothSymlinks = srcStat.isSymbolicLink() && destStat.isSymbolicLink(); - const bothFolders = srcStat.isDirectory() && destStat.isDirectory(); - const bothFiles = srcStat.isFile() && destStat.isFile(); - - // EINVAL access errors sometimes happen which shouldn't because node shouldn't be giving - // us modes that aren't valid. investigate this, it's generally safe to proceed. - - /* if (srcStat.mode !== destStat.mode) { - try { - await access(dest, srcStat.mode); - } catch (err) {} - } */ - - if (bothFiles && artifactFiles.has(dest)) { - // this file gets changed during build, likely by a custom install script. Don't bother checking it. - onDone(); - reporter.verbose(reporter.lang('verboseFileSkipArtifact', src)); - return; - } - - if (bothFiles && srcStat.size === destStat.size && (0, (_fsNormalized || _load_fsNormalized()).fileDatesEqual)(srcStat.mtime, destStat.mtime)) { - // we can safely assume this is the same file - onDone(); - reporter.verbose(reporter.lang('verboseFileSkip', src, dest, srcStat.size, +srcStat.mtime)); - return; - } - - if (bothSymlinks) { - const srcReallink = yield readlink(src); - if (srcReallink === (yield readlink(dest))) { - // if both symlinks are the same then we can continue on - onDone(); - reporter.verbose(reporter.lang('verboseFileSkipSymlink', src, dest, srcReallink)); - return; - } - } - - if (bothFolders) { - // mark files that aren't in this folder as possibly extraneous - const destFiles = yield readdir(dest); - invariant(srcFiles, 'src files not initialised'); - - for (var _iterator4 = destFiles, _isArray4 = Array.isArray(_iterator4), _i4 = 0, _iterator4 = _isArray4 ? _iterator4 : _iterator4[Symbol.iterator]();;) { - var _ref6; - - if (_isArray4) { - if (_i4 >= _iterator4.length) break; - _ref6 = _iterator4[_i4++]; - } else { - _i4 = _iterator4.next(); - if (_i4.done) break; - _ref6 = _i4.value; - } - - const file = _ref6; - - if (srcFiles.indexOf(file) < 0) { - const loc = (_path || _load_path()).default.join(dest, file); - possibleExtraneous.add(loc); - - if ((yield lstat(loc)).isDirectory()) { - for (var _iterator5 = yield readdir(loc), _isArray5 = Array.isArray(_iterator5), _i5 = 0, _iterator5 = _isArray5 ? _iterator5 : _iterator5[Symbol.iterator]();;) { - var _ref7; - - if (_isArray5) { - if (_i5 >= _iterator5.length) break; - _ref7 = _iterator5[_i5++]; - } else { - _i5 = _iterator5.next(); - if (_i5.done) break; - _ref7 = _i5.value; - } - - const file = _ref7; - - possibleExtraneous.add((_path || _load_path()).default.join(loc, file)); - } - } - } - } - } - } - - if (destStat && destStat.isSymbolicLink()) { - yield (0, (_fsNormalized || _load_fsNormalized()).unlink)(dest); - destStat = null; - } - - if (srcStat.isSymbolicLink()) { - onFresh(); - const linkname = yield readlink(src); - actions.symlink.push({ - dest, - linkname - }); - onDone(); - } else if (srcStat.isDirectory()) { - if (!destStat) { - reporter.verbose(reporter.lang('verboseFileFolder', dest)); - yield mkdirp(dest); - } - - const destParts = dest.split((_path || _load_path()).default.sep); - while (destParts.length) { - files.add(destParts.join((_path || _load_path()).default.sep).toLowerCase()); - destParts.pop(); - } - - // push all files to queue - invariant(srcFiles, 'src files not initialised'); - let remaining = srcFiles.length; - if (!remaining) { - onDone(); - } - for (var _iterator6 = srcFiles, _isArray6 = Array.isArray(_iterator6), _i6 = 0, _iterator6 = _isArray6 ? _iterator6 : _iterator6[Symbol.iterator]();;) { - var _ref8; - - if (_isArray6) { - if (_i6 >= _iterator6.length) break; - _ref8 = _iterator6[_i6++]; - } else { - _i6 = _iterator6.next(); - if (_i6.done) break; - _ref8 = _i6.value; - } - - const file = _ref8; - - queue.push({ - dest: (_path || _load_path()).default.join(dest, file), - onFresh, - onDone: function (_onDone) { - function onDone() { - return _onDone.apply(this, arguments); - } - - onDone.toString = function () { - return _onDone.toString(); - }; - - return onDone; - }(function () { - if (--remaining === 0) { - onDone(); - } - }), - src: (_path || _load_path()).default.join(src, file) - }); - } - } else if (srcStat.isFile()) { - onFresh(); - actions.file.push({ - src, - dest, - atime: srcStat.atime, - mtime: srcStat.mtime, - mode: srcStat.mode - }); - onDone(); - } else { - throw new Error(`unsure how to copy this: ${src}`); - } - }); - - return function build(_x5) { - return _ref5.apply(this, arguments); - }; - })(); - - const artifactFiles = new Set(events.artifactFiles || []); - const files = new Set(); - - // initialise events - for (var _iterator = queue, _isArray = Array.isArray(_iterator), _i = 0, _iterator = _isArray ? _iterator : _iterator[Symbol.iterator]();;) { - var _ref2; - - if (_isArray) { - if (_i >= _iterator.length) break; - _ref2 = _iterator[_i++]; - } else { - _i = _iterator.next(); - if (_i.done) break; - _ref2 = _i.value; - } - - const item = _ref2; - - const onDone = item.onDone; - item.onDone = function () { - events.onProgress(item.dest); - if (onDone) { - onDone(); - } - }; - } - events.onStart(queue.length); - - // start building actions - const actions = { - file: [], - symlink: [], - link: [] - }; - - // custom concurrency logic as we're always executing stacks of CONCURRENT_QUEUE_ITEMS queue items - // at a time due to the requirement to push items onto the queue - while (queue.length) { - const items = queue.splice(0, CONCURRENT_QUEUE_ITEMS); - yield Promise.all(items.map(build)); - } - - // simulate the existence of some files to prevent considering them extraneous - for (var _iterator2 = artifactFiles, _isArray2 = Array.isArray(_iterator2), _i2 = 0, _iterator2 = _isArray2 ? _iterator2 : _iterator2[Symbol.iterator]();;) { - var _ref3; - - if (_isArray2) { - if (_i2 >= _iterator2.length) break; - _ref3 = _iterator2[_i2++]; - } else { - _i2 = _iterator2.next(); - if (_i2.done) break; - _ref3 = _i2.value; - } - - const file = _ref3; - - if (possibleExtraneous.has(file)) { - reporter.verbose(reporter.lang('verboseFilePhantomExtraneous', file)); - possibleExtraneous.delete(file); - } - } - - for (var _iterator3 = possibleExtraneous, _isArray3 = Array.isArray(_iterator3), _i3 = 0, _iterator3 = _isArray3 ? _iterator3 : _iterator3[Symbol.iterator]();;) { - var _ref4; - - if (_isArray3) { - if (_i3 >= _iterator3.length) break; - _ref4 = _iterator3[_i3++]; - } else { - _i3 = _iterator3.next(); - if (_i3.done) break; - _ref4 = _i3.value; - } - - const loc = _ref4; - - if (files.has(loc.toLowerCase())) { - possibleExtraneous.delete(loc); - } - } - - return actions; - }); - - return function buildActionsForCopy(_x, _x2, _x3, _x4) { - return _ref.apply(this, arguments); - }; -})(); - -let buildActionsForHardlink = (() => { - var _ref9 = (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* (queue, events, possibleExtraneous, reporter) { - - // - let build = (() => { - var _ref13 = (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* (data) { - const src = data.src, - dest = data.dest; - - const onFresh = data.onFresh || noop; - const onDone = data.onDone || noop; - if (files.has(dest.toLowerCase())) { - // Fixes issue https://github.com/yarnpkg/yarn/issues/2734 - // When bulk hardlinking we have A -> B structure that we want to hardlink to A1 -> B1, - // package-linker passes that modules A1 and B1 need to be hardlinked, - // the recursive linking algorithm of A1 ends up scheduling files in B1 to be linked twice which will case - // an exception. - onDone(); - return; - } - files.add(dest.toLowerCase()); - - if (events.ignoreBasenames.indexOf((_path || _load_path()).default.basename(src)) >= 0) { - // ignored file - return; - } - - const srcStat = yield lstat(src); - let srcFiles; - - if (srcStat.isDirectory()) { - srcFiles = yield readdir(src); - } - - const destExists = yield exists(dest); - if (destExists) { - const destStat = yield lstat(dest); - - const bothSymlinks = srcStat.isSymbolicLink() && destStat.isSymbolicLink(); - const bothFolders = srcStat.isDirectory() && destStat.isDirectory(); - const bothFiles = srcStat.isFile() && destStat.isFile(); - - if (srcStat.mode !== destStat.mode) { - try { - yield access(dest, srcStat.mode); - } catch (err) { - // EINVAL access errors sometimes happen which shouldn't because node shouldn't be giving - // us modes that aren't valid. investigate this, it's generally safe to proceed. - reporter.verbose(err); - } - } - - if (bothFiles && artifactFiles.has(dest)) { - // this file gets changed during build, likely by a custom install script. Don't bother checking it. - onDone(); - reporter.verbose(reporter.lang('verboseFileSkipArtifact', src)); - return; - } - - // correct hardlink - if (bothFiles && srcStat.ino !== null && srcStat.ino === destStat.ino) { - onDone(); - reporter.verbose(reporter.lang('verboseFileSkip', src, dest, srcStat.ino)); - return; - } - - if (bothSymlinks) { - const srcReallink = yield readlink(src); - if (srcReallink === (yield readlink(dest))) { - // if both symlinks are the same then we can continue on - onDone(); - reporter.verbose(reporter.lang('verboseFileSkipSymlink', src, dest, srcReallink)); - return; - } - } - - if (bothFolders) { - // mark files that aren't in this folder as possibly extraneous - const destFiles = yield readdir(dest); - invariant(srcFiles, 'src files not initialised'); - - for (var _iterator10 = destFiles, _isArray10 = Array.isArray(_iterator10), _i10 = 0, _iterator10 = _isArray10 ? _iterator10 : _iterator10[Symbol.iterator]();;) { - var _ref14; - - if (_isArray10) { - if (_i10 >= _iterator10.length) break; - _ref14 = _iterator10[_i10++]; - } else { - _i10 = _iterator10.next(); - if (_i10.done) break; - _ref14 = _i10.value; - } - - const file = _ref14; - - if (srcFiles.indexOf(file) < 0) { - const loc = (_path || _load_path()).default.join(dest, file); - possibleExtraneous.add(loc); - - if ((yield lstat(loc)).isDirectory()) { - for (var _iterator11 = yield readdir(loc), _isArray11 = Array.isArray(_iterator11), _i11 = 0, _iterator11 = _isArray11 ? _iterator11 : _iterator11[Symbol.iterator]();;) { - var _ref15; - - if (_isArray11) { - if (_i11 >= _iterator11.length) break; - _ref15 = _iterator11[_i11++]; - } else { - _i11 = _iterator11.next(); - if (_i11.done) break; - _ref15 = _i11.value; - } - - const file = _ref15; - - possibleExtraneous.add((_path || _load_path()).default.join(loc, file)); - } - } - } - } - } - } - - if (srcStat.isSymbolicLink()) { - onFresh(); - const linkname = yield readlink(src); - actions.symlink.push({ - dest, - linkname - }); - onDone(); - } else if (srcStat.isDirectory()) { - reporter.verbose(reporter.lang('verboseFileFolder', dest)); - yield mkdirp(dest); - - const destParts = dest.split((_path || _load_path()).default.sep); - while (destParts.length) { - files.add(destParts.join((_path || _load_path()).default.sep).toLowerCase()); - destParts.pop(); - } - - // push all files to queue - invariant(srcFiles, 'src files not initialised'); - let remaining = srcFiles.length; - if (!remaining) { - onDone(); - } - for (var _iterator12 = srcFiles, _isArray12 = Array.isArray(_iterator12), _i12 = 0, _iterator12 = _isArray12 ? _iterator12 : _iterator12[Symbol.iterator]();;) { - var _ref16; - - if (_isArray12) { - if (_i12 >= _iterator12.length) break; - _ref16 = _iterator12[_i12++]; - } else { - _i12 = _iterator12.next(); - if (_i12.done) break; - _ref16 = _i12.value; - } - - const file = _ref16; - - queue.push({ - onFresh, - src: (_path || _load_path()).default.join(src, file), - dest: (_path || _load_path()).default.join(dest, file), - onDone: function (_onDone2) { - function onDone() { - return _onDone2.apply(this, arguments); - } - - onDone.toString = function () { - return _onDone2.toString(); - }; - - return onDone; - }(function () { - if (--remaining === 0) { - onDone(); - } - }) - }); - } - } else if (srcStat.isFile()) { - onFresh(); - actions.link.push({ - src, - dest, - removeDest: destExists - }); - onDone(); - } else { - throw new Error(`unsure how to copy this: ${src}`); - } - }); - - return function build(_x10) { - return _ref13.apply(this, arguments); - }; - })(); - - const artifactFiles = new Set(events.artifactFiles || []); - const files = new Set(); - - // initialise events - for (var _iterator7 = queue, _isArray7 = Array.isArray(_iterator7), _i7 = 0, _iterator7 = _isArray7 ? _iterator7 : _iterator7[Symbol.iterator]();;) { - var _ref10; - - if (_isArray7) { - if (_i7 >= _iterator7.length) break; - _ref10 = _iterator7[_i7++]; - } else { - _i7 = _iterator7.next(); - if (_i7.done) break; - _ref10 = _i7.value; - } - - const item = _ref10; - - const onDone = item.onDone || noop; - item.onDone = function () { - events.onProgress(item.dest); - onDone(); - }; - } - events.onStart(queue.length); - - // start building actions - const actions = { - file: [], - symlink: [], - link: [] - }; - - // custom concurrency logic as we're always executing stacks of CONCURRENT_QUEUE_ITEMS queue items - // at a time due to the requirement to push items onto the queue - while (queue.length) { - const items = queue.splice(0, CONCURRENT_QUEUE_ITEMS); - yield Promise.all(items.map(build)); - } - - // simulate the existence of some files to prevent considering them extraneous - for (var _iterator8 = artifactFiles, _isArray8 = Array.isArray(_iterator8), _i8 = 0, _iterator8 = _isArray8 ? _iterator8 : _iterator8[Symbol.iterator]();;) { - var _ref11; - - if (_isArray8) { - if (_i8 >= _iterator8.length) break; - _ref11 = _iterator8[_i8++]; - } else { - _i8 = _iterator8.next(); - if (_i8.done) break; - _ref11 = _i8.value; - } - - const file = _ref11; - - if (possibleExtraneous.has(file)) { - reporter.verbose(reporter.lang('verboseFilePhantomExtraneous', file)); - possibleExtraneous.delete(file); - } - } - - for (var _iterator9 = possibleExtraneous, _isArray9 = Array.isArray(_iterator9), _i9 = 0, _iterator9 = _isArray9 ? _iterator9 : _iterator9[Symbol.iterator]();;) { - var _ref12; - - if (_isArray9) { - if (_i9 >= _iterator9.length) break; - _ref12 = _iterator9[_i9++]; - } else { - _i9 = _iterator9.next(); - if (_i9.done) break; - _ref12 = _i9.value; - } - - const loc = _ref12; - - if (files.has(loc.toLowerCase())) { - possibleExtraneous.delete(loc); - } - } - - return actions; - }); - - return function buildActionsForHardlink(_x6, _x7, _x8, _x9) { - return _ref9.apply(this, arguments); - }; -})(); - -let copyBulk = exports.copyBulk = (() => { - var _ref17 = (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* (queue, reporter, _events) { - const events = { - onStart: _events && _events.onStart || noop, - onProgress: _events && _events.onProgress || noop, - possibleExtraneous: _events ? _events.possibleExtraneous : new Set(), - ignoreBasenames: _events && _events.ignoreBasenames || [], - artifactFiles: _events && _events.artifactFiles || [] - }; - - const actions = yield buildActionsForCopy(queue, events, events.possibleExtraneous, reporter); - events.onStart(actions.file.length + actions.symlink.length + actions.link.length); - - const fileActions = actions.file; - - const currentlyWriting = new Map(); - - yield (_promise || _load_promise()).queue(fileActions, (() => { - var _ref18 = (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* (data) { - let writePromise; - while (writePromise = currentlyWriting.get(data.dest)) { - yield writePromise; - } - - reporter.verbose(reporter.lang('verboseFileCopy', data.src, data.dest)); - const copier = (0, (_fsNormalized || _load_fsNormalized()).copyFile)(data, function () { - return currentlyWriting.delete(data.dest); - }); - currentlyWriting.set(data.dest, copier); - events.onProgress(data.dest); - return copier; - }); - - return function (_x14) { - return _ref18.apply(this, arguments); - }; - })(), CONCURRENT_QUEUE_ITEMS); - - // we need to copy symlinks last as they could reference files we were copying - const symlinkActions = actions.symlink; - yield (_promise || _load_promise()).queue(symlinkActions, function (data) { - const linkname = (_path || _load_path()).default.resolve((_path || _load_path()).default.dirname(data.dest), data.linkname); - reporter.verbose(reporter.lang('verboseFileSymlink', data.dest, linkname)); - return symlink(linkname, data.dest); - }); - }); - - return function copyBulk(_x11, _x12, _x13) { - return _ref17.apply(this, arguments); - }; -})(); - -let hardlinkBulk = exports.hardlinkBulk = (() => { - var _ref19 = (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* (queue, reporter, _events) { - const events = { - onStart: _events && _events.onStart || noop, - onProgress: _events && _events.onProgress || noop, - possibleExtraneous: _events ? _events.possibleExtraneous : new Set(), - artifactFiles: _events && _events.artifactFiles || [], - ignoreBasenames: [] - }; - - const actions = yield buildActionsForHardlink(queue, events, events.possibleExtraneous, reporter); - events.onStart(actions.file.length + actions.symlink.length + actions.link.length); - - const fileActions = actions.link; - - yield (_promise || _load_promise()).queue(fileActions, (() => { - var _ref20 = (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* (data) { - reporter.verbose(reporter.lang('verboseFileLink', data.src, data.dest)); - if (data.removeDest) { - yield (0, (_fsNormalized || _load_fsNormalized()).unlink)(data.dest); - } - yield link(data.src, data.dest); - }); - - return function (_x18) { - return _ref20.apply(this, arguments); - }; - })(), CONCURRENT_QUEUE_ITEMS); - - // we need to copy symlinks last as they could reference files we were copying - const symlinkActions = actions.symlink; - yield (_promise || _load_promise()).queue(symlinkActions, function (data) { - const linkname = (_path || _load_path()).default.resolve((_path || _load_path()).default.dirname(data.dest), data.linkname); - reporter.verbose(reporter.lang('verboseFileSymlink', data.dest, linkname)); - return symlink(linkname, data.dest); - }); - }); - - return function hardlinkBulk(_x15, _x16, _x17) { - return _ref19.apply(this, arguments); - }; -})(); - -let readFileAny = exports.readFileAny = (() => { - var _ref21 = (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* (files) { - for (var _iterator13 = files, _isArray13 = Array.isArray(_iterator13), _i13 = 0, _iterator13 = _isArray13 ? _iterator13 : _iterator13[Symbol.iterator]();;) { - var _ref22; - - if (_isArray13) { - if (_i13 >= _iterator13.length) break; - _ref22 = _iterator13[_i13++]; - } else { - _i13 = _iterator13.next(); - if (_i13.done) break; - _ref22 = _i13.value; - } - - const file = _ref22; - - if (yield exists(file)) { - return readFile(file); - } - } - return null; - }); - - return function readFileAny(_x19) { - return _ref21.apply(this, arguments); - }; -})(); - -let readJson = exports.readJson = (() => { - var _ref23 = (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* (loc) { - return (yield readJsonAndFile(loc)).object; - }); - - return function readJson(_x20) { - return _ref23.apply(this, arguments); - }; -})(); - -let readJsonAndFile = exports.readJsonAndFile = (() => { - var _ref24 = (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* (loc) { - const file = yield readFile(loc); - try { - return { - object: (0, (_map || _load_map()).default)(JSON.parse(stripBOM(file))), - content: file - }; - } catch (err) { - err.message = `${loc}: ${err.message}`; - throw err; - } - }); - - return function readJsonAndFile(_x21) { - return _ref24.apply(this, arguments); - }; -})(); - -let find = exports.find = (() => { - var _ref25 = (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* (filename, dir) { - const parts = dir.split((_path || _load_path()).default.sep); - - while (parts.length) { - const loc = parts.concat(filename).join((_path || _load_path()).default.sep); - - if (yield exists(loc)) { - return loc; - } else { - parts.pop(); - } - } - - return false; - }); - - return function find(_x22, _x23) { - return _ref25.apply(this, arguments); - }; -})(); - -let symlink = exports.symlink = (() => { - var _ref26 = (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* (src, dest) { - if (process.platform !== 'win32') { - // use relative paths otherwise which will be retained if the directory is moved - src = (_path || _load_path()).default.relative((_path || _load_path()).default.dirname(dest), src); - // When path.relative returns an empty string for the current directory, we should instead use - // '.', which is a valid fs.symlink target. - src = src || '.'; - } - - try { - const stats = yield lstat(dest); - if (stats.isSymbolicLink()) { - const resolved = dest; - if (resolved === src) { - return; - } - } - } catch (err) { - if (err.code !== 'ENOENT') { - throw err; - } - } - - // We use rimraf for unlink which never throws an ENOENT on missing target - yield (0, (_fsNormalized || _load_fsNormalized()).unlink)(dest); - - if (process.platform === 'win32') { - // use directory junctions if possible on win32, this requires absolute paths - yield fsSymlink(src, dest, 'junction'); - } else { - yield fsSymlink(src, dest); - } - }); - - return function symlink(_x24, _x25) { - return _ref26.apply(this, arguments); - }; -})(); - -let walk = exports.walk = (() => { - var _ref27 = (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* (dir, relativeDir, ignoreBasenames = new Set()) { - let files = []; - - let filenames = yield readdir(dir); - if (ignoreBasenames.size) { - filenames = filenames.filter(function (name) { - return !ignoreBasenames.has(name); - }); - } - - for (var _iterator14 = filenames, _isArray14 = Array.isArray(_iterator14), _i14 = 0, _iterator14 = _isArray14 ? _iterator14 : _iterator14[Symbol.iterator]();;) { - var _ref28; - - if (_isArray14) { - if (_i14 >= _iterator14.length) break; - _ref28 = _iterator14[_i14++]; - } else { - _i14 = _iterator14.next(); - if (_i14.done) break; - _ref28 = _i14.value; - } - - const name = _ref28; - - const relative = relativeDir ? (_path || _load_path()).default.join(relativeDir, name) : name; - const loc = (_path || _load_path()).default.join(dir, name); - const stat = yield lstat(loc); - - files.push({ - relative, - basename: name, - absolute: loc, - mtime: +stat.mtime - }); - - if (stat.isDirectory()) { - files = files.concat((yield walk(loc, relative, ignoreBasenames))); - } - } - - return files; - }); - - return function walk(_x26, _x27) { - return _ref27.apply(this, arguments); - }; -})(); - -let getFileSizeOnDisk = exports.getFileSizeOnDisk = (() => { - var _ref29 = (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* (loc) { - const stat = yield lstat(loc); - const size = stat.size, - blockSize = stat.blksize; - - - return Math.ceil(size / blockSize) * blockSize; - }); - - return function getFileSizeOnDisk(_x28) { - return _ref29.apply(this, arguments); - }; -})(); - -let getEolFromFile = (() => { - var _ref30 = (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* (path) { - if (!(yield exists(path))) { - return undefined; - } - - const buffer = yield readFileBuffer(path); - - for (let i = 0; i < buffer.length; ++i) { - if (buffer[i] === cr) { - return '\r\n'; - } - if (buffer[i] === lf) { - return '\n'; - } - } - return undefined; - }); - - return function getEolFromFile(_x29) { - return _ref30.apply(this, arguments); - }; -})(); - -let writeFilePreservingEol = exports.writeFilePreservingEol = (() => { - var _ref31 = (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* (path, data) { - const eol = (yield getEolFromFile(path)) || (_os || _load_os()).default.EOL; - if (eol !== '\n') { - data = data.replace(/\n/g, eol); - } - yield writeFile(path, data); - }); - - return function writeFilePreservingEol(_x30, _x31) { - return _ref31.apply(this, arguments); - }; -})(); - -let hardlinksWork = exports.hardlinksWork = (() => { - var _ref32 = (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* (dir) { - const filename = 'test-file' + Math.random(); - const file = (_path || _load_path()).default.join(dir, filename); - const fileLink = (_path || _load_path()).default.join(dir, filename + '-link'); - try { - yield writeFile(file, 'test'); - yield link(file, fileLink); - } catch (err) { - return false; - } finally { - yield (0, (_fsNormalized || _load_fsNormalized()).unlink)(file); - yield (0, (_fsNormalized || _load_fsNormalized()).unlink)(fileLink); - } - return true; - }); - - return function hardlinksWork(_x32) { - return _ref32.apply(this, arguments); - }; -})(); - -// not a strict polyfill for Node's fs.mkdtemp - - -let makeTempDir = exports.makeTempDir = (() => { - var _ref33 = (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* (prefix) { - const dir = (_path || _load_path()).default.join((_os || _load_os()).default.tmpdir(), `yarn-${prefix || ''}-${Date.now()}-${Math.random()}`); - yield (0, (_fsNormalized || _load_fsNormalized()).unlink)(dir); - yield mkdirp(dir); - return dir; - }); - - return function makeTempDir(_x33) { - return _ref33.apply(this, arguments); - }; -})(); - -let readFirstAvailableStream = exports.readFirstAvailableStream = (() => { - var _ref34 = (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* (paths) { - for (var _iterator15 = paths, _isArray15 = Array.isArray(_iterator15), _i15 = 0, _iterator15 = _isArray15 ? _iterator15 : _iterator15[Symbol.iterator]();;) { - var _ref35; - - if (_isArray15) { - if (_i15 >= _iterator15.length) break; - _ref35 = _iterator15[_i15++]; - } else { - _i15 = _iterator15.next(); - if (_i15.done) break; - _ref35 = _i15.value; - } - - const path = _ref35; - - try { - const fd = yield open(path, 'r'); - return (_fs || _load_fs()).default.createReadStream(path, { fd }); - } catch (err) { - // Try the next one - } - } - return null; - }); - - return function readFirstAvailableStream(_x34) { - return _ref34.apply(this, arguments); - }; -})(); - -let getFirstSuitableFolder = exports.getFirstSuitableFolder = (() => { - var _ref36 = (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* (paths, mode = constants.W_OK | constants.X_OK) { - const result = { - skipped: [], - folder: null - }; - - for (var _iterator16 = paths, _isArray16 = Array.isArray(_iterator16), _i16 = 0, _iterator16 = _isArray16 ? _iterator16 : _iterator16[Symbol.iterator]();;) { - var _ref37; - - if (_isArray16) { - if (_i16 >= _iterator16.length) break; - _ref37 = _iterator16[_i16++]; - } else { - _i16 = _iterator16.next(); - if (_i16.done) break; - _ref37 = _i16.value; - } - - const folder = _ref37; - - try { - yield mkdirp(folder); - yield access(folder, mode); - - result.folder = folder; - - return result; - } catch (error) { - result.skipped.push({ - error, - folder - }); - } - } - return result; - }); - - return function getFirstSuitableFolder(_x35) { - return _ref36.apply(this, arguments); - }; -})(); - -exports.copy = copy; -exports.readFile = readFile; -exports.readFileRaw = readFileRaw; -exports.normalizeOS = normalizeOS; - -var _fs; - -function _load_fs() { - return _fs = _interopRequireDefault(__webpack_require__(5)); -} - -var _glob; - -function _load_glob() { - return _glob = _interopRequireDefault(__webpack_require__(99)); -} - -var _os; - -function _load_os() { - return _os = _interopRequireDefault(__webpack_require__(46)); -} - -var _path; - -function _load_path() { - return _path = _interopRequireDefault(__webpack_require__(0)); -} - -var _blockingQueue; - -function _load_blockingQueue() { - return _blockingQueue = _interopRequireDefault(__webpack_require__(110)); -} - -var _promise; - -function _load_promise() { - return _promise = _interopRequireWildcard(__webpack_require__(50)); -} - -var _promise2; - -function _load_promise2() { - return _promise2 = __webpack_require__(50); -} - -var _map; - -function _load_map() { - return _map = _interopRequireDefault(__webpack_require__(29)); -} - -var _fsNormalized; - -function _load_fsNormalized() { - return _fsNormalized = __webpack_require__(218); -} - -function _interopRequireWildcard(obj) { if (obj && obj.__esModule) { return obj; } else { var newObj = {}; if (obj != null) { for (var key in obj) { if (Object.prototype.hasOwnProperty.call(obj, key)) newObj[key] = obj[key]; } } newObj.default = obj; return newObj; } } - -function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; } - -const constants = exports.constants = typeof (_fs || _load_fs()).default.constants !== 'undefined' ? (_fs || _load_fs()).default.constants : { - R_OK: (_fs || _load_fs()).default.R_OK, - W_OK: (_fs || _load_fs()).default.W_OK, - X_OK: (_fs || _load_fs()).default.X_OK -}; - -const lockQueue = exports.lockQueue = new (_blockingQueue || _load_blockingQueue()).default('fs lock'); - -const readFileBuffer = exports.readFileBuffer = (0, (_promise2 || _load_promise2()).promisify)((_fs || _load_fs()).default.readFile); -const open = exports.open = (0, (_promise2 || _load_promise2()).promisify)((_fs || _load_fs()).default.open); -const writeFile = exports.writeFile = (0, (_promise2 || _load_promise2()).promisify)((_fs || _load_fs()).default.writeFile); -const readlink = exports.readlink = (0, (_promise2 || _load_promise2()).promisify)((_fs || _load_fs()).default.readlink); -const realpath = exports.realpath = (0, (_promise2 || _load_promise2()).promisify)((_fs || _load_fs()).default.realpath); -const readdir = exports.readdir = (0, (_promise2 || _load_promise2()).promisify)((_fs || _load_fs()).default.readdir); -const rename = exports.rename = (0, (_promise2 || _load_promise2()).promisify)((_fs || _load_fs()).default.rename); -const access = exports.access = (0, (_promise2 || _load_promise2()).promisify)((_fs || _load_fs()).default.access); -const stat = exports.stat = (0, (_promise2 || _load_promise2()).promisify)((_fs || _load_fs()).default.stat); -const mkdirp = exports.mkdirp = (0, (_promise2 || _load_promise2()).promisify)(__webpack_require__(145)); -const exists = exports.exists = (0, (_promise2 || _load_promise2()).promisify)((_fs || _load_fs()).default.exists, true); -const lstat = exports.lstat = (0, (_promise2 || _load_promise2()).promisify)((_fs || _load_fs()).default.lstat); -const chmod = exports.chmod = (0, (_promise2 || _load_promise2()).promisify)((_fs || _load_fs()).default.chmod); -const link = exports.link = (0, (_promise2 || _load_promise2()).promisify)((_fs || _load_fs()).default.link); -const glob = exports.glob = (0, (_promise2 || _load_promise2()).promisify)((_glob || _load_glob()).default); -exports.unlink = (_fsNormalized || _load_fsNormalized()).unlink; - -// fs.copyFile uses the native file copying instructions on the system, performing much better -// than any JS-based solution and consumes fewer resources. Repeated testing to fine tune the -// concurrency level revealed 128 as the sweet spot on a quad-core, 16 CPU Intel system with SSD. - -const CONCURRENT_QUEUE_ITEMS = (_fs || _load_fs()).default.copyFile ? 128 : 4; - -const fsSymlink = (0, (_promise2 || _load_promise2()).promisify)((_fs || _load_fs()).default.symlink); -const invariant = __webpack_require__(9); -const stripBOM = __webpack_require__(160); - -const noop = () => {}; - -function copy(src, dest, reporter) { - return copyBulk([{ src, dest }], reporter); -} - -function _readFile(loc, encoding) { - return new Promise((resolve, reject) => { - (_fs || _load_fs()).default.readFile(loc, encoding, function (err, content) { - if (err) { - reject(err); - } else { - resolve(content); - } - }); - }); -} - -function readFile(loc) { - return _readFile(loc, 'utf8').then(normalizeOS); -} - -function readFileRaw(loc) { - return _readFile(loc, 'binary'); -} - -function normalizeOS(body) { - return body.replace(/\r\n/g, '\n'); -} - -const cr = '\r'.charCodeAt(0); -const lf = '\n'.charCodeAt(0); - -/***/ }), -/* 5 */ -/***/ (function(module, exports) { - -module.exports = require("fs"); - -/***/ }), -/* 6 */ -/***/ (function(module, exports, __webpack_require__) { - -"use strict"; - - -Object.defineProperty(exports, "__esModule", { - value: true -}); -class MessageError extends Error { - constructor(msg, code) { - super(msg); - this.code = code; - } - -} - -exports.MessageError = MessageError; -class ProcessSpawnError extends MessageError { - constructor(msg, code, process) { - super(msg, code); - this.process = process; - } - -} - -exports.ProcessSpawnError = ProcessSpawnError; -class SecurityError extends MessageError {} - -exports.SecurityError = SecurityError; -class ProcessTermError extends MessageError {} - -exports.ProcessTermError = ProcessTermError; -class ResponseError extends Error { - constructor(msg, responseCode) { - super(msg); - this.responseCode = responseCode; - } - -} - -exports.ResponseError = ResponseError; -class OneTimePasswordError extends Error {} -exports.OneTimePasswordError = OneTimePasswordError; - -/***/ }), -/* 7 */ -/***/ (function(module, __webpack_exports__, __webpack_require__) { - -"use strict"; -/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "a", function() { return Subscriber; }); -/* unused harmony export SafeSubscriber */ -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0_tslib__ = __webpack_require__(1); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__util_isFunction__ = __webpack_require__(154); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__Observer__ = __webpack_require__(420); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3__Subscription__ = __webpack_require__(25); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_4__internal_symbol_rxSubscriber__ = __webpack_require__(321); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_5__config__ = __webpack_require__(185); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_6__util_hostReportError__ = __webpack_require__(323); -/** PURE_IMPORTS_START tslib,_util_isFunction,_Observer,_Subscription,_internal_symbol_rxSubscriber,_config,_util_hostReportError PURE_IMPORTS_END */ - - - - - - - -var Subscriber = /*@__PURE__*/ (function (_super) { - __WEBPACK_IMPORTED_MODULE_0_tslib__["a" /* __extends */](Subscriber, _super); - function Subscriber(destinationOrNext, error, complete) { - var _this = _super.call(this) || this; - _this.syncErrorValue = null; - _this.syncErrorThrown = false; - _this.syncErrorThrowable = false; - _this.isStopped = false; - _this._parentSubscription = null; - switch (arguments.length) { - case 0: - _this.destination = __WEBPACK_IMPORTED_MODULE_2__Observer__["a" /* empty */]; - break; - case 1: - if (!destinationOrNext) { - _this.destination = __WEBPACK_IMPORTED_MODULE_2__Observer__["a" /* empty */]; - break; - } - if (typeof destinationOrNext === 'object') { - if (destinationOrNext instanceof Subscriber) { - _this.syncErrorThrowable = destinationOrNext.syncErrorThrowable; - _this.destination = destinationOrNext; - destinationOrNext.add(_this); - } - else { - _this.syncErrorThrowable = true; - _this.destination = new SafeSubscriber(_this, destinationOrNext); - } - break; - } - default: - _this.syncErrorThrowable = true; - _this.destination = new SafeSubscriber(_this, destinationOrNext, error, complete); - break; - } - return _this; - } - Subscriber.prototype[__WEBPACK_IMPORTED_MODULE_4__internal_symbol_rxSubscriber__["a" /* rxSubscriber */]] = function () { return this; }; - Subscriber.create = function (next, error, complete) { - var subscriber = new Subscriber(next, error, complete); - subscriber.syncErrorThrowable = false; - return subscriber; - }; - Subscriber.prototype.next = function (value) { - if (!this.isStopped) { - this._next(value); - } - }; - Subscriber.prototype.error = function (err) { - if (!this.isStopped) { - this.isStopped = true; - this._error(err); - } - }; - Subscriber.prototype.complete = function () { - if (!this.isStopped) { - this.isStopped = true; - this._complete(); - } - }; - Subscriber.prototype.unsubscribe = function () { - if (this.closed) { - return; - } - this.isStopped = true; - _super.prototype.unsubscribe.call(this); - }; - Subscriber.prototype._next = function (value) { - this.destination.next(value); - }; - Subscriber.prototype._error = function (err) { - this.destination.error(err); - this.unsubscribe(); - }; - Subscriber.prototype._complete = function () { - this.destination.complete(); - this.unsubscribe(); - }; - Subscriber.prototype._unsubscribeAndRecycle = function () { - var _a = this, _parent = _a._parent, _parents = _a._parents; - this._parent = null; - this._parents = null; - this.unsubscribe(); - this.closed = false; - this.isStopped = false; - this._parent = _parent; - this._parents = _parents; - this._parentSubscription = null; - return this; - }; - return Subscriber; -}(__WEBPACK_IMPORTED_MODULE_3__Subscription__["a" /* Subscription */])); - -var SafeSubscriber = /*@__PURE__*/ (function (_super) { - __WEBPACK_IMPORTED_MODULE_0_tslib__["a" /* __extends */](SafeSubscriber, _super); - function SafeSubscriber(_parentSubscriber, observerOrNext, error, complete) { - var _this = _super.call(this) || this; - _this._parentSubscriber = _parentSubscriber; - var next; - var context = _this; - if (__webpack_require__.i(__WEBPACK_IMPORTED_MODULE_1__util_isFunction__["a" /* isFunction */])(observerOrNext)) { - next = observerOrNext; - } - else if (observerOrNext) { - next = observerOrNext.next; - error = observerOrNext.error; - complete = observerOrNext.complete; - if (observerOrNext !== __WEBPACK_IMPORTED_MODULE_2__Observer__["a" /* empty */]) { - context = Object.create(observerOrNext); - if (__webpack_require__.i(__WEBPACK_IMPORTED_MODULE_1__util_isFunction__["a" /* isFunction */])(context.unsubscribe)) { - _this.add(context.unsubscribe.bind(context)); - } - context.unsubscribe = _this.unsubscribe.bind(_this); - } - } - _this._context = context; - _this._next = next; - _this._error = error; - _this._complete = complete; - return _this; - } - SafeSubscriber.prototype.next = function (value) { - if (!this.isStopped && this._next) { - var _parentSubscriber = this._parentSubscriber; - if (!__WEBPACK_IMPORTED_MODULE_5__config__["a" /* config */].useDeprecatedSynchronousErrorHandling || !_parentSubscriber.syncErrorThrowable) { - this.__tryOrUnsub(this._next, value); - } - else if (this.__tryOrSetError(_parentSubscriber, this._next, value)) { - this.unsubscribe(); - } - } - }; - SafeSubscriber.prototype.error = function (err) { - if (!this.isStopped) { - var _parentSubscriber = this._parentSubscriber; - var useDeprecatedSynchronousErrorHandling = __WEBPACK_IMPORTED_MODULE_5__config__["a" /* config */].useDeprecatedSynchronousErrorHandling; - if (this._error) { - if (!useDeprecatedSynchronousErrorHandling || !_parentSubscriber.syncErrorThrowable) { - this.__tryOrUnsub(this._error, err); - this.unsubscribe(); - } - else { - this.__tryOrSetError(_parentSubscriber, this._error, err); - this.unsubscribe(); - } - } - else if (!_parentSubscriber.syncErrorThrowable) { - this.unsubscribe(); - if (useDeprecatedSynchronousErrorHandling) { - throw err; - } - __webpack_require__.i(__WEBPACK_IMPORTED_MODULE_6__util_hostReportError__["a" /* hostReportError */])(err); - } - else { - if (useDeprecatedSynchronousErrorHandling) { - _parentSubscriber.syncErrorValue = err; - _parentSubscriber.syncErrorThrown = true; - } - else { - __webpack_require__.i(__WEBPACK_IMPORTED_MODULE_6__util_hostReportError__["a" /* hostReportError */])(err); - } - this.unsubscribe(); - } - } - }; - SafeSubscriber.prototype.complete = function () { - var _this = this; - if (!this.isStopped) { - var _parentSubscriber = this._parentSubscriber; - if (this._complete) { - var wrappedComplete = function () { return _this._complete.call(_this._context); }; - if (!__WEBPACK_IMPORTED_MODULE_5__config__["a" /* config */].useDeprecatedSynchronousErrorHandling || !_parentSubscriber.syncErrorThrowable) { - this.__tryOrUnsub(wrappedComplete); - this.unsubscribe(); - } - else { - this.__tryOrSetError(_parentSubscriber, wrappedComplete); - this.unsubscribe(); - } - } - else { - this.unsubscribe(); - } - } - }; - SafeSubscriber.prototype.__tryOrUnsub = function (fn, value) { - try { - fn.call(this._context, value); - } - catch (err) { - this.unsubscribe(); - if (__WEBPACK_IMPORTED_MODULE_5__config__["a" /* config */].useDeprecatedSynchronousErrorHandling) { - throw err; - } - else { - __webpack_require__.i(__WEBPACK_IMPORTED_MODULE_6__util_hostReportError__["a" /* hostReportError */])(err); - } - } - }; - SafeSubscriber.prototype.__tryOrSetError = function (parent, fn, value) { - if (!__WEBPACK_IMPORTED_MODULE_5__config__["a" /* config */].useDeprecatedSynchronousErrorHandling) { - throw new Error('bad call'); - } - try { - fn.call(this._context, value); - } - catch (err) { - if (__WEBPACK_IMPORTED_MODULE_5__config__["a" /* config */].useDeprecatedSynchronousErrorHandling) { - parent.syncErrorValue = err; - parent.syncErrorThrown = true; - return true; - } - else { - __webpack_require__.i(__WEBPACK_IMPORTED_MODULE_6__util_hostReportError__["a" /* hostReportError */])(err); - return true; - } - } - return false; - }; - SafeSubscriber.prototype._unsubscribe = function () { - var _parentSubscriber = this._parentSubscriber; - this._context = null; - this._parentSubscriber = null; - _parentSubscriber.unsubscribe(); - }; - return SafeSubscriber; -}(Subscriber)); - -//# sourceMappingURL=Subscriber.js.map - - -/***/ }), -/* 8 */ -/***/ (function(module, exports, __webpack_require__) { - -"use strict"; - - -Object.defineProperty(exports, "__esModule", { - value: true -}); -exports.getPathKey = getPathKey; -const os = __webpack_require__(46); -const path = __webpack_require__(0); -const userHome = __webpack_require__(67).default; - -var _require = __webpack_require__(225); - -const getCacheDir = _require.getCacheDir, - getConfigDir = _require.getConfigDir, - getDataDir = _require.getDataDir; - -const isWebpackBundle = __webpack_require__(278); - -const DEPENDENCY_TYPES = exports.DEPENDENCY_TYPES = ['devDependencies', 'dependencies', 'optionalDependencies', 'peerDependencies']; -const OWNED_DEPENDENCY_TYPES = exports.OWNED_DEPENDENCY_TYPES = ['devDependencies', 'dependencies', 'optionalDependencies']; - -const RESOLUTIONS = exports.RESOLUTIONS = 'resolutions'; -const MANIFEST_FIELDS = exports.MANIFEST_FIELDS = [RESOLUTIONS, ...DEPENDENCY_TYPES]; - -const SUPPORTED_NODE_VERSIONS = exports.SUPPORTED_NODE_VERSIONS = '^4.8.0 || ^5.7.0 || ^6.2.2 || >=8.0.0'; - -const YARN_REGISTRY = exports.YARN_REGISTRY = 'https://registry.yarnpkg.com'; -const NPM_REGISTRY_RE = exports.NPM_REGISTRY_RE = /https?:\/\/registry\.npmjs\.org/g; - -const YARN_DOCS = exports.YARN_DOCS = 'https://yarnpkg.com/en/docs/cli/'; -const YARN_INSTALLER_SH = exports.YARN_INSTALLER_SH = 'https://yarnpkg.com/install.sh'; -const YARN_INSTALLER_MSI = exports.YARN_INSTALLER_MSI = 'https://yarnpkg.com/latest.msi'; - -const SELF_UPDATE_VERSION_URL = exports.SELF_UPDATE_VERSION_URL = 'https://yarnpkg.com/latest-version'; - -// cache version, bump whenever we make backwards incompatible changes -const CACHE_VERSION = exports.CACHE_VERSION = 6; - -// lockfile version, bump whenever we make backwards incompatible changes -const LOCKFILE_VERSION = exports.LOCKFILE_VERSION = 1; - -// max amount of network requests to perform concurrently -const NETWORK_CONCURRENCY = exports.NETWORK_CONCURRENCY = 8; - -// HTTP timeout used when downloading packages -const NETWORK_TIMEOUT = exports.NETWORK_TIMEOUT = 30 * 1000; // in milliseconds - -// max amount of child processes to execute concurrently -const CHILD_CONCURRENCY = exports.CHILD_CONCURRENCY = 5; - -const REQUIRED_PACKAGE_KEYS = exports.REQUIRED_PACKAGE_KEYS = ['name', 'version', '_uid']; - -function getPreferredCacheDirectories() { - const preferredCacheDirectories = [getCacheDir()]; - - if (process.getuid) { - // $FlowFixMe: process.getuid exists, dammit - preferredCacheDirectories.push(path.join(os.tmpdir(), `.yarn-cache-${process.getuid()}`)); - } - - preferredCacheDirectories.push(path.join(os.tmpdir(), `.yarn-cache`)); - - return preferredCacheDirectories; -} - -const PREFERRED_MODULE_CACHE_DIRECTORIES = exports.PREFERRED_MODULE_CACHE_DIRECTORIES = getPreferredCacheDirectories(); -const CONFIG_DIRECTORY = exports.CONFIG_DIRECTORY = getConfigDir(); -const DATA_DIRECTORY = exports.DATA_DIRECTORY = getDataDir(); -const LINK_REGISTRY_DIRECTORY = exports.LINK_REGISTRY_DIRECTORY = path.join(DATA_DIRECTORY, 'link'); -const GLOBAL_MODULE_DIRECTORY = exports.GLOBAL_MODULE_DIRECTORY = path.join(DATA_DIRECTORY, 'global'); - -const NODE_BIN_PATH = exports.NODE_BIN_PATH = process.execPath; -const YARN_BIN_PATH = exports.YARN_BIN_PATH = getYarnBinPath(); - -// Webpack needs to be configured with node.__dirname/__filename = false -function getYarnBinPath() { - if (isWebpackBundle) { - return __filename; - } else { - return path.join(__dirname, '..', 'bin', 'yarn.js'); - } -} - -const NODE_MODULES_FOLDER = exports.NODE_MODULES_FOLDER = 'node_modules'; -const NODE_PACKAGE_JSON = exports.NODE_PACKAGE_JSON = 'package.json'; - -const PNP_FILENAME = exports.PNP_FILENAME = '.pnp.js'; - -const POSIX_GLOBAL_PREFIX = exports.POSIX_GLOBAL_PREFIX = `${process.env.DESTDIR || ''}/usr/local`; -const FALLBACK_GLOBAL_PREFIX = exports.FALLBACK_GLOBAL_PREFIX = path.join(userHome, '.yarn'); - -const META_FOLDER = exports.META_FOLDER = '.yarn-meta'; -const INTEGRITY_FILENAME = exports.INTEGRITY_FILENAME = '.yarn-integrity'; -const LOCKFILE_FILENAME = exports.LOCKFILE_FILENAME = 'yarn.lock'; -const METADATA_FILENAME = exports.METADATA_FILENAME = '.yarn-metadata.json'; -const TARBALL_FILENAME = exports.TARBALL_FILENAME = '.yarn-tarball.tgz'; -const CLEAN_FILENAME = exports.CLEAN_FILENAME = '.yarnclean'; - -const NPM_LOCK_FILENAME = exports.NPM_LOCK_FILENAME = 'package-lock.json'; -const NPM_SHRINKWRAP_FILENAME = exports.NPM_SHRINKWRAP_FILENAME = 'npm-shrinkwrap.json'; - -const DEFAULT_INDENT = exports.DEFAULT_INDENT = ' '; -const SINGLE_INSTANCE_PORT = exports.SINGLE_INSTANCE_PORT = 31997; -const SINGLE_INSTANCE_FILENAME = exports.SINGLE_INSTANCE_FILENAME = '.yarn-single-instance'; - -const ENV_PATH_KEY = exports.ENV_PATH_KEY = getPathKey(process.platform, process.env); - -function getPathKey(platform, env) { - let pathKey = 'PATH'; - - // windows calls its path "Path" usually, but this is not guaranteed. - if (platform === 'win32') { - pathKey = 'Path'; - - for (const key in env) { - if (key.toLowerCase() === 'path') { - pathKey = key; - } - } - } - - return pathKey; -} - -const VERSION_COLOR_SCHEME = exports.VERSION_COLOR_SCHEME = { - major: 'red', - premajor: 'red', - minor: 'yellow', - preminor: 'yellow', - patch: 'green', - prepatch: 'green', - prerelease: 'red', - unchanged: 'white', - unknown: 'red' -}; - -/***/ }), -/* 9 */ -/***/ (function(module, exports, __webpack_require__) { - -"use strict"; -/** - * Copyright (c) 2013-present, Facebook, Inc. - * - * This source code is licensed under the MIT license found in the - * LICENSE file in the root directory of this source tree. - */ - - - -/** - * Use invariant() to assert state which your program assumes to be true. - * - * Provide sprintf-style format (only %s is supported) and arguments - * to provide information about what broke and what you were - * expecting. - * - * The invariant message will be stripped in production, but the invariant - * will remain to ensure logic does not differ in production. - */ - -var NODE_ENV = process.env.NODE_ENV; - -var invariant = function(condition, format, a, b, c, d, e, f) { - if (NODE_ENV !== 'production') { - if (format === undefined) { - throw new Error('invariant requires an error message argument'); - } - } - - if (!condition) { - var error; - if (format === undefined) { - error = new Error( - 'Minified exception occurred; use the non-minified dev environment ' + - 'for the full error message and additional helpful warnings.' - ); - } else { - var args = [a, b, c, d, e, f]; - var argIndex = 0; - error = new Error( - format.replace(/%s/g, function() { return args[argIndex++]; }) - ); - error.name = 'Invariant Violation'; - } - - error.framesToPop = 1; // we don't care about invariant's own frame - throw error; - } -}; - -module.exports = invariant; - - -/***/ }), -/* 10 */ -/***/ (function(module, exports, __webpack_require__) { - -"use strict"; - - -var YAMLException = __webpack_require__(54); - -var TYPE_CONSTRUCTOR_OPTIONS = [ - 'kind', - 'resolve', - 'construct', - 'instanceOf', - 'predicate', - 'represent', - 'defaultStyle', - 'styleAliases' -]; - -var YAML_NODE_KINDS = [ - 'scalar', - 'sequence', - 'mapping' -]; - -function compileStyleAliases(map) { - var result = {}; - - if (map !== null) { - Object.keys(map).forEach(function (style) { - map[style].forEach(function (alias) { - result[String(alias)] = style; - }); - }); - } - - return result; -} - -function Type(tag, options) { - options = options || {}; - - Object.keys(options).forEach(function (name) { - if (TYPE_CONSTRUCTOR_OPTIONS.indexOf(name) === -1) { - throw new YAMLException('Unknown option "' + name + '" is met in definition of "' + tag + '" YAML type.'); - } - }); - - // TODO: Add tag format check. - this.tag = tag; - this.kind = options['kind'] || null; - this.resolve = options['resolve'] || function () { return true; }; - this.construct = options['construct'] || function (data) { return data; }; - this.instanceOf = options['instanceOf'] || null; - this.predicate = options['predicate'] || null; - this.represent = options['represent'] || null; - this.defaultStyle = options['defaultStyle'] || null; - this.styleAliases = compileStyleAliases(options['styleAliases'] || null); - - if (YAML_NODE_KINDS.indexOf(this.kind) === -1) { - throw new YAMLException('Unknown kind "' + this.kind + '" is specified for "' + tag + '" YAML type.'); - } -} - -module.exports = Type; - - -/***/ }), -/* 11 */ -/***/ (function(module, exports) { - -module.exports = require("crypto"); - -/***/ }), -/* 12 */ -/***/ (function(module, __webpack_exports__, __webpack_require__) { - -"use strict"; -/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "a", function() { return Observable; }); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__util_canReportError__ = __webpack_require__(322); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__util_toSubscriber__ = __webpack_require__(932); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__internal_symbol_observable__ = __webpack_require__(117); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3__util_pipe__ = __webpack_require__(324); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_4__config__ = __webpack_require__(185); -/** PURE_IMPORTS_START _util_canReportError,_util_toSubscriber,_internal_symbol_observable,_util_pipe,_config PURE_IMPORTS_END */ - - - - - -var Observable = /*@__PURE__*/ (function () { - function Observable(subscribe) { - this._isScalar = false; - if (subscribe) { - this._subscribe = subscribe; - } - } - Observable.prototype.lift = function (operator) { - var observable = new Observable(); - observable.source = this; - observable.operator = operator; - return observable; - }; - Observable.prototype.subscribe = function (observerOrNext, error, complete) { - var operator = this.operator; - var sink = __webpack_require__.i(__WEBPACK_IMPORTED_MODULE_1__util_toSubscriber__["a" /* toSubscriber */])(observerOrNext, error, complete); - if (operator) { - operator.call(sink, this.source); - } - else { - sink.add(this.source || (__WEBPACK_IMPORTED_MODULE_4__config__["a" /* config */].useDeprecatedSynchronousErrorHandling && !sink.syncErrorThrowable) ? - this._subscribe(sink) : - this._trySubscribe(sink)); - } - if (__WEBPACK_IMPORTED_MODULE_4__config__["a" /* config */].useDeprecatedSynchronousErrorHandling) { - if (sink.syncErrorThrowable) { - sink.syncErrorThrowable = false; - if (sink.syncErrorThrown) { - throw sink.syncErrorValue; - } - } - } - return sink; - }; - Observable.prototype._trySubscribe = function (sink) { - try { - return this._subscribe(sink); - } - catch (err) { - if (__WEBPACK_IMPORTED_MODULE_4__config__["a" /* config */].useDeprecatedSynchronousErrorHandling) { - sink.syncErrorThrown = true; - sink.syncErrorValue = err; - } - if (__webpack_require__.i(__WEBPACK_IMPORTED_MODULE_0__util_canReportError__["a" /* canReportError */])(sink)) { - sink.error(err); - } - else { - console.warn(err); - } - } - }; - Observable.prototype.forEach = function (next, promiseCtor) { - var _this = this; - promiseCtor = getPromiseCtor(promiseCtor); - return new promiseCtor(function (resolve, reject) { - var subscription; - subscription = _this.subscribe(function (value) { - try { - next(value); - } - catch (err) { - reject(err); - if (subscription) { - subscription.unsubscribe(); - } - } - }, reject, resolve); - }); - }; - Observable.prototype._subscribe = function (subscriber) { - var source = this.source; - return source && source.subscribe(subscriber); - }; - Observable.prototype[__WEBPACK_IMPORTED_MODULE_2__internal_symbol_observable__["a" /* observable */]] = function () { - return this; - }; - Observable.prototype.pipe = function () { - var operations = []; - for (var _i = 0; _i < arguments.length; _i++) { - operations[_i] = arguments[_i]; - } - if (operations.length === 0) { - return this; - } - return __webpack_require__.i(__WEBPACK_IMPORTED_MODULE_3__util_pipe__["b" /* pipeFromArray */])(operations)(this); - }; - Observable.prototype.toPromise = function (promiseCtor) { - var _this = this; - promiseCtor = getPromiseCtor(promiseCtor); - return new promiseCtor(function (resolve, reject) { - var value; - _this.subscribe(function (x) { return value = x; }, function (err) { return reject(err); }, function () { return resolve(value); }); - }); - }; - Observable.create = function (subscribe) { - return new Observable(subscribe); - }; - return Observable; -}()); - -function getPromiseCtor(promiseCtor) { - if (!promiseCtor) { - promiseCtor = __WEBPACK_IMPORTED_MODULE_4__config__["a" /* config */].Promise || Promise; - } - if (!promiseCtor) { - throw new Error('no Promise impl found'); - } - return promiseCtor; -} -//# sourceMappingURL=Observable.js.map - - -/***/ }), -/* 13 */ -/***/ (function(module, __webpack_exports__, __webpack_require__) { - -"use strict"; -/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "a", function() { return OuterSubscriber; }); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0_tslib__ = __webpack_require__(1); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__Subscriber__ = __webpack_require__(7); -/** PURE_IMPORTS_START tslib,_Subscriber PURE_IMPORTS_END */ - - -var OuterSubscriber = /*@__PURE__*/ (function (_super) { - __WEBPACK_IMPORTED_MODULE_0_tslib__["a" /* __extends */](OuterSubscriber, _super); - function OuterSubscriber() { - return _super !== null && _super.apply(this, arguments) || this; - } - OuterSubscriber.prototype.notifyNext = function (outerValue, innerValue, outerIndex, innerIndex, innerSub) { - this.destination.next(innerValue); - }; - OuterSubscriber.prototype.notifyError = function (error, innerSub) { - this.destination.error(error); - }; - OuterSubscriber.prototype.notifyComplete = function (innerSub) { - this.destination.complete(); - }; - return OuterSubscriber; -}(__WEBPACK_IMPORTED_MODULE_1__Subscriber__["a" /* Subscriber */])); - -//# sourceMappingURL=OuterSubscriber.js.map - - -/***/ }), -/* 14 */ -/***/ (function(module, __webpack_exports__, __webpack_require__) { - -"use strict"; -/* harmony export (immutable) */ __webpack_exports__["a"] = subscribeToResult; -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__InnerSubscriber__ = __webpack_require__(84); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__subscribeTo__ = __webpack_require__(446); -/** PURE_IMPORTS_START _InnerSubscriber,_subscribeTo PURE_IMPORTS_END */ - - -function subscribeToResult(outerSubscriber, result, outerValue, outerIndex, destination) { - if (destination === void 0) { - destination = new __WEBPACK_IMPORTED_MODULE_0__InnerSubscriber__["a" /* InnerSubscriber */](outerSubscriber, outerValue, outerIndex); - } - if (destination.closed) { - return; - } - return __webpack_require__.i(__WEBPACK_IMPORTED_MODULE_1__subscribeTo__["a" /* subscribeTo */])(result)(destination); -} -//# sourceMappingURL=subscribeToResult.js.map - - -/***/ }), -/* 15 */ -/***/ (function(module, exports, __webpack_require__) { - -"use strict"; -/* eslint-disable node/no-deprecated-api */ - - - -var buffer = __webpack_require__(64) -var Buffer = buffer.Buffer - -var safer = {} - -var key - -for (key in buffer) { - if (!buffer.hasOwnProperty(key)) continue - if (key === 'SlowBuffer' || key === 'Buffer') continue - safer[key] = buffer[key] -} - -var Safer = safer.Buffer = {} -for (key in Buffer) { - if (!Buffer.hasOwnProperty(key)) continue - if (key === 'allocUnsafe' || key === 'allocUnsafeSlow') continue - Safer[key] = Buffer[key] -} - -safer.Buffer.prototype = Buffer.prototype - -if (!Safer.from || Safer.from === Uint8Array.from) { - Safer.from = function (value, encodingOrOffset, length) { - if (typeof value === 'number') { - throw new TypeError('The "value" argument must not be of type number. Received type ' + typeof value) - } - if (value && typeof value.length === 'undefined') { - throw new TypeError('The first argument must be one of type string, Buffer, ArrayBuffer, Array, or Array-like Object. Received type ' + typeof value) - } - return Buffer(value, encodingOrOffset, length) - } -} - -if (!Safer.alloc) { - Safer.alloc = function (size, fill, encoding) { - if (typeof size !== 'number') { - throw new TypeError('The "size" argument must be of type number. Received type ' + typeof size) - } - if (size < 0 || size >= 2 * (1 << 30)) { - throw new RangeError('The value "' + size + '" is invalid for option "size"') - } - var buf = Buffer(size) - if (!fill || fill.length === 0) { - buf.fill(0) - } else if (typeof encoding === 'string') { - buf.fill(fill, encoding) - } else { - buf.fill(fill) - } - return buf - } -} - -if (!safer.kStringMaxLength) { - try { - safer.kStringMaxLength = process.binding('buffer').kStringMaxLength - } catch (e) { - // we can't determine kStringMaxLength in environments where process.binding - // is unsupported, so let's not set it - } -} - -if (!safer.constants) { - safer.constants = { - MAX_LENGTH: safer.kMaxLength - } - if (safer.kStringMaxLength) { - safer.constants.MAX_STRING_LENGTH = safer.kStringMaxLength - } -} - -module.exports = safer - - -/***/ }), -/* 16 */ -/***/ (function(module, exports, __webpack_require__) { - -// Copyright (c) 2012, Mark Cavage. All rights reserved. -// Copyright 2015 Joyent, Inc. - -var assert = __webpack_require__(28); -var Stream = __webpack_require__(23).Stream; -var util = __webpack_require__(3); - - -///--- Globals - -/* JSSTYLED */ -var UUID_REGEXP = /^[a-fA-F0-9]{8}-[a-fA-F0-9]{4}-[a-fA-F0-9]{4}-[a-fA-F0-9]{4}-[a-fA-F0-9]{12}$/; - - -///--- Internal - -function _capitalize(str) { - return (str.charAt(0).toUpperCase() + str.slice(1)); -} - -function _toss(name, expected, oper, arg, actual) { - throw new assert.AssertionError({ - message: util.format('%s (%s) is required', name, expected), - actual: (actual === undefined) ? typeof (arg) : actual(arg), - expected: expected, - operator: oper || '===', - stackStartFunction: _toss.caller - }); -} - -function _getClass(arg) { - return (Object.prototype.toString.call(arg).slice(8, -1)); -} - -function noop() { - // Why even bother with asserts? -} - - -///--- Exports - -var types = { - bool: { - check: function (arg) { return typeof (arg) === 'boolean'; } - }, - func: { - check: function (arg) { return typeof (arg) === 'function'; } - }, - string: { - check: function (arg) { return typeof (arg) === 'string'; } - }, - object: { - check: function (arg) { - return typeof (arg) === 'object' && arg !== null; - } - }, - number: { - check: function (arg) { - return typeof (arg) === 'number' && !isNaN(arg); - } - }, - finite: { - check: function (arg) { - return typeof (arg) === 'number' && !isNaN(arg) && isFinite(arg); - } - }, - buffer: { - check: function (arg) { return Buffer.isBuffer(arg); }, - operator: 'Buffer.isBuffer' - }, - array: { - check: function (arg) { return Array.isArray(arg); }, - operator: 'Array.isArray' - }, - stream: { - check: function (arg) { return arg instanceof Stream; }, - operator: 'instanceof', - actual: _getClass - }, - date: { - check: function (arg) { return arg instanceof Date; }, - operator: 'instanceof', - actual: _getClass - }, - regexp: { - check: function (arg) { return arg instanceof RegExp; }, - operator: 'instanceof', - actual: _getClass - }, - uuid: { - check: function (arg) { - return typeof (arg) === 'string' && UUID_REGEXP.test(arg); - }, - operator: 'isUUID' - } -}; - -function _setExports(ndebug) { - var keys = Object.keys(types); - var out; - - /* re-export standard assert */ - if (process.env.NODE_NDEBUG) { - out = noop; - } else { - out = function (arg, msg) { - if (!arg) { - _toss(msg, 'true', arg); - } - }; - } - - /* standard checks */ - keys.forEach(function (k) { - if (ndebug) { - out[k] = noop; - return; - } - var type = types[k]; - out[k] = function (arg, msg) { - if (!type.check(arg)) { - _toss(msg, k, type.operator, arg, type.actual); - } - }; - }); - - /* optional checks */ - keys.forEach(function (k) { - var name = 'optional' + _capitalize(k); - if (ndebug) { - out[name] = noop; - return; - } - var type = types[k]; - out[name] = function (arg, msg) { - if (arg === undefined || arg === null) { - return; - } - if (!type.check(arg)) { - _toss(msg, k, type.operator, arg, type.actual); - } - }; - }); - - /* arrayOf checks */ - keys.forEach(function (k) { - var name = 'arrayOf' + _capitalize(k); - if (ndebug) { - out[name] = noop; - return; - } - var type = types[k]; - var expected = '[' + k + ']'; - out[name] = function (arg, msg) { - if (!Array.isArray(arg)) { - _toss(msg, expected, type.operator, arg, type.actual); - } - var i; - for (i = 0; i < arg.length; i++) { - if (!type.check(arg[i])) { - _toss(msg, expected, type.operator, arg, type.actual); - } - } - }; - }); - - /* optionalArrayOf checks */ - keys.forEach(function (k) { - var name = 'optionalArrayOf' + _capitalize(k); - if (ndebug) { - out[name] = noop; - return; - } - var type = types[k]; - var expected = '[' + k + ']'; - out[name] = function (arg, msg) { - if (arg === undefined || arg === null) { - return; - } - if (!Array.isArray(arg)) { - _toss(msg, expected, type.operator, arg, type.actual); - } - var i; - for (i = 0; i < arg.length; i++) { - if (!type.check(arg[i])) { - _toss(msg, expected, type.operator, arg, type.actual); - } - } - }; - }); - - /* re-export built-in assertions */ - Object.keys(assert).forEach(function (k) { - if (k === 'AssertionError') { - out[k] = assert[k]; - return; - } - if (ndebug) { - out[k] = noop; - return; - } - out[k] = assert[k]; - }); - - /* export ourselves (for unit tests _only_) */ - out._setExports = _setExports; - - return out; -} - -module.exports = _setExports(process.env.NODE_NDEBUG); - - -/***/ }), -/* 17 */ -/***/ (function(module, exports) { - -// https://github.com/zloirock/core-js/issues/86#issuecomment-115759028 -var global = module.exports = typeof window != 'undefined' && window.Math == Math - ? window : typeof self != 'undefined' && self.Math == Math ? self - // eslint-disable-next-line no-new-func - : Function('return this')(); -if (typeof __g == 'number') __g = global; // eslint-disable-line no-undef - - -/***/ }), -/* 18 */ -/***/ (function(module, exports, __webpack_require__) { - -"use strict"; - - -Object.defineProperty(exports, "__esModule", { - value: true -}); -exports.sortAlpha = sortAlpha; -exports.sortOptionsByFlags = sortOptionsByFlags; -exports.entries = entries; -exports.removePrefix = removePrefix; -exports.removeSuffix = removeSuffix; -exports.addSuffix = addSuffix; -exports.hyphenate = hyphenate; -exports.camelCase = camelCase; -exports.compareSortedArrays = compareSortedArrays; -exports.sleep = sleep; -const _camelCase = __webpack_require__(230); - -function sortAlpha(a, b) { - // sort alphabetically in a deterministic way - const shortLen = Math.min(a.length, b.length); - for (let i = 0; i < shortLen; i++) { - const aChar = a.charCodeAt(i); - const bChar = b.charCodeAt(i); - if (aChar !== bChar) { - return aChar - bChar; - } - } - return a.length - b.length; -} - -function sortOptionsByFlags(a, b) { - const aOpt = a.flags.replace(/-/g, ''); - const bOpt = b.flags.replace(/-/g, ''); - return sortAlpha(aOpt, bOpt); -} - -function entries(obj) { - const entries = []; - if (obj) { - for (const key in obj) { - entries.push([key, obj[key]]); - } - } - return entries; -} - -function removePrefix(pattern, prefix) { - if (pattern.startsWith(prefix)) { - pattern = pattern.slice(prefix.length); - } - - return pattern; -} - -function removeSuffix(pattern, suffix) { - if (pattern.endsWith(suffix)) { - return pattern.slice(0, -suffix.length); - } - - return pattern; -} - -function addSuffix(pattern, suffix) { - if (!pattern.endsWith(suffix)) { - return pattern + suffix; - } - - return pattern; -} - -function hyphenate(str) { - return str.replace(/[A-Z]/g, match => { - return '-' + match.charAt(0).toLowerCase(); - }); -} - -function camelCase(str) { - if (/[A-Z]/.test(str)) { - return null; - } else { - return _camelCase(str); - } -} - -function compareSortedArrays(array1, array2) { - if (array1.length !== array2.length) { - return false; - } - for (let i = 0, len = array1.length; i < len; i++) { - if (array1[i] !== array2[i]) { - return false; - } - } - return true; -} - -function sleep(ms) { - return new Promise(resolve => { - setTimeout(resolve, ms); - }); -} - -/***/ }), -/* 19 */ -/***/ (function(module, exports, __webpack_require__) { - -"use strict"; - - -Object.defineProperty(exports, "__esModule", { - value: true -}); -exports.stringify = exports.parse = undefined; - -var _asyncToGenerator2; - -function _load_asyncToGenerator() { - return _asyncToGenerator2 = _interopRequireDefault(__webpack_require__(2)); -} - -var _parse; - -function _load_parse() { - return _parse = __webpack_require__(105); -} - -Object.defineProperty(exports, 'parse', { - enumerable: true, - get: function get() { - return _interopRequireDefault(_parse || _load_parse()).default; - } -}); - -var _stringify; - -function _load_stringify() { - return _stringify = __webpack_require__(199); -} - -Object.defineProperty(exports, 'stringify', { - enumerable: true, - get: function get() { - return _interopRequireDefault(_stringify || _load_stringify()).default; - } -}); -exports.implodeEntry = implodeEntry; -exports.explodeEntry = explodeEntry; - -var _misc; - -function _load_misc() { - return _misc = __webpack_require__(18); -} - -var _normalizePattern; - -function _load_normalizePattern() { - return _normalizePattern = __webpack_require__(37); -} - -var _parse2; - -function _load_parse2() { - return _parse2 = _interopRequireDefault(__webpack_require__(105)); -} - -var _constants; - -function _load_constants() { - return _constants = __webpack_require__(8); -} - -var _fs; - -function _load_fs() { - return _fs = _interopRequireWildcard(__webpack_require__(4)); -} - -function _interopRequireWildcard(obj) { if (obj && obj.__esModule) { return obj; } else { var newObj = {}; if (obj != null) { for (var key in obj) { if (Object.prototype.hasOwnProperty.call(obj, key)) newObj[key] = obj[key]; } } newObj.default = obj; return newObj; } } - -function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; } - -const invariant = __webpack_require__(9); - -const path = __webpack_require__(0); -const ssri = __webpack_require__(65); - -function getName(pattern) { - return (0, (_normalizePattern || _load_normalizePattern()).normalizePattern)(pattern).name; -} - -function blankObjectUndefined(obj) { - return obj && Object.keys(obj).length ? obj : undefined; -} - -function keyForRemote(remote) { - return remote.resolved || (remote.reference && remote.hash ? `${remote.reference}#${remote.hash}` : null); -} - -function serializeIntegrity(integrity) { - // We need this because `Integrity.toString()` does not use sorting to ensure a stable string output - // See https://git.io/vx2Hy - return integrity.toString().split(' ').sort().join(' '); -} - -function implodeEntry(pattern, obj) { - const inferredName = getName(pattern); - const integrity = obj.integrity ? serializeIntegrity(obj.integrity) : ''; - const imploded = { - name: inferredName === obj.name ? undefined : obj.name, - version: obj.version, - uid: obj.uid === obj.version ? undefined : obj.uid, - resolved: obj.resolved, - registry: obj.registry === 'npm' ? undefined : obj.registry, - dependencies: blankObjectUndefined(obj.dependencies), - optionalDependencies: blankObjectUndefined(obj.optionalDependencies), - permissions: blankObjectUndefined(obj.permissions), - prebuiltVariants: blankObjectUndefined(obj.prebuiltVariants) - }; - if (integrity) { - imploded.integrity = integrity; - } - return imploded; -} - -function explodeEntry(pattern, obj) { - obj.optionalDependencies = obj.optionalDependencies || {}; - obj.dependencies = obj.dependencies || {}; - obj.uid = obj.uid || obj.version; - obj.permissions = obj.permissions || {}; - obj.registry = obj.registry || 'npm'; - obj.name = obj.name || getName(pattern); - const integrity = obj.integrity; - if (integrity && integrity.isIntegrity) { - obj.integrity = ssri.parse(integrity); - } - return obj; -} - -class Lockfile { - constructor({ cache, source, parseResultType } = {}) { - this.source = source || ''; - this.cache = cache; - this.parseResultType = parseResultType; - } - - // source string if the `cache` was parsed - - - // if true, we're parsing an old yarn file and need to update integrity fields - hasEntriesExistWithoutIntegrity() { - if (!this.cache) { - return false; - } - - for (const key in this.cache) { - // $FlowFixMe - `this.cache` is clearly defined at this point - if (!/^.*@(file:|http)/.test(key) && this.cache[key] && !this.cache[key].integrity) { - return true; - } - } - - return false; - } - - static fromDirectory(dir, reporter) { - return (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* () { - // read the manifest in this directory - const lockfileLoc = path.join(dir, (_constants || _load_constants()).LOCKFILE_FILENAME); - - let lockfile; - let rawLockfile = ''; - let parseResult; - - if (yield (_fs || _load_fs()).exists(lockfileLoc)) { - rawLockfile = yield (_fs || _load_fs()).readFile(lockfileLoc); - parseResult = (0, (_parse2 || _load_parse2()).default)(rawLockfile, lockfileLoc); - - if (reporter) { - if (parseResult.type === 'merge') { - reporter.info(reporter.lang('lockfileMerged')); - } else if (parseResult.type === 'conflict') { - reporter.warn(reporter.lang('lockfileConflict')); - } - } - - lockfile = parseResult.object; - } else if (reporter) { - reporter.info(reporter.lang('noLockfileFound')); - } - - if (lockfile && lockfile.__metadata) { - const lockfilev2 = lockfile; - lockfile = {}; - } - - return new Lockfile({ cache: lockfile, source: rawLockfile, parseResultType: parseResult && parseResult.type }); - })(); - } - - getLocked(pattern) { - const cache = this.cache; - if (!cache) { - return undefined; - } - - const shrunk = pattern in cache && cache[pattern]; - - if (typeof shrunk === 'string') { - return this.getLocked(shrunk); - } else if (shrunk) { - explodeEntry(pattern, shrunk); - return shrunk; - } - - return undefined; - } - - removePattern(pattern) { - const cache = this.cache; - if (!cache) { - return; - } - delete cache[pattern]; - } - - getLockfile(patterns) { - const lockfile = {}; - const seen = new Map(); - - // order by name so that lockfile manifest is assigned to the first dependency with this manifest - // the others that have the same remoteKey will just refer to the first - // ordering allows for consistency in lockfile when it is serialized - const sortedPatternsKeys = Object.keys(patterns).sort((_misc || _load_misc()).sortAlpha); - - for (var _iterator = sortedPatternsKeys, _isArray = Array.isArray(_iterator), _i = 0, _iterator = _isArray ? _iterator : _iterator[Symbol.iterator]();;) { - var _ref; - - if (_isArray) { - if (_i >= _iterator.length) break; - _ref = _iterator[_i++]; - } else { - _i = _iterator.next(); - if (_i.done) break; - _ref = _i.value; - } - - const pattern = _ref; - - const pkg = patterns[pattern]; - const remote = pkg._remote, - ref = pkg._reference; - - invariant(ref, 'Package is missing a reference'); - invariant(remote, 'Package is missing a remote'); - - const remoteKey = keyForRemote(remote); - const seenPattern = remoteKey && seen.get(remoteKey); - if (seenPattern) { - // no point in duplicating it - lockfile[pattern] = seenPattern; - - // if we're relying on our name being inferred and two of the patterns have - // different inferred names then we need to set it - if (!seenPattern.name && getName(pattern) !== pkg.name) { - seenPattern.name = pkg.name; - } - continue; - } - const obj = implodeEntry(pattern, { - name: pkg.name, - version: pkg.version, - uid: pkg._uid, - resolved: remote.resolved, - integrity: remote.integrity, - registry: remote.registry, - dependencies: pkg.dependencies, - peerDependencies: pkg.peerDependencies, - optionalDependencies: pkg.optionalDependencies, - permissions: ref.permissions, - prebuiltVariants: pkg.prebuiltVariants - }); - - lockfile[pattern] = obj; - - if (remoteKey) { - seen.set(remoteKey, obj); - } - } - - return lockfile; - } -} -exports.default = Lockfile; - -/***/ }), -/* 20 */ -/***/ (function(module, exports, __webpack_require__) { - -var store = __webpack_require__(133)('wks'); -var uid = __webpack_require__(137); -var Symbol = __webpack_require__(17).Symbol; -var USE_SYMBOL = typeof Symbol == 'function'; - -var $exports = module.exports = function (name) { - return store[name] || (store[name] = - USE_SYMBOL && Symbol[name] || (USE_SYMBOL ? Symbol : uid)('Symbol.' + name)); -}; - -$exports.store = store; - - -/***/ }), -/* 21 */ -/***/ (function(module, exports, __webpack_require__) { - -"use strict"; - - -exports.__esModule = true; - -var _assign = __webpack_require__(591); - -var _assign2 = _interopRequireDefault(_assign); - -function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; } - -exports.default = _assign2.default || function (target) { - for (var i = 1; i < arguments.length; i++) { - var source = arguments[i]; - - for (var key in source) { - if (Object.prototype.hasOwnProperty.call(source, key)) { - target[key] = source[key]; - } - } - } - - return target; -}; - -/***/ }), -/* 22 */ -/***/ (function(module, exports) { - -exports = module.exports = SemVer; - -// The debug function is excluded entirely from the minified version. -/* nomin */ var debug; -/* nomin */ if (typeof process === 'object' && - /* nomin */ process.env && - /* nomin */ process.env.NODE_DEBUG && - /* nomin */ /\bsemver\b/i.test(process.env.NODE_DEBUG)) - /* nomin */ debug = function() { - /* nomin */ var args = Array.prototype.slice.call(arguments, 0); - /* nomin */ args.unshift('SEMVER'); - /* nomin */ console.log.apply(console, args); - /* nomin */ }; -/* nomin */ else - /* nomin */ debug = function() {}; - -// Note: this is the semver.org version of the spec that it implements -// Not necessarily the package version of this code. -exports.SEMVER_SPEC_VERSION = '2.0.0'; - -var MAX_LENGTH = 256; -var MAX_SAFE_INTEGER = Number.MAX_SAFE_INTEGER || 9007199254740991; - -// Max safe segment length for coercion. -var MAX_SAFE_COMPONENT_LENGTH = 16; - -// The actual regexps go on exports.re -var re = exports.re = []; -var src = exports.src = []; -var R = 0; - -// The following Regular Expressions can be used for tokenizing, -// validating, and parsing SemVer version strings. - -// ## Numeric Identifier -// A single `0`, or a non-zero digit followed by zero or more digits. - -var NUMERICIDENTIFIER = R++; -src[NUMERICIDENTIFIER] = '0|[1-9]\\d*'; -var NUMERICIDENTIFIERLOOSE = R++; -src[NUMERICIDENTIFIERLOOSE] = '[0-9]+'; - - -// ## Non-numeric Identifier -// Zero or more digits, followed by a letter or hyphen, and then zero or -// more letters, digits, or hyphens. - -var NONNUMERICIDENTIFIER = R++; -src[NONNUMERICIDENTIFIER] = '\\d*[a-zA-Z-][a-zA-Z0-9-]*'; - - -// ## Main Version -// Three dot-separated numeric identifiers. - -var MAINVERSION = R++; -src[MAINVERSION] = '(' + src[NUMERICIDENTIFIER] + ')\\.' + - '(' + src[NUMERICIDENTIFIER] + ')\\.' + - '(' + src[NUMERICIDENTIFIER] + ')'; - -var MAINVERSIONLOOSE = R++; -src[MAINVERSIONLOOSE] = '(' + src[NUMERICIDENTIFIERLOOSE] + ')\\.' + - '(' + src[NUMERICIDENTIFIERLOOSE] + ')\\.' + - '(' + src[NUMERICIDENTIFIERLOOSE] + ')'; - -// ## Pre-release Version Identifier -// A numeric identifier, or a non-numeric identifier. - -var PRERELEASEIDENTIFIER = R++; -src[PRERELEASEIDENTIFIER] = '(?:' + src[NUMERICIDENTIFIER] + - '|' + src[NONNUMERICIDENTIFIER] + ')'; - -var PRERELEASEIDENTIFIERLOOSE = R++; -src[PRERELEASEIDENTIFIERLOOSE] = '(?:' + src[NUMERICIDENTIFIERLOOSE] + - '|' + src[NONNUMERICIDENTIFIER] + ')'; - - -// ## Pre-release Version -// Hyphen, followed by one or more dot-separated pre-release version -// identifiers. - -var PRERELEASE = R++; -src[PRERELEASE] = '(?:-(' + src[PRERELEASEIDENTIFIER] + - '(?:\\.' + src[PRERELEASEIDENTIFIER] + ')*))'; - -var PRERELEASELOOSE = R++; -src[PRERELEASELOOSE] = '(?:-?(' + src[PRERELEASEIDENTIFIERLOOSE] + - '(?:\\.' + src[PRERELEASEIDENTIFIERLOOSE] + ')*))'; - -// ## Build Metadata Identifier -// Any combination of digits, letters, or hyphens. - -var BUILDIDENTIFIER = R++; -src[BUILDIDENTIFIER] = '[0-9A-Za-z-]+'; - -// ## Build Metadata -// Plus sign, followed by one or more period-separated build metadata -// identifiers. - -var BUILD = R++; -src[BUILD] = '(?:\\+(' + src[BUILDIDENTIFIER] + - '(?:\\.' + src[BUILDIDENTIFIER] + ')*))'; - - -// ## Full Version String -// A main version, followed optionally by a pre-release version and -// build metadata. - -// Note that the only major, minor, patch, and pre-release sections of -// the version string are capturing groups. The build metadata is not a -// capturing group, because it should not ever be used in version -// comparison. - -var FULL = R++; -var FULLPLAIN = 'v?' + src[MAINVERSION] + - src[PRERELEASE] + '?' + - src[BUILD] + '?'; - -src[FULL] = '^' + FULLPLAIN + '$'; - -// like full, but allows v1.2.3 and =1.2.3, which people do sometimes. -// also, 1.0.0alpha1 (prerelease without the hyphen) which is pretty -// common in the npm registry. -var LOOSEPLAIN = '[v=\\s]*' + src[MAINVERSIONLOOSE] + - src[PRERELEASELOOSE] + '?' + - src[BUILD] + '?'; - -var LOOSE = R++; -src[LOOSE] = '^' + LOOSEPLAIN + '$'; - -var GTLT = R++; -src[GTLT] = '((?:<|>)?=?)'; - -// Something like "2.*" or "1.2.x". -// Note that "x.x" is a valid xRange identifer, meaning "any version" -// Only the first item is strictly required. -var XRANGEIDENTIFIERLOOSE = R++; -src[XRANGEIDENTIFIERLOOSE] = src[NUMERICIDENTIFIERLOOSE] + '|x|X|\\*'; -var XRANGEIDENTIFIER = R++; -src[XRANGEIDENTIFIER] = src[NUMERICIDENTIFIER] + '|x|X|\\*'; - -var XRANGEPLAIN = R++; -src[XRANGEPLAIN] = '[v=\\s]*(' + src[XRANGEIDENTIFIER] + ')' + - '(?:\\.(' + src[XRANGEIDENTIFIER] + ')' + - '(?:\\.(' + src[XRANGEIDENTIFIER] + ')' + - '(?:' + src[PRERELEASE] + ')?' + - src[BUILD] + '?' + - ')?)?'; - -var XRANGEPLAINLOOSE = R++; -src[XRANGEPLAINLOOSE] = '[v=\\s]*(' + src[XRANGEIDENTIFIERLOOSE] + ')' + - '(?:\\.(' + src[XRANGEIDENTIFIERLOOSE] + ')' + - '(?:\\.(' + src[XRANGEIDENTIFIERLOOSE] + ')' + - '(?:' + src[PRERELEASELOOSE] + ')?' + - src[BUILD] + '?' + - ')?)?'; - -var XRANGE = R++; -src[XRANGE] = '^' + src[GTLT] + '\\s*' + src[XRANGEPLAIN] + '$'; -var XRANGELOOSE = R++; -src[XRANGELOOSE] = '^' + src[GTLT] + '\\s*' + src[XRANGEPLAINLOOSE] + '$'; - -// Coercion. -// Extract anything that could conceivably be a part of a valid semver -var COERCE = R++; -src[COERCE] = '(?:^|[^\\d])' + - '(\\d{1,' + MAX_SAFE_COMPONENT_LENGTH + '})' + - '(?:\\.(\\d{1,' + MAX_SAFE_COMPONENT_LENGTH + '}))?' + - '(?:\\.(\\d{1,' + MAX_SAFE_COMPONENT_LENGTH + '}))?' + - '(?:$|[^\\d])'; - -// Tilde ranges. -// Meaning is "reasonably at or greater than" -var LONETILDE = R++; -src[LONETILDE] = '(?:~>?)'; - -var TILDETRIM = R++; -src[TILDETRIM] = '(\\s*)' + src[LONETILDE] + '\\s+'; -re[TILDETRIM] = new RegExp(src[TILDETRIM], 'g'); -var tildeTrimReplace = '$1~'; - -var TILDE = R++; -src[TILDE] = '^' + src[LONETILDE] + src[XRANGEPLAIN] + '$'; -var TILDELOOSE = R++; -src[TILDELOOSE] = '^' + src[LONETILDE] + src[XRANGEPLAINLOOSE] + '$'; - -// Caret ranges. -// Meaning is "at least and backwards compatible with" -var LONECARET = R++; -src[LONECARET] = '(?:\\^)'; - -var CARETTRIM = R++; -src[CARETTRIM] = '(\\s*)' + src[LONECARET] + '\\s+'; -re[CARETTRIM] = new RegExp(src[CARETTRIM], 'g'); -var caretTrimReplace = '$1^'; - -var CARET = R++; -src[CARET] = '^' + src[LONECARET] + src[XRANGEPLAIN] + '$'; -var CARETLOOSE = R++; -src[CARETLOOSE] = '^' + src[LONECARET] + src[XRANGEPLAINLOOSE] + '$'; - -// A simple gt/lt/eq thing, or just "" to indicate "any version" -var COMPARATORLOOSE = R++; -src[COMPARATORLOOSE] = '^' + src[GTLT] + '\\s*(' + LOOSEPLAIN + ')$|^$'; -var COMPARATOR = R++; -src[COMPARATOR] = '^' + src[GTLT] + '\\s*(' + FULLPLAIN + ')$|^$'; - - -// An expression to strip any whitespace between the gtlt and the thing -// it modifies, so that `> 1.2.3` ==> `>1.2.3` -var COMPARATORTRIM = R++; -src[COMPARATORTRIM] = '(\\s*)' + src[GTLT] + - '\\s*(' + LOOSEPLAIN + '|' + src[XRANGEPLAIN] + ')'; - -// this one has to use the /g flag -re[COMPARATORTRIM] = new RegExp(src[COMPARATORTRIM], 'g'); -var comparatorTrimReplace = '$1$2$3'; - - -// Something like `1.2.3 - 1.2.4` -// Note that these all use the loose form, because they'll be -// checked against either the strict or loose comparator form -// later. -var HYPHENRANGE = R++; -src[HYPHENRANGE] = '^\\s*(' + src[XRANGEPLAIN] + ')' + - '\\s+-\\s+' + - '(' + src[XRANGEPLAIN] + ')' + - '\\s*$'; - -var HYPHENRANGELOOSE = R++; -src[HYPHENRANGELOOSE] = '^\\s*(' + src[XRANGEPLAINLOOSE] + ')' + - '\\s+-\\s+' + - '(' + src[XRANGEPLAINLOOSE] + ')' + - '\\s*$'; - -// Star ranges basically just allow anything at all. -var STAR = R++; -src[STAR] = '(<|>)?=?\\s*\\*'; - -// Compile to actual regexp objects. -// All are flag-free, unless they were created above with a flag. -for (var i = 0; i < R; i++) { - debug(i, src[i]); - if (!re[i]) - re[i] = new RegExp(src[i]); -} - -exports.parse = parse; -function parse(version, loose) { - if (version instanceof SemVer) - return version; - - if (typeof version !== 'string') - return null; - - if (version.length > MAX_LENGTH) - return null; - - var r = loose ? re[LOOSE] : re[FULL]; - if (!r.test(version)) - return null; - - try { - return new SemVer(version, loose); - } catch (er) { - return null; - } -} - -exports.valid = valid; -function valid(version, loose) { - var v = parse(version, loose); - return v ? v.version : null; -} - - -exports.clean = clean; -function clean(version, loose) { - var s = parse(version.trim().replace(/^[=v]+/, ''), loose); - return s ? s.version : null; -} - -exports.SemVer = SemVer; - -function SemVer(version, loose) { - if (version instanceof SemVer) { - if (version.loose === loose) - return version; - else - version = version.version; - } else if (typeof version !== 'string') { - throw new TypeError('Invalid Version: ' + version); - } - - if (version.length > MAX_LENGTH) - throw new TypeError('version is longer than ' + MAX_LENGTH + ' characters') - - if (!(this instanceof SemVer)) - return new SemVer(version, loose); - - debug('SemVer', version, loose); - this.loose = loose; - var m = version.trim().match(loose ? re[LOOSE] : re[FULL]); - - if (!m) - throw new TypeError('Invalid Version: ' + version); - - this.raw = version; - - // these are actually numbers - this.major = +m[1]; - this.minor = +m[2]; - this.patch = +m[3]; - - if (this.major > MAX_SAFE_INTEGER || this.major < 0) - throw new TypeError('Invalid major version') - - if (this.minor > MAX_SAFE_INTEGER || this.minor < 0) - throw new TypeError('Invalid minor version') - - if (this.patch > MAX_SAFE_INTEGER || this.patch < 0) - throw new TypeError('Invalid patch version') - - // numberify any prerelease numeric ids - if (!m[4]) - this.prerelease = []; - else - this.prerelease = m[4].split('.').map(function(id) { - if (/^[0-9]+$/.test(id)) { - var num = +id; - if (num >= 0 && num < MAX_SAFE_INTEGER) - return num; - } - return id; - }); - - this.build = m[5] ? m[5].split('.') : []; - this.format(); -} - -SemVer.prototype.format = function() { - this.version = this.major + '.' + this.minor + '.' + this.patch; - if (this.prerelease.length) - this.version += '-' + this.prerelease.join('.'); - return this.version; -}; - -SemVer.prototype.toString = function() { - return this.version; -}; - -SemVer.prototype.compare = function(other) { - debug('SemVer.compare', this.version, this.loose, other); - if (!(other instanceof SemVer)) - other = new SemVer(other, this.loose); - - return this.compareMain(other) || this.comparePre(other); -}; - -SemVer.prototype.compareMain = function(other) { - if (!(other instanceof SemVer)) - other = new SemVer(other, this.loose); - - return compareIdentifiers(this.major, other.major) || - compareIdentifiers(this.minor, other.minor) || - compareIdentifiers(this.patch, other.patch); -}; - -SemVer.prototype.comparePre = function(other) { - if (!(other instanceof SemVer)) - other = new SemVer(other, this.loose); - - // NOT having a prerelease is > having one - if (this.prerelease.length && !other.prerelease.length) - return -1; - else if (!this.prerelease.length && other.prerelease.length) - return 1; - else if (!this.prerelease.length && !other.prerelease.length) - return 0; - - var i = 0; - do { - var a = this.prerelease[i]; - var b = other.prerelease[i]; - debug('prerelease compare', i, a, b); - if (a === undefined && b === undefined) - return 0; - else if (b === undefined) - return 1; - else if (a === undefined) - return -1; - else if (a === b) - continue; - else - return compareIdentifiers(a, b); - } while (++i); -}; - -// preminor will bump the version up to the next minor release, and immediately -// down to pre-release. premajor and prepatch work the same way. -SemVer.prototype.inc = function(release, identifier) { - switch (release) { - case 'premajor': - this.prerelease.length = 0; - this.patch = 0; - this.minor = 0; - this.major++; - this.inc('pre', identifier); - break; - case 'preminor': - this.prerelease.length = 0; - this.patch = 0; - this.minor++; - this.inc('pre', identifier); - break; - case 'prepatch': - // If this is already a prerelease, it will bump to the next version - // drop any prereleases that might already exist, since they are not - // relevant at this point. - this.prerelease.length = 0; - this.inc('patch', identifier); - this.inc('pre', identifier); - break; - // If the input is a non-prerelease version, this acts the same as - // prepatch. - case 'prerelease': - if (this.prerelease.length === 0) - this.inc('patch', identifier); - this.inc('pre', identifier); - break; - - case 'major': - // If this is a pre-major version, bump up to the same major version. - // Otherwise increment major. - // 1.0.0-5 bumps to 1.0.0 - // 1.1.0 bumps to 2.0.0 - if (this.minor !== 0 || this.patch !== 0 || this.prerelease.length === 0) - this.major++; - this.minor = 0; - this.patch = 0; - this.prerelease = []; - break; - case 'minor': - // If this is a pre-minor version, bump up to the same minor version. - // Otherwise increment minor. - // 1.2.0-5 bumps to 1.2.0 - // 1.2.1 bumps to 1.3.0 - if (this.patch !== 0 || this.prerelease.length === 0) - this.minor++; - this.patch = 0; - this.prerelease = []; - break; - case 'patch': - // If this is not a pre-release version, it will increment the patch. - // If it is a pre-release it will bump up to the same patch version. - // 1.2.0-5 patches to 1.2.0 - // 1.2.0 patches to 1.2.1 - if (this.prerelease.length === 0) - this.patch++; - this.prerelease = []; - break; - // This probably shouldn't be used publicly. - // 1.0.0 "pre" would become 1.0.0-0 which is the wrong direction. - case 'pre': - if (this.prerelease.length === 0) - this.prerelease = [0]; - else { - var i = this.prerelease.length; - while (--i >= 0) { - if (typeof this.prerelease[i] === 'number') { - this.prerelease[i]++; - i = -2; - } - } - if (i === -1) // didn't increment anything - this.prerelease.push(0); - } - if (identifier) { - // 1.2.0-beta.1 bumps to 1.2.0-beta.2, - // 1.2.0-beta.fooblz or 1.2.0-beta bumps to 1.2.0-beta.0 - if (this.prerelease[0] === identifier) { - if (isNaN(this.prerelease[1])) - this.prerelease = [identifier, 0]; - } else - this.prerelease = [identifier, 0]; - } - break; - - default: - throw new Error('invalid increment argument: ' + release); - } - this.format(); - this.raw = this.version; - return this; -}; - -exports.inc = inc; -function inc(version, release, loose, identifier) { - if (typeof(loose) === 'string') { - identifier = loose; - loose = undefined; - } - - try { - return new SemVer(version, loose).inc(release, identifier).version; - } catch (er) { - return null; - } -} - -exports.diff = diff; -function diff(version1, version2) { - if (eq(version1, version2)) { - return null; - } else { - var v1 = parse(version1); - var v2 = parse(version2); - if (v1.prerelease.length || v2.prerelease.length) { - for (var key in v1) { - if (key === 'major' || key === 'minor' || key === 'patch') { - if (v1[key] !== v2[key]) { - return 'pre'+key; - } - } - } - return 'prerelease'; - } - for (var key in v1) { - if (key === 'major' || key === 'minor' || key === 'patch') { - if (v1[key] !== v2[key]) { - return key; - } - } - } - } -} - -exports.compareIdentifiers = compareIdentifiers; - -var numeric = /^[0-9]+$/; -function compareIdentifiers(a, b) { - var anum = numeric.test(a); - var bnum = numeric.test(b); - - if (anum && bnum) { - a = +a; - b = +b; - } - - return (anum && !bnum) ? -1 : - (bnum && !anum) ? 1 : - a < b ? -1 : - a > b ? 1 : - 0; -} - -exports.rcompareIdentifiers = rcompareIdentifiers; -function rcompareIdentifiers(a, b) { - return compareIdentifiers(b, a); -} - -exports.major = major; -function major(a, loose) { - return new SemVer(a, loose).major; -} - -exports.minor = minor; -function minor(a, loose) { - return new SemVer(a, loose).minor; -} - -exports.patch = patch; -function patch(a, loose) { - return new SemVer(a, loose).patch; -} - -exports.compare = compare; -function compare(a, b, loose) { - return new SemVer(a, loose).compare(new SemVer(b, loose)); -} - -exports.compareLoose = compareLoose; -function compareLoose(a, b) { - return compare(a, b, true); -} - -exports.rcompare = rcompare; -function rcompare(a, b, loose) { - return compare(b, a, loose); -} - -exports.sort = sort; -function sort(list, loose) { - return list.sort(function(a, b) { - return exports.compare(a, b, loose); - }); -} - -exports.rsort = rsort; -function rsort(list, loose) { - return list.sort(function(a, b) { - return exports.rcompare(a, b, loose); - }); -} - -exports.gt = gt; -function gt(a, b, loose) { - return compare(a, b, loose) > 0; -} - -exports.lt = lt; -function lt(a, b, loose) { - return compare(a, b, loose) < 0; -} - -exports.eq = eq; -function eq(a, b, loose) { - return compare(a, b, loose) === 0; -} - -exports.neq = neq; -function neq(a, b, loose) { - return compare(a, b, loose) !== 0; -} - -exports.gte = gte; -function gte(a, b, loose) { - return compare(a, b, loose) >= 0; -} - -exports.lte = lte; -function lte(a, b, loose) { - return compare(a, b, loose) <= 0; -} - -exports.cmp = cmp; -function cmp(a, op, b, loose) { - var ret; - switch (op) { - case '===': - if (typeof a === 'object') a = a.version; - if (typeof b === 'object') b = b.version; - ret = a === b; - break; - case '!==': - if (typeof a === 'object') a = a.version; - if (typeof b === 'object') b = b.version; - ret = a !== b; - break; - case '': case '=': case '==': ret = eq(a, b, loose); break; - case '!=': ret = neq(a, b, loose); break; - case '>': ret = gt(a, b, loose); break; - case '>=': ret = gte(a, b, loose); break; - case '<': ret = lt(a, b, loose); break; - case '<=': ret = lte(a, b, loose); break; - default: throw new TypeError('Invalid operator: ' + op); - } - return ret; -} - -exports.Comparator = Comparator; -function Comparator(comp, loose) { - if (comp instanceof Comparator) { - if (comp.loose === loose) - return comp; - else - comp = comp.value; - } - - if (!(this instanceof Comparator)) - return new Comparator(comp, loose); - - debug('comparator', comp, loose); - this.loose = loose; - this.parse(comp); - - if (this.semver === ANY) - this.value = ''; - else - this.value = this.operator + this.semver.version; - - debug('comp', this); -} - -var ANY = {}; -Comparator.prototype.parse = function(comp) { - var r = this.loose ? re[COMPARATORLOOSE] : re[COMPARATOR]; - var m = comp.match(r); - - if (!m) - throw new TypeError('Invalid comparator: ' + comp); - - this.operator = m[1]; - if (this.operator === '=') - this.operator = ''; - - // if it literally is just '>' or '' then allow anything. - if (!m[2]) - this.semver = ANY; - else - this.semver = new SemVer(m[2], this.loose); -}; - -Comparator.prototype.toString = function() { - return this.value; -}; - -Comparator.prototype.test = function(version) { - debug('Comparator.test', version, this.loose); - - if (this.semver === ANY) - return true; - - if (typeof version === 'string') - version = new SemVer(version, this.loose); - - return cmp(version, this.operator, this.semver, this.loose); -}; - -Comparator.prototype.intersects = function(comp, loose) { - if (!(comp instanceof Comparator)) { - throw new TypeError('a Comparator is required'); - } - - var rangeTmp; - - if (this.operator === '') { - rangeTmp = new Range(comp.value, loose); - return satisfies(this.value, rangeTmp, loose); - } else if (comp.operator === '') { - rangeTmp = new Range(this.value, loose); - return satisfies(comp.semver, rangeTmp, loose); - } - - var sameDirectionIncreasing = - (this.operator === '>=' || this.operator === '>') && - (comp.operator === '>=' || comp.operator === '>'); - var sameDirectionDecreasing = - (this.operator === '<=' || this.operator === '<') && - (comp.operator === '<=' || comp.operator === '<'); - var sameSemVer = this.semver.version === comp.semver.version; - var differentDirectionsInclusive = - (this.operator === '>=' || this.operator === '<=') && - (comp.operator === '>=' || comp.operator === '<='); - var oppositeDirectionsLessThan = - cmp(this.semver, '<', comp.semver, loose) && - ((this.operator === '>=' || this.operator === '>') && - (comp.operator === '<=' || comp.operator === '<')); - var oppositeDirectionsGreaterThan = - cmp(this.semver, '>', comp.semver, loose) && - ((this.operator === '<=' || this.operator === '<') && - (comp.operator === '>=' || comp.operator === '>')); - - return sameDirectionIncreasing || sameDirectionDecreasing || - (sameSemVer && differentDirectionsInclusive) || - oppositeDirectionsLessThan || oppositeDirectionsGreaterThan; -}; - - -exports.Range = Range; -function Range(range, loose) { - if (range instanceof Range) { - if (range.loose === loose) { - return range; - } else { - return new Range(range.raw, loose); - } - } - - if (range instanceof Comparator) { - return new Range(range.value, loose); - } - - if (!(this instanceof Range)) - return new Range(range, loose); - - this.loose = loose; - - // First, split based on boolean or || - this.raw = range; - this.set = range.split(/\s*\|\|\s*/).map(function(range) { - return this.parseRange(range.trim()); - }, this).filter(function(c) { - // throw out any that are not relevant for whatever reason - return c.length; - }); - - if (!this.set.length) { - throw new TypeError('Invalid SemVer Range: ' + range); - } - - this.format(); -} - -Range.prototype.format = function() { - this.range = this.set.map(function(comps) { - return comps.join(' ').trim(); - }).join('||').trim(); - return this.range; -}; - -Range.prototype.toString = function() { - return this.range; -}; - -Range.prototype.parseRange = function(range) { - var loose = this.loose; - range = range.trim(); - debug('range', range, loose); - // `1.2.3 - 1.2.4` => `>=1.2.3 <=1.2.4` - var hr = loose ? re[HYPHENRANGELOOSE] : re[HYPHENRANGE]; - range = range.replace(hr, hyphenReplace); - debug('hyphen replace', range); - // `> 1.2.3 < 1.2.5` => `>1.2.3 <1.2.5` - range = range.replace(re[COMPARATORTRIM], comparatorTrimReplace); - debug('comparator trim', range, re[COMPARATORTRIM]); - - // `~ 1.2.3` => `~1.2.3` - range = range.replace(re[TILDETRIM], tildeTrimReplace); - - // `^ 1.2.3` => `^1.2.3` - range = range.replace(re[CARETTRIM], caretTrimReplace); - - // normalize spaces - range = range.split(/\s+/).join(' '); - - // At this point, the range is completely trimmed and - // ready to be split into comparators. - - var compRe = loose ? re[COMPARATORLOOSE] : re[COMPARATOR]; - var set = range.split(' ').map(function(comp) { - return parseComparator(comp, loose); - }).join(' ').split(/\s+/); - if (this.loose) { - // in loose mode, throw out any that are not valid comparators - set = set.filter(function(comp) { - return !!comp.match(compRe); - }); - } - set = set.map(function(comp) { - return new Comparator(comp, loose); - }); - - return set; -}; - -Range.prototype.intersects = function(range, loose) { - if (!(range instanceof Range)) { - throw new TypeError('a Range is required'); - } - - return this.set.some(function(thisComparators) { - return thisComparators.every(function(thisComparator) { - return range.set.some(function(rangeComparators) { - return rangeComparators.every(function(rangeComparator) { - return thisComparator.intersects(rangeComparator, loose); - }); - }); - }); - }); -}; - -// Mostly just for testing and legacy API reasons -exports.toComparators = toComparators; -function toComparators(range, loose) { - return new Range(range, loose).set.map(function(comp) { - return comp.map(function(c) { - return c.value; - }).join(' ').trim().split(' '); - }); -} - -// comprised of xranges, tildes, stars, and gtlt's at this point. -// already replaced the hyphen ranges -// turn into a set of JUST comparators. -function parseComparator(comp, loose) { - debug('comp', comp); - comp = replaceCarets(comp, loose); - debug('caret', comp); - comp = replaceTildes(comp, loose); - debug('tildes', comp); - comp = replaceXRanges(comp, loose); - debug('xrange', comp); - comp = replaceStars(comp, loose); - debug('stars', comp); - return comp; -} - -function isX(id) { - return !id || id.toLowerCase() === 'x' || id === '*'; -} - -// ~, ~> --> * (any, kinda silly) -// ~2, ~2.x, ~2.x.x, ~>2, ~>2.x ~>2.x.x --> >=2.0.0 <3.0.0 -// ~2.0, ~2.0.x, ~>2.0, ~>2.0.x --> >=2.0.0 <2.1.0 -// ~1.2, ~1.2.x, ~>1.2, ~>1.2.x --> >=1.2.0 <1.3.0 -// ~1.2.3, ~>1.2.3 --> >=1.2.3 <1.3.0 -// ~1.2.0, ~>1.2.0 --> >=1.2.0 <1.3.0 -function replaceTildes(comp, loose) { - return comp.trim().split(/\s+/).map(function(comp) { - return replaceTilde(comp, loose); - }).join(' '); -} - -function replaceTilde(comp, loose) { - var r = loose ? re[TILDELOOSE] : re[TILDE]; - return comp.replace(r, function(_, M, m, p, pr) { - debug('tilde', comp, _, M, m, p, pr); - var ret; - - if (isX(M)) - ret = ''; - else if (isX(m)) - ret = '>=' + M + '.0.0 <' + (+M + 1) + '.0.0'; - else if (isX(p)) - // ~1.2 == >=1.2.0 <1.3.0 - ret = '>=' + M + '.' + m + '.0 <' + M + '.' + (+m + 1) + '.0'; - else if (pr) { - debug('replaceTilde pr', pr); - if (pr.charAt(0) !== '-') - pr = '-' + pr; - ret = '>=' + M + '.' + m + '.' + p + pr + - ' <' + M + '.' + (+m + 1) + '.0'; - } else - // ~1.2.3 == >=1.2.3 <1.3.0 - ret = '>=' + M + '.' + m + '.' + p + - ' <' + M + '.' + (+m + 1) + '.0'; - - debug('tilde return', ret); - return ret; - }); -} - -// ^ --> * (any, kinda silly) -// ^2, ^2.x, ^2.x.x --> >=2.0.0 <3.0.0 -// ^2.0, ^2.0.x --> >=2.0.0 <3.0.0 -// ^1.2, ^1.2.x --> >=1.2.0 <2.0.0 -// ^1.2.3 --> >=1.2.3 <2.0.0 -// ^1.2.0 --> >=1.2.0 <2.0.0 -function replaceCarets(comp, loose) { - return comp.trim().split(/\s+/).map(function(comp) { - return replaceCaret(comp, loose); - }).join(' '); -} - -function replaceCaret(comp, loose) { - debug('caret', comp, loose); - var r = loose ? re[CARETLOOSE] : re[CARET]; - return comp.replace(r, function(_, M, m, p, pr) { - debug('caret', comp, _, M, m, p, pr); - var ret; - - if (isX(M)) - ret = ''; - else if (isX(m)) - ret = '>=' + M + '.0.0 <' + (+M + 1) + '.0.0'; - else if (isX(p)) { - if (M === '0') - ret = '>=' + M + '.' + m + '.0 <' + M + '.' + (+m + 1) + '.0'; - else - ret = '>=' + M + '.' + m + '.0 <' + (+M + 1) + '.0.0'; - } else if (pr) { - debug('replaceCaret pr', pr); - if (pr.charAt(0) !== '-') - pr = '-' + pr; - if (M === '0') { - if (m === '0') - ret = '>=' + M + '.' + m + '.' + p + pr + - ' <' + M + '.' + m + '.' + (+p + 1); - else - ret = '>=' + M + '.' + m + '.' + p + pr + - ' <' + M + '.' + (+m + 1) + '.0'; - } else - ret = '>=' + M + '.' + m + '.' + p + pr + - ' <' + (+M + 1) + '.0.0'; - } else { - debug('no pr'); - if (M === '0') { - if (m === '0') - ret = '>=' + M + '.' + m + '.' + p + - ' <' + M + '.' + m + '.' + (+p + 1); - else - ret = '>=' + M + '.' + m + '.' + p + - ' <' + M + '.' + (+m + 1) + '.0'; - } else - ret = '>=' + M + '.' + m + '.' + p + - ' <' + (+M + 1) + '.0.0'; - } - - debug('caret return', ret); - return ret; - }); -} - -function replaceXRanges(comp, loose) { - debug('replaceXRanges', comp, loose); - return comp.split(/\s+/).map(function(comp) { - return replaceXRange(comp, loose); - }).join(' '); -} - -function replaceXRange(comp, loose) { - comp = comp.trim(); - var r = loose ? re[XRANGELOOSE] : re[XRANGE]; - return comp.replace(r, function(ret, gtlt, M, m, p, pr) { - debug('xRange', comp, ret, gtlt, M, m, p, pr); - var xM = isX(M); - var xm = xM || isX(m); - var xp = xm || isX(p); - var anyX = xp; - - if (gtlt === '=' && anyX) - gtlt = ''; - - if (xM) { - if (gtlt === '>' || gtlt === '<') { - // nothing is allowed - ret = '<0.0.0'; - } else { - // nothing is forbidden - ret = '*'; - } - } else if (gtlt && anyX) { - // replace X with 0 - if (xm) - m = 0; - if (xp) - p = 0; - - if (gtlt === '>') { - // >1 => >=2.0.0 - // >1.2 => >=1.3.0 - // >1.2.3 => >= 1.2.4 - gtlt = '>='; - if (xm) { - M = +M + 1; - m = 0; - p = 0; - } else if (xp) { - m = +m + 1; - p = 0; - } - } else if (gtlt === '<=') { - // <=0.7.x is actually <0.8.0, since any 0.7.x should - // pass. Similarly, <=7.x is actually <8.0.0, etc. - gtlt = '<'; - if (xm) - M = +M + 1; - else - m = +m + 1; - } - - ret = gtlt + M + '.' + m + '.' + p; - } else if (xm) { - ret = '>=' + M + '.0.0 <' + (+M + 1) + '.0.0'; - } else if (xp) { - ret = '>=' + M + '.' + m + '.0 <' + M + '.' + (+m + 1) + '.0'; - } - - debug('xRange return', ret); - - return ret; - }); -} - -// Because * is AND-ed with everything else in the comparator, -// and '' means "any version", just remove the *s entirely. -function replaceStars(comp, loose) { - debug('replaceStars', comp, loose); - // Looseness is ignored here. star is always as loose as it gets! - return comp.trim().replace(re[STAR], ''); -} - -// This function is passed to string.replace(re[HYPHENRANGE]) -// M, m, patch, prerelease, build -// 1.2 - 3.4.5 => >=1.2.0 <=3.4.5 -// 1.2.3 - 3.4 => >=1.2.0 <3.5.0 Any 3.4.x will do -// 1.2 - 3.4 => >=1.2.0 <3.5.0 -function hyphenReplace($0, - from, fM, fm, fp, fpr, fb, - to, tM, tm, tp, tpr, tb) { - - if (isX(fM)) - from = ''; - else if (isX(fm)) - from = '>=' + fM + '.0.0'; - else if (isX(fp)) - from = '>=' + fM + '.' + fm + '.0'; - else - from = '>=' + from; - - if (isX(tM)) - to = ''; - else if (isX(tm)) - to = '<' + (+tM + 1) + '.0.0'; - else if (isX(tp)) - to = '<' + tM + '.' + (+tm + 1) + '.0'; - else if (tpr) - to = '<=' + tM + '.' + tm + '.' + tp + '-' + tpr; - else - to = '<=' + to; - - return (from + ' ' + to).trim(); -} - - -// if ANY of the sets match ALL of its comparators, then pass -Range.prototype.test = function(version) { - if (!version) - return false; - - if (typeof version === 'string') - version = new SemVer(version, this.loose); - - for (var i = 0; i < this.set.length; i++) { - if (testSet(this.set[i], version)) - return true; - } - return false; -}; - -function testSet(set, version) { - for (var i = 0; i < set.length; i++) { - if (!set[i].test(version)) - return false; - } - - if (version.prerelease.length) { - // Find the set of versions that are allowed to have prereleases - // For example, ^1.2.3-pr.1 desugars to >=1.2.3-pr.1 <2.0.0 - // That should allow `1.2.3-pr.2` to pass. - // However, `1.2.4-alpha.notready` should NOT be allowed, - // even though it's within the range set by the comparators. - for (var i = 0; i < set.length; i++) { - debug(set[i].semver); - if (set[i].semver === ANY) - continue; - - if (set[i].semver.prerelease.length > 0) { - var allowed = set[i].semver; - if (allowed.major === version.major && - allowed.minor === version.minor && - allowed.patch === version.patch) - return true; - } - } - - // Version has a -pre, but it's not one of the ones we like. - return false; - } - - return true; -} - -exports.satisfies = satisfies; -function satisfies(version, range, loose) { - try { - range = new Range(range, loose); - } catch (er) { - return false; - } - return range.test(version); -} - -exports.maxSatisfying = maxSatisfying; -function maxSatisfying(versions, range, loose) { - var max = null; - var maxSV = null; - try { - var rangeObj = new Range(range, loose); - } catch (er) { - return null; - } - versions.forEach(function (v) { - if (rangeObj.test(v)) { // satisfies(v, range, loose) - if (!max || maxSV.compare(v) === -1) { // compare(max, v, true) - max = v; - maxSV = new SemVer(max, loose); - } - } - }) - return max; -} - -exports.minSatisfying = minSatisfying; -function minSatisfying(versions, range, loose) { - var min = null; - var minSV = null; - try { - var rangeObj = new Range(range, loose); - } catch (er) { - return null; - } - versions.forEach(function (v) { - if (rangeObj.test(v)) { // satisfies(v, range, loose) - if (!min || minSV.compare(v) === 1) { // compare(min, v, true) - min = v; - minSV = new SemVer(min, loose); - } - } - }) - return min; -} - -exports.validRange = validRange; -function validRange(range, loose) { - try { - // Return '*' instead of '' so that truthiness works. - // This will throw if it's invalid anyway - return new Range(range, loose).range || '*'; - } catch (er) { - return null; - } -} - -// Determine if version is less than all the versions possible in the range -exports.ltr = ltr; -function ltr(version, range, loose) { - return outside(version, range, '<', loose); -} - -// Determine if version is greater than all the versions possible in the range. -exports.gtr = gtr; -function gtr(version, range, loose) { - return outside(version, range, '>', loose); -} - -exports.outside = outside; -function outside(version, range, hilo, loose) { - version = new SemVer(version, loose); - range = new Range(range, loose); - - var gtfn, ltefn, ltfn, comp, ecomp; - switch (hilo) { - case '>': - gtfn = gt; - ltefn = lte; - ltfn = lt; - comp = '>'; - ecomp = '>='; - break; - case '<': - gtfn = lt; - ltefn = gte; - ltfn = gt; - comp = '<'; - ecomp = '<='; - break; - default: - throw new TypeError('Must provide a hilo val of "<" or ">"'); - } - - // If it satisifes the range it is not outside - if (satisfies(version, range, loose)) { - return false; - } - - // From now on, variable terms are as if we're in "gtr" mode. - // but note that everything is flipped for the "ltr" function. - - for (var i = 0; i < range.set.length; ++i) { - var comparators = range.set[i]; - - var high = null; - var low = null; - - comparators.forEach(function(comparator) { - if (comparator.semver === ANY) { - comparator = new Comparator('>=0.0.0') - } - high = high || comparator; - low = low || comparator; - if (gtfn(comparator.semver, high.semver, loose)) { - high = comparator; - } else if (ltfn(comparator.semver, low.semver, loose)) { - low = comparator; - } - }); - - // If the edge version comparator has a operator then our version - // isn't outside it - if (high.operator === comp || high.operator === ecomp) { - return false; - } - - // If the lowest version comparator has an operator and our version - // is less than it then it isn't higher than the range - if ((!low.operator || low.operator === comp) && - ltefn(version, low.semver)) { - return false; - } else if (low.operator === ecomp && ltfn(version, low.semver)) { - return false; - } - } - return true; -} - -exports.prerelease = prerelease; -function prerelease(version, loose) { - var parsed = parse(version, loose); - return (parsed && parsed.prerelease.length) ? parsed.prerelease : null; -} - -exports.intersects = intersects; -function intersects(r1, r2, loose) { - r1 = new Range(r1, loose) - r2 = new Range(r2, loose) - return r1.intersects(r2) -} - -exports.coerce = coerce; -function coerce(version) { - if (version instanceof SemVer) - return version; - - if (typeof version !== 'string') - return null; - - var match = version.match(re[COERCE]); - - if (match == null) - return null; - - return parse((match[1] || '0') + '.' + (match[2] || '0') + '.' + (match[3] || '0')); -} - - -/***/ }), -/* 23 */ -/***/ (function(module, exports) { - -module.exports = require("stream"); - -/***/ }), -/* 24 */ -/***/ (function(module, exports) { - -module.exports = require("url"); - -/***/ }), -/* 25 */ -/***/ (function(module, __webpack_exports__, __webpack_require__) { - -"use strict"; -/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "a", function() { return Subscription; }); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0__util_isArray__ = __webpack_require__(41); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__util_isObject__ = __webpack_require__(444); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__util_isFunction__ = __webpack_require__(154); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3__util_tryCatch__ = __webpack_require__(56); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_4__util_errorObject__ = __webpack_require__(48); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_5__util_UnsubscriptionError__ = __webpack_require__(441); -/** PURE_IMPORTS_START _util_isArray,_util_isObject,_util_isFunction,_util_tryCatch,_util_errorObject,_util_UnsubscriptionError PURE_IMPORTS_END */ - - - - - - -var Subscription = /*@__PURE__*/ (function () { - function Subscription(unsubscribe) { - this.closed = false; - this._parent = null; - this._parents = null; - this._subscriptions = null; - if (unsubscribe) { - this._unsubscribe = unsubscribe; - } - } - Subscription.prototype.unsubscribe = function () { - var hasErrors = false; - var errors; - if (this.closed) { - return; - } - var _a = this, _parent = _a._parent, _parents = _a._parents, _unsubscribe = _a._unsubscribe, _subscriptions = _a._subscriptions; - this.closed = true; - this._parent = null; - this._parents = null; - this._subscriptions = null; - var index = -1; - var len = _parents ? _parents.length : 0; - while (_parent) { - _parent.remove(this); - _parent = ++index < len && _parents[index] || null; - } - if (__webpack_require__.i(__WEBPACK_IMPORTED_MODULE_2__util_isFunction__["a" /* isFunction */])(_unsubscribe)) { - var trial = __webpack_require__.i(__WEBPACK_IMPORTED_MODULE_3__util_tryCatch__["a" /* tryCatch */])(_unsubscribe).call(this); - if (trial === __WEBPACK_IMPORTED_MODULE_4__util_errorObject__["a" /* errorObject */]) { - hasErrors = true; - errors = errors || (__WEBPACK_IMPORTED_MODULE_4__util_errorObject__["a" /* errorObject */].e instanceof __WEBPACK_IMPORTED_MODULE_5__util_UnsubscriptionError__["a" /* UnsubscriptionError */] ? - flattenUnsubscriptionErrors(__WEBPACK_IMPORTED_MODULE_4__util_errorObject__["a" /* errorObject */].e.errors) : [__WEBPACK_IMPORTED_MODULE_4__util_errorObject__["a" /* errorObject */].e]); - } - } - if (__webpack_require__.i(__WEBPACK_IMPORTED_MODULE_0__util_isArray__["a" /* isArray */])(_subscriptions)) { - index = -1; - len = _subscriptions.length; - while (++index < len) { - var sub = _subscriptions[index]; - if (__webpack_require__.i(__WEBPACK_IMPORTED_MODULE_1__util_isObject__["a" /* isObject */])(sub)) { - var trial = __webpack_require__.i(__WEBPACK_IMPORTED_MODULE_3__util_tryCatch__["a" /* tryCatch */])(sub.unsubscribe).call(sub); - if (trial === __WEBPACK_IMPORTED_MODULE_4__util_errorObject__["a" /* errorObject */]) { - hasErrors = true; - errors = errors || []; - var err = __WEBPACK_IMPORTED_MODULE_4__util_errorObject__["a" /* errorObject */].e; - if (err instanceof __WEBPACK_IMPORTED_MODULE_5__util_UnsubscriptionError__["a" /* UnsubscriptionError */]) { - errors = errors.concat(flattenUnsubscriptionErrors(err.errors)); - } - else { - errors.push(err); - } - } - } - } - } - if (hasErrors) { - throw new __WEBPACK_IMPORTED_MODULE_5__util_UnsubscriptionError__["a" /* UnsubscriptionError */](errors); - } - }; - Subscription.prototype.add = function (teardown) { - if (!teardown || (teardown === Subscription.EMPTY)) { - return Subscription.EMPTY; - } - if (teardown === this) { - return this; - } - var subscription = teardown; - switch (typeof teardown) { - case 'function': - subscription = new Subscription(teardown); - case 'object': - if (subscription.closed || typeof subscription.unsubscribe !== 'function') { - return subscription; - } - else if (this.closed) { - subscription.unsubscribe(); - return subscription; - } - else if (typeof subscription._addParent !== 'function') { - var tmp = subscription; - subscription = new Subscription(); - subscription._subscriptions = [tmp]; - } - break; - default: - throw new Error('unrecognized teardown ' + teardown + ' added to Subscription.'); - } - var subscriptions = this._subscriptions || (this._subscriptions = []); - subscriptions.push(subscription); - subscription._addParent(this); - return subscription; - }; - Subscription.prototype.remove = function (subscription) { - var subscriptions = this._subscriptions; - if (subscriptions) { - var subscriptionIndex = subscriptions.indexOf(subscription); - if (subscriptionIndex !== -1) { - subscriptions.splice(subscriptionIndex, 1); - } - } - }; - Subscription.prototype._addParent = function (parent) { - var _a = this, _parent = _a._parent, _parents = _a._parents; - if (!_parent || _parent === parent) { - this._parent = parent; - } - else if (!_parents) { - this._parents = [parent]; - } - else if (_parents.indexOf(parent) === -1) { - _parents.push(parent); - } - }; - Subscription.EMPTY = (function (empty) { - empty.closed = true; - return empty; - }(new Subscription())); - return Subscription; -}()); - -function flattenUnsubscriptionErrors(errors) { - return errors.reduce(function (errs, err) { return errs.concat((err instanceof __WEBPACK_IMPORTED_MODULE_5__util_UnsubscriptionError__["a" /* UnsubscriptionError */]) ? err.errors : err); }, []); -} -//# sourceMappingURL=Subscription.js.map - - -/***/ }), -/* 26 */ -/***/ (function(module, exports, __webpack_require__) { - -// Copyright 2015 Joyent, Inc. - -module.exports = { - bufferSplit: bufferSplit, - addRSAMissing: addRSAMissing, - calculateDSAPublic: calculateDSAPublic, - calculateED25519Public: calculateED25519Public, - calculateX25519Public: calculateX25519Public, - mpNormalize: mpNormalize, - mpDenormalize: mpDenormalize, - ecNormalize: ecNormalize, - countZeros: countZeros, - assertCompatible: assertCompatible, - isCompatible: isCompatible, - opensslKeyDeriv: opensslKeyDeriv, - opensshCipherInfo: opensshCipherInfo, - publicFromPrivateECDSA: publicFromPrivateECDSA, - zeroPadToLength: zeroPadToLength, - writeBitString: writeBitString, - readBitString: readBitString -}; - -var assert = __webpack_require__(16); -var Buffer = __webpack_require__(15).Buffer; -var PrivateKey = __webpack_require__(33); -var Key = __webpack_require__(27); -var crypto = __webpack_require__(11); -var algs = __webpack_require__(32); -var asn1 = __webpack_require__(66); - -var ec, jsbn; -var nacl; - -var MAX_CLASS_DEPTH = 3; - -function isCompatible(obj, klass, needVer) { - if (obj === null || typeof (obj) !== 'object') - return (false); - if (needVer === undefined) - needVer = klass.prototype._sshpkApiVersion; - if (obj instanceof klass && - klass.prototype._sshpkApiVersion[0] == needVer[0]) - return (true); - var proto = Object.getPrototypeOf(obj); - var depth = 0; - while (proto.constructor.name !== klass.name) { - proto = Object.getPrototypeOf(proto); - if (!proto || ++depth > MAX_CLASS_DEPTH) - return (false); - } - if (proto.constructor.name !== klass.name) - return (false); - var ver = proto._sshpkApiVersion; - if (ver === undefined) - ver = klass._oldVersionDetect(obj); - if (ver[0] != needVer[0] || ver[1] < needVer[1]) - return (false); - return (true); -} - -function assertCompatible(obj, klass, needVer, name) { - if (name === undefined) - name = 'object'; - assert.ok(obj, name + ' must not be null'); - assert.object(obj, name + ' must be an object'); - if (needVer === undefined) - needVer = klass.prototype._sshpkApiVersion; - if (obj instanceof klass && - klass.prototype._sshpkApiVersion[0] == needVer[0]) - return; - var proto = Object.getPrototypeOf(obj); - var depth = 0; - while (proto.constructor.name !== klass.name) { - proto = Object.getPrototypeOf(proto); - assert.ok(proto && ++depth <= MAX_CLASS_DEPTH, - name + ' must be a ' + klass.name + ' instance'); - } - assert.strictEqual(proto.constructor.name, klass.name, - name + ' must be a ' + klass.name + ' instance'); - var ver = proto._sshpkApiVersion; - if (ver === undefined) - ver = klass._oldVersionDetect(obj); - assert.ok(ver[0] == needVer[0] && ver[1] >= needVer[1], - name + ' must be compatible with ' + klass.name + ' klass ' + - 'version ' + needVer[0] + '.' + needVer[1]); -} - -var CIPHER_LEN = { - 'des-ede3-cbc': { key: 7, iv: 8 }, - 'aes-128-cbc': { key: 16, iv: 16 } -}; -var PKCS5_SALT_LEN = 8; - -function opensslKeyDeriv(cipher, salt, passphrase, count) { - assert.buffer(salt, 'salt'); - assert.buffer(passphrase, 'passphrase'); - assert.number(count, 'iteration count'); - - var clen = CIPHER_LEN[cipher]; - assert.object(clen, 'supported cipher'); - - salt = salt.slice(0, PKCS5_SALT_LEN); - - var D, D_prev, bufs; - var material = Buffer.alloc(0); - while (material.length < clen.key + clen.iv) { - bufs = []; - if (D_prev) - bufs.push(D_prev); - bufs.push(passphrase); - bufs.push(salt); - D = Buffer.concat(bufs); - for (var j = 0; j < count; ++j) - D = crypto.createHash('md5').update(D).digest(); - material = Buffer.concat([material, D]); - D_prev = D; - } - - return ({ - key: material.slice(0, clen.key), - iv: material.slice(clen.key, clen.key + clen.iv) - }); -} - -/* Count leading zero bits on a buffer */ -function countZeros(buf) { - var o = 0, obit = 8; - while (o < buf.length) { - var mask = (1 << obit); - if ((buf[o] & mask) === mask) - break; - obit--; - if (obit < 0) { - o++; - obit = 8; - } - } - return (o*8 + (8 - obit) - 1); -} - -function bufferSplit(buf, chr) { - assert.buffer(buf); - assert.string(chr); - - var parts = []; - var lastPart = 0; - var matches = 0; - for (var i = 0; i < buf.length; ++i) { - if (buf[i] === chr.charCodeAt(matches)) - ++matches; - else if (buf[i] === chr.charCodeAt(0)) - matches = 1; - else - matches = 0; - - if (matches >= chr.length) { - var newPart = i + 1; - parts.push(buf.slice(lastPart, newPart - matches)); - lastPart = newPart; - matches = 0; - } - } - if (lastPart <= buf.length) - parts.push(buf.slice(lastPart, buf.length)); - - return (parts); -} - -function ecNormalize(buf, addZero) { - assert.buffer(buf); - if (buf[0] === 0x00 && buf[1] === 0x04) { - if (addZero) - return (buf); - return (buf.slice(1)); - } else if (buf[0] === 0x04) { - if (!addZero) - return (buf); - } else { - while (buf[0] === 0x00) - buf = buf.slice(1); - if (buf[0] === 0x02 || buf[0] === 0x03) - throw (new Error('Compressed elliptic curve points ' + - 'are not supported')); - if (buf[0] !== 0x04) - throw (new Error('Not a valid elliptic curve point')); - if (!addZero) - return (buf); - } - var b = Buffer.alloc(buf.length + 1); - b[0] = 0x0; - buf.copy(b, 1); - return (b); -} - -function readBitString(der, tag) { - if (tag === undefined) - tag = asn1.Ber.BitString; - var buf = der.readString(tag, true); - assert.strictEqual(buf[0], 0x00, 'bit strings with unused bits are ' + - 'not supported (0x' + buf[0].toString(16) + ')'); - return (buf.slice(1)); -} - -function writeBitString(der, buf, tag) { - if (tag === undefined) - tag = asn1.Ber.BitString; - var b = Buffer.alloc(buf.length + 1); - b[0] = 0x00; - buf.copy(b, 1); - der.writeBuffer(b, tag); -} - -function mpNormalize(buf) { - assert.buffer(buf); - while (buf.length > 1 && buf[0] === 0x00 && (buf[1] & 0x80) === 0x00) - buf = buf.slice(1); - if ((buf[0] & 0x80) === 0x80) { - var b = Buffer.alloc(buf.length + 1); - b[0] = 0x00; - buf.copy(b, 1); - buf = b; - } - return (buf); -} - -function mpDenormalize(buf) { - assert.buffer(buf); - while (buf.length > 1 && buf[0] === 0x00) - buf = buf.slice(1); - return (buf); -} - -function zeroPadToLength(buf, len) { - assert.buffer(buf); - assert.number(len); - while (buf.length > len) { - assert.equal(buf[0], 0x00); - buf = buf.slice(1); - } - while (buf.length < len) { - var b = Buffer.alloc(buf.length + 1); - b[0] = 0x00; - buf.copy(b, 1); - buf = b; - } - return (buf); -} - -function bigintToMpBuf(bigint) { - var buf = Buffer.from(bigint.toByteArray()); - buf = mpNormalize(buf); - return (buf); -} - -function calculateDSAPublic(g, p, x) { - assert.buffer(g); - assert.buffer(p); - assert.buffer(x); - try { - var bigInt = __webpack_require__(81).BigInteger; - } catch (e) { - throw (new Error('To load a PKCS#8 format DSA private key, ' + - 'the node jsbn library is required.')); - } - g = new bigInt(g); - p = new bigInt(p); - x = new bigInt(x); - var y = g.modPow(x, p); - var ybuf = bigintToMpBuf(y); - return (ybuf); -} - -function calculateED25519Public(k) { - assert.buffer(k); - - if (nacl === undefined) - nacl = __webpack_require__(76); - - var kp = nacl.sign.keyPair.fromSeed(new Uint8Array(k)); - return (Buffer.from(kp.publicKey)); -} - -function calculateX25519Public(k) { - assert.buffer(k); - - if (nacl === undefined) - nacl = __webpack_require__(76); - - var kp = nacl.box.keyPair.fromSeed(new Uint8Array(k)); - return (Buffer.from(kp.publicKey)); -} - -function addRSAMissing(key) { - assert.object(key); - assertCompatible(key, PrivateKey, [1, 1]); - try { - var bigInt = __webpack_require__(81).BigInteger; - } catch (e) { - throw (new Error('To write a PEM private key from ' + - 'this source, the node jsbn lib is required.')); - } - - var d = new bigInt(key.part.d.data); - var buf; - - if (!key.part.dmodp) { - var p = new bigInt(key.part.p.data); - var dmodp = d.mod(p.subtract(1)); - - buf = bigintToMpBuf(dmodp); - key.part.dmodp = {name: 'dmodp', data: buf}; - key.parts.push(key.part.dmodp); - } - if (!key.part.dmodq) { - var q = new bigInt(key.part.q.data); - var dmodq = d.mod(q.subtract(1)); - - buf = bigintToMpBuf(dmodq); - key.part.dmodq = {name: 'dmodq', data: buf}; - key.parts.push(key.part.dmodq); - } -} - -function publicFromPrivateECDSA(curveName, priv) { - assert.string(curveName, 'curveName'); - assert.buffer(priv); - if (ec === undefined) - ec = __webpack_require__(139); - if (jsbn === undefined) - jsbn = __webpack_require__(81).BigInteger; - var params = algs.curves[curveName]; - var p = new jsbn(params.p); - var a = new jsbn(params.a); - var b = new jsbn(params.b); - var curve = new ec.ECCurveFp(p, a, b); - var G = curve.decodePointHex(params.G.toString('hex')); - - var d = new jsbn(mpNormalize(priv)); - var pub = G.multiply(d); - pub = Buffer.from(curve.encodePointHex(pub), 'hex'); - - var parts = []; - parts.push({name: 'curve', data: Buffer.from(curveName)}); - parts.push({name: 'Q', data: pub}); - - var key = new Key({type: 'ecdsa', curve: curve, parts: parts}); - return (key); -} - -function opensshCipherInfo(cipher) { - var inf = {}; - switch (cipher) { - case '3des-cbc': - inf.keySize = 24; - inf.blockSize = 8; - inf.opensslName = 'des-ede3-cbc'; - break; - case 'blowfish-cbc': - inf.keySize = 16; - inf.blockSize = 8; - inf.opensslName = 'bf-cbc'; - break; - case 'aes128-cbc': - case 'aes128-ctr': - case 'aes128-gcm@openssh.com': - inf.keySize = 16; - inf.blockSize = 16; - inf.opensslName = 'aes-128-' + cipher.slice(7, 10); - break; - case 'aes192-cbc': - case 'aes192-ctr': - case 'aes192-gcm@openssh.com': - inf.keySize = 24; - inf.blockSize = 16; - inf.opensslName = 'aes-192-' + cipher.slice(7, 10); - break; - case 'aes256-cbc': - case 'aes256-ctr': - case 'aes256-gcm@openssh.com': - inf.keySize = 32; - inf.blockSize = 16; - inf.opensslName = 'aes-256-' + cipher.slice(7, 10); - break; - default: - throw (new Error( - 'Unsupported openssl cipher "' + cipher + '"')); - } - return (inf); -} - - -/***/ }), -/* 27 */ -/***/ (function(module, exports, __webpack_require__) { - -// Copyright 2017 Joyent, Inc. - -module.exports = Key; - -var assert = __webpack_require__(16); -var algs = __webpack_require__(32); -var crypto = __webpack_require__(11); -var Fingerprint = __webpack_require__(156); -var Signature = __webpack_require__(75); -var DiffieHellman = __webpack_require__(325).DiffieHellman; -var errs = __webpack_require__(74); -var utils = __webpack_require__(26); -var PrivateKey = __webpack_require__(33); -var edCompat; - -try { - edCompat = __webpack_require__(454); -} catch (e) { - /* Just continue through, and bail out if we try to use it. */ -} - -var InvalidAlgorithmError = errs.InvalidAlgorithmError; -var KeyParseError = errs.KeyParseError; - -var formats = {}; -formats['auto'] = __webpack_require__(455); -formats['pem'] = __webpack_require__(86); -formats['pkcs1'] = __webpack_require__(327); -formats['pkcs8'] = __webpack_require__(157); -formats['rfc4253'] = __webpack_require__(103); -formats['ssh'] = __webpack_require__(456); -formats['ssh-private'] = __webpack_require__(192); -formats['openssh'] = formats['ssh-private']; -formats['dnssec'] = __webpack_require__(326); - -function Key(opts) { - assert.object(opts, 'options'); - assert.arrayOfObject(opts.parts, 'options.parts'); - assert.string(opts.type, 'options.type'); - assert.optionalString(opts.comment, 'options.comment'); - - var algInfo = algs.info[opts.type]; - if (typeof (algInfo) !== 'object') - throw (new InvalidAlgorithmError(opts.type)); - - var partLookup = {}; - for (var i = 0; i < opts.parts.length; ++i) { - var part = opts.parts[i]; - partLookup[part.name] = part; - } - - this.type = opts.type; - this.parts = opts.parts; - this.part = partLookup; - this.comment = undefined; - this.source = opts.source; - - /* for speeding up hashing/fingerprint operations */ - this._rfc4253Cache = opts._rfc4253Cache; - this._hashCache = {}; - - var sz; - this.curve = undefined; - if (this.type === 'ecdsa') { - var curve = this.part.curve.data.toString(); - this.curve = curve; - sz = algs.curves[curve].size; - } else if (this.type === 'ed25519' || this.type === 'curve25519') { - sz = 256; - this.curve = 'curve25519'; - } else { - var szPart = this.part[algInfo.sizePart]; - sz = szPart.data.length; - sz = sz * 8 - utils.countZeros(szPart.data); - } - this.size = sz; -} - -Key.formats = formats; - -Key.prototype.toBuffer = function (format, options) { - if (format === undefined) - format = 'ssh'; - assert.string(format, 'format'); - assert.object(formats[format], 'formats[format]'); - assert.optionalObject(options, 'options'); - - if (format === 'rfc4253') { - if (this._rfc4253Cache === undefined) - this._rfc4253Cache = formats['rfc4253'].write(this); - return (this._rfc4253Cache); - } - - return (formats[format].write(this, options)); -}; - -Key.prototype.toString = function (format, options) { - return (this.toBuffer(format, options).toString()); -}; - -Key.prototype.hash = function (algo) { - assert.string(algo, 'algorithm'); - algo = algo.toLowerCase(); - if (algs.hashAlgs[algo] === undefined) - throw (new InvalidAlgorithmError(algo)); - - if (this._hashCache[algo]) - return (this._hashCache[algo]); - var hash = crypto.createHash(algo). - update(this.toBuffer('rfc4253')).digest(); - this._hashCache[algo] = hash; - return (hash); -}; - -Key.prototype.fingerprint = function (algo) { - if (algo === undefined) - algo = 'sha256'; - assert.string(algo, 'algorithm'); - var opts = { - type: 'key', - hash: this.hash(algo), - algorithm: algo - }; - return (new Fingerprint(opts)); -}; - -Key.prototype.defaultHashAlgorithm = function () { - var hashAlgo = 'sha1'; - if (this.type === 'rsa') - hashAlgo = 'sha256'; - if (this.type === 'dsa' && this.size > 1024) - hashAlgo = 'sha256'; - if (this.type === 'ed25519') - hashAlgo = 'sha512'; - if (this.type === 'ecdsa') { - if (this.size <= 256) - hashAlgo = 'sha256'; - else if (this.size <= 384) - hashAlgo = 'sha384'; - else - hashAlgo = 'sha512'; - } - return (hashAlgo); -}; - -Key.prototype.createVerify = function (hashAlgo) { - if (hashAlgo === undefined) - hashAlgo = this.defaultHashAlgorithm(); - assert.string(hashAlgo, 'hash algorithm'); - - /* ED25519 is not supported by OpenSSL, use a javascript impl. */ - if (this.type === 'ed25519' && edCompat !== undefined) - return (new edCompat.Verifier(this, hashAlgo)); - if (this.type === 'curve25519') - throw (new Error('Curve25519 keys are not suitable for ' + - 'signing or verification')); - - var v, nm, err; - try { - nm = hashAlgo.toUpperCase(); - v = crypto.createVerify(nm); - } catch (e) { - err = e; - } - if (v === undefined || (err instanceof Error && - err.message.match(/Unknown message digest/))) { - nm = 'RSA-'; - nm += hashAlgo.toUpperCase(); - v = crypto.createVerify(nm); - } - assert.ok(v, 'failed to create verifier'); - var oldVerify = v.verify.bind(v); - var key = this.toBuffer('pkcs8'); - var curve = this.curve; - var self = this; - v.verify = function (signature, fmt) { - if (Signature.isSignature(signature, [2, 0])) { - if (signature.type !== self.type) - return (false); - if (signature.hashAlgorithm && - signature.hashAlgorithm !== hashAlgo) - return (false); - if (signature.curve && self.type === 'ecdsa' && - signature.curve !== curve) - return (false); - return (oldVerify(key, signature.toBuffer('asn1'))); - - } else if (typeof (signature) === 'string' || - Buffer.isBuffer(signature)) { - return (oldVerify(key, signature, fmt)); - - /* - * Avoid doing this on valid arguments, walking the prototype - * chain can be quite slow. - */ - } else if (Signature.isSignature(signature, [1, 0])) { - throw (new Error('signature was created by too old ' + - 'a version of sshpk and cannot be verified')); - - } else { - throw (new TypeError('signature must be a string, ' + - 'Buffer, or Signature object')); - } - }; - return (v); -}; - -Key.prototype.createDiffieHellman = function () { - if (this.type === 'rsa') - throw (new Error('RSA keys do not support Diffie-Hellman')); - - return (new DiffieHellman(this)); -}; -Key.prototype.createDH = Key.prototype.createDiffieHellman; - -Key.parse = function (data, format, options) { - if (typeof (data) !== 'string') - assert.buffer(data, 'data'); - if (format === undefined) - format = 'auto'; - assert.string(format, 'format'); - if (typeof (options) === 'string') - options = { filename: options }; - assert.optionalObject(options, 'options'); - if (options === undefined) - options = {}; - assert.optionalString(options.filename, 'options.filename'); - if (options.filename === undefined) - options.filename = '(unnamed)'; - - assert.object(formats[format], 'formats[format]'); - - try { - var k = formats[format].read(data, options); - if (k instanceof PrivateKey) - k = k.toPublic(); - if (!k.comment) - k.comment = options.filename; - return (k); - } catch (e) { - if (e.name === 'KeyEncryptedError') - throw (e); - throw (new KeyParseError(options.filename, format, e)); - } -}; - -Key.isKey = function (obj, ver) { - return (utils.isCompatible(obj, Key, ver)); -}; - -/* - * API versions for Key: - * [1,0] -- initial ver, may take Signature for createVerify or may not - * [1,1] -- added pkcs1, pkcs8 formats - * [1,2] -- added auto, ssh-private, openssh formats - * [1,3] -- added defaultHashAlgorithm - * [1,4] -- added ed support, createDH - * [1,5] -- first explicitly tagged version - * [1,6] -- changed ed25519 part names - */ -Key.prototype._sshpkApiVersion = [1, 6]; - -Key._oldVersionDetect = function (obj) { - assert.func(obj.toBuffer); - assert.func(obj.fingerprint); - if (obj.createDH) - return ([1, 4]); - if (obj.defaultHashAlgorithm) - return ([1, 3]); - if (obj.formats['auto']) - return ([1, 2]); - if (obj.formats['pkcs1']) - return ([1, 1]); - return ([1, 0]); -}; - - -/***/ }), -/* 28 */ -/***/ (function(module, exports) { - -module.exports = require("assert"); - -/***/ }), -/* 29 */ -/***/ (function(module, exports, __webpack_require__) { - -"use strict"; - - -Object.defineProperty(exports, "__esModule", { - value: true -}); -exports.default = nullify; -function nullify(obj = {}) { - if (Array.isArray(obj)) { - for (var _iterator = obj, _isArray = Array.isArray(_iterator), _i = 0, _iterator = _isArray ? _iterator : _iterator[Symbol.iterator]();;) { - var _ref; - - if (_isArray) { - if (_i >= _iterator.length) break; - _ref = _iterator[_i++]; - } else { - _i = _iterator.next(); - if (_i.done) break; - _ref = _i.value; - } - - const item = _ref; - - nullify(item); - } - } else if (obj !== null && typeof obj === 'object' || typeof obj === 'function') { - Object.setPrototypeOf(obj, null); - - // for..in can only be applied to 'object', not 'function' - if (typeof obj === 'object') { - for (const key in obj) { - nullify(obj[key]); - } - } - } - - return obj; -} - -/***/ }), -/* 30 */ -/***/ (function(module, exports, __webpack_require__) { - -"use strict"; - -const escapeStringRegexp = __webpack_require__(388); -const ansiStyles = __webpack_require__(506); -const stdoutColor = __webpack_require__(598).stdout; - -const template = __webpack_require__(599); - -const isSimpleWindowsTerm = process.platform === 'win32' && !(process.env.TERM || '').toLowerCase().startsWith('xterm'); - -// `supportsColor.level` → `ansiStyles.color[name]` mapping -const levelMapping = ['ansi', 'ansi', 'ansi256', 'ansi16m']; - -// `color-convert` models to exclude from the Chalk API due to conflicts and such -const skipModels = new Set(['gray']); - -const styles = Object.create(null); - -function applyOptions(obj, options) { - options = options || {}; - - // Detect level if not set manually - const scLevel = stdoutColor ? stdoutColor.level : 0; - obj.level = options.level === undefined ? scLevel : options.level; - obj.enabled = 'enabled' in options ? options.enabled : obj.level > 0; -} - -function Chalk(options) { - // We check for this.template here since calling `chalk.constructor()` - // by itself will have a `this` of a previously constructed chalk object - if (!this || !(this instanceof Chalk) || this.template) { - const chalk = {}; - applyOptions(chalk, options); - - chalk.template = function () { - const args = [].slice.call(arguments); - return chalkTag.apply(null, [chalk.template].concat(args)); - }; - - Object.setPrototypeOf(chalk, Chalk.prototype); - Object.setPrototypeOf(chalk.template, chalk); - - chalk.template.constructor = Chalk; - - return chalk.template; - } - - applyOptions(this, options); -} - -// Use bright blue on Windows as the normal blue color is illegible -if (isSimpleWindowsTerm) { - ansiStyles.blue.open = '\u001B[94m'; -} - -for (const key of Object.keys(ansiStyles)) { - ansiStyles[key].closeRe = new RegExp(escapeStringRegexp(ansiStyles[key].close), 'g'); - - styles[key] = { - get() { - const codes = ansiStyles[key]; - return build.call(this, this._styles ? this._styles.concat(codes) : [codes], this._empty, key); - } - }; -} - -styles.visible = { - get() { - return build.call(this, this._styles || [], true, 'visible'); - } -}; - -ansiStyles.color.closeRe = new RegExp(escapeStringRegexp(ansiStyles.color.close), 'g'); -for (const model of Object.keys(ansiStyles.color.ansi)) { - if (skipModels.has(model)) { - continue; - } - - styles[model] = { - get() { - const level = this.level; - return function () { - const open = ansiStyles.color[levelMapping[level]][model].apply(null, arguments); - const codes = { - open, - close: ansiStyles.color.close, - closeRe: ansiStyles.color.closeRe - }; - return build.call(this, this._styles ? this._styles.concat(codes) : [codes], this._empty, model); - }; - } - }; -} - -ansiStyles.bgColor.closeRe = new RegExp(escapeStringRegexp(ansiStyles.bgColor.close), 'g'); -for (const model of Object.keys(ansiStyles.bgColor.ansi)) { - if (skipModels.has(model)) { - continue; - } - - const bgModel = 'bg' + model[0].toUpperCase() + model.slice(1); - styles[bgModel] = { - get() { - const level = this.level; - return function () { - const open = ansiStyles.bgColor[levelMapping[level]][model].apply(null, arguments); - const codes = { - open, - close: ansiStyles.bgColor.close, - closeRe: ansiStyles.bgColor.closeRe - }; - return build.call(this, this._styles ? this._styles.concat(codes) : [codes], this._empty, model); - }; - } - }; -} - -const proto = Object.defineProperties(() => {}, styles); - -function build(_styles, _empty, key) { - const builder = function () { - return applyStyle.apply(builder, arguments); - }; - - builder._styles = _styles; - builder._empty = _empty; - - const self = this; - - Object.defineProperty(builder, 'level', { - enumerable: true, - get() { - return self.level; - }, - set(level) { - self.level = level; - } - }); - - Object.defineProperty(builder, 'enabled', { - enumerable: true, - get() { - return self.enabled; - }, - set(enabled) { - self.enabled = enabled; - } - }); - - // See below for fix regarding invisible grey/dim combination on Windows - builder.hasGrey = this.hasGrey || key === 'gray' || key === 'grey'; - - // `__proto__` is used because we must return a function, but there is - // no way to create a function with a different prototype - builder.__proto__ = proto; // eslint-disable-line no-proto - - return builder; -} - -function applyStyle() { - // Support varags, but simply cast to string in case there's only one arg - const args = arguments; - const argsLen = args.length; - let str = String(arguments[0]); - - if (argsLen === 0) { - return ''; - } - - if (argsLen > 1) { - // Don't slice `arguments`, it prevents V8 optimizations - for (let a = 1; a < argsLen; a++) { - str += ' ' + args[a]; - } - } - - if (!this.enabled || this.level <= 0 || !str) { - return this._empty ? '' : str; - } - - // Turns out that on Windows dimmed gray text becomes invisible in cmd.exe, - // see https://github.com/chalk/chalk/issues/58 - // If we're on Windows and we're dealing with a gray color, temporarily make 'dim' a noop. - const originalDim = ansiStyles.dim.open; - if (isSimpleWindowsTerm && this.hasGrey) { - ansiStyles.dim.open = ''; - } - - for (const code of this._styles.slice().reverse()) { - // Replace any instances already present with a re-opening code - // otherwise only the part of the string until said closing code - // will be colored, and the rest will simply be 'plain'. - str = code.open + str.replace(code.closeRe, code.open) + code.close; - - // Close the styling before a linebreak and reopen - // after next line to fix a bleed issue on macOS - // https://github.com/chalk/chalk/pull/92 - str = str.replace(/\r?\n/g, `${code.close}$&${code.open}`); - } - - // Reset the original `dim` if we changed it to work around the Windows dimmed gray issue - ansiStyles.dim.open = originalDim; - - return str; -} - -function chalkTag(chalk, strings) { - if (!Array.isArray(strings)) { - // If chalk() was called by itself or with a string, - // return the string itself as a string. - return [].slice.call(arguments, 1).join(' '); - } - - const args = [].slice.call(arguments, 2); - const parts = [strings.raw[0]]; - - for (let i = 1; i < strings.length; i++) { - parts.push(String(args[i - 1]).replace(/[{}\\]/g, '\\$&')); - parts.push(String(strings.raw[i])); - } - - return template(chalk, parts.join('')); -} - -Object.defineProperties(Chalk.prototype, styles); - -module.exports = Chalk(); // eslint-disable-line new-cap -module.exports.supportsColor = stdoutColor; -module.exports.default = module.exports; // For TypeScript - - -/***/ }), -/* 31 */ -/***/ (function(module, exports) { - -var core = module.exports = { version: '2.5.7' }; -if (typeof __e == 'number') __e = core; // eslint-disable-line no-undef - - -/***/ }), -/* 32 */ -/***/ (function(module, exports, __webpack_require__) { - -// Copyright 2015 Joyent, Inc. - -var Buffer = __webpack_require__(15).Buffer; - -var algInfo = { - 'dsa': { - parts: ['p', 'q', 'g', 'y'], - sizePart: 'p' - }, - 'rsa': { - parts: ['e', 'n'], - sizePart: 'n' - }, - 'ecdsa': { - parts: ['curve', 'Q'], - sizePart: 'Q' - }, - 'ed25519': { - parts: ['A'], - sizePart: 'A' - } -}; -algInfo['curve25519'] = algInfo['ed25519']; - -var algPrivInfo = { - 'dsa': { - parts: ['p', 'q', 'g', 'y', 'x'] - }, - 'rsa': { - parts: ['n', 'e', 'd', 'iqmp', 'p', 'q'] - }, - 'ecdsa': { - parts: ['curve', 'Q', 'd'] - }, - 'ed25519': { - parts: ['A', 'k'] - } -}; -algPrivInfo['curve25519'] = algPrivInfo['ed25519']; - -var hashAlgs = { - 'md5': true, - 'sha1': true, - 'sha256': true, - 'sha384': true, - 'sha512': true -}; - -/* - * Taken from - * http://csrc.nist.gov/groups/ST/toolkit/documents/dss/NISTReCur.pdf - */ -var curves = { - 'nistp256': { - size: 256, - pkcs8oid: '1.2.840.10045.3.1.7', - p: Buffer.from(('00' + - 'ffffffff 00000001 00000000 00000000' + - '00000000 ffffffff ffffffff ffffffff'). - replace(/ /g, ''), 'hex'), - a: Buffer.from(('00' + - 'FFFFFFFF 00000001 00000000 00000000' + - '00000000 FFFFFFFF FFFFFFFF FFFFFFFC'). - replace(/ /g, ''), 'hex'), - b: Buffer.from(( - '5ac635d8 aa3a93e7 b3ebbd55 769886bc' + - '651d06b0 cc53b0f6 3bce3c3e 27d2604b'). - replace(/ /g, ''), 'hex'), - s: Buffer.from(('00' + - 'c49d3608 86e70493 6a6678e1 139d26b7' + - '819f7e90'). - replace(/ /g, ''), 'hex'), - n: Buffer.from(('00' + - 'ffffffff 00000000 ffffffff ffffffff' + - 'bce6faad a7179e84 f3b9cac2 fc632551'). - replace(/ /g, ''), 'hex'), - G: Buffer.from(('04' + - '6b17d1f2 e12c4247 f8bce6e5 63a440f2' + - '77037d81 2deb33a0 f4a13945 d898c296' + - '4fe342e2 fe1a7f9b 8ee7eb4a 7c0f9e16' + - '2bce3357 6b315ece cbb64068 37bf51f5'). - replace(/ /g, ''), 'hex') - }, - 'nistp384': { - size: 384, - pkcs8oid: '1.3.132.0.34', - p: Buffer.from(('00' + - 'ffffffff ffffffff ffffffff ffffffff' + - 'ffffffff ffffffff ffffffff fffffffe' + - 'ffffffff 00000000 00000000 ffffffff'). - replace(/ /g, ''), 'hex'), - a: Buffer.from(('00' + - 'FFFFFFFF FFFFFFFF FFFFFFFF FFFFFFFF' + - 'FFFFFFFF FFFFFFFF FFFFFFFF FFFFFFFE' + - 'FFFFFFFF 00000000 00000000 FFFFFFFC'). - replace(/ /g, ''), 'hex'), - b: Buffer.from(( - 'b3312fa7 e23ee7e4 988e056b e3f82d19' + - '181d9c6e fe814112 0314088f 5013875a' + - 'c656398d 8a2ed19d 2a85c8ed d3ec2aef'). - replace(/ /g, ''), 'hex'), - s: Buffer.from(('00' + - 'a335926a a319a27a 1d00896a 6773a482' + - '7acdac73'). - replace(/ /g, ''), 'hex'), - n: Buffer.from(('00' + - 'ffffffff ffffffff ffffffff ffffffff' + - 'ffffffff ffffffff c7634d81 f4372ddf' + - '581a0db2 48b0a77a ecec196a ccc52973'). - replace(/ /g, ''), 'hex'), - G: Buffer.from(('04' + - 'aa87ca22 be8b0537 8eb1c71e f320ad74' + - '6e1d3b62 8ba79b98 59f741e0 82542a38' + - '5502f25d bf55296c 3a545e38 72760ab7' + - '3617de4a 96262c6f 5d9e98bf 9292dc29' + - 'f8f41dbd 289a147c e9da3113 b5f0b8c0' + - '0a60b1ce 1d7e819d 7a431d7c 90ea0e5f'). - replace(/ /g, ''), 'hex') - }, - 'nistp521': { - size: 521, - pkcs8oid: '1.3.132.0.35', - p: Buffer.from(( - '01ffffff ffffffff ffffffff ffffffff' + - 'ffffffff ffffffff ffffffff ffffffff' + - 'ffffffff ffffffff ffffffff ffffffff' + - 'ffffffff ffffffff ffffffff ffffffff' + - 'ffff').replace(/ /g, ''), 'hex'), - a: Buffer.from(('01FF' + - 'FFFFFFFF FFFFFFFF FFFFFFFF FFFFFFFF' + - 'FFFFFFFF FFFFFFFF FFFFFFFF FFFFFFFF' + - 'FFFFFFFF FFFFFFFF FFFFFFFF FFFFFFFF' + - 'FFFFFFFF FFFFFFFF FFFFFFFF FFFFFFFC'). - replace(/ /g, ''), 'hex'), - b: Buffer.from(('51' + - '953eb961 8e1c9a1f 929a21a0 b68540ee' + - 'a2da725b 99b315f3 b8b48991 8ef109e1' + - '56193951 ec7e937b 1652c0bd 3bb1bf07' + - '3573df88 3d2c34f1 ef451fd4 6b503f00'). - replace(/ /g, ''), 'hex'), - s: Buffer.from(('00' + - 'd09e8800 291cb853 96cc6717 393284aa' + - 'a0da64ba').replace(/ /g, ''), 'hex'), - n: Buffer.from(('01ff' + - 'ffffffff ffffffff ffffffff ffffffff' + - 'ffffffff ffffffff ffffffff fffffffa' + - '51868783 bf2f966b 7fcc0148 f709a5d0' + - '3bb5c9b8 899c47ae bb6fb71e 91386409'). - replace(/ /g, ''), 'hex'), - G: Buffer.from(('04' + - '00c6 858e06b7 0404e9cd 9e3ecb66 2395b442' + - '9c648139 053fb521 f828af60 6b4d3dba' + - 'a14b5e77 efe75928 fe1dc127 a2ffa8de' + - '3348b3c1 856a429b f97e7e31 c2e5bd66' + - '0118 39296a78 9a3bc004 5c8a5fb4 2c7d1bd9' + - '98f54449 579b4468 17afbd17 273e662c' + - '97ee7299 5ef42640 c550b901 3fad0761' + - '353c7086 a272c240 88be9476 9fd16650'). - replace(/ /g, ''), 'hex') - } -}; - -module.exports = { - info: algInfo, - privInfo: algPrivInfo, - hashAlgs: hashAlgs, - curves: curves -}; - - -/***/ }), -/* 33 */ -/***/ (function(module, exports, __webpack_require__) { - -// Copyright 2017 Joyent, Inc. - -module.exports = PrivateKey; - -var assert = __webpack_require__(16); -var Buffer = __webpack_require__(15).Buffer; -var algs = __webpack_require__(32); -var crypto = __webpack_require__(11); -var Fingerprint = __webpack_require__(156); -var Signature = __webpack_require__(75); -var errs = __webpack_require__(74); -var util = __webpack_require__(3); -var utils = __webpack_require__(26); -var dhe = __webpack_require__(325); -var generateECDSA = dhe.generateECDSA; -var generateED25519 = dhe.generateED25519; -var edCompat; -var nacl; - -try { - edCompat = __webpack_require__(454); -} catch (e) { - /* Just continue through, and bail out if we try to use it. */ -} - -var Key = __webpack_require__(27); - -var InvalidAlgorithmError = errs.InvalidAlgorithmError; -var KeyParseError = errs.KeyParseError; -var KeyEncryptedError = errs.KeyEncryptedError; - -var formats = {}; -formats['auto'] = __webpack_require__(455); -formats['pem'] = __webpack_require__(86); -formats['pkcs1'] = __webpack_require__(327); -formats['pkcs8'] = __webpack_require__(157); -formats['rfc4253'] = __webpack_require__(103); -formats['ssh-private'] = __webpack_require__(192); -formats['openssh'] = formats['ssh-private']; -formats['ssh'] = formats['ssh-private']; -formats['dnssec'] = __webpack_require__(326); - -function PrivateKey(opts) { - assert.object(opts, 'options'); - Key.call(this, opts); - - this._pubCache = undefined; -} -util.inherits(PrivateKey, Key); - -PrivateKey.formats = formats; - -PrivateKey.prototype.toBuffer = function (format, options) { - if (format === undefined) - format = 'pkcs1'; - assert.string(format, 'format'); - assert.object(formats[format], 'formats[format]'); - assert.optionalObject(options, 'options'); - - return (formats[format].write(this, options)); -}; - -PrivateKey.prototype.hash = function (algo) { - return (this.toPublic().hash(algo)); -}; - -PrivateKey.prototype.toPublic = function () { - if (this._pubCache) - return (this._pubCache); - - var algInfo = algs.info[this.type]; - var pubParts = []; - for (var i = 0; i < algInfo.parts.length; ++i) { - var p = algInfo.parts[i]; - pubParts.push(this.part[p]); - } - - this._pubCache = new Key({ - type: this.type, - source: this, - parts: pubParts - }); - if (this.comment) - this._pubCache.comment = this.comment; - return (this._pubCache); -}; - -PrivateKey.prototype.derive = function (newType) { - assert.string(newType, 'type'); - var priv, pub, pair; - - if (this.type === 'ed25519' && newType === 'curve25519') { - if (nacl === undefined) - nacl = __webpack_require__(76); - - priv = this.part.k.data; - if (priv[0] === 0x00) - priv = priv.slice(1); - - pair = nacl.box.keyPair.fromSecretKey(new Uint8Array(priv)); - pub = Buffer.from(pair.publicKey); - - return (new PrivateKey({ - type: 'curve25519', - parts: [ - { name: 'A', data: utils.mpNormalize(pub) }, - { name: 'k', data: utils.mpNormalize(priv) } - ] - })); - } else if (this.type === 'curve25519' && newType === 'ed25519') { - if (nacl === undefined) - nacl = __webpack_require__(76); - - priv = this.part.k.data; - if (priv[0] === 0x00) - priv = priv.slice(1); - - pair = nacl.sign.keyPair.fromSeed(new Uint8Array(priv)); - pub = Buffer.from(pair.publicKey); - - return (new PrivateKey({ - type: 'ed25519', - parts: [ - { name: 'A', data: utils.mpNormalize(pub) }, - { name: 'k', data: utils.mpNormalize(priv) } - ] - })); - } - throw (new Error('Key derivation not supported from ' + this.type + - ' to ' + newType)); -}; - -PrivateKey.prototype.createVerify = function (hashAlgo) { - return (this.toPublic().createVerify(hashAlgo)); -}; - -PrivateKey.prototype.createSign = function (hashAlgo) { - if (hashAlgo === undefined) - hashAlgo = this.defaultHashAlgorithm(); - assert.string(hashAlgo, 'hash algorithm'); - - /* ED25519 is not supported by OpenSSL, use a javascript impl. */ - if (this.type === 'ed25519' && edCompat !== undefined) - return (new edCompat.Signer(this, hashAlgo)); - if (this.type === 'curve25519') - throw (new Error('Curve25519 keys are not suitable for ' + - 'signing or verification')); - - var v, nm, err; - try { - nm = hashAlgo.toUpperCase(); - v = crypto.createSign(nm); - } catch (e) { - err = e; - } - if (v === undefined || (err instanceof Error && - err.message.match(/Unknown message digest/))) { - nm = 'RSA-'; - nm += hashAlgo.toUpperCase(); - v = crypto.createSign(nm); - } - assert.ok(v, 'failed to create verifier'); - var oldSign = v.sign.bind(v); - var key = this.toBuffer('pkcs1'); - var type = this.type; - var curve = this.curve; - v.sign = function () { - var sig = oldSign(key); - if (typeof (sig) === 'string') - sig = Buffer.from(sig, 'binary'); - sig = Signature.parse(sig, type, 'asn1'); - sig.hashAlgorithm = hashAlgo; - sig.curve = curve; - return (sig); - }; - return (v); -}; - -PrivateKey.parse = function (data, format, options) { - if (typeof (data) !== 'string') - assert.buffer(data, 'data'); - if (format === undefined) - format = 'auto'; - assert.string(format, 'format'); - if (typeof (options) === 'string') - options = { filename: options }; - assert.optionalObject(options, 'options'); - if (options === undefined) - options = {}; - assert.optionalString(options.filename, 'options.filename'); - if (options.filename === undefined) - options.filename = '(unnamed)'; - - assert.object(formats[format], 'formats[format]'); - - try { - var k = formats[format].read(data, options); - assert.ok(k instanceof PrivateKey, 'key is not a private key'); - if (!k.comment) - k.comment = options.filename; - return (k); - } catch (e) { - if (e.name === 'KeyEncryptedError') - throw (e); - throw (new KeyParseError(options.filename, format, e)); - } -}; - -PrivateKey.isPrivateKey = function (obj, ver) { - return (utils.isCompatible(obj, PrivateKey, ver)); -}; - -PrivateKey.generate = function (type, options) { - if (options === undefined) - options = {}; - assert.object(options, 'options'); - - switch (type) { - case 'ecdsa': - if (options.curve === undefined) - options.curve = 'nistp256'; - assert.string(options.curve, 'options.curve'); - return (generateECDSA(options.curve)); - case 'ed25519': - return (generateED25519()); - default: - throw (new Error('Key generation not supported with key ' + - 'type "' + type + '"')); - } -}; - -/* - * API versions for PrivateKey: - * [1,0] -- initial ver - * [1,1] -- added auto, pkcs[18], openssh/ssh-private formats - * [1,2] -- added defaultHashAlgorithm - * [1,3] -- added derive, ed, createDH - * [1,4] -- first tagged version - * [1,5] -- changed ed25519 part names and format - */ -PrivateKey.prototype._sshpkApiVersion = [1, 5]; - -PrivateKey._oldVersionDetect = function (obj) { - assert.func(obj.toPublic); - assert.func(obj.createSign); - if (obj.derive) - return ([1, 3]); - if (obj.defaultHashAlgorithm) - return ([1, 2]); - if (obj.formats['auto']) - return ([1, 1]); - return ([1, 0]); -}; - - -/***/ }), -/* 34 */ -/***/ (function(module, exports, __webpack_require__) { - -"use strict"; - - -Object.defineProperty(exports, "__esModule", { - value: true -}); -exports.wrapLifecycle = exports.run = exports.install = exports.Install = undefined; - -var _extends2; - -function _load_extends() { - return _extends2 = _interopRequireDefault(__webpack_require__(21)); -} - -var _asyncToGenerator2; - -function _load_asyncToGenerator() { - return _asyncToGenerator2 = _interopRequireDefault(__webpack_require__(2)); -} - -let install = exports.install = (() => { - var _ref29 = (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* (config, reporter, flags, lockfile) { - yield wrapLifecycle(config, flags, (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* () { - const install = new Install(flags, config, reporter, lockfile); - yield install.init(); - })); - }); - - return function install(_x7, _x8, _x9, _x10) { - return _ref29.apply(this, arguments); - }; -})(); - -let run = exports.run = (() => { - var _ref31 = (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* (config, reporter, flags, args) { - let lockfile; - let error = 'installCommandRenamed'; - if (flags.lockfile === false) { - lockfile = new (_lockfile || _load_lockfile()).default(); - } else { - lockfile = yield (_lockfile || _load_lockfile()).default.fromDirectory(config.lockfileFolder, reporter); - } - - if (args.length) { - const exampleArgs = args.slice(); - - if (flags.saveDev) { - exampleArgs.push('--dev'); - } - if (flags.savePeer) { - exampleArgs.push('--peer'); - } - if (flags.saveOptional) { - exampleArgs.push('--optional'); - } - if (flags.saveExact) { - exampleArgs.push('--exact'); - } - if (flags.saveTilde) { - exampleArgs.push('--tilde'); - } - let command = 'add'; - if (flags.global) { - error = 'globalFlagRemoved'; - command = 'global add'; - } - throw new (_errors || _load_errors()).MessageError(reporter.lang(error, `yarn ${command} ${exampleArgs.join(' ')}`)); - } - - yield install(config, reporter, flags, lockfile); - }); - - return function run(_x11, _x12, _x13, _x14) { - return _ref31.apply(this, arguments); - }; -})(); - -let wrapLifecycle = exports.wrapLifecycle = (() => { - var _ref32 = (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* (config, flags, factory) { - yield config.executeLifecycleScript('preinstall'); - - yield factory(); - - // npm behaviour, seems kinda funky but yay compatibility - yield config.executeLifecycleScript('install'); - yield config.executeLifecycleScript('postinstall'); - - if (!config.production) { - if (!config.disablePrepublish) { - yield config.executeLifecycleScript('prepublish'); - } - yield config.executeLifecycleScript('prepare'); - } - }); - - return function wrapLifecycle(_x15, _x16, _x17) { - return _ref32.apply(this, arguments); - }; -})(); - -exports.hasWrapper = hasWrapper; -exports.setFlags = setFlags; - -var _objectPath; - -function _load_objectPath() { - return _objectPath = _interopRequireDefault(__webpack_require__(304)); -} - -var _hooks; - -function _load_hooks() { - return _hooks = __webpack_require__(374); -} - -var _index; - -function _load_index() { - return _index = _interopRequireDefault(__webpack_require__(220)); -} - -var _errors; - -function _load_errors() { - return _errors = __webpack_require__(6); -} - -var _integrityChecker; - -function _load_integrityChecker() { - return _integrityChecker = _interopRequireDefault(__webpack_require__(208)); -} - -var _lockfile; - -function _load_lockfile() { - return _lockfile = _interopRequireDefault(__webpack_require__(19)); -} - -var _lockfile2; - -function _load_lockfile2() { - return _lockfile2 = __webpack_require__(19); -} - -var _packageFetcher; - -function _load_packageFetcher() { - return _packageFetcher = _interopRequireWildcard(__webpack_require__(210)); -} - -var _packageInstallScripts; - -function _load_packageInstallScripts() { - return _packageInstallScripts = _interopRequireDefault(__webpack_require__(557)); -} - -var _packageCompatibility; - -function _load_packageCompatibility() { - return _packageCompatibility = _interopRequireWildcard(__webpack_require__(209)); -} - -var _packageResolver; - -function _load_packageResolver() { - return _packageResolver = _interopRequireDefault(__webpack_require__(366)); -} - -var _packageLinker; - -function _load_packageLinker() { - return _packageLinker = _interopRequireDefault(__webpack_require__(211)); -} - -var _index2; - -function _load_index2() { - return _index2 = __webpack_require__(57); -} - -var _index3; - -function _load_index3() { - return _index3 = __webpack_require__(78); -} - -var _autoclean; - -function _load_autoclean() { - return _autoclean = __webpack_require__(354); -} - -var _constants; - -function _load_constants() { - return _constants = _interopRequireWildcard(__webpack_require__(8)); -} - -var _normalizePattern; - -function _load_normalizePattern() { - return _normalizePattern = __webpack_require__(37); -} - -var _fs; - -function _load_fs() { - return _fs = _interopRequireWildcard(__webpack_require__(4)); -} - -var _map; - -function _load_map() { - return _map = _interopRequireDefault(__webpack_require__(29)); -} - -var _yarnVersion; - -function _load_yarnVersion() { - return _yarnVersion = __webpack_require__(120); -} - -var _generatePnpMap; - -function _load_generatePnpMap() { - return _generatePnpMap = __webpack_require__(579); -} - -var _workspaceLayout; - -function _load_workspaceLayout() { - return _workspaceLayout = _interopRequireDefault(__webpack_require__(90)); -} - -var _resolutionMap; - -function _load_resolutionMap() { - return _resolutionMap = _interopRequireDefault(__webpack_require__(214)); -} - -var _guessName; - -function _load_guessName() { - return _guessName = _interopRequireDefault(__webpack_require__(169)); -} - -var _audit; - -function _load_audit() { - return _audit = _interopRequireDefault(__webpack_require__(353)); -} - -function _interopRequireWildcard(obj) { if (obj && obj.__esModule) { return obj; } else { var newObj = {}; if (obj != null) { for (var key in obj) { if (Object.prototype.hasOwnProperty.call(obj, key)) newObj[key] = obj[key]; } } newObj.default = obj; return newObj; } } - -function _interopRequireDefault(obj) { return obj && obj.__esModule ? obj : { default: obj }; } - -const deepEqual = __webpack_require__(631); - -const emoji = __webpack_require__(302); -const invariant = __webpack_require__(9); -const path = __webpack_require__(0); -const semver = __webpack_require__(22); -const uuid = __webpack_require__(119); -const ssri = __webpack_require__(65); - -const ONE_DAY = 1000 * 60 * 60 * 24; - -/** - * Try and detect the installation method for Yarn and provide a command to update it with. - */ - -function getUpdateCommand(installationMethod) { - if (installationMethod === 'tar') { - return `curl --compressed -o- -L ${(_constants || _load_constants()).YARN_INSTALLER_SH} | bash`; - } - - if (installationMethod === 'homebrew') { - return 'brew upgrade yarn'; - } - - if (installationMethod === 'deb') { - return 'sudo apt-get update && sudo apt-get install yarn'; - } - - if (installationMethod === 'rpm') { - return 'sudo yum install yarn'; - } - - if (installationMethod === 'npm') { - return 'npm install --global yarn'; - } - - if (installationMethod === 'chocolatey') { - return 'choco upgrade yarn'; - } - - if (installationMethod === 'apk') { - return 'apk update && apk add -u yarn'; - } - - if (installationMethod === 'portage') { - return 'sudo emerge --sync && sudo emerge -au sys-apps/yarn'; - } - - return null; -} - -function getUpdateInstaller(installationMethod) { - // Windows - if (installationMethod === 'msi') { - return (_constants || _load_constants()).YARN_INSTALLER_MSI; - } - - return null; -} - -function normalizeFlags(config, rawFlags) { - const flags = { - // install - har: !!rawFlags.har, - ignorePlatform: !!rawFlags.ignorePlatform, - ignoreEngines: !!rawFlags.ignoreEngines, - ignoreScripts: !!rawFlags.ignoreScripts, - ignoreOptional: !!rawFlags.ignoreOptional, - force: !!rawFlags.force, - flat: !!rawFlags.flat, - lockfile: rawFlags.lockfile !== false, - pureLockfile: !!rawFlags.pureLockfile, - updateChecksums: !!rawFlags.updateChecksums, - skipIntegrityCheck: !!rawFlags.skipIntegrityCheck, - frozenLockfile: !!rawFlags.frozenLockfile, - linkDuplicates: !!rawFlags.linkDuplicates, - checkFiles: !!rawFlags.checkFiles, - audit: !!rawFlags.audit, - - // add - peer: !!rawFlags.peer, - dev: !!rawFlags.dev, - optional: !!rawFlags.optional, - exact: !!rawFlags.exact, - tilde: !!rawFlags.tilde, - ignoreWorkspaceRootCheck: !!rawFlags.ignoreWorkspaceRootCheck, - - // outdated, update-interactive - includeWorkspaceDeps: !!rawFlags.includeWorkspaceDeps, - - // add, remove, update - workspaceRootIsCwd: rawFlags.workspaceRootIsCwd !== false - }; - - if (config.getOption('ignore-scripts')) { - flags.ignoreScripts = true; - } - - if (config.getOption('ignore-platform')) { - flags.ignorePlatform = true; - } - - if (config.getOption('ignore-engines')) { - flags.ignoreEngines = true; - } - - if (config.getOption('ignore-optional')) { - flags.ignoreOptional = true; - } - - if (config.getOption('force')) { - flags.force = true; - } - - return flags; -} - -class Install { - constructor(flags, config, reporter, lockfile) { - this.rootManifestRegistries = []; - this.rootPatternsToOrigin = (0, (_map || _load_map()).default)(); - this.lockfile = lockfile; - this.reporter = reporter; - this.config = config; - this.flags = normalizeFlags(config, flags); - this.resolutions = (0, (_map || _load_map()).default)(); // Legacy resolutions field used for flat install mode - this.resolutionMap = new (_resolutionMap || _load_resolutionMap()).default(config); // Selective resolutions for nested dependencies - this.resolver = new (_packageResolver || _load_packageResolver()).default(config, lockfile, this.resolutionMap); - this.integrityChecker = new (_integrityChecker || _load_integrityChecker()).default(config); - this.linker = new (_packageLinker || _load_packageLinker()).default(config, this.resolver); - this.scripts = new (_packageInstallScripts || _load_packageInstallScripts()).default(config, this.resolver, this.flags.force); - } - - /** - * Create a list of dependency requests from the current directories manifests. - */ - - fetchRequestFromCwd(excludePatterns = [], ignoreUnusedPatterns = false) { - var _this = this; - - return (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* () { - const patterns = []; - const deps = []; - let resolutionDeps = []; - const manifest = {}; - - const ignorePatterns = []; - const usedPatterns = []; - let workspaceLayout; - - // some commands should always run in the context of the entire workspace - const cwd = _this.flags.includeWorkspaceDeps || _this.flags.workspaceRootIsCwd ? _this.config.lockfileFolder : _this.config.cwd; - - // non-workspaces are always root, otherwise check for workspace root - const cwdIsRoot = !_this.config.workspaceRootFolder || _this.config.lockfileFolder === cwd; - - // exclude package names that are in install args - const excludeNames = []; - for (var _iterator = excludePatterns, _isArray = Array.isArray(_iterator), _i = 0, _iterator = _isArray ? _iterator : _iterator[Symbol.iterator]();;) { - var _ref; - - if (_isArray) { - if (_i >= _iterator.length) break; - _ref = _iterator[_i++]; - } else { - _i = _iterator.next(); - if (_i.done) break; - _ref = _i.value; - } - - const pattern = _ref; - - if ((0, (_index3 || _load_index3()).getExoticResolver)(pattern)) { - excludeNames.push((0, (_guessName || _load_guessName()).default)(pattern)); - } else { - // extract the name - const parts = (0, (_normalizePattern || _load_normalizePattern()).normalizePattern)(pattern); - excludeNames.push(parts.name); - } - } - - const stripExcluded = function stripExcluded(manifest) { - for (var _iterator2 = excludeNames, _isArray2 = Array.isArray(_iterator2), _i2 = 0, _iterator2 = _isArray2 ? _iterator2 : _iterator2[Symbol.iterator]();;) { - var _ref2; - - if (_isArray2) { - if (_i2 >= _iterator2.length) break; - _ref2 = _iterator2[_i2++]; - } else { - _i2 = _iterator2.next(); - if (_i2.done) break; - _ref2 = _i2.value; - } - - const exclude = _ref2; - - if (manifest.dependencies && manifest.dependencies[exclude]) { - delete manifest.dependencies[exclude]; - } - if (manifest.devDependencies && manifest.devDependencies[exclude]) { - delete manifest.devDependencies[exclude]; - } - if (manifest.optionalDependencies && manifest.optionalDependencies[exclude]) { - delete manifest.optionalDependencies[exclude]; - } - } - }; - - for (var _iterator3 = Object.keys((_index2 || _load_index2()).registries), _isArray3 = Array.isArray(_iterator3), _i3 = 0, _iterator3 = _isArray3 ? _iterator3 : _iterator3[Symbol.iterator]();;) { - var _ref3; - - if (_isArray3) { - if (_i3 >= _iterator3.length) break; - _ref3 = _iterator3[_i3++]; - } else { - _i3 = _iterator3.next(); - if (_i3.done) break; - _ref3 = _i3.value; - } - - const registry = _ref3; - - const filename = (_index2 || _load_index2()).registries[registry].filename; - - const loc = path.join(cwd, filename); - if (!(yield (_fs || _load_fs()).exists(loc))) { - continue; - } - - _this.rootManifestRegistries.push(registry); - - const projectManifestJson = yield _this.config.readJson(loc); - yield (0, (_index || _load_index()).default)(projectManifestJson, cwd, _this.config, cwdIsRoot); - - Object.assign(_this.resolutions, projectManifestJson.resolutions); - Object.assign(manifest, projectManifestJson); - - _this.resolutionMap.init(_this.resolutions); - for (var _iterator4 = Object.keys(_this.resolutionMap.resolutionsByPackage), _isArray4 = Array.isArray(_iterator4), _i4 = 0, _iterator4 = _isArray4 ? _iterator4 : _iterator4[Symbol.iterator]();;) { - var _ref4; - - if (_isArray4) { - if (_i4 >= _iterator4.length) break; - _ref4 = _iterator4[_i4++]; - } else { - _i4 = _iterator4.next(); - if (_i4.done) break; - _ref4 = _i4.value; - } - - const packageName = _ref4; - - const optional = (_objectPath || _load_objectPath()).default.has(manifest.optionalDependencies, packageName) && _this.flags.ignoreOptional; - for (var _iterator8 = _this.resolutionMap.resolutionsByPackage[packageName], _isArray8 = Array.isArray(_iterator8), _i8 = 0, _iterator8 = _isArray8 ? _iterator8 : _iterator8[Symbol.iterator]();;) { - var _ref9; - - if (_isArray8) { - if (_i8 >= _iterator8.length) break; - _ref9 = _iterator8[_i8++]; - } else { - _i8 = _iterator8.next(); - if (_i8.done) break; - _ref9 = _i8.value; - } - - const _ref8 = _ref9; - const pattern = _ref8.pattern; - - resolutionDeps = [...resolutionDeps, { registry, pattern, optional, hint: 'resolution' }]; - } - } - - const pushDeps = function pushDeps(depType, manifest, { hint, optional }, isUsed) { - if (ignoreUnusedPatterns && !isUsed) { - return; - } - // We only take unused dependencies into consideration to get deterministic hoisting. - // Since flat mode doesn't care about hoisting and everything is top level and specified then we can safely - // leave these out. - if (_this.flags.flat && !isUsed) { - return; - } - const depMap = manifest[depType]; - for (const name in depMap) { - if (excludeNames.indexOf(name) >= 0) { - continue; - } - - let pattern = name; - if (!_this.lockfile.getLocked(pattern)) { - // when we use --save we save the dependency to the lockfile with just the name rather than the - // version combo - pattern += '@' + depMap[name]; - } - - // normalization made sure packages are mentioned only once - if (isUsed) { - usedPatterns.push(pattern); - } else { - ignorePatterns.push(pattern); - } - - _this.rootPatternsToOrigin[pattern] = depType; - patterns.push(pattern); - deps.push({ pattern, registry, hint, optional, workspaceName: manifest.name, workspaceLoc: manifest._loc }); - } - }; - - if (cwdIsRoot) { - pushDeps('dependencies', projectManifestJson, { hint: null, optional: false }, true); - pushDeps('devDependencies', projectManifestJson, { hint: 'dev', optional: false }, !_this.config.production); - pushDeps('optionalDependencies', projectManifestJson, { hint: 'optional', optional: true }, true); - } - - if (_this.config.workspaceRootFolder) { - const workspaceLoc = cwdIsRoot ? loc : path.join(_this.config.lockfileFolder, filename); - const workspacesRoot = path.dirname(workspaceLoc); - - let workspaceManifestJson = projectManifestJson; - if (!cwdIsRoot) { - // the manifest we read before was a child workspace, so get the root - workspaceManifestJson = yield _this.config.readJson(workspaceLoc); - yield (0, (_index || _load_index()).default)(workspaceManifestJson, workspacesRoot, _this.config, true); - } - - const workspaces = yield _this.config.resolveWorkspaces(workspacesRoot, workspaceManifestJson); - workspaceLayout = new (_workspaceLayout || _load_workspaceLayout()).default(workspaces, _this.config); - - // add virtual manifest that depends on all workspaces, this way package hoisters and resolvers will work fine - const workspaceDependencies = (0, (_extends2 || _load_extends()).default)({}, workspaceManifestJson.dependencies); - for (var _iterator5 = Object.keys(workspaces), _isArray5 = Array.isArray(_iterator5), _i5 = 0, _iterator5 = _isArray5 ? _iterator5 : _iterator5[Symbol.iterator]();;) { - var _ref5; - - if (_isArray5) { - if (_i5 >= _iterator5.length) break; - _ref5 = _iterator5[_i5++]; - } else { - _i5 = _iterator5.next(); - if (_i5.done) break; - _ref5 = _i5.value; - } - - const workspaceName = _ref5; - - const workspaceManifest = workspaces[workspaceName].manifest; - workspaceDependencies[workspaceName] = workspaceManifest.version; - - // include dependencies from all workspaces - if (_this.flags.includeWorkspaceDeps) { - pushDeps('dependencies', workspaceManifest, { hint: null, optional: false }, true); - pushDeps('devDependencies', workspaceManifest, { hint: 'dev', optional: false }, !_this.config.production); - pushDeps('optionalDependencies', workspaceManifest, { hint: 'optional', optional: true }, true); - } - } - const virtualDependencyManifest = { - _uid: '', - name: `workspace-aggregator-${uuid.v4()}`, - version: '1.0.0', - _registry: 'npm', - _loc: workspacesRoot, - dependencies: workspaceDependencies, - devDependencies: (0, (_extends2 || _load_extends()).default)({}, workspaceManifestJson.devDependencies), - optionalDependencies: (0, (_extends2 || _load_extends()).default)({}, workspaceManifestJson.optionalDependencies), - private: workspaceManifestJson.private, - workspaces: workspaceManifestJson.workspaces - }; - workspaceLayout.virtualManifestName = virtualDependencyManifest.name; - const virtualDep = {}; - virtualDep[virtualDependencyManifest.name] = virtualDependencyManifest.version; - workspaces[virtualDependencyManifest.name] = { loc: workspacesRoot, manifest: virtualDependencyManifest }; - - // ensure dependencies that should be excluded are stripped from the correct manifest - stripExcluded(cwdIsRoot ? virtualDependencyManifest : workspaces[projectManifestJson.name].manifest); - - pushDeps('workspaces', { workspaces: virtualDep }, { hint: 'workspaces', optional: false }, true); - - const implicitWorkspaceDependencies = (0, (_extends2 || _load_extends()).default)({}, workspaceDependencies); - - for (var _iterator6 = (_constants || _load_constants()).OWNED_DEPENDENCY_TYPES, _isArray6 = Array.isArray(_iterator6), _i6 = 0, _iterator6 = _isArray6 ? _iterator6 : _iterator6[Symbol.iterator]();;) { - var _ref6; - - if (_isArray6) { - if (_i6 >= _iterator6.length) break; - _ref6 = _iterator6[_i6++]; - } else { - _i6 = _iterator6.next(); - if (_i6.done) break; - _ref6 = _i6.value; - } - - const type = _ref6; - - for (var _iterator7 = Object.keys(projectManifestJson[type] || {}), _isArray7 = Array.isArray(_iterator7), _i7 = 0, _iterator7 = _isArray7 ? _iterator7 : _iterator7[Symbol.iterator]();;) { - var _ref7; - - if (_isArray7) { - if (_i7 >= _iterator7.length) break; - _ref7 = _iterator7[_i7++]; - } else { - _i7 = _iterator7.next(); - if (_i7.done) break; - _ref7 = _i7.value; - } - - const dependencyName = _ref7; - - delete implicitWorkspaceDependencies[dependencyName]; - } - } - - pushDeps('dependencies', { dependencies: implicitWorkspaceDependencies }, { hint: 'workspaces', optional: false }, true); - } - - break; - } - - // inherit root flat flag - if (manifest.flat) { - _this.flags.flat = true; - } - - return { - requests: [...resolutionDeps, ...deps], - patterns, - manifest, - usedPatterns, - ignorePatterns, - workspaceLayout - }; - })(); - } - - /** - * TODO description - */ - - prepareRequests(requests) { - return requests; - } - - preparePatterns(patterns) { - return patterns; - } - preparePatternsForLinking(patterns, cwdManifest, cwdIsRoot) { - return patterns; - } - - prepareManifests() { - var _this2 = this; - - return (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* () { - const manifests = yield _this2.config.getRootManifests(); - return manifests; - })(); - } - - bailout(patterns, workspaceLayout) { - var _this3 = this; - - return (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* () { - // We don't want to skip the audit - it could yield important errors - if (_this3.flags.audit) { - return false; - } - // PNP is so fast that the integrity check isn't pertinent - if (_this3.config.plugnplayEnabled) { - return false; - } - if (_this3.flags.skipIntegrityCheck || _this3.flags.force) { - return false; - } - const lockfileCache = _this3.lockfile.cache; - if (!lockfileCache) { - return false; - } - const lockfileClean = _this3.lockfile.parseResultType === 'success'; - const match = yield _this3.integrityChecker.check(patterns, lockfileCache, _this3.flags, workspaceLayout); - if (_this3.flags.frozenLockfile && (!lockfileClean || match.missingPatterns.length > 0)) { - throw new (_errors || _load_errors()).MessageError(_this3.reporter.lang('frozenLockfileError')); - } - - const haveLockfile = yield (_fs || _load_fs()).exists(path.join(_this3.config.lockfileFolder, (_constants || _load_constants()).LOCKFILE_FILENAME)); - - const lockfileIntegrityPresent = !_this3.lockfile.hasEntriesExistWithoutIntegrity(); - const integrityBailout = lockfileIntegrityPresent || !_this3.config.autoAddIntegrity; - - if (match.integrityMatches && haveLockfile && lockfileClean && integrityBailout) { - _this3.reporter.success(_this3.reporter.lang('upToDate')); - return true; - } - - if (match.integrityFileMissing && haveLockfile) { - // Integrity file missing, force script installations - _this3.scripts.setForce(true); - return false; - } - - if (match.hardRefreshRequired) { - // e.g. node version doesn't match, force script installations - _this3.scripts.setForce(true); - return false; - } - - if (!patterns.length && !match.integrityFileMissing) { - _this3.reporter.success(_this3.reporter.lang('nothingToInstall')); - yield _this3.createEmptyManifestFolders(); - yield _this3.saveLockfileAndIntegrity(patterns, workspaceLayout); - return true; - } - - return false; - })(); - } - - /** - * Produce empty folders for all used root manifests. - */ - - createEmptyManifestFolders() { - var _this4 = this; - - return (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* () { - if (_this4.config.modulesFolder) { - // already created - return; - } - - for (var _iterator9 = _this4.rootManifestRegistries, _isArray9 = Array.isArray(_iterator9), _i9 = 0, _iterator9 = _isArray9 ? _iterator9 : _iterator9[Symbol.iterator]();;) { - var _ref10; - - if (_isArray9) { - if (_i9 >= _iterator9.length) break; - _ref10 = _iterator9[_i9++]; - } else { - _i9 = _iterator9.next(); - if (_i9.done) break; - _ref10 = _i9.value; - } - - const registryName = _ref10; - const folder = _this4.config.registries[registryName].folder; - - yield (_fs || _load_fs()).mkdirp(path.join(_this4.config.lockfileFolder, folder)); - } - })(); - } - - /** - * TODO description - */ - - markIgnored(patterns) { - for (var _iterator10 = patterns, _isArray10 = Array.isArray(_iterator10), _i10 = 0, _iterator10 = _isArray10 ? _iterator10 : _iterator10[Symbol.iterator]();;) { - var _ref11; - - if (_isArray10) { - if (_i10 >= _iterator10.length) break; - _ref11 = _iterator10[_i10++]; - } else { - _i10 = _iterator10.next(); - if (_i10.done) break; - _ref11 = _i10.value; - } - - const pattern = _ref11; - - const manifest = this.resolver.getStrictResolvedPattern(pattern); - const ref = manifest._reference; - invariant(ref, 'expected package reference'); - - // just mark the package as ignored. if the package is used by a required package, the hoister - // will take care of that. - ref.ignore = true; - } - } - - /** - * helper method that gets only recent manifests - * used by global.ls command - */ - getFlattenedDeps() { - var _this5 = this; - - return (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* () { - var _ref12 = yield _this5.fetchRequestFromCwd(); - - const depRequests = _ref12.requests, - rawPatterns = _ref12.patterns; - - - yield _this5.resolver.init(depRequests, {}); - - const manifests = yield (_packageFetcher || _load_packageFetcher()).fetch(_this5.resolver.getManifests(), _this5.config); - _this5.resolver.updateManifests(manifests); - - return _this5.flatten(rawPatterns); - })(); - } - - /** - * TODO description - */ - - init() { - var _this6 = this; - - return (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* () { - _this6.checkUpdate(); - - // warn if we have a shrinkwrap - if (yield (_fs || _load_fs()).exists(path.join(_this6.config.lockfileFolder, (_constants || _load_constants()).NPM_SHRINKWRAP_FILENAME))) { - _this6.reporter.warn(_this6.reporter.lang('shrinkwrapWarning')); - } - - // warn if we have an npm lockfile - if (yield (_fs || _load_fs()).exists(path.join(_this6.config.lockfileFolder, (_constants || _load_constants()).NPM_LOCK_FILENAME))) { - _this6.reporter.warn(_this6.reporter.lang('npmLockfileWarning')); - } - - if (_this6.config.plugnplayEnabled) { - _this6.reporter.info(_this6.reporter.lang('plugnplaySuggestV2L1')); - _this6.reporter.info(_this6.reporter.lang('plugnplaySuggestV2L2')); - } - - let flattenedTopLevelPatterns = []; - const steps = []; - - var _ref13 = yield _this6.fetchRequestFromCwd(); - - const depRequests = _ref13.requests, - rawPatterns = _ref13.patterns, - ignorePatterns = _ref13.ignorePatterns, - workspaceLayout = _ref13.workspaceLayout, - manifest = _ref13.manifest; - - let topLevelPatterns = []; - - const artifacts = yield _this6.integrityChecker.getArtifacts(); - if (artifacts) { - _this6.linker.setArtifacts(artifacts); - _this6.scripts.setArtifacts(artifacts); - } - - if ((_packageCompatibility || _load_packageCompatibility()).shouldCheck(manifest, _this6.flags)) { - steps.push((() => { - var _ref14 = (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* (curr, total) { - _this6.reporter.step(curr, total, _this6.reporter.lang('checkingManifest'), emoji.get('mag')); - yield _this6.checkCompatibility(); - }); - - return function (_x, _x2) { - return _ref14.apply(this, arguments); - }; - })()); - } - - const audit = new (_audit || _load_audit()).default(_this6.config, _this6.reporter, { groups: (_constants || _load_constants()).OWNED_DEPENDENCY_TYPES }); - let auditFoundProblems = false; - - steps.push(function (curr, total) { - return (0, (_hooks || _load_hooks()).callThroughHook)('resolveStep', (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* () { - _this6.reporter.step(curr, total, _this6.reporter.lang('resolvingPackages'), emoji.get('mag')); - yield _this6.resolver.init(_this6.prepareRequests(depRequests), { - isFlat: _this6.flags.flat, - isFrozen: _this6.flags.frozenLockfile, - workspaceLayout - }); - topLevelPatterns = _this6.preparePatterns(rawPatterns); - flattenedTopLevelPatterns = yield _this6.flatten(topLevelPatterns); - return { bailout: !_this6.flags.audit && (yield _this6.bailout(topLevelPatterns, workspaceLayout)) }; - })); - }); - - if (_this6.flags.audit) { - steps.push(function (curr, total) { - return (0, (_hooks || _load_hooks()).callThroughHook)('auditStep', (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* () { - _this6.reporter.step(curr, total, _this6.reporter.lang('auditRunning'), emoji.get('mag')); - if (_this6.flags.offline) { - _this6.reporter.warn(_this6.reporter.lang('auditOffline')); - return { bailout: false }; - } - const preparedManifests = yield _this6.prepareManifests(); - // $FlowFixMe - Flow considers `m` in the map operation to be "mixed", so does not recognize `m.object` - const mergedManifest = Object.assign({}, ...Object.values(preparedManifests).map(function (m) { - return m.object; - })); - const auditVulnerabilityCounts = yield audit.performAudit(mergedManifest, _this6.lockfile, _this6.resolver, _this6.linker, topLevelPatterns); - auditFoundProblems = auditVulnerabilityCounts.info || auditVulnerabilityCounts.low || auditVulnerabilityCounts.moderate || auditVulnerabilityCounts.high || auditVulnerabilityCounts.critical; - return { bailout: yield _this6.bailout(topLevelPatterns, workspaceLayout) }; - })); - }); - } - - steps.push(function (curr, total) { - return (0, (_hooks || _load_hooks()).callThroughHook)('fetchStep', (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* () { - _this6.markIgnored(ignorePatterns); - _this6.reporter.step(curr, total, _this6.reporter.lang('fetchingPackages'), emoji.get('truck')); - const manifests = yield (_packageFetcher || _load_packageFetcher()).fetch(_this6.resolver.getManifests(), _this6.config); - _this6.resolver.updateManifests(manifests); - yield (_packageCompatibility || _load_packageCompatibility()).check(_this6.resolver.getManifests(), _this6.config, _this6.flags.ignoreEngines); - })); - }); - - steps.push(function (curr, total) { - return (0, (_hooks || _load_hooks()).callThroughHook)('linkStep', (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* () { - // remove integrity hash to make this operation atomic - yield _this6.integrityChecker.removeIntegrityFile(); - _this6.reporter.step(curr, total, _this6.reporter.lang('linkingDependencies'), emoji.get('link')); - flattenedTopLevelPatterns = _this6.preparePatternsForLinking(flattenedTopLevelPatterns, manifest, _this6.config.lockfileFolder === _this6.config.cwd); - yield _this6.linker.init(flattenedTopLevelPatterns, workspaceLayout, { - linkDuplicates: _this6.flags.linkDuplicates, - ignoreOptional: _this6.flags.ignoreOptional - }); - })); - }); - - if (_this6.config.plugnplayEnabled) { - steps.push(function (curr, total) { - return (0, (_hooks || _load_hooks()).callThroughHook)('pnpStep', (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* () { - const pnpPath = `${_this6.config.lockfileFolder}/${(_constants || _load_constants()).PNP_FILENAME}`; - - const code = yield (0, (_generatePnpMap || _load_generatePnpMap()).generatePnpMap)(_this6.config, flattenedTopLevelPatterns, { - resolver: _this6.resolver, - reporter: _this6.reporter, - targetPath: pnpPath, - workspaceLayout - }); - - try { - const file = yield (_fs || _load_fs()).readFile(pnpPath); - if (file === code) { - return; - } - } catch (error) {} - - yield (_fs || _load_fs()).writeFile(pnpPath, code); - yield (_fs || _load_fs()).chmod(pnpPath, 0o755); - })); - }); - } - - steps.push(function (curr, total) { - return (0, (_hooks || _load_hooks()).callThroughHook)('buildStep', (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* () { - _this6.reporter.step(curr, total, _this6.flags.force ? _this6.reporter.lang('rebuildingPackages') : _this6.reporter.lang('buildingFreshPackages'), emoji.get('hammer')); - - if (_this6.config.ignoreScripts) { - _this6.reporter.warn(_this6.reporter.lang('ignoredScripts')); - } else { - yield _this6.scripts.init(flattenedTopLevelPatterns); - } - })); - }); - - if (_this6.flags.har) { - steps.push((() => { - var _ref21 = (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* (curr, total) { - const formattedDate = new Date().toISOString().replace(/:/g, '-'); - const filename = `yarn-install_${formattedDate}.har`; - _this6.reporter.step(curr, total, _this6.reporter.lang('savingHar', filename), emoji.get('black_circle_for_record')); - yield _this6.config.requestManager.saveHar(filename); - }); - - return function (_x3, _x4) { - return _ref21.apply(this, arguments); - }; - })()); - } - - if (yield _this6.shouldClean()) { - steps.push((() => { - var _ref22 = (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* (curr, total) { - _this6.reporter.step(curr, total, _this6.reporter.lang('cleaningModules'), emoji.get('recycle')); - yield (0, (_autoclean || _load_autoclean()).clean)(_this6.config, _this6.reporter); - }); - - return function (_x5, _x6) { - return _ref22.apply(this, arguments); - }; - })()); - } - - let currentStep = 0; - for (var _iterator11 = steps, _isArray11 = Array.isArray(_iterator11), _i11 = 0, _iterator11 = _isArray11 ? _iterator11 : _iterator11[Symbol.iterator]();;) { - var _ref23; - - if (_isArray11) { - if (_i11 >= _iterator11.length) break; - _ref23 = _iterator11[_i11++]; - } else { - _i11 = _iterator11.next(); - if (_i11.done) break; - _ref23 = _i11.value; - } - - const step = _ref23; - - const stepResult = yield step(++currentStep, steps.length); - if (stepResult && stepResult.bailout) { - if (_this6.flags.audit) { - audit.summary(); - } - if (auditFoundProblems) { - _this6.reporter.warn(_this6.reporter.lang('auditRunAuditForDetails')); - } - _this6.maybeOutputUpdate(); - return flattenedTopLevelPatterns; - } - } - - // fin! - if (_this6.flags.audit) { - audit.summary(); - } - if (auditFoundProblems) { - _this6.reporter.warn(_this6.reporter.lang('auditRunAuditForDetails')); - } - yield _this6.saveLockfileAndIntegrity(topLevelPatterns, workspaceLayout); - yield _this6.persistChanges(); - _this6.maybeOutputUpdate(); - _this6.config.requestManager.clearCache(); - return flattenedTopLevelPatterns; - })(); - } - - checkCompatibility() { - var _this7 = this; - - return (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* () { - var _ref24 = yield _this7.fetchRequestFromCwd(); - - const manifest = _ref24.manifest; - - yield (_packageCompatibility || _load_packageCompatibility()).checkOne(manifest, _this7.config, _this7.flags.ignoreEngines); - })(); - } - - persistChanges() { - var _this8 = this; - - return (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* () { - // get all the different registry manifests in this folder - const manifests = yield _this8.config.getRootManifests(); - - if (yield _this8.applyChanges(manifests)) { - yield _this8.config.saveRootManifests(manifests); - } - })(); - } - - applyChanges(manifests) { - let hasChanged = false; - - if (this.config.plugnplayPersist) { - const object = manifests.npm.object; - - - if (typeof object.installConfig !== 'object') { - object.installConfig = {}; - } - - if (this.config.plugnplayEnabled && object.installConfig.pnp !== true) { - object.installConfig.pnp = true; - hasChanged = true; - } else if (!this.config.plugnplayEnabled && typeof object.installConfig.pnp !== 'undefined') { - delete object.installConfig.pnp; - hasChanged = true; - } - - if (Object.keys(object.installConfig).length === 0) { - delete object.installConfig; - } - } - - return Promise.resolve(hasChanged); - } - - /** - * Check if we should run the cleaning step. - */ - - shouldClean() { - return (_fs || _load_fs()).exists(path.join(this.config.lockfileFolder, (_constants || _load_constants()).CLEAN_FILENAME)); - } - - /** - * TODO - */ - - flatten(patterns) { - var _this9 = this; - - return (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* () { - if (!_this9.flags.flat) { - return patterns; - } - - const flattenedPatterns = []; - - for (var _iterator12 = _this9.resolver.getAllDependencyNamesByLevelOrder(patterns), _isArray12 = Array.isArray(_iterator12), _i12 = 0, _iterator12 = _isArray12 ? _iterator12 : _iterator12[Symbol.iterator]();;) { - var _ref25; - - if (_isArray12) { - if (_i12 >= _iterator12.length) break; - _ref25 = _iterator12[_i12++]; - } else { - _i12 = _iterator12.next(); - if (_i12.done) break; - _ref25 = _i12.value; - } - - const name = _ref25; - - const infos = _this9.resolver.getAllInfoForPackageName(name).filter(function (manifest) { - const ref = manifest._reference; - invariant(ref, 'expected package reference'); - return !ref.ignore; - }); - - if (infos.length === 0) { - continue; - } - - if (infos.length === 1) { - // single version of this package - // take out a single pattern as multiple patterns may have resolved to this package - flattenedPatterns.push(_this9.resolver.patternsByPackage[name][0]); - continue; - } - - const options = infos.map(function (info) { - const ref = info._reference; - invariant(ref, 'expected reference'); - return { - // TODO `and is required by {PARENT}`, - name: _this9.reporter.lang('manualVersionResolutionOption', ref.patterns.join(', '), info.version), - - value: info.version - }; - }); - const versions = infos.map(function (info) { - return info.version; - }); - let version; - - const resolutionVersion = _this9.resolutions[name]; - if (resolutionVersion && versions.indexOf(resolutionVersion) >= 0) { - // use json `resolution` version - version = resolutionVersion; - } else { - version = yield _this9.reporter.select(_this9.reporter.lang('manualVersionResolution', name), _this9.reporter.lang('answer'), options); - _this9.resolutions[name] = version; - } - - flattenedPatterns.push(_this9.resolver.collapseAllVersionsOfPackage(name, version)); - } - - // save resolutions to their appropriate root manifest - if (Object.keys(_this9.resolutions).length) { - const manifests = yield _this9.config.getRootManifests(); - - for (const name in _this9.resolutions) { - const version = _this9.resolutions[name]; - - const patterns = _this9.resolver.patternsByPackage[name]; - if (!patterns) { - continue; - } - - let manifest; - for (var _iterator13 = patterns, _isArray13 = Array.isArray(_iterator13), _i13 = 0, _iterator13 = _isArray13 ? _iterator13 : _iterator13[Symbol.iterator]();;) { - var _ref26; - - if (_isArray13) { - if (_i13 >= _iterator13.length) break; - _ref26 = _iterator13[_i13++]; - } else { - _i13 = _iterator13.next(); - if (_i13.done) break; - _ref26 = _i13.value; - } - - const pattern = _ref26; - - manifest = _this9.resolver.getResolvedPattern(pattern); - if (manifest) { - break; - } - } - invariant(manifest, 'expected manifest'); - - const ref = manifest._reference; - invariant(ref, 'expected reference'); - - const object = manifests[ref.registry].object; - object.resolutions = object.resolutions || {}; - object.resolutions[name] = version; - } - - yield _this9.config.saveRootManifests(manifests); - } - - return flattenedPatterns; - })(); - } - - /** - * Remove offline tarballs that are no longer required - */ - - pruneOfflineMirror(lockfile) { - var _this10 = this; - - return (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* () { - const mirror = _this10.config.getOfflineMirrorPath(); - if (!mirror) { - return; - } - - const requiredTarballs = new Set(); - for (const dependency in lockfile) { - const resolved = lockfile[dependency].resolved; - if (resolved) { - const basename = path.basename(resolved.split('#')[0]); - if (dependency[0] === '@' && basename[0] !== '@') { - requiredTarballs.add(`${dependency.split('/')[0]}-${basename}`); - } - requiredTarballs.add(basename); - } - } - - const mirrorFiles = yield (_fs || _load_fs()).walk(mirror); - for (var _iterator14 = mirrorFiles, _isArray14 = Array.isArray(_iterator14), _i14 = 0, _iterator14 = _isArray14 ? _iterator14 : _iterator14[Symbol.iterator]();;) { - var _ref27; - - if (_isArray14) { - if (_i14 >= _iterator14.length) break; - _ref27 = _iterator14[_i14++]; - } else { - _i14 = _iterator14.next(); - if (_i14.done) break; - _ref27 = _i14.value; - } - - const file = _ref27; - - const isTarball = path.extname(file.basename) === '.tgz'; - // if using experimental-pack-script-packages-in-mirror flag, don't unlink prebuilt packages - const hasPrebuiltPackage = file.relative.startsWith('prebuilt/'); - if (isTarball && !hasPrebuiltPackage && !requiredTarballs.has(file.basename)) { - yield (_fs || _load_fs()).unlink(file.absolute); - } - } - })(); - } - - /** - * Save updated integrity and lockfiles. - */ - - saveLockfileAndIntegrity(patterns, workspaceLayout) { - var _this11 = this; - - return (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* () { - const resolvedPatterns = {}; - Object.keys(_this11.resolver.patterns).forEach(function (pattern) { - if (!workspaceLayout || !workspaceLayout.getManifestByPattern(pattern)) { - resolvedPatterns[pattern] = _this11.resolver.patterns[pattern]; - } - }); - - // TODO this code is duplicated in a few places, need a common way to filter out workspace patterns from lockfile - patterns = patterns.filter(function (p) { - return !workspaceLayout || !workspaceLayout.getManifestByPattern(p); - }); - - const lockfileBasedOnResolver = _this11.lockfile.getLockfile(resolvedPatterns); - - if (_this11.config.pruneOfflineMirror) { - yield _this11.pruneOfflineMirror(lockfileBasedOnResolver); - } - - // write integrity hash - if (!_this11.config.plugnplayEnabled) { - yield _this11.integrityChecker.save(patterns, lockfileBasedOnResolver, _this11.flags, workspaceLayout, _this11.scripts.getArtifacts()); - } - - // --no-lockfile or --pure-lockfile or --frozen-lockfile - if (_this11.flags.lockfile === false || _this11.flags.pureLockfile || _this11.flags.frozenLockfile) { - return; - } - - const lockFileHasAllPatterns = patterns.every(function (p) { - return _this11.lockfile.getLocked(p); - }); - const lockfilePatternsMatch = Object.keys(_this11.lockfile.cache || {}).every(function (p) { - return lockfileBasedOnResolver[p]; - }); - const resolverPatternsAreSameAsInLockfile = Object.keys(lockfileBasedOnResolver).every(function (pattern) { - const manifest = _this11.lockfile.getLocked(pattern); - return manifest && manifest.resolved === lockfileBasedOnResolver[pattern].resolved && deepEqual(manifest.prebuiltVariants, lockfileBasedOnResolver[pattern].prebuiltVariants); - }); - const integrityPatternsAreSameAsInLockfile = Object.keys(lockfileBasedOnResolver).every(function (pattern) { - const existingIntegrityInfo = lockfileBasedOnResolver[pattern].integrity; - if (!existingIntegrityInfo) { - // if this entry does not have an integrity, no need to re-write the lockfile because of it - return true; - } - const manifest = _this11.lockfile.getLocked(pattern); - if (manifest && manifest.integrity) { - const manifestIntegrity = ssri.stringify(manifest.integrity); - return manifestIntegrity === existingIntegrityInfo; - } - return false; - }); - - // remove command is followed by install with force, lockfile will be rewritten in any case then - if (!_this11.flags.force && _this11.lockfile.parseResultType === 'success' && lockFileHasAllPatterns && lockfilePatternsMatch && resolverPatternsAreSameAsInLockfile && integrityPatternsAreSameAsInLockfile && patterns.length) { - return; - } - - // build lockfile location - const loc = path.join(_this11.config.lockfileFolder, (_constants || _load_constants()).LOCKFILE_FILENAME); - - // write lockfile - const lockSource = (0, (_lockfile2 || _load_lockfile2()).stringify)(lockfileBasedOnResolver, false, _this11.config.enableLockfileVersions); - yield (_fs || _load_fs()).writeFilePreservingEol(loc, lockSource); - - _this11._logSuccessSaveLockfile(); - })(); - } - - _logSuccessSaveLockfile() { - this.reporter.success(this.reporter.lang('savedLockfile')); - } - - /** - * Load the dependency graph of the current install. Only does package resolving and wont write to the cwd. - */ - hydrate(ignoreUnusedPatterns) { - var _this12 = this; - - return (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* () { - const request = yield _this12.fetchRequestFromCwd([], ignoreUnusedPatterns); - const depRequests = request.requests, - rawPatterns = request.patterns, - ignorePatterns = request.ignorePatterns, - workspaceLayout = request.workspaceLayout; - - - yield _this12.resolver.init(depRequests, { - isFlat: _this12.flags.flat, - isFrozen: _this12.flags.frozenLockfile, - workspaceLayout - }); - yield _this12.flatten(rawPatterns); - _this12.markIgnored(ignorePatterns); - - // fetch packages, should hit cache most of the time - const manifests = yield (_packageFetcher || _load_packageFetcher()).fetch(_this12.resolver.getManifests(), _this12.config); - _this12.resolver.updateManifests(manifests); - yield (_packageCompatibility || _load_packageCompatibility()).check(_this12.resolver.getManifests(), _this12.config, _this12.flags.ignoreEngines); - - // expand minimal manifests - for (var _iterator15 = _this12.resolver.getManifests(), _isArray15 = Array.isArray(_iterator15), _i15 = 0, _iterator15 = _isArray15 ? _iterator15 : _iterator15[Symbol.iterator]();;) { - var _ref28; - - if (_isArray15) { - if (_i15 >= _iterator15.length) break; - _ref28 = _iterator15[_i15++]; - } else { - _i15 = _iterator15.next(); - if (_i15.done) break; - _ref28 = _i15.value; - } - - const manifest = _ref28; - - const ref = manifest._reference; - invariant(ref, 'expected reference'); - const type = ref.remote.type; - // link specifier won't ever hit cache - - let loc = ''; - if (type === 'link') { - continue; - } else if (type === 'workspace') { - if (!ref.remote.reference) { - continue; - } - loc = ref.remote.reference; - } else { - loc = _this12.config.generateModuleCachePath(ref); - } - const newPkg = yield _this12.config.readManifest(loc); - yield _this12.resolver.updateManifest(ref, newPkg); - } - - return request; - })(); - } - - /** - * Check for updates every day and output a nag message if there's a newer version. - */ - - checkUpdate() { - if (this.config.nonInteractive) { - // don't show upgrade dialog on CI or non-TTY terminals - return; - } - - // don't check if disabled - if (this.config.getOption('disable-self-update-check')) { - return; - } - - // only check for updates once a day - const lastUpdateCheck = Number(this.config.getOption('lastUpdateCheck')) || 0; - if (lastUpdateCheck && Date.now() - lastUpdateCheck < ONE_DAY) { - return; - } - - // don't bug for updates on tagged releases - if ((_yarnVersion || _load_yarnVersion()).version.indexOf('-') >= 0) { - return; - } - - this._checkUpdate().catch(() => { - // swallow errors - }); - } - - _checkUpdate() { - var _this13 = this; - - return (0, (_asyncToGenerator2 || _load_asyncToGenerator()).default)(function* () { - let latestVersion = yield _this13.config.requestManager.request({ - url: (_constants || _load_constants()).SELF_UPDATE_VERSION_URL - }); - invariant(typeof latestVersion === 'string', 'expected string'); - latestVersion = latestVersion.trim(); - if (!semver.valid(latestVersion)) { - return; - } - - // ensure we only check for updates periodically - _this13.config.registries.yarn.saveHomeConfig({ - lastUpdateCheck: Date.now() - }); - - if (semver.gt(latestVersion, (_yarnVersion || _load_yarnVersion()).version)) { - const installationMethod = yield (0, (_yarnVersion || _load_yarnVersion()).getInstallationMethod)(); - _this13.maybeOutputUpdate = function () { - _this13.reporter.warn(_this13.reporter.lang('yarnOutdated', latestVersion, (_yarnVersion || _load_yarnVersion()).version)); - - const command = getUpdateCommand(installationMethod); - if (command) { - _this13.reporter.info(_this13.reporter.lang('yarnOutdatedCommand')); - _this13.reporter.command(command); - } else { - const installer = getUpdateInstaller(installationMethod); - if (installer) { - _this13.reporter.info(_this13.reporter.lang('yarnOutdatedInstaller', installer)); - } - } - }; - } - })(); - } - - /** - * Method to override with a possible upgrade message. - */ - - maybeOutputUpdate() {} -} - -exports.Install = Install; -function hasWrapper(commander, args) { - return true; -} - -function setFlags(commander) { - commander.description('Yarn install is used to install all dependencies for a project.'); - commander.usage('install [flags]'); - commander.option('-A, --audit', 'Run vulnerability audit on installed packages'); - commander.option('-g, --global', 'DEPRECATED'); - commander.option('-S, --save', 'DEPRECATED - save package to your `dependencies`'); - commander.option('-D, --save-dev', 'DEPRECATED - save package to your `devDependencies`'); - commander.option('-P, --save-peer', 'DEPRECATED - save package to your `peerDependencies`'); - commander.option('-O, --save-optional', 'DEPRECATED - save package to your `optionalDependencies`'); - commander.option('-E, --save-exact', 'DEPRECATED'); - commander.option('-T, --save-tilde', 'DEPRECATED'); -} - -/***/ }), -/* 35 */ -/***/ (function(module, exports, __webpack_require__) { - -var isObject = __webpack_require__(52); -module.exports = function (it) { - if (!isObject(it)) throw TypeError(it + ' is not an object!'); - return it; -}; - - -/***/ }), -/* 36 */ -/***/ (function(module, __webpack_exports__, __webpack_require__) { - -"use strict"; -/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "b", function() { return SubjectSubscriber; }); -/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "a", function() { return Subject; }); -/* unused harmony export AnonymousSubject */ -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_0_tslib__ = __webpack_require__(1); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_1__Observable__ = __webpack_require__(12); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_2__Subscriber__ = __webpack_require__(7); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_3__Subscription__ = __webpack_require__(25); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_4__util_ObjectUnsubscribedError__ = __webpack_require__(189); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_5__SubjectSubscription__ = __webpack_require__(422); -/* harmony import */ var __WEBPACK_IMPORTED_MODULE_6__internal_symbol_rxSubscriber__ = __webpack_require__(321); -/** PURE_IMPORTS_START tslib,_Observable,_Subscriber,_Subscription,_util_ObjectUnsubscribedError,_SubjectSubscription,_internal_symbol_rxSubscriber PURE_IMPORTS_END */ - - - - - - - -var SubjectSubscriber = /*@__PURE__*/ (function (_super) { - __WEBPACK_IMPORTED_MODULE_0_tslib__["a" /* __extends */](SubjectSubscriber, _super); - function SubjectSubscriber(destination) { - var _this = _super.call(this, destination) || this; - _this.destination = destination; - return _this; - } - return SubjectSubscriber; -}(__WEBPACK_IMPORTED_MODULE_2__Subscriber__["a" /* Subscriber */])); - -var Subject = /*@__PURE__*/ (function (_super) { - __WEBPACK_IMPORTED_MODULE_0_tslib__["a" /* __extends */](Subject, _super); - function Subject() { - var _this = _super.call(this) || this; - _this.observers = []; - _this.closed = false; - _this.isStopped = false; - _this.hasError = false; - _this.thrownError = null; - return _this; - } - Subject.prototype[__WEBPACK_IMPORTED_MODULE_6__internal_symbol_rxSubscriber__["a" /* rxSubscriber */]] = function () { - return new SubjectSubscriber(this); - }; - Subject.prototype.lift = function (operator) { - var subject = new AnonymousSubject(this, this); - subject.operator = operator; - return subject; - }; - Subject.prototype.next = function (value) { - if (this.closed) { - throw new __WEBPACK_IMPORTED_MODULE_4__util_ObjectUnsubscribedError__["a" /* ObjectUnsubscribedError */](); - } - if (!this.isStopped) { - var observers = this.observers; - var len = observers.length; - var copy = observers.slice(); - for (var i = 0; i < len; i++) { - copy[i].next(value); - } - } - }; - Subject.prototype.error = function (err) { - if (this.closed) { - throw new __WEBPACK_IMPORTED_MODULE_4__util_ObjectUnsubscribedError__["a" /* ObjectUnsubscribedError */](); - } - this.hasError = true; - this.thrownError = err; - this.isStopped = true; - var observers = this.observers; - var len = observers.length; - var copy = observers.slice(); - for (var i = 0; i < len; i++) { - copy[i].error(err); - } - this.observers.length = 0; - }; - Subject.prototype.complete = function () { - if (this.closed) { - throw new __WEBPACK_IMPORTED_MODULE_4__util_ObjectUnsubscribedError__["a" /* ObjectUnsubscribedError */](); - } - this.isStopped = true; - var observers = this.observers; - var len = observers.length; - var copy = observers.slice(); - for (var i = 0; i < len; i++) { - copy[i].complete(); - } - this.observers.length = 0; - }; - Subject.prototype.unsubscribe = function () { - this.isStopped = true; - this.closed = true; - this.observers = null; - }; - Subject.prototype._trySubscribe = function (subscriber) { - if (this.closed) { - throw new __WEBPACK_IMPORTED_MODULE_4__util_ObjectUnsubscribedError__["a" /* ObjectUnsubscribedError */](); - } - else { - return _super.prototype._trySubscribe.call(this, subscriber); - } - }; - Subject.prototype._subscribe = function (subscriber) { - if (this.closed) { - throw new __WEBPACK_IMPORTED_MODULE_4__util_ObjectUnsubscribedError__["a" /* ObjectUnsubscribedError */](); - } - else if (this.hasError) { - subscriber.error(this.thrownError); - return __WEBPACK_IMPORTED_MODULE_3__Subscription__["a" /* Subscription */].EMPTY; - } - else if (this.isStopped) { - subscriber.complete(); - return __WEBPACK_IMPORTED_MODULE_3__Subscription__["a" /* Subscription */].EMPTY; - } - else { - this.observers.push(subscriber); - return new __WEBPACK_IMPORTED_MODULE_5__SubjectSubscription__["a" /* SubjectSubscription */](this, subscriber); - } - }; - Subject.prototype.asObservable = function () { - var observable = new __WEBPACK_IMPORTED_MODULE_1__Observable__["a" /* Observable */](); - observable.source = this; - return observable; - }; - Subject.create = function (destination, source) { - return new AnonymousSubject(destination, source); - }; - return Subject; -}(__WEBPACK_IMPORTED_MODULE_1__Observable__["a" /* Observable */])); - -var AnonymousSubject = /*@__PURE__*/ (function (_super) { - __WEBPACK_IMPORTED_MODULE_0_tslib__["a" /* __extends */](AnonymousSubject, _super); - function AnonymousSubject(destination, source) { - var _this = _super.call(this) || this; - _this.destination = destination; - _this.source = source; - return _this; - } - AnonymousSubject.prototype.next = function (value) { - var destination = this.destination; - if (destination && destination.next) { - destination.next(value); - } - }; - AnonymousSubject.prototype.error = function (err) { - var destination = this.destination; - if (destination && destination.error) { - this.destination.error(err); - } - }; - AnonymousSubject.prototype.complete = function () { - var destination = this.destination; - if (destination && destination.complete) { - this.destination.complete(); - } - }; - AnonymousSubject.prototype._subscribe = function (subscriber) { - var source = this.source; - if (source) { - return this.source.subscribe(subscriber); - } - else { - return __WEBPACK_IMPORTED_MODULE_3__Subscription__["a" /* Subscription */].EMPTY; - } - }; - return AnonymousSubject; -}(Subject)); - -//# sourceMappingURL=Subject.js.map - - -/***/ }), -/* 37 */ -/***/ (function(module, exports, __webpack_require__) { - -"use strict"; - - -Object.defineProperty(exports, "__esModule", { - value: true -}); -exports.normalizePattern = normalizePattern; - -/** - * Explode and normalize a pattern into its name and range. - */ - -function normalizePattern(pattern) { - let hasVersion = false; - let range = 'latest'; - let name = pattern; - - // if we're a scope then remove the @ and add it back later - let isScoped = false; - if (name[0] === '@') { - isScoped = true; - name = name.slice(1); - } - - // take first part as the name - const parts = name.split('@'); - if (parts.length > 1) { - name = parts.shift(); - range = parts.join('@'); - - if (range) { - hasVersion = true; - } else { - range = '*'; - } - } - - // add back @ scope suffix - if (isScoped) { - name = `@${name}`; - } - - return { name, range, hasVersion }; -} - -/***/ }), -/* 38 */ -/***/ (function(module, exports, __webpack_require__) { - -/* WEBPACK VAR INJECTION */(function(module) {var __WEBPACK_AMD_DEFINE_RESULT__;/** - * @license - * Lodash - * Copyright JS Foundation and other contributors - * Released under MIT license - * Based on Underscore.js 1.8.3 - * Copyright Jeremy Ashkenas, DocumentCloud and Investigative Reporters & Editors - */ -;(function() { - - /** Used as a safe reference for `undefined` in pre-ES5 environments. */ - var undefined; - - /** Used as the semantic version number. */ - var VERSION = '4.17.10'; - - /** Used as the size to enable large array optimizations. */ - var LARGE_ARRAY_SIZE = 200; - - /** Error message constants. */ - var CORE_ERROR_TEXT = 'Unsupported core-js use. Try https://npms.io/search?q=ponyfill.', - FUNC_ERROR_TEXT = 'Expected a function'; - - /** Used to stand-in for `undefined` hash values. */ - var HASH_UNDEFINED = '__lodash_hash_undefined__'; - - /** Used as the maximum memoize cache size. */ - var MAX_MEMOIZE_SIZE = 500; - - /** Used as the internal argument placeholder. */ - var PLACEHOLDER = '__lodash_placeholder__'; - - /** Used to compose bitmasks for cloning. */ - var CLONE_DEEP_FLAG = 1, - CLONE_FLAT_FLAG = 2, - CLONE_SYMBOLS_FLAG = 4; - - /** Used to compose bitmasks for value comparisons. */ - var COMPARE_PARTIAL_FLAG = 1, - COMPARE_UNORDERED_FLAG = 2; - - /** Used to compose bitmasks for function metadata. */ - var WRAP_BIND_FLAG = 1, - WRAP_BIND_KEY_FLAG = 2, - WRAP_CURRY_BOUND_FLAG = 4, - WRAP_CURRY_FLAG = 8, - WRAP_CURRY_RIGHT_FLAG = 16, - WRAP_PARTIAL_FLAG = 32, - WRAP_PARTIAL_RIGHT_FLAG = 64, - WRAP_ARY_FLAG = 128, - WRAP_REARG_FLAG = 256, - WRAP_FLIP_FLAG = 512; - - /** Used as default options for `_.truncate`. */ - var DEFAULT_TRUNC_LENGTH = 30, - DEFAULT_TRUNC_OMISSION = '...'; - - /** Used to detect hot functions by number of calls within a span of milliseconds. */ - var HOT_COUNT = 800, - HOT_SPAN = 16; - - /** Used to indicate the type of lazy iteratees. */ - var LAZY_FILTER_FLAG = 1, - LAZY_MAP_FLAG = 2, - LAZY_WHILE_FLAG = 3; - - /** Used as references for various `Number` constants. */ - var INFINITY = 1 / 0, - MAX_SAFE_INTEGER = 9007199254740991, - MAX_INTEGER = 1.7976931348623157e+308, - NAN = 0 / 0; - - /** Used as references for the maximum length and index of an array. */ - var MAX_ARRAY_LENGTH = 4294967295, - MAX_ARRAY_INDEX = MAX_ARRAY_LENGTH - 1, - HALF_MAX_ARRAY_LENGTH = MAX_ARRAY_LENGTH >>> 1; - - /** Used to associate wrap methods with their bit flags. */ - var wrapFlags = [ - ['ary', WRAP_ARY_FLAG], - ['bind', WRAP_BIND_FLAG], - ['bindKey', WRAP_BIND_KEY_FLAG], - ['curry', WRAP_CURRY_FLAG], - ['curryRight', WRAP_CURRY_RIGHT_FLAG], - ['flip', WRAP_FLIP_FLAG], - ['partial', WRAP_PARTIAL_FLAG], - ['partialRight', WRAP_PARTIAL_RIGHT_FLAG], - ['rearg', WRAP_REARG_FLAG] - ]; - - /** `Object#toString` result references. */ - var argsTag = '[object Arguments]', - arrayTag = '[object Array]', - asyncTag = '[object AsyncFunction]', - boolTag = '[object Boolean]', - dateTag = '[object Date]', - domExcTag = '[object DOMException]', - errorTag = '[object Error]', - funcTag = '[object Function]', - genTag = '[object GeneratorFunction]', - mapTag = '[object Map]', - numberTag = '[object Number]', - nullTag = '[object Null]', - objectTag = '[object Object]', - promiseTag = '[object Promise]', - proxyTag = '[object Proxy]', - regexpTag = '[object RegExp]', - setTag = '[object Set]', - stringTag = '[object String]', - symbolTag = '[object Symbol]', - undefinedTag = '[object Undefined]', - weakMapTag = '[object WeakMap]', - weakSetTag = '[object WeakSet]'; - - var arrayBufferTag = '[object ArrayBuffer]', - dataViewTag = '[object DataView]', - float32Tag = '[object Float32Array]', - float64Tag = '[object Float64Array]', - int8Tag = '[object Int8Array]', - int16Tag = '[object Int16Array]', - int32Tag = '[object Int32Array]', - uint8Tag = '[object Uint8Array]', - uint8ClampedTag = '[object Uint8ClampedArray]', - uint16Tag = '[object Uint16Array]', - uint32Tag = '[object Uint32Array]'; - - /** Used to match empty string literals in compiled template source. */ - var reEmptyStringLeading = /\b__p \+= '';/g, - reEmptyStringMiddle = /\b(__p \+=) '' \+/g, - reEmptyStringTrailing = /(__e\(.*?\)|\b__t\)) \+\n'';/g; - - /** Used to match HTML entities and HTML characters. */ - var reEscapedHtml = /&(?:amp|lt|gt|quot|#39);/g, - reUnescapedHtml = /[&<>"']/g, - reHasEscapedHtml = RegExp(reEscapedHtml.source), - reHasUnescapedHtml = RegExp(reUnescapedHtml.source); - - /** Used to match template delimiters. */ - var reEscape = /<%-([\s\S]+?)%>/g, - reEvaluate = /<%([\s\S]+?)%>/g, - reInterpolate = /<%=([\s\S]+?)%>/g; - - /** Used to match property names within property paths. */ - var reIsDeepProp = /\.|\[(?:[^[\]]*|(["'])(?:(?!\1)[^\\]|\\.)*?\1)\]/, - reIsPlainProp = /^\w*$/, - rePropName = /[^.[\]]+|\[(?:(-?\d+(?:\.\d+)?)|(["'])((?:(?!\2)[^\\]|\\.)*?)\2)\]|(?=(?:\.|\[\])(?:\.|\[\]|$))/g; - - /** - * Used to match `RegExp` - * [syntax characters](http://ecma-international.org/ecma-262/7.0/#sec-patterns). - */ - var reRegExpChar = /[\\^$.*+?()[\]{}|]/g, - reHasRegExpChar = RegExp(reRegExpChar.source); - - /** Used to match leading and trailing whitespace. */ - var reTrim = /^\s+|\s+$/g, - reTrimStart = /^\s+/, - reTrimEnd = /\s+$/; - - /** Used to match wrap detail comments. */ - var reWrapComment = /\{(?:\n\/\* \[wrapped with .+\] \*\/)?\n?/, - reWrapDetails = /\{\n\/\* \[wrapped with (.+)\] \*/, - reSplitDetails = /,? & /; - - /** Used to match words composed of alphanumeric characters. */ - var reAsciiWord = /[^\x00-\x2f\x3a-\x40\x5b-\x60\x7b-\x7f]+/g; - - /** Used to match backslashes in property paths. */ - var reEscapeChar = /\\(\\)?/g; - - /** - * Used to match - * [ES template delimiters](http://ecma-international.org/ecma-262/7.0/#sec-template-literal-lexical-components). - */ - var reEsTemplate = /\$\{([^\\}]*(?:\\.[^\\}]*)*)\}/g; - - /** Used to match `RegExp` flags from their coerced string values. */ - var reFlags = /\w*$/; - - /** Used to detect bad signed hexadecimal string values. */ - var reIsBadHex = /^[-+]0x[0-9a-f]+$/i; - - /** Used to detect binary string values. */ - var reIsBinary = /^0b[01]+$/i; - - /** Used to detect host constructors (Safari). */ - var reIsHostCtor = /^\[object .+?Constructor\]$/; - - /** Used to detect octal string values. */ - var reIsOctal = /^0o[0-7]+$/i; - - /** Used to detect unsigned integer values. */ - var reIsUint = /^(?:0|[1-9]\d*)$/; - - /** Used to match Latin Unicode letters (excluding mathematical operators). */ - var reLatin = /[\xc0-\xd6\xd8-\xf6\xf8-\xff\u0100-\u017f]/g; - - /** Used to ensure capturing order of template delimiters. */ - var reNoMatch = /($^)/; - - /** Used to match unescaped characters in compiled string literals. */ - var reUnescapedString = /['\n\r\u2028\u2029\\]/g; - - /** Used to compose unicode character classes. */ - var rsAstralRange = '\\ud800-\\udfff', - rsComboMarksRange = '\\u0300-\\u036f', - reComboHalfMarksRange = '\\ufe20-\\ufe2f', - rsComboSymbolsRange = '\\u20d0-\\u20ff', - rsComboRange = rsComboMarksRange + reComboHalfMarksRange + rsComboSymbolsRange, - rsDingbatRange = '\\u2700-\\u27bf', - rsLowerRange = 'a-z\\xdf-\\xf6\\xf8-\\xff', - rsMathOpRange = '\\xac\\xb1\\xd7\\xf7', - rsNonCharRange = '\\x00-\\x2f\\x3a-\\x40\\x5b-\\x60\\x7b-\\xbf', - rsPunctuationRange = '\\u2000-\\u206f', - rsSpaceRange = ' \\t\\x0b\\f\\xa0\\ufeff\\n\\r\\u2028\\u2029\\u1680\\u180e\\u2000\\u2001\\u2002\\u2003\\u2004\\u2005\\u2006\\u2007\\u2008\\u2009\\u200a\\u202f\\u205f\\u3000', - rsUpperRange = 'A-Z\\xc0-\\xd6\\xd8-\\xde', - rsVarRange = '\\ufe0e\\ufe0f', - rsBreakRange = rsMathOpRange + rsNonCharRange + rsPunctuationRange + rsSpaceRange; - - /** Used to compose unicode capture groups. */ - var rsApos = "['\u2019]", - rsAstral = '[' + rsAstralRange + ']', - rsBreak = '[' + rsBreakRange + ']', - rsCombo = '[' + rsComboRange + ']', - rsDigits = '\\d+', - rsDingbat = '[' + rsDingbatRange + ']', - rsLower = '[' + rsLowerRange + ']', - rsMisc = '[^' + rsAstralRange + rsBreakRange + rsDigits + rsDingbatRange + rsLowerRange + rsUpperRange + ']', - rsFitz = '\\ud83c[\\udffb-\\udfff]', - rsModifier = '(?:' + rsCombo + '|' + rsFitz + ')', - rsNonAstral = '[^' + rsAstralRange + ']', - rsRegional = '(?:\\ud83c[\\udde6-\\uddff]){2}', - rsSurrPair = '[\\ud800-\\udbff][\\udc00-\\udfff]', - rsUpper = '[' + rsUpperRange + ']', - rsZWJ = '\\u200d'; - - /** Used to compose unicode regexes. */ - var rsMiscLower = '(?:' + rsLower + '|' + rsMisc + ')', - rsMiscUpper = '(?:' + rsUpper + '|' + rsMisc + ')', - rsOptContrLower = '(?:' + rsApos + '(?:d|ll|m|re|s|t|ve))?', - rsOptContrUpper = '(?:' + rsApos + '(?:D|LL|M|RE|S|T|VE))?', - reOptMod = rsModifier + '?', - rsOptVar = '[' + rsVarRange + ']?', - rsOptJoin = '(?:' + rsZWJ + '(?:' + [rsNonAstral, rsRegional, rsSurrPair].join('|') + ')' + rsOptVar + reOptMod + ')*', - rsOrdLower = '\\d*(?:1st|2nd|3rd|(?![123])\\dth)(?=\\b|[A-Z_])', - rsOrdUpper = '\\d*(?:1ST|2ND|3RD|(?![123])\\dTH)(?=\\b|[a-z_])', - rsSeq = rsOptVar + reOptMod + rsOptJoin, - rsEmoji = '(?:' + [rsDingbat, rsRegional, rsSurrPair].join('|') + ')' + rsSeq, - rsSymbol = '(?:' + [rsNonAstral + rsCombo + '?', rsCombo, rsRegional, rsSurrPair, rsAstral].join('|') + ')'; - - /** Used to match apostrophes. */ - var reApos = RegExp(rsApos, 'g'); - - /** - * Used to match [combining diacritical marks](https://en.wikipedia.org/wiki/Combining_Diacritical_Marks) and - * [combining diacritical marks for symbols](https://en.wikipedia.org/wiki/Combining_Diacritical_Marks_for_Symbols). - */ - var reComboMark = RegExp(rsCombo, 'g'); - - /** Used to match [string symbols](https://mathiasbynens.be/notes/javascript-unicode). */ - var reUnicode = RegExp(rsFitz + '(?=' + rsFitz + ')|' + rsSymbol + rsSeq, 'g'); - - /** Used to match complex or compound words. */ - var reUnicodeWord = RegExp([ - rsUpper + '?' + rsLower + '+' + rsOptContrLower + '(?=' + [rsBreak, rsUpper, '$'].join('|') + ')', - rsMiscUpper + '+' + rsOptContrUpper + '(?=' + [rsBreak, rsUpper + rsMiscLower, '$'].join('|') + ')', - rsUpper + '?' + rsMiscLower + '+' + rsOptContrLower, - rsUpper + '+' + rsOptContrUpper, - rsOrdUpper, - rsOrdLower, - rsDigits, - rsEmoji - ].join('|'), 'g'); - - /** Used to detect strings with [zero-width joiners or code points from the astral planes](http://eev.ee/blog/2015/09/12/dark-corners-of-unicode/). */ - var reHasUnicode = RegExp('[' + rsZWJ + rsAstralRange + rsComboRange + rsVarRange + ']'); - - /** Used to detect strings that need a more robust regexp to match words. */ - var reHasUnicodeWord = /[a-z][A-Z]|[A-Z]{2,}[a-z]|[0-9][a-zA-Z]|[a-zA-Z][0-9]|[^a-zA-Z0-9 ]/; - - /** Used to assign default `context` object properties. */ - var contextProps = [ - 'Array', 'Buffer', 'DataView', 'Date', 'Error', 'Float32Array', 'Float64Array', - 'Function', 'Int8Array', 'Int16Array', 'Int32Array', 'Map', 'Math', 'Object', - 'Promise', 'RegExp', 'Set', 'String', 'Symbol', 'TypeError', 'Uint8Array', - 'Uint8ClampedArray', 'Uint16Array', 'Uint32Array', 'WeakMap', - '_', 'clearTimeout', 'isFinite', 'parseInt', 'setTimeout' - ]; - - /** Used to make template sourceURLs easier to identify. */ - var templateCounter = -1; - - /** Used to identify `toStringTag` values of typed arrays. */ - var typedArrayTags = {}; - typedArrayTags[float32Tag] = typedArrayTags[float64Tag] = - typedArrayTags[int8Tag] = typedArrayTags[int16Tag] = - typedArrayTags[int32Tag] = typedArrayTags[uint8Tag] = - typedArrayTags[uint8ClampedTag] = typedArrayTags[uint16Tag] = - typedArrayTags[uint32Tag] = true; - typedArrayTags[argsTag] = typedArrayTags[arrayTag] = - typedArrayTags[arrayBufferTag] = typedArrayTags[boolTag] = - typedArrayTags[dataViewTag] = typedArrayTags[dateTag] = - typedArrayTags[errorTag] = typedArrayTags[funcTag] = - typedArrayTags[mapTag] = typedArrayTags[numberTag] = - typedArrayTags[objectTag] = typedArrayTags[regexpTag] = - typedArrayTags[setTag] = typedArrayTags[stringTag] = - typedArrayTags[weakMapTag] = false; - - /** Used to identify `toStringTag` values supported by `_.clone`. */ - var cloneableTags = {}; - cloneableTags[argsTag] = cloneableTags[arrayTag] = - cloneableTags[arrayBufferTag] = cloneableTags[dataViewTag] = - cloneableTags[boolTag] = cloneableTags[dateTag] = - cloneableTags[float32Tag] = cloneableTags[float64Tag] = - cloneableTags[int8Tag] = cloneableTags[int16Tag] = - cloneableTags[int32Tag] = cloneableTags[mapTag] = - cloneableTags[numberTag] = cloneableTags[objectTag] = - cloneableTags[regexpTag] = cloneableTags[setTag] = - cloneableTags[stringTag] = cloneableTags[symbolTag] = - cloneableTags[uint8Tag] = cloneableTags[uint8ClampedTag] = - cloneableTags[uint16Tag] = cloneableTags[uint32Tag] = true; - cloneableTags[errorTag] = cloneableTags[funcTag] = - cloneableTags[weakMapTag] = false; - - /** Used to map Latin Unicode letters to basic Latin letters. */ - var deburredLetters = { - // Latin-1 Supplement block. - '\xc0': 'A', '\xc1': 'A', '\xc2': 'A', '\xc3': 'A', '\xc4': 'A', '\xc5': 'A', - '\xe0': 'a', '\xe1': 'a', '\xe2': 'a', '\xe3': 'a', '\xe4': 'a', '\xe5': 'a', - '\xc7': 'C', '\xe7': 'c', - '\xd0': 'D', '\xf0': 'd', - '\xc8': 'E', '\xc9': 'E', '\xca': 'E', '\xcb': 'E', - '\xe8': 'e', '\xe9': 'e', '\xea': 'e', '\xeb': 'e', - '\xcc': 'I', '\xcd': 'I', '\xce': 'I', '\xcf': 'I', - '\xec': 'i', '\xed': 'i', '\xee': 'i', '\xef': 'i', - '\xd1': 'N', '\xf1': 'n', - '\xd2': 'O', '\xd3': 'O', '\xd4': 'O', '\xd5': 'O', '\xd6': 'O', '\xd8': 'O', - '\xf2': 'o', '\xf3': 'o', '\xf4': 'o', '\xf5': 'o', '\xf6': 'o', '\xf8': 'o', - '\xd9': 'U', '\xda': 'U', '\xdb': 'U', '\xdc': 'U', - '\xf9': 'u', '\xfa': 'u', '\xfb': 'u', '\xfc': 'u', - '\xdd': 'Y', '\xfd': 'y', '\xff': 'y', - '\xc6': 'Ae', '\xe6': 'ae', - '\xde': 'Th', '\xfe': 'th', - '\xdf': 'ss', - // Latin Extended-A block. - '\u0100': 'A', '\u0102': 'A', '\u0104': 'A', - '\u0101': 'a', '\u0103': 'a', '\u0105': 'a', - '\u0106': 'C', '\u0108': 'C', '\u010a': 'C', '\u010c': 'C', - '\u0107': 'c', '\u0109': 'c', '\u010b': 'c', '\u010d': 'c', - '\u010e': 'D', '\u0110': 'D', '\u010f': 'd', '\u0111': 'd', - '\u0112': 'E', '\u0114': 'E', '\u0116': 'E', '\u0118': 'E', '\u011a': 'E', - '\u0113': 'e', '\u0115': 'e', '\u0117': 'e', '\u0119': 'e', '\u011b': 'e', - '\u011c': 'G', '\u011e': 'G', '\u0120': 'G', '\u0122': 'G', - '\u011d': 'g', '\u011f': 'g', '\u0121': 'g', '\u0123': 'g', - '\u0124': 'H', '\u0126': 'H', '\u0125': 'h', '\u0127': 'h', - '\u0128': 'I', '\u012a': 'I', '\u012c': 'I', '\u012e': 'I', '\u0130': 'I', - '\u0129': 'i', '\u012b': 'i', '\u012d': 'i', '\u012f': 'i', '\u0131': 'i', - '\u0134': 'J', '\u0135': 'j', - '\u0136': 'K', '\u0137': 'k', '\u0138': 'k', - '\u0139': 'L', '\u013b': 'L', '\u013d': 'L', '\u013f': 'L', '\u0141': 'L', - '\u013a': 'l', '\u013c': 'l', '\u013e': 'l', '\u0140': 'l', '\u0142': 'l', - '\u0143': 'N', '\u0145': 'N', '\u0147': 'N', '\u014a': 'N', - '\u0144': 'n', '\u0146': 'n', '\u0148': 'n', '\u014b': 'n', - '\u014c': 'O', '\u014e': 'O', '\u0150': 'O', - '\u014d': 'o', '\u014f': 'o', '\u0151': 'o', - '\u0154': 'R', '\u0156': 'R', '\u0158': 'R', - '\u0155': 'r', '\u0157': 'r', '\u0159': 'r', - '\u015a': 'S', '\u015c': 'S', '\u015e': 'S', '\u0160': 'S', - '\u015b': 's', '\u015d': 's', '\u015f': 's', '\u0161': 's', - '\u0162': 'T', '\u0164': 'T', '\u0166': 'T', - '\u0163': 't', '\u0165': 't', '\u0167': 't', - '\u0168': 'U', '\u016a': 'U', '\u016c': 'U', '\u016e': 'U', '\u0170': 'U', '\u0172': 'U', - '\u0169': 'u', '\u016b': 'u', '\u016d': 'u', '\u016f': 'u', '\u0171': 'u', '\u0173': 'u', - '\u0174': 'W', '\u0175': 'w', - '\u0176': 'Y', '\u0177': 'y', '\u0178': 'Y', - '\u0179': 'Z', '\u017b': 'Z', '\u017d': 'Z', - '\u017a': 'z', '\u017c': 'z', '\u017e': 'z', - '\u0132': 'IJ', '\u0133': 'ij', - '\u0152': 'Oe', '\u0153': 'oe', - '\u0149': "'n", '\u017f': 's' - }; - - /** Used to map characters to HTML entities. */ - var htmlEscapes = { - '&': '&', - '<': '<', - '>': '>', - '"': '"', - "'": ''' - }; - - /** Used to map HTML entities to characters. */ - var htmlUnescapes = { - '&': '&', - '<': '<', - '>': '>', - '"': '"', - ''': "'" - }; - - /** Used to escape characters for inclusion in compiled string literals. */ - var stringEscapes = { - '\\': '\\', - "'": "'", - '\n': 'n', - '\r': 'r', - '\u2028': 'u2028', - '\u2029': 'u2029' - }; - - /** Built-in method references without a dependency on `root`. */ - var freeParseFloat = parseFloat, - freeParseInt = parseInt; - - /** Detect free variable `global` from Node.js. */ - var freeGlobal = typeof global == 'object' && global && global.Object === Object && global; - - /** Detect free variable `self`. */ - var freeSelf = typeof self == 'object' && self && self.Object === Object && self; - - /** Used as a reference to the global object. */ - var root = freeGlobal || freeSelf || Function('return this')(); - - /** Detect free variable `exports`. */ - var freeExports = typeof exports == 'object' && exports && !exports.nodeType && exports; - - /** Detect free variable `module`. */ - var freeModule = freeExports && typeof module == 'object' && module && !module.nodeType && module; - - /** Detect the popular CommonJS extension `module.exports`. */ - var moduleExports = freeModule && freeModule.exports === freeExports; - - /** Detect free variable `process` from Node.js. */ - var freeProcess = moduleExports && freeGlobal.process; - - /** Used to access faster Node.js helpers. */ - var nodeUtil = (function() { - try { - // Use `util.types` for Node.js 10+. - var types = freeModule && freeModule.require && freeModule.require('util').types; - - if (types) { - return types; - } - - // Legacy `process.binding('util')` for Node.js < 10. - return freeProcess && freeProcess.binding && freeProcess.binding('util'); - } catch (e) {} - }()); - - /* Node.js helper references. */ - var nodeIsArrayBuffer = nodeUtil && nodeUtil.isArrayBuffer, - nodeIsDate = nodeUtil && nodeUtil.isDate, - nodeIsMap = nodeUtil && nodeUtil.isMap, - nodeIsRegExp = nodeUtil && nodeUtil.isRegExp, - nodeIsSet = nodeUtil && nodeUtil.isSet, - nodeIsTypedArray = nodeUtil && nodeUtil.isTypedArray; - - /*--------------------------------------------------------------------------*/ - - /** - * A faster alternative to `Function#apply`, this function invokes `func` - * with the `this` binding of `thisArg` and the arguments of `args`. - * - * @private - * @param {Function} func The function to invoke. - * @param {*} thisArg The `this` binding of `func`. - * @param {Array} args The arguments to invoke `func` with. - * @returns {*} Returns the result of `func`. - */ - function apply(func, thisArg, args) { - switch (args.length) { - case 0: return func.call(thisArg); - case 1: return func.call(thisArg, args[0]); - case 2: return func.call(thisArg, args[0], args[1]); - case 3: return func.call(thisArg, args[0], args[1], args[2]); - } - return func.apply(thisArg, args); - } - - /** - * A specialized version of `baseAggregator` for arrays. - * - * @private - * @param {Array} [array] The array to iterate over. - * @param {Function} setter The function to set `accumulator` values. - * @param {Function} iteratee The iteratee to transform keys. - * @param {Object} accumulator The initial aggregated object. - * @returns {Function} Returns `accumulator`. - */ - function arrayAggregator(array, setter, iteratee, accumulator) { - var index = -1, - length = array == null ? 0 : array.length; - - while (++index < length) { - var value = array[index]; - setter(accumulator, value, iteratee(value), array); - } - return accumulator; - } - - /** - * A specialized version of `_.forEach` for arrays without support for - * iteratee shorthands. - * - * @private - * @param {Array} [array] The array to iterate over. - * @param {Function} iteratee The function invoked per iteration. - * @returns {Array} Returns `array`. - */ - function arrayEach(array, iteratee) { - var index = -1, - length = array == null ? 0 : array.length; - - while (++index < length) { - if (iteratee(array[index], index, array) === false) { - break; - } - } - return array; - } - - /** - * A specialized version of `_.forEachRight` for arrays without support for - * iteratee shorthands. - * - * @private - * @param {Array} [array] The array to iterate over. - * @param {Function} iteratee The function invoked per iteration. - * @returns {Array} Returns `array`. - */ - function arrayEachRight(array, iteratee) { - var length = array == null ? 0 : array.length; - - while (length--) { - if (iteratee(array[length], length, array) === false) { - break; - } - } - return array; - } - - /** - * A specialized version of `_.every` for arrays without support for - * iteratee shorthands. - * - * @private - * @param {Array} [array] The array to iterate over. - * @param {Function} predicate The function invoked per iteration. - * @returns {boolean} Returns `true` if all elements pass the predicate check, - * else `false`. - */ - function arrayEvery(array, predicate) { - var index = -1, - length = array == null ? 0 : array.length; - - while (++index < length) { - if (!predicate(array[index], index, array)) { - return false; - } - } - return true; - } - - /** - * A specialized version of `_.filter` for arrays without support for - * iteratee shorthands. - * - * @private - * @param {Array} [array] The array to iterate over. - * @param {Function} predicate The function invoked per iteration. - * @returns {Array} Returns the new filtered array. - */ - function arrayFilter(array, predicate) { - var index = -1, - length = array == null ? 0 : array.length, - resIndex = 0, - result = []; - - while (++index < length) { - var value = array[index]; - if (predicate(value, index, array)) { - result[resIndex++] = value; - } - } - return result; - } - - /** - * A specialized version of `_.includes` for arrays without support for - * specifying an index to search from. - * - * @private - * @param {Array} [array] The array to inspect. - * @param {*} target The value to search for. - * @returns {boolean} Returns `true` if `target` is found, else `false`. - */ - function arrayIncludes(array, value) { - var length = array == null ? 0 : array.length; - return !!length && baseIndexOf(array, value, 0) > -1; - } - - /** - * This function is like `arrayIncludes` except that it accepts a comparator. - * - * @private - * @param {Array} [array] The array to inspect. - * @param {*} target The value to search for. - * @param {Function} comparator The comparator invoked per element. - * @returns {boolean} Returns `true` if `target` is found, else `false`. - */ - function arrayIncludesWith(array, value, comparator) { - var index = -1, - length = array == null ? 0 : array.length; - - while (++index < length) { - if (comparator(value, array[index])) { - return true; - } - } - return false; - } - - /** - * A specialized version of `_.map` for arrays without support for iteratee - * shorthands. - * - * @private - * @param {Array} [array] The array to iterate over. - * @param {Function} iteratee The function invoked per iteration. - * @returns {Array} Returns the new mapped array. - */ - function arrayMap(array, iteratee) { - var index = -1, - length = array == null ? 0 : array.length, - result = Array(length); - - while (++index < length) { - result[index] = iteratee(array[index], index, array); - } - return result; - } - - /** - * Appends the elements of `values` to `array`. - * - * @private - * @param {Array} array The array to modify. - * @param {Array} values The values to append. - * @returns {Array} Returns `array`. - */ - function arrayPush(array, values) { - var index = -1, - length = values.length, - offset = array.length; - - while (++index < length) { - array[offset + index] = values[index]; - } - return array; - } - - /** - * A specialized version of `_.reduce` for arrays without support for - * iteratee shorthands. - * - * @private - * @param {Array} [array] The array to iterate over. - * @param {Function} iteratee The function invoked per iteration. - * @param {*} [accumulator] The initial value. - * @param {boolean} [initAccum] Specify using the first element of `array` as - * the initial value. - * @returns {*} Returns the accumulated value. - */ - function arrayReduce(array, iteratee, accumulator, initAccum) { - var index = -1, - length = array == null ? 0 : array.length; - - if (initAccum && length) { - accumulator = array[++index]; - } - while (++index < length) { - accumulator = iteratee(accumulator, array[index], index, array); - } - return accumulator; - } - - /** - * A specialized version of `_.reduceRight` for arrays without support for - * iteratee shorthands. - * - * @private - * @param {Array} [array] The array to iterate over. - * @param {Function} iteratee The function invoked per iteration. - * @param {*} [accumulator] The initial value. - * @param {boolean} [initAccum] Specify using the last element of `array` as - * the initial value. - * @returns {*} Returns the accumulated value. - */ - function arrayReduceRight(array, iteratee, accumulator, initAccum) { - var length = array == null ? 0 : array.length; - if (initAccum && length) { - accumulator = array[--length]; - } - while (length--) { - accumulator = iteratee(accumulator, array[length], length, array); - } - return accumulator; - } - - /** - * A specialized version of `_.some` for arrays without support for iteratee - * shorthands. - * - * @private - * @param {Array} [array] The array to iterate over. - * @param {Function} predicate The function invoked per iteration. - * @returns {boolean} Returns `true` if any element passes the predicate check, - * else `false`. - */ - function arraySome(array, predicate) { - var index = -1, - length = array == null ? 0 : array.length; - - while (++index < length) { - if (predicate(array[index], index, array)) { - return true; - } - } - return false; - } - - /** - * Gets the size of an ASCII `string`. - * - * @private - * @param {string} string The string inspect. - * @returns {number} Returns the string size. - */ - var asciiSize = baseProperty('length'); - - /** - * Converts an ASCII `string` to an array. - * - * @private - * @param {string} string The string to convert. - * @returns {Array} Returns the converted array. - */ - function asciiToArray(string) { - return string.split(''); - } - - /** - * Splits an ASCII `string` into an array of its words. - * - * @private - * @param {string} The string to inspect. - * @returns {Array} Returns the words of `string`. - */ - function asciiWords(string) { - return string.match(reAsciiWord) || []; - } - - /** - * The base implementation of methods like `_.findKey` and `_.findLastKey`, - * without support for iteratee shorthands, which iterates over `collection` - * using `eachFunc`. - * - * @private - * @param {Array|Object} collection The collection to inspect. - * @param {Function} predicate The function invoked per iteration. - * @param {Function} eachFunc The function to iterate over `collection`. - * @returns {*} Returns the found element or its key, else `undefined`. - */ - function baseFindKey(collection, predicate, eachFunc) { - var result; - eachFunc(collection, function(value, key, collection) { - if (predicate(value, key, collection)) { - result = key; - return false; - } - }); - return result; - } - - /** - * The base implementation of `_.findIndex` and `_.findLastIndex` without - * support for iteratee shorthands. - * - * @private - * @param {Array} array The array to inspect. - * @param {Function} predicate The function invoked per iteration. - * @param {number} fromIndex The index to search from. - * @param {boolean} [fromRight] Specify iterating from right to left. - * @returns {number} Returns the index of the matched value, else `-1`. - */ - function baseFindIndex(array, predicate, fromIndex, fromRight) { - var length = array.length, - index = fromIndex + (fromRight ? 1 : -1); - - while ((fromRight ? index-- : ++index < length)) { - if (predicate(array[index], index, array)) { - return index; - } - } - return -1; - } - - /** - * The base implementation of `_.indexOf` without `fromIndex` bounds checks. - * - * @private - * @param {Array} array The array to inspect. - * @param {*} value The value to search for. - * @param {number} fromIndex The index to search from. - * @returns {number} Returns the index of the matched value, else `-1`. - */ - function baseIndexOf(array, value, fromIndex) { - return value === value - ? strictIndexOf(array, value, fromIndex) - : baseFindIndex(array, baseIsNaN, fromIndex); - } - - /** - * This function is like `baseIndexOf` except that it accepts a comparator. - * - * @private - * @param {Array} array The array to inspect. - * @param {*} value The value to search for. - * @param {number} fromIndex The index to search from. - * @param {Function} comparator The comparator invoked per element. - * @returns {number} Returns the index of the matched value, else `-1`. - */ - function baseIndexOfWith(array, value, fromIndex, comparator) { - var index = fromIndex - 1, - length = array.length; - - while (++index < length) { - if (comparator(array[index], value)) { - return index; - } - } - return -1; - } - - /** - * The base implementation of `_.isNaN` without support for number objects. - * - * @private - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` is `NaN`, else `false`. - */ - function baseIsNaN(value) { - return value !== value; - } - - /** - * The base implementation of `_.mean` and `_.meanBy` without support for - * iteratee shorthands. - * - * @private - * @param {Array} array The array to iterate over. - * @param {Function} iteratee The function invoked per iteration. - * @returns {number} Returns the mean. - */ - function baseMean(array, iteratee) { - var length = array == null ? 0 : array.length; - return length ? (baseSum(array, iteratee) / length) : NAN; - } - - /** - * The base implementation of `_.property` without support for deep paths. - * - * @private - * @param {string} key The key of the property to get. - * @returns {Function} Returns the new accessor function. - */ - function baseProperty(key) { - return function(object) { - return object == null ? undefined : object[key]; - }; - } - - /** - * The base implementation of `_.propertyOf` without support for deep paths. - * - * @private - * @param {Object} object The object to query. - * @returns {Function} Returns the new accessor function. - */ - function basePropertyOf(object) { - return function(key) { - return object == null ? undefined : object[key]; - }; - } - - /** - * The base implementation of `_.reduce` and `_.reduceRight`, without support - * for iteratee shorthands, which iterates over `collection` using `eachFunc`. - * - * @private - * @param {Array|Object} collection The collection to iterate over. - * @param {Function} iteratee The function invoked per iteration. - * @param {*} accumulator The initial value. - * @param {boolean} initAccum Specify using the first or last element of - * `collection` as the initial value. - * @param {Function} eachFunc The function to iterate over `collection`. - * @returns {*} Returns the accumulated value. - */ - function baseReduce(collection, iteratee, accumulator, initAccum, eachFunc) { - eachFunc(collection, function(value, index, collection) { - accumulator = initAccum - ? (initAccum = false, value) - : iteratee(accumulator, value, index, collection); - }); - return accumulator; - } - - /** - * The base implementation of `_.sortBy` which uses `comparer` to define the - * sort order of `array` and replaces criteria objects with their corresponding - * values. - * - * @private - * @param {Array} array The array to sort. - * @param {Function} comparer The function to define sort order. - * @returns {Array} Returns `array`. - */ - function baseSortBy(array, comparer) { - var length = array.length; - - array.sort(comparer); - while (length--) { - array[length] = array[length].value; - } - return array; - } - - /** - * The base implementation of `_.sum` and `_.sumBy` without support for - * iteratee shorthands. - * - * @private - * @param {Array} array The array to iterate over. - * @param {Function} iteratee The function invoked per iteration. - * @returns {number} Returns the sum. - */ - function baseSum(array, iteratee) { - var result, - index = -1, - length = array.length; - - while (++index < length) { - var current = iteratee(array[index]); - if (current !== undefined) { - result = result === undefined ? current : (result + current); - } - } - return result; - } - - /** - * The base implementation of `_.times` without support for iteratee shorthands - * or max array length checks. - * - * @private - * @param {number} n The number of times to invoke `iteratee`. - * @param {Function} iteratee The function invoked per iteration. - * @returns {Array} Returns the array of results. - */ - function baseTimes(n, iteratee) { - var index = -1, - result = Array(n); - - while (++index < n) { - result[index] = iteratee(index); - } - return result; - } - - /** - * The base implementation of `_.toPairs` and `_.toPairsIn` which creates an array - * of key-value pairs for `object` corresponding to the property names of `props`. - * - * @private - * @param {Object} object The object to query. - * @param {Array} props The property names to get values for. - * @returns {Object} Returns the key-value pairs. - */ - function baseToPairs(object, props) { - return arrayMap(props, function(key) { - return [key, object[key]]; - }); - } - - /** - * The base implementation of `_.unary` without support for storing metadata. - * - * @private - * @param {Function} func The function to cap arguments for. - * @returns {Function} Returns the new capped function. - */ - function baseUnary(func) { - return function(value) { - return func(value); - }; - } - - /** - * The base implementation of `_.values` and `_.valuesIn` which creates an - * array of `object` property values corresponding to the property names - * of `props`. - * - * @private - * @param {Object} object The object to query. - * @param {Array} props The property names to get values for. - * @returns {Object} Returns the array of property values. - */ - function baseValues(object, props) { - return arrayMap(props, function(key) { - return object[key]; - }); - } - - /** - * Checks if a `cache` value for `key` exists. - * - * @private - * @param {Object} cache The cache to query. - * @param {string} key The key of the entry to check. - * @returns {boolean} Returns `true` if an entry for `key` exists, else `false`. - */ - function cacheHas(cache, key) { - return cache.has(key); - } - - /** - * Used by `_.trim` and `_.trimStart` to get the index of the first string symbol - * that is not found in the character symbols. - * - * @private - * @param {Array} strSymbols The string symbols to inspect. - * @param {Array} chrSymbols The character symbols to find. - * @returns {number} Returns the index of the first unmatched string symbol. - */ - function charsStartIndex(strSymbols, chrSymbols) { - var index = -1, - length = strSymbols.length; - - while (++index < length && baseIndexOf(chrSymbols, strSymbols[index], 0) > -1) {} - return index; - } - - /** - * Used by `_.trim` and `_.trimEnd` to get the index of the last string symbol - * that is not found in the character symbols. - * - * @private - * @param {Array} strSymbols The string symbols to inspect. - * @param {Array} chrSymbols The character symbols to find. - * @returns {number} Returns the index of the last unmatched string symbol. - */ - function charsEndIndex(strSymbols, chrSymbols) { - var index = strSymbols.length; - - while (index-- && baseIndexOf(chrSymbols, strSymbols[index], 0) > -1) {} - return index; - } - - /** - * Gets the number of `placeholder` occurrences in `array`. - * - * @private - * @param {Array} array The array to inspect. - * @param {*} placeholder The placeholder to search for. - * @returns {number} Returns the placeholder count. - */ - function countHolders(array, placeholder) { - var length = array.length, - result = 0; - - while (length--) { - if (array[length] === placeholder) { - ++result; - } - } - return result; - } - - /** - * Used by `_.deburr` to convert Latin-1 Supplement and Latin Extended-A - * letters to basic Latin letters. - * - * @private - * @param {string} letter The matched letter to deburr. - * @returns {string} Returns the deburred letter. - */ - var deburrLetter = basePropertyOf(deburredLetters); - - /** - * Used by `_.escape` to convert characters to HTML entities. - * - * @private - * @param {string} chr The matched character to escape. - * @returns {string} Returns the escaped character. - */ - var escapeHtmlChar = basePropertyOf(htmlEscapes); - - /** - * Used by `_.template` to escape characters for inclusion in compiled string literals. - * - * @private - * @param {string} chr The matched character to escape. - * @returns {string} Returns the escaped character. - */ - function escapeStringChar(chr) { - return '\\' + stringEscapes[chr]; - } - - /** - * Gets the value at `key` of `object`. - * - * @private - * @param {Object} [object] The object to query. - * @param {string} key The key of the property to get. - * @returns {*} Returns the property value. - */ - function getValue(object, key) { - return object == null ? undefined : object[key]; - } - - /** - * Checks if `string` contains Unicode symbols. - * - * @private - * @param {string} string The string to inspect. - * @returns {boolean} Returns `true` if a symbol is found, else `false`. - */ - function hasUnicode(string) { - return reHasUnicode.test(string); - } - - /** - * Checks if `string` contains a word composed of Unicode symbols. - * - * @private - * @param {string} string The string to inspect. - * @returns {boolean} Returns `true` if a word is found, else `false`. - */ - function hasUnicodeWord(string) { - return reHasUnicodeWord.test(string); - } - - /** - * Converts `iterator` to an array. - * - * @private - * @param {Object} iterator The iterator to convert. - * @returns {Array} Returns the converted array. - */ - function iteratorToArray(iterator) { - var data, - result = []; - - while (!(data = iterator.next()).done) { - result.push(data.value); - } - return result; - } - - /** - * Converts `map` to its key-value pairs. - * - * @private - * @param {Object} map The map to convert. - * @returns {Array} Returns the key-value pairs. - */ - function mapToArray(map) { - var index = -1, - result = Array(map.size); - - map.forEach(function(value, key) { - result[++index] = [key, value]; - }); - return result; - } - - /** - * Creates a unary function that invokes `func` with its argument transformed. - * - * @private - * @param {Function} func The function to wrap. - * @param {Function} transform The argument transform. - * @returns {Function} Returns the new function. - */ - function overArg(func, transform) { - return function(arg) { - return func(transform(arg)); - }; - } - - /** - * Replaces all `placeholder` elements in `array` with an internal placeholder - * and returns an array of their indexes. - * - * @private - * @param {Array} array The array to modify. - * @param {*} placeholder The placeholder to replace. - * @returns {Array} Returns the new array of placeholder indexes. - */ - function replaceHolders(array, placeholder) { - var index = -1, - length = array.length, - resIndex = 0, - result = []; - - while (++index < length) { - var value = array[index]; - if (value === placeholder || value === PLACEHOLDER) { - array[index] = PLACEHOLDER; - result[resIndex++] = index; - } - } - return result; - } - - /** - * Gets the value at `key`, unless `key` is "__proto__". - * - * @private - * @param {Object} object The object to query. - * @param {string} key The key of the property to get. - * @returns {*} Returns the property value. - */ - function safeGet(object, key) { - return key == '__proto__' - ? undefined - : object[key]; - } - - /** - * Converts `set` to an array of its values. - * - * @private - * @param {Object} set The set to convert. - * @returns {Array} Returns the values. - */ - function setToArray(set) { - var index = -1, - result = Array(set.size); - - set.forEach(function(value) { - result[++index] = value; - }); - return result; - } - - /** - * Converts `set` to its value-value pairs. - * - * @private - * @param {Object} set The set to convert. - * @returns {Array} Returns the value-value pairs. - */ - function setToPairs(set) { - var index = -1, - result = Array(set.size); - - set.forEach(function(value) { - result[++index] = [value, value]; - }); - return result; - } - - /** - * A specialized version of `_.indexOf` which performs strict equality - * comparisons of values, i.e. `===`. - * - * @private - * @param {Array} array The array to inspect. - * @param {*} value The value to search for. - * @param {number} fromIndex The index to search from. - * @returns {number} Returns the index of the matched value, else `-1`. - */ - function strictIndexOf(array, value, fromIndex) { - var index = fromIndex - 1, - length = array.length; - - while (++index < length) { - if (array[index] === value) { - return index; - } - } - return -1; - } - - /** - * A specialized version of `_.lastIndexOf` which performs strict equality - * comparisons of values, i.e. `===`. - * - * @private - * @param {Array} array The array to inspect. - * @param {*} value The value to search for. - * @param {number} fromIndex The index to search from. - * @returns {number} Returns the index of the matched value, else `-1`. - */ - function strictLastIndexOf(array, value, fromIndex) { - var index = fromIndex + 1; - while (index--) { - if (array[index] === value) { - return index; - } - } - return index; - } - - /** - * Gets the number of symbols in `string`. - * - * @private - * @param {string} string The string to inspect. - * @returns {number} Returns the string size. - */ - function stringSize(string) { - return hasUnicode(string) - ? unicodeSize(string) - : asciiSize(string); - } - - /** - * Converts `string` to an array. - * - * @private - * @param {string} string The string to convert. - * @returns {Array} Returns the converted array. - */ - function stringToArray(string) { - return hasUnicode(string) - ? unicodeToArray(string) - : asciiToArray(string); - } - - /** - * Used by `_.unescape` to convert HTML entities to characters. - * - * @private - * @param {string} chr The matched character to unescape. - * @returns {string} Returns the unescaped character. - */ - var unescapeHtmlChar = basePropertyOf(htmlUnescapes); - - /** - * Gets the size of a Unicode `string`. - * - * @private - * @param {string} string The string inspect. - * @returns {number} Returns the string size. - */ - function unicodeSize(string) { - var result = reUnicode.lastIndex = 0; - while (reUnicode.test(string)) { - ++result; - } - return result; - } - - /** - * Converts a Unicode `string` to an array. - * - * @private - * @param {string} string The string to convert. - * @returns {Array} Returns the converted array. - */ - function unicodeToArray(string) { - return string.match(reUnicode) || []; - } - - /** - * Splits a Unicode `string` into an array of its words. - * - * @private - * @param {string} The string to inspect. - * @returns {Array} Returns the words of `string`. - */ - function unicodeWords(string) { - return string.match(reUnicodeWord) || []; - } - - /*--------------------------------------------------------------------------*/ - - /** - * Create a new pristine `lodash` function using the `context` object. - * - * @static - * @memberOf _ - * @since 1.1.0 - * @category Util - * @param {Object} [context=root] The context object. - * @returns {Function} Returns a new `lodash` function. - * @example - * - * _.mixin({ 'foo': _.constant('foo') }); - * - * var lodash = _.runInContext(); - * lodash.mixin({ 'bar': lodash.constant('bar') }); - * - * _.isFunction(_.foo); - * // => true - * _.isFunction(_.bar); - * // => false - * - * lodash.isFunction(lodash.foo); - * // => false - * lodash.isFunction(lodash.bar); - * // => true - * - * // Create a suped-up `defer` in Node.js. - * var defer = _.runInContext({ 'setTimeout': setImmediate }).defer; - */ - var runInContext = (function runInContext(context) { - context = context == null ? root : _.defaults(root.Object(), context, _.pick(root, contextProps)); - - /** Built-in constructor references. */ - var Array = context.Array, - Date = context.Date, - Error = context.Error, - Function = context.Function, - Math = context.Math, - Object = context.Object, - RegExp = context.RegExp, - String = context.String, - TypeError = context.TypeError; - - /** Used for built-in method references. */ - var arrayProto = Array.prototype, - funcProto = Function.prototype, - objectProto = Object.prototype; - - /** Used to detect overreaching core-js shims. */ - var coreJsData = context['__core-js_shared__']; - - /** Used to resolve the decompiled source of functions. */ - var funcToString = funcProto.toString; - - /** Used to check objects for own properties. */ - var hasOwnProperty = objectProto.hasOwnProperty; - - /** Used to generate unique IDs. */ - var idCounter = 0; - - /** Used to detect methods masquerading as native. */ - var maskSrcKey = (function() { - var uid = /[^.]+$/.exec(coreJsData && coreJsData.keys && coreJsData.keys.IE_PROTO || ''); - return uid ? ('Symbol(src)_1.' + uid) : ''; - }()); - - /** - * Used to resolve the - * [`toStringTag`](http://ecma-international.org/ecma-262/7.0/#sec-object.prototype.tostring) - * of values. - */ - var nativeObjectToString = objectProto.toString; - - /** Used to infer the `Object` constructor. */ - var objectCtorString = funcToString.call(Object); - - /** Used to restore the original `_` reference in `_.noConflict`. */ - var oldDash = root._; - - /** Used to detect if a method is native. */ - var reIsNative = RegExp('^' + - funcToString.call(hasOwnProperty).replace(reRegExpChar, '\\$&') - .replace(/hasOwnProperty|(function).*?(?=\\\()| for .+?(?=\\\])/g, '$1.*?') + '$' - ); - - /** Built-in value references. */ - var Buffer = moduleExports ? context.Buffer : undefined, - Symbol = context.Symbol, - Uint8Array = context.Uint8Array, - allocUnsafe = Buffer ? Buffer.allocUnsafe : undefined, - getPrototype = overArg(Object.getPrototypeOf, Object), - objectCreate = Object.create, - propertyIsEnumerable = objectProto.propertyIsEnumerable, - splice = arrayProto.splice, - spreadableSymbol = Symbol ? Symbol.isConcatSpreadable : undefined, - symIterator = Symbol ? Symbol.iterator : undefined, - symToStringTag = Symbol ? Symbol.toStringTag : undefined; - - var defineProperty = (function() { - try { - var func = getNative(Object, 'defineProperty'); - func({}, '', {}); - return func; - } catch (e) {} - }()); - - /** Mocked built-ins. */ - var ctxClearTimeout = context.clearTimeout !== root.clearTimeout && context.clearTimeout, - ctxNow = Date && Date.now !== root.Date.now && Date.now, - ctxSetTimeout = context.setTimeout !== root.setTimeout && context.setTimeout; - - /* Built-in method references for those with the same name as other `lodash` methods. */ - var nativeCeil = Math.ceil, - nativeFloor = Math.floor, - nativeGetSymbols = Object.getOwnPropertySymbols, - nativeIsBuffer = Buffer ? Buffer.isBuffer : undefined, - nativeIsFinite = context.isFinite, - nativeJoin = arrayProto.join, - nativeKeys = overArg(Object.keys, Object), - nativeMax = Math.max, - nativeMin = Math.min, - nativeNow = Date.now, - nativeParseInt = context.parseInt, - nativeRandom = Math.random, - nativeReverse = arrayProto.reverse; - - /* Built-in method references that are verified to be native. */ - var DataView = getNative(context, 'DataView'), - Map = getNative(context, 'Map'), - Promise = getNative(context, 'Promise'), - Set = getNative(context, 'Set'), - WeakMap = getNative(context, 'WeakMap'), - nativeCreate = getNative(Object, 'create'); - - /** Used to store function metadata. */ - var metaMap = WeakMap && new WeakMap; - - /** Used to lookup unminified function names. */ - var realNames = {}; - - /** Used to detect maps, sets, and weakmaps. */ - var dataViewCtorString = toSource(DataView), - mapCtorString = toSource(Map), - promiseCtorString = toSource(Promise), - setCtorString = toSource(Set), - weakMapCtorString = toSource(WeakMap); - - /** Used to convert symbols to primitives and strings. */ - var symbolProto = Symbol ? Symbol.prototype : undefined, - symbolValueOf = symbolProto ? symbolProto.valueOf : undefined, - symbolToString = symbolProto ? symbolProto.toString : undefined; - - /*------------------------------------------------------------------------*/ - - /** - * Creates a `lodash` object which wraps `value` to enable implicit method - * chain sequences. Methods that operate on and return arrays, collections, - * and functions can be chained together. Methods that retrieve a single value - * or may return a primitive value will automatically end the chain sequence - * and return the unwrapped value. Otherwise, the value must be unwrapped - * with `_#value`. - * - * Explicit chain sequences, which must be unwrapped with `_#value`, may be - * enabled using `_.chain`. - * - * The execution of chained methods is lazy, that is, it's deferred until - * `_#value` is implicitly or explicitly called. - * - * Lazy evaluation allows several methods to support shortcut fusion. - * Shortcut fusion is an optimization to merge iteratee calls; this avoids - * the creation of intermediate arrays and can greatly reduce the number of - * iteratee executions. Sections of a chain sequence qualify for shortcut - * fusion if the section is applied to an array and iteratees accept only - * one argument. The heuristic for whether a section qualifies for shortcut - * fusion is subject to change. - * - * Chaining is supported in custom builds as long as the `_#value` method is - * directly or indirectly included in the build. - * - * In addition to lodash methods, wrappers have `Array` and `String` methods. - * - * The wrapper `Array` methods are: - * `concat`, `join`, `pop`, `push`, `shift`, `sort`, `splice`, and `unshift` - * - * The wrapper `String` methods are: - * `replace` and `split` - * - * The wrapper methods that support shortcut fusion are: - * `at`, `compact`, `drop`, `dropRight`, `dropWhile`, `filter`, `find`, - * `findLast`, `head`, `initial`, `last`, `map`, `reject`, `reverse`, `slice`, - * `tail`, `take`, `takeRight`, `takeRightWhile`, `takeWhile`, and `toArray` - * - * The chainable wrapper methods are: - * `after`, `ary`, `assign`, `assignIn`, `assignInWith`, `assignWith`, `at`, - * `before`, `bind`, `bindAll`, `bindKey`, `castArray`, `chain`, `chunk`, - * `commit`, `compact`, `concat`, `conforms`, `constant`, `countBy`, `create`, - * `curry`, `debounce`, `defaults`, `defaultsDeep`, `defer`, `delay`, - * `difference`, `differenceBy`, `differenceWith`, `drop`, `dropRight`, - * `dropRightWhile`, `dropWhile`, `extend`, `extendWith`, `fill`, `filter`, - * `flatMap`, `flatMapDeep`, `flatMapDepth`, `flatten`, `flattenDeep`, - * `flattenDepth`, `flip`, `flow`, `flowRight`, `fromPairs`, `functions`, - * `functionsIn`, `groupBy`, `initial`, `intersection`, `intersectionBy`, - * `intersectionWith`, `invert`, `invertBy`, `invokeMap`, `iteratee`, `keyBy`, - * `keys`, `keysIn`, `map`, `mapKeys`, `mapValues`, `matches`, `matchesProperty`, - * `memoize`, `merge`, `mergeWith`, `method`, `methodOf`, `mixin`, `negate`, - * `nthArg`, `omit`, `omitBy`, `once`, `orderBy`, `over`, `overArgs`, - * `overEvery`, `overSome`, `partial`, `partialRight`, `partition`, `pick`, - * `pickBy`, `plant`, `property`, `propertyOf`, `pull`, `pullAll`, `pullAllBy`, - * `pullAllWith`, `pullAt`, `push`, `range`, `rangeRight`, `rearg`, `reject`, - * `remove`, `rest`, `reverse`, `sampleSize`, `set`, `setWith`, `shuffle`, - * `slice`, `sort`, `sortBy`, `splice`, `spread`, `tail`, `take`, `takeRight`, - * `takeRightWhile`, `takeWhile`, `tap`, `throttle`, `thru`, `toArray`, - * `toPairs`, `toPairsIn`, `toPath`, `toPlainObject`, `transform`, `unary`, - * `union`, `unionBy`, `unionWith`, `uniq`, `uniqBy`, `uniqWith`, `unset`, - * `unshift`, `unzip`, `unzipWith`, `update`, `updateWith`, `values`, - * `valuesIn`, `without`, `wrap`, `xor`, `xorBy`, `xorWith`, `zip`, - * `zipObject`, `zipObjectDeep`, and `zipWith` - * - * The wrapper methods that are **not** chainable by default are: - * `add`, `attempt`, `camelCase`, `capitalize`, `ceil`, `clamp`, `clone`, - * `cloneDeep`, `cloneDeepWith`, `cloneWith`, `conformsTo`, `deburr`, - * `defaultTo`, `divide`, `each`, `eachRight`, `endsWith`, `eq`, `escape`, - * `escapeRegExp`, `every`, `find`, `findIndex`, `findKey`, `findLast`, - * `findLastIndex`, `findLastKey`, `first`, `floor`, `forEach`, `forEachRight`, - * `forIn`, `forInRight`, `forOwn`, `forOwnRight`, `get`, `gt`, `gte`, `has`, - * `hasIn`, `head`, `identity`, `includes`, `indexOf`, `inRange`, `invoke`, - * `isArguments`, `isArray`, `isArrayBuffer`, `isArrayLike`, `isArrayLikeObject`, - * `isBoolean`, `isBuffer`, `isDate`, `isElement`, `isEmpty`, `isEqual`, - * `isEqualWith`, `isError`, `isFinite`, `isFunction`, `isInteger`, `isLength`, - * `isMap`, `isMatch`, `isMatchWith`, `isNaN`, `isNative`, `isNil`, `isNull`, - * `isNumber`, `isObject`, `isObjectLike`, `isPlainObject`, `isRegExp`, - * `isSafeInteger`, `isSet`, `isString`, `isUndefined`, `isTypedArray`, - * `isWeakMap`, `isWeakSet`, `join`, `kebabCase`, `last`, `lastIndexOf`, - * `lowerCase`, `lowerFirst`, `lt`, `lte`, `max`, `maxBy`, `mean`, `meanBy`, - * `min`, `minBy`, `multiply`, `noConflict`, `noop`, `now`, `nth`, `pad`, - * `padEnd`, `padStart`, `parseInt`, `pop`, `random`, `reduce`, `reduceRight`, - * `repeat`, `result`, `round`, `runInContext`, `sample`, `shift`, `size`, - * `snakeCase`, `some`, `sortedIndex`, `sortedIndexBy`, `sortedLastIndex`, - * `sortedLastIndexBy`, `startCase`, `startsWith`, `stubArray`, `stubFalse`, - * `stubObject`, `stubString`, `stubTrue`, `subtract`, `sum`, `sumBy`, - * `template`, `times`, `toFinite`, `toInteger`, `toJSON`, `toLength`, - * `toLower`, `toNumber`, `toSafeInteger`, `toString`, `toUpper`, `trim`, - * `trimEnd`, `trimStart`, `truncate`, `unescape`, `uniqueId`, `upperCase`, - * `upperFirst`, `value`, and `words` - * - * @name _ - * @constructor - * @category Seq - * @param {*} value The value to wrap in a `lodash` instance. - * @returns {Object} Returns the new `lodash` wrapper instance. - * @example - * - * function square(n) { - * return n * n; - * } - * - * var wrapped = _([1, 2, 3]); - * - * // Returns an unwrapped value. - * wrapped.reduce(_.add); - * // => 6 - * - * // Returns a wrapped value. - * var squares = wrapped.map(square); - * - * _.isArray(squares); - * // => false - * - * _.isArray(squares.value()); - * // => true - */ - function lodash(value) { - if (isObjectLike(value) && !isArray(value) && !(value instanceof LazyWrapper)) { - if (value instanceof LodashWrapper) { - return value; - } - if (hasOwnProperty.call(value, '__wrapped__')) { - return wrapperClone(value); - } - } - return new LodashWrapper(value); - } - - /** - * The base implementation of `_.create` without support for assigning - * properties to the created object. - * - * @private - * @param {Object} proto The object to inherit from. - * @returns {Object} Returns the new object. - */ - var baseCreate = (function() { - function object() {} - return function(proto) { - if (!isObject(proto)) { - return {}; - } - if (objectCreate) { - return objectCreate(proto); - } - object.prototype = proto; - var result = new object; - object.prototype = undefined; - return result; - }; - }()); - - /** - * The function whose prototype chain sequence wrappers inherit from. - * - * @private - */ - function baseLodash() { - // No operation performed. - } - - /** - * The base constructor for creating `lodash` wrapper objects. - * - * @private - * @param {*} value The value to wrap. - * @param {boolean} [chainAll] Enable explicit method chain sequences. - */ - function LodashWrapper(value, chainAll) { - this.__wrapped__ = value; - this.__actions__ = []; - this.__chain__ = !!chainAll; - this.__index__ = 0; - this.__values__ = undefined; - } - - /** - * By default, the template delimiters used by lodash are like those in - * embedded Ruby (ERB) as well as ES2015 template strings. Change the - * following template settings to use alternative delimiters. - * - * @static - * @memberOf _ - * @type {Object} - */ - lodash.templateSettings = { - - /** - * Used to detect `data` property values to be HTML-escaped. - * - * @memberOf _.templateSettings - * @type {RegExp} - */ - 'escape': reEscape, - - /** - * Used to detect code to be evaluated. - * - * @memberOf _.templateSettings - * @type {RegExp} - */ - 'evaluate': reEvaluate, - - /** - * Used to detect `data` property values to inject. - * - * @memberOf _.templateSettings - * @type {RegExp} - */ - 'interpolate': reInterpolate, - - /** - * Used to reference the data object in the template text. - * - * @memberOf _.templateSettings - * @type {string} - */ - 'variable': '', - - /** - * Used to import variables into the compiled template. - * - * @memberOf _.templateSettings - * @type {Object} - */ - 'imports': { - - /** - * A reference to the `lodash` function. - * - * @memberOf _.templateSettings.imports - * @type {Function} - */ - '_': lodash - } - }; - - // Ensure wrappers are instances of `baseLodash`. - lodash.prototype = baseLodash.prototype; - lodash.prototype.constructor = lodash; - - LodashWrapper.prototype = baseCreate(baseLodash.prototype); - LodashWrapper.prototype.constructor = LodashWrapper; - - /*------------------------------------------------------------------------*/ - - /** - * Creates a lazy wrapper object which wraps `value` to enable lazy evaluation. - * - * @private - * @constructor - * @param {*} value The value to wrap. - */ - function LazyWrapper(value) { - this.__wrapped__ = value; - this.__actions__ = []; - this.__dir__ = 1; - this.__filtered__ = false; - this.__iteratees__ = []; - this.__takeCount__ = MAX_ARRAY_LENGTH; - this.__views__ = []; - } - - /** - * Creates a clone of the lazy wrapper object. - * - * @private - * @name clone - * @memberOf LazyWrapper - * @returns {Object} Returns the cloned `LazyWrapper` object. - */ - function lazyClone() { - var result = new LazyWrapper(this.__wrapped__); - result.__actions__ = copyArray(this.__actions__); - result.__dir__ = this.__dir__; - result.__filtered__ = this.__filtered__; - result.__iteratees__ = copyArray(this.__iteratees__); - result.__takeCount__ = this.__takeCount__; - result.__views__ = copyArray(this.__views__); - return result; - } - - /** - * Reverses the direction of lazy iteration. - * - * @private - * @name reverse - * @memberOf LazyWrapper - * @returns {Object} Returns the new reversed `LazyWrapper` object. - */ - function lazyReverse() { - if (this.__filtered__) { - var result = new LazyWrapper(this); - result.__dir__ = -1; - result.__filtered__ = true; - } else { - result = this.clone(); - result.__dir__ *= -1; - } - return result; - } - - /** - * Extracts the unwrapped value from its lazy wrapper. - * - * @private - * @name value - * @memberOf LazyWrapper - * @returns {*} Returns the unwrapped value. - */ - function lazyValue() { - var array = this.__wrapped__.value(), - dir = this.__dir__, - isArr = isArray(array), - isRight = dir < 0, - arrLength = isArr ? array.length : 0, - view = getView(0, arrLength, this.__views__), - start = view.start, - end = view.end, - length = end - start, - index = isRight ? end : (start - 1), - iteratees = this.__iteratees__, - iterLength = iteratees.length, - resIndex = 0, - takeCount = nativeMin(length, this.__takeCount__); - - if (!isArr || (!isRight && arrLength == length && takeCount == length)) { - return baseWrapperValue(array, this.__actions__); - } - var result = []; - - outer: - while (length-- && resIndex < takeCount) { - index += dir; - - var iterIndex = -1, - value = array[index]; - - while (++iterIndex < iterLength) { - var data = iteratees[iterIndex], - iteratee = data.iteratee, - type = data.type, - computed = iteratee(value); - - if (type == LAZY_MAP_FLAG) { - value = computed; - } else if (!computed) { - if (type == LAZY_FILTER_FLAG) { - continue outer; - } else { - break outer; - } - } - } - result[resIndex++] = value; - } - return result; - } - - // Ensure `LazyWrapper` is an instance of `baseLodash`. - LazyWrapper.prototype = baseCreate(baseLodash.prototype); - LazyWrapper.prototype.constructor = LazyWrapper; - - /*------------------------------------------------------------------------*/ - - /** - * Creates a hash object. - * - * @private - * @constructor - * @param {Array} [entries] The key-value pairs to cache. - */ - function Hash(entries) { - var index = -1, - length = entries == null ? 0 : entries.length; - - this.clear(); - while (++index < length) { - var entry = entries[index]; - this.set(entry[0], entry[1]); - } - } - - /** - * Removes all key-value entries from the hash. - * - * @private - * @name clear - * @memberOf Hash - */ - function hashClear() { - this.__data__ = nativeCreate ? nativeCreate(null) : {}; - this.size = 0; - } - - /** - * Removes `key` and its value from the hash. - * - * @private - * @name delete - * @memberOf Hash - * @param {Object} hash The hash to modify. - * @param {string} key The key of the value to remove. - * @returns {boolean} Returns `true` if the entry was removed, else `false`. - */ - function hashDelete(key) { - var result = this.has(key) && delete this.__data__[key]; - this.size -= result ? 1 : 0; - return result; - } - - /** - * Gets the hash value for `key`. - * - * @private - * @name get - * @memberOf Hash - * @param {string} key The key of the value to get. - * @returns {*} Returns the entry value. - */ - function hashGet(key) { - var data = this.__data__; - if (nativeCreate) { - var result = data[key]; - return result === HASH_UNDEFINED ? undefined : result; - } - return hasOwnProperty.call(data, key) ? data[key] : undefined; - } - - /** - * Checks if a hash value for `key` exists. - * - * @private - * @name has - * @memberOf Hash - * @param {string} key The key of the entry to check. - * @returns {boolean} Returns `true` if an entry for `key` exists, else `false`. - */ - function hashHas(key) { - var data = this.__data__; - return nativeCreate ? (data[key] !== undefined) : hasOwnProperty.call(data, key); - } - - /** - * Sets the hash `key` to `value`. - * - * @private - * @name set - * @memberOf Hash - * @param {string} key The key of the value to set. - * @param {*} value The value to set. - * @returns {Object} Returns the hash instance. - */ - function hashSet(key, value) { - var data = this.__data__; - this.size += this.has(key) ? 0 : 1; - data[key] = (nativeCreate && value === undefined) ? HASH_UNDEFINED : value; - return this; - } - - // Add methods to `Hash`. - Hash.prototype.clear = hashClear; - Hash.prototype['delete'] = hashDelete; - Hash.prototype.get = hashGet; - Hash.prototype.has = hashHas; - Hash.prototype.set = hashSet; - - /*------------------------------------------------------------------------*/ - - /** - * Creates an list cache object. - * - * @private - * @constructor - * @param {Array} [entries] The key-value pairs to cache. - */ - function ListCache(entries) { - var index = -1, - length = entries == null ? 0 : entries.length; - - this.clear(); - while (++index < length) { - var entry = entries[index]; - this.set(entry[0], entry[1]); - } - } - - /** - * Removes all key-value entries from the list cache. - * - * @private - * @name clear - * @memberOf ListCache - */ - function listCacheClear() { - this.__data__ = []; - this.size = 0; - } - - /** - * Removes `key` and its value from the list cache. - * - * @private - * @name delete - * @memberOf ListCache - * @param {string} key The key of the value to remove. - * @returns {boolean} Returns `true` if the entry was removed, else `false`. - */ - function listCacheDelete(key) { - var data = this.__data__, - index = assocIndexOf(data, key); - - if (index < 0) { - return false; - } - var lastIndex = data.length - 1; - if (index == lastIndex) { - data.pop(); - } else { - splice.call(data, index, 1); - } - --this.size; - return true; - } - - /** - * Gets the list cache value for `key`. - * - * @private - * @name get - * @memberOf ListCache - * @param {string} key The key of the value to get. - * @returns {*} Returns the entry value. - */ - function listCacheGet(key) { - var data = this.__data__, - index = assocIndexOf(data, key); - - return index < 0 ? undefined : data[index][1]; - } - - /** - * Checks if a list cache value for `key` exists. - * - * @private - * @name has - * @memberOf ListCache - * @param {string} key The key of the entry to check. - * @returns {boolean} Returns `true` if an entry for `key` exists, else `false`. - */ - function listCacheHas(key) { - return assocIndexOf(this.__data__, key) > -1; - } - - /** - * Sets the list cache `key` to `value`. - * - * @private - * @name set - * @memberOf ListCache - * @param {string} key The key of the value to set. - * @param {*} value The value to set. - * @returns {Object} Returns the list cache instance. - */ - function listCacheSet(key, value) { - var data = this.__data__, - index = assocIndexOf(data, key); - - if (index < 0) { - ++this.size; - data.push([key, value]); - } else { - data[index][1] = value; - } - return this; - } - - // Add methods to `ListCache`. - ListCache.prototype.clear = listCacheClear; - ListCache.prototype['delete'] = listCacheDelete; - ListCache.prototype.get = listCacheGet; - ListCache.prototype.has = listCacheHas; - ListCache.prototype.set = listCacheSet; - - /*------------------------------------------------------------------------*/ - - /** - * Creates a map cache object to store key-value pairs. - * - * @private - * @constructor - * @param {Array} [entries] The key-value pairs to cache. - */ - function MapCache(entries) { - var index = -1, - length = entries == null ? 0 : entries.length; - - this.clear(); - while (++index < length) { - var entry = entries[index]; - this.set(entry[0], entry[1]); - } - } - - /** - * Removes all key-value entries from the map. - * - * @private - * @name clear - * @memberOf MapCache - */ - function mapCacheClear() { - this.size = 0; - this.__data__ = { - 'hash': new Hash, - 'map': new (Map || ListCache), - 'string': new Hash - }; - } - - /** - * Removes `key` and its value from the map. - * - * @private - * @name delete - * @memberOf MapCache - * @param {string} key The key of the value to remove. - * @returns {boolean} Returns `true` if the entry was removed, else `false`. - */ - function mapCacheDelete(key) { - var result = getMapData(this, key)['delete'](key); - this.size -= result ? 1 : 0; - return result; - } - - /** - * Gets the map value for `key`. - * - * @private - * @name get - * @memberOf MapCache - * @param {string} key The key of the value to get. - * @returns {*} Returns the entry value. - */ - function mapCacheGet(key) { - return getMapData(this, key).get(key); - } - - /** - * Checks if a map value for `key` exists. - * - * @private - * @name has - * @memberOf MapCache - * @param {string} key The key of the entry to check. - * @returns {boolean} Returns `true` if an entry for `key` exists, else `false`. - */ - function mapCacheHas(key) { - return getMapData(this, key).has(key); - } - - /** - * Sets the map `key` to `value`. - * - * @private - * @name set - * @memberOf MapCache - * @param {string} key The key of the value to set. - * @param {*} value The value to set. - * @returns {Object} Returns the map cache instance. - */ - function mapCacheSet(key, value) { - var data = getMapData(this, key), - size = data.size; - - data.set(key, value); - this.size += data.size == size ? 0 : 1; - return this; - } - - // Add methods to `MapCache`. - MapCache.prototype.clear = mapCacheClear; - MapCache.prototype['delete'] = mapCacheDelete; - MapCache.prototype.get = mapCacheGet; - MapCache.prototype.has = mapCacheHas; - MapCache.prototype.set = mapCacheSet; - - /*------------------------------------------------------------------------*/ - - /** - * - * Creates an array cache object to store unique values. - * - * @private - * @constructor - * @param {Array} [values] The values to cache. - */ - function SetCache(values) { - var index = -1, - length = values == null ? 0 : values.length; - - this.__data__ = new MapCache; - while (++index < length) { - this.add(values[index]); - } - } - - /** - * Adds `value` to the array cache. - * - * @private - * @name add - * @memberOf SetCache - * @alias push - * @param {*} value The value to cache. - * @returns {Object} Returns the cache instance. - */ - function setCacheAdd(value) { - this.__data__.set(value, HASH_UNDEFINED); - return this; - } - - /** - * Checks if `value` is in the array cache. - * - * @private - * @name has - * @memberOf SetCache - * @param {*} value The value to search for. - * @returns {number} Returns `true` if `value` is found, else `false`. - */ - function setCacheHas(value) { - return this.__data__.has(value); - } - - // Add methods to `SetCache`. - SetCache.prototype.add = SetCache.prototype.push = setCacheAdd; - SetCache.prototype.has = setCacheHas; - - /*------------------------------------------------------------------------*/ - - /** - * Creates a stack cache object to store key-value pairs. - * - * @private - * @constructor - * @param {Array} [entries] The key-value pairs to cache. - */ - function Stack(entries) { - var data = this.__data__ = new ListCache(entries); - this.size = data.size; - } - - /** - * Removes all key-value entries from the stack. - * - * @private - * @name clear - * @memberOf Stack - */ - function stackClear() { - this.__data__ = new ListCache; - this.size = 0; - } - - /** - * Removes `key` and its value from the stack. - * - * @private - * @name delete - * @memberOf Stack - * @param {string} key The key of the value to remove. - * @returns {boolean} Returns `true` if the entry was removed, else `false`. - */ - function stackDelete(key) { - var data = this.__data__, - result = data['delete'](key); - - this.size = data.size; - return result; - } - - /** - * Gets the stack value for `key`. - * - * @private - * @name get - * @memberOf Stack - * @param {string} key The key of the value to get. - * @returns {*} Returns the entry value. - */ - function stackGet(key) { - return this.__data__.get(key); - } - - /** - * Checks if a stack value for `key` exists. - * - * @private - * @name has - * @memberOf Stack - * @param {string} key The key of the entry to check. - * @returns {boolean} Returns `true` if an entry for `key` exists, else `false`. - */ - function stackHas(key) { - return this.__data__.has(key); - } - - /** - * Sets the stack `key` to `value`. - * - * @private - * @name set - * @memberOf Stack - * @param {string} key The key of the value to set. - * @param {*} value The value to set. - * @returns {Object} Returns the stack cache instance. - */ - function stackSet(key, value) { - var data = this.__data__; - if (data instanceof ListCache) { - var pairs = data.__data__; - if (!Map || (pairs.length < LARGE_ARRAY_SIZE - 1)) { - pairs.push([key, value]); - this.size = ++data.size; - return this; - } - data = this.__data__ = new MapCache(pairs); - } - data.set(key, value); - this.size = data.size; - return this; - } - - // Add methods to `Stack`. - Stack.prototype.clear = stackClear; - Stack.prototype['delete'] = stackDelete; - Stack.prototype.get = stackGet; - Stack.prototype.has = stackHas; - Stack.prototype.set = stackSet; - - /*------------------------------------------------------------------------*/ - - /** - * Creates an array of the enumerable property names of the array-like `value`. - * - * @private - * @param {*} value The value to query. - * @param {boolean} inherited Specify returning inherited property names. - * @returns {Array} Returns the array of property names. - */ - function arrayLikeKeys(value, inherited) { - var isArr = isArray(value), - isArg = !isArr && isArguments(value), - isBuff = !isArr && !isArg && isBuffer(value), - isType = !isArr && !isArg && !isBuff && isTypedArray(value), - skipIndexes = isArr || isArg || isBuff || isType, - result = skipIndexes ? baseTimes(value.length, String) : [], - length = result.length; - - for (var key in value) { - if ((inherited || hasOwnProperty.call(value, key)) && - !(skipIndexes && ( - // Safari 9 has enumerable `arguments.length` in strict mode. - key == 'length' || - // Node.js 0.10 has enumerable non-index properties on buffers. - (isBuff && (key == 'offset' || key == 'parent')) || - // PhantomJS 2 has enumerable non-index properties on typed arrays. - (isType && (key == 'buffer' || key == 'byteLength' || key == 'byteOffset')) || - // Skip index properties. - isIndex(key, length) - ))) { - result.push(key); - } - } - return result; - } - - /** - * A specialized version of `_.sample` for arrays. - * - * @private - * @param {Array} array The array to sample. - * @returns {*} Returns the random element. - */ - function arraySample(array) { - var length = array.length; - return length ? array[baseRandom(0, length - 1)] : undefined; - } - - /** - * A specialized version of `_.sampleSize` for arrays. - * - * @private - * @param {Array} array The array to sample. - * @param {number} n The number of elements to sample. - * @returns {Array} Returns the random elements. - */ - function arraySampleSize(array, n) { - return shuffleSelf(copyArray(array), baseClamp(n, 0, array.length)); - } - - /** - * A specialized version of `_.shuffle` for arrays. - * - * @private - * @param {Array} array The array to shuffle. - * @returns {Array} Returns the new shuffled array. - */ - function arrayShuffle(array) { - return shuffleSelf(copyArray(array)); - } - - /** - * This function is like `assignValue` except that it doesn't assign - * `undefined` values. - * - * @private - * @param {Object} object The object to modify. - * @param {string} key The key of the property to assign. - * @param {*} value The value to assign. - */ - function assignMergeValue(object, key, value) { - if ((value !== undefined && !eq(object[key], value)) || - (value === undefined && !(key in object))) { - baseAssignValue(object, key, value); - } - } - - /** - * Assigns `value` to `key` of `object` if the existing value is not equivalent - * using [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero) - * for equality comparisons. - * - * @private - * @param {Object} object The object to modify. - * @param {string} key The key of the property to assign. - * @param {*} value The value to assign. - */ - function assignValue(object, key, value) { - var objValue = object[key]; - if (!(hasOwnProperty.call(object, key) && eq(objValue, value)) || - (value === undefined && !(key in object))) { - baseAssignValue(object, key, value); - } - } - - /** - * Gets the index at which the `key` is found in `array` of key-value pairs. - * - * @private - * @param {Array} array The array to inspect. - * @param {*} key The key to search for. - * @returns {number} Returns the index of the matched value, else `-1`. - */ - function assocIndexOf(array, key) { - var length = array.length; - while (length--) { - if (eq(array[length][0], key)) { - return length; - } - } - return -1; - } - - /** - * Aggregates elements of `collection` on `accumulator` with keys transformed - * by `iteratee` and values set by `setter`. - * - * @private - * @param {Array|Object} collection The collection to iterate over. - * @param {Function} setter The function to set `accumulator` values. - * @param {Function} iteratee The iteratee to transform keys. - * @param {Object} accumulator The initial aggregated object. - * @returns {Function} Returns `accumulator`. - */ - function baseAggregator(collection, setter, iteratee, accumulator) { - baseEach(collection, function(value, key, collection) { - setter(accumulator, value, iteratee(value), collection); - }); - return accumulator; - } - - /** - * The base implementation of `_.assign` without support for multiple sources - * or `customizer` functions. - * - * @private - * @param {Object} object The destination object. - * @param {Object} source The source object. - * @returns {Object} Returns `object`. - */ - function baseAssign(object, source) { - return object && copyObject(source, keys(source), object); - } - - /** - * The base implementation of `_.assignIn` without support for multiple sources - * or `customizer` functions. - * - * @private - * @param {Object} object The destination object. - * @param {Object} source The source object. - * @returns {Object} Returns `object`. - */ - function baseAssignIn(object, source) { - return object && copyObject(source, keysIn(source), object); - } - - /** - * The base implementation of `assignValue` and `assignMergeValue` without - * value checks. - * - * @private - * @param {Object} object The object to modify. - * @param {string} key The key of the property to assign. - * @param {*} value The value to assign. - */ - function baseAssignValue(object, key, value) { - if (key == '__proto__' && defineProperty) { - defineProperty(object, key, { - 'configurable': true, - 'enumerable': true, - 'value': value, - 'writable': true - }); - } else { - object[key] = value; - } - } - - /** - * The base implementation of `_.at` without support for individual paths. - * - * @private - * @param {Object} object The object to iterate over. - * @param {string[]} paths The property paths to pick. - * @returns {Array} Returns the picked elements. - */ - function baseAt(object, paths) { - var index = -1, - length = paths.length, - result = Array(length), - skip = object == null; - - while (++index < length) { - result[index] = skip ? undefined : get(object, paths[index]); - } - return result; - } - - /** - * The base implementation of `_.clamp` which doesn't coerce arguments. - * - * @private - * @param {number} number The number to clamp. - * @param {number} [lower] The lower bound. - * @param {number} upper The upper bound. - * @returns {number} Returns the clamped number. - */ - function baseClamp(number, lower, upper) { - if (number === number) { - if (upper !== undefined) { - number = number <= upper ? number : upper; - } - if (lower !== undefined) { - number = number >= lower ? number : lower; - } - } - return number; - } - - /** - * The base implementation of `_.clone` and `_.cloneDeep` which tracks - * traversed objects. - * - * @private - * @param {*} value The value to clone. - * @param {boolean} bitmask The bitmask flags. - * 1 - Deep clone - * 2 - Flatten inherited properties - * 4 - Clone symbols - * @param {Function} [customizer] The function to customize cloning. - * @param {string} [key] The key of `value`. - * @param {Object} [object] The parent object of `value`. - * @param {Object} [stack] Tracks traversed objects and their clone counterparts. - * @returns {*} Returns the cloned value. - */ - function baseClone(value, bitmask, customizer, key, object, stack) { - var result, - isDeep = bitmask & CLONE_DEEP_FLAG, - isFlat = bitmask & CLONE_FLAT_FLAG, - isFull = bitmask & CLONE_SYMBOLS_FLAG; - - if (customizer) { - result = object ? customizer(value, key, object, stack) : customizer(value); - } - if (result !== undefined) { - return result; - } - if (!isObject(value)) { - return value; - } - var isArr = isArray(value); - if (isArr) { - result = initCloneArray(value); - if (!isDeep) { - return copyArray(value, result); - } - } else { - var tag = getTag(value), - isFunc = tag == funcTag || tag == genTag; - - if (isBuffer(value)) { - return cloneBuffer(value, isDeep); - } - if (tag == objectTag || tag == argsTag || (isFunc && !object)) { - result = (isFlat || isFunc) ? {} : initCloneObject(value); - if (!isDeep) { - return isFlat - ? copySymbolsIn(value, baseAssignIn(result, value)) - : copySymbols(value, baseAssign(result, value)); - } - } else { - if (!cloneableTags[tag]) { - return object ? value : {}; - } - result = initCloneByTag(value, tag, isDeep); - } - } - // Check for circular references and return its corresponding clone. - stack || (stack = new Stack); - var stacked = stack.get(value); - if (stacked) { - return stacked; - } - stack.set(value, result); - - if (isSet(value)) { - value.forEach(function(subValue) { - result.add(baseClone(subValue, bitmask, customizer, subValue, value, stack)); - }); - - return result; - } - - if (isMap(value)) { - value.forEach(function(subValue, key) { - result.set(key, baseClone(subValue, bitmask, customizer, key, value, stack)); - }); - - return result; - } - - var keysFunc = isFull - ? (isFlat ? getAllKeysIn : getAllKeys) - : (isFlat ? keysIn : keys); - - var props = isArr ? undefined : keysFunc(value); - arrayEach(props || value, function(subValue, key) { - if (props) { - key = subValue; - subValue = value[key]; - } - // Recursively populate clone (susceptible to call stack limits). - assignValue(result, key, baseClone(subValue, bitmask, customizer, key, value, stack)); - }); - return result; - } - - /** - * The base implementation of `_.conforms` which doesn't clone `source`. - * - * @private - * @param {Object} source The object of property predicates to conform to. - * @returns {Function} Returns the new spec function. - */ - function baseConforms(source) { - var props = keys(source); - return function(object) { - return baseConformsTo(object, source, props); - }; - } - - /** - * The base implementation of `_.conformsTo` which accepts `props` to check. - * - * @private - * @param {Object} object The object to inspect. - * @param {Object} source The object of property predicates to conform to. - * @returns {boolean} Returns `true` if `object` conforms, else `false`. - */ - function baseConformsTo(object, source, props) { - var length = props.length; - if (object == null) { - return !length; - } - object = Object(object); - while (length--) { - var key = props[length], - predicate = source[key], - value = object[key]; - - if ((value === undefined && !(key in object)) || !predicate(value)) { - return false; - } - } - return true; - } - - /** - * The base implementation of `_.delay` and `_.defer` which accepts `args` - * to provide to `func`. - * - * @private - * @param {Function} func The function to delay. - * @param {number} wait The number of milliseconds to delay invocation. - * @param {Array} args The arguments to provide to `func`. - * @returns {number|Object} Returns the timer id or timeout object. - */ - function baseDelay(func, wait, args) { - if (typeof func != 'function') { - throw new TypeError(FUNC_ERROR_TEXT); - } - return setTimeout(function() { func.apply(undefined, args); }, wait); - } - - /** - * The base implementation of methods like `_.difference` without support - * for excluding multiple arrays or iteratee shorthands. - * - * @private - * @param {Array} array The array to inspect. - * @param {Array} values The values to exclude. - * @param {Function} [iteratee] The iteratee invoked per element. - * @param {Function} [comparator] The comparator invoked per element. - * @returns {Array} Returns the new array of filtered values. - */ - function baseDifference(array, values, iteratee, comparator) { - var index = -1, - includes = arrayIncludes, - isCommon = true, - length = array.length, - result = [], - valuesLength = values.length; - - if (!length) { - return result; - } - if (iteratee) { - values = arrayMap(values, baseUnary(iteratee)); - } - if (comparator) { - includes = arrayIncludesWith; - isCommon = false; - } - else if (values.length >= LARGE_ARRAY_SIZE) { - includes = cacheHas; - isCommon = false; - values = new SetCache(values); - } - outer: - while (++index < length) { - var value = array[index], - computed = iteratee == null ? value : iteratee(value); - - value = (comparator || value !== 0) ? value : 0; - if (isCommon && computed === computed) { - var valuesIndex = valuesLength; - while (valuesIndex--) { - if (values[valuesIndex] === computed) { - continue outer; - } - } - result.push(value); - } - else if (!includes(values, computed, comparator)) { - result.push(value); - } - } - return result; - } - - /** - * The base implementation of `_.forEach` without support for iteratee shorthands. - * - * @private - * @param {Array|Object} collection The collection to iterate over. - * @param {Function} iteratee The function invoked per iteration. - * @returns {Array|Object} Returns `collection`. - */ - var baseEach = createBaseEach(baseForOwn); - - /** - * The base implementation of `_.forEachRight` without support for iteratee shorthands. - * - * @private - * @param {Array|Object} collection The collection to iterate over. - * @param {Function} iteratee The function invoked per iteration. - * @returns {Array|Object} Returns `collection`. - */ - var baseEachRight = createBaseEach(baseForOwnRight, true); - - /** - * The base implementation of `_.every` without support for iteratee shorthands. - * - * @private - * @param {Array|Object} collection The collection to iterate over. - * @param {Function} predicate The function invoked per iteration. - * @returns {boolean} Returns `true` if all elements pass the predicate check, - * else `false` - */ - function baseEvery(collection, predicate) { - var result = true; - baseEach(collection, function(value, index, collection) { - result = !!predicate(value, index, collection); - return result; - }); - return result; - } - - /** - * The base implementation of methods like `_.max` and `_.min` which accepts a - * `comparator` to determine the extremum value. - * - * @private - * @param {Array} array The array to iterate over. - * @param {Function} iteratee The iteratee invoked per iteration. - * @param {Function} comparator The comparator used to compare values. - * @returns {*} Returns the extremum value. - */ - function baseExtremum(array, iteratee, comparator) { - var index = -1, - length = array.length; - - while (++index < length) { - var value = array[index], - current = iteratee(value); - - if (current != null && (computed === undefined - ? (current === current && !isSymbol(current)) - : comparator(current, computed) - )) { - var computed = current, - result = value; - } - } - return result; - } - - /** - * The base implementation of `_.fill` without an iteratee call guard. - * - * @private - * @param {Array} array The array to fill. - * @param {*} value The value to fill `array` with. - * @param {number} [start=0] The start position. - * @param {number} [end=array.length] The end position. - * @returns {Array} Returns `array`. - */ - function baseFill(array, value, start, end) { - var length = array.length; - - start = toInteger(start); - if (start < 0) { - start = -start > length ? 0 : (length + start); - } - end = (end === undefined || end > length) ? length : toInteger(end); - if (end < 0) { - end += length; - } - end = start > end ? 0 : toLength(end); - while (start < end) { - array[start++] = value; - } - return array; - } - - /** - * The base implementation of `_.filter` without support for iteratee shorthands. - * - * @private - * @param {Array|Object} collection The collection to iterate over. - * @param {Function} predicate The function invoked per iteration. - * @returns {Array} Returns the new filtered array. - */ - function baseFilter(collection, predicate) { - var result = []; - baseEach(collection, function(value, index, collection) { - if (predicate(value, index, collection)) { - result.push(value); - } - }); - return result; - } - - /** - * The base implementation of `_.flatten` with support for restricting flattening. - * - * @private - * @param {Array} array The array to flatten. - * @param {number} depth The maximum recursion depth. - * @param {boolean} [predicate=isFlattenable] The function invoked per iteration. - * @param {boolean} [isStrict] Restrict to values that pass `predicate` checks. - * @param {Array} [result=[]] The initial result value. - * @returns {Array} Returns the new flattened array. - */ - function baseFlatten(array, depth, predicate, isStrict, result) { - var index = -1, - length = array.length; - - predicate || (predicate = isFlattenable); - result || (result = []); - - while (++index < length) { - var value = array[index]; - if (depth > 0 && predicate(value)) { - if (depth > 1) { - // Recursively flatten arrays (susceptible to call stack limits). - baseFlatten(value, depth - 1, predicate, isStrict, result); - } else { - arrayPush(result, value); - } - } else if (!isStrict) { - result[result.length] = value; - } - } - return result; - } - - /** - * The base implementation of `baseForOwn` which iterates over `object` - * properties returned by `keysFunc` and invokes `iteratee` for each property. - * Iteratee functions may exit iteration early by explicitly returning `false`. - * - * @private - * @param {Object} object The object to iterate over. - * @param {Function} iteratee The function invoked per iteration. - * @param {Function} keysFunc The function to get the keys of `object`. - * @returns {Object} Returns `object`. - */ - var baseFor = createBaseFor(); - - /** - * This function is like `baseFor` except that it iterates over properties - * in the opposite order. - * - * @private - * @param {Object} object The object to iterate over. - * @param {Function} iteratee The function invoked per iteration. - * @param {Function} keysFunc The function to get the keys of `object`. - * @returns {Object} Returns `object`. - */ - var baseForRight = createBaseFor(true); - - /** - * The base implementation of `_.forOwn` without support for iteratee shorthands. - * - * @private - * @param {Object} object The object to iterate over. - * @param {Function} iteratee The function invoked per iteration. - * @returns {Object} Returns `object`. - */ - function baseForOwn(object, iteratee) { - return object && baseFor(object, iteratee, keys); - } - - /** - * The base implementation of `_.forOwnRight` without support for iteratee shorthands. - * - * @private - * @param {Object} object The object to iterate over. - * @param {Function} iteratee The function invoked per iteration. - * @returns {Object} Returns `object`. - */ - function baseForOwnRight(object, iteratee) { - return object && baseForRight(object, iteratee, keys); - } - - /** - * The base implementation of `_.functions` which creates an array of - * `object` function property names filtered from `props`. - * - * @private - * @param {Object} object The object to inspect. - * @param {Array} props The property names to filter. - * @returns {Array} Returns the function names. - */ - function baseFunctions(object, props) { - return arrayFilter(props, function(key) { - return isFunction(object[key]); - }); - } - - /** - * The base implementation of `_.get` without support for default values. - * - * @private - * @param {Object} object The object to query. - * @param {Array|string} path The path of the property to get. - * @returns {*} Returns the resolved value. - */ - function baseGet(object, path) { - path = castPath(path, object); - - var index = 0, - length = path.length; - - while (object != null && index < length) { - object = object[toKey(path[index++])]; - } - return (index && index == length) ? object : undefined; - } - - /** - * The base implementation of `getAllKeys` and `getAllKeysIn` which uses - * `keysFunc` and `symbolsFunc` to get the enumerable property names and - * symbols of `object`. - * - * @private - * @param {Object} object The object to query. - * @param {Function} keysFunc The function to get the keys of `object`. - * @param {Function} symbolsFunc The function to get the symbols of `object`. - * @returns {Array} Returns the array of property names and symbols. - */ - function baseGetAllKeys(object, keysFunc, symbolsFunc) { - var result = keysFunc(object); - return isArray(object) ? result : arrayPush(result, symbolsFunc(object)); - } - - /** - * The base implementation of `getTag` without fallbacks for buggy environments. - * - * @private - * @param {*} value The value to query. - * @returns {string} Returns the `toStringTag`. - */ - function baseGetTag(value) { - if (value == null) { - return value === undefined ? undefinedTag : nullTag; - } - return (symToStringTag && symToStringTag in Object(value)) - ? getRawTag(value) - : objectToString(value); - } - - /** - * The base implementation of `_.gt` which doesn't coerce arguments. - * - * @private - * @param {*} value The value to compare. - * @param {*} other The other value to compare. - * @returns {boolean} Returns `true` if `value` is greater than `other`, - * else `false`. - */ - function baseGt(value, other) { - return value > other; - } - - /** - * The base implementation of `_.has` without support for deep paths. - * - * @private - * @param {Object} [object] The object to query. - * @param {Array|string} key The key to check. - * @returns {boolean} Returns `true` if `key` exists, else `false`. - */ - function baseHas(object, key) { - return object != null && hasOwnProperty.call(object, key); - } - - /** - * The base implementation of `_.hasIn` without support for deep paths. - * - * @private - * @param {Object} [object] The object to query. - * @param {Array|string} key The key to check. - * @returns {boolean} Returns `true` if `key` exists, else `false`. - */ - function baseHasIn(object, key) { - return object != null && key in Object(object); - } - - /** - * The base implementation of `_.inRange` which doesn't coerce arguments. - * - * @private - * @param {number} number The number to check. - * @param {number} start The start of the range. - * @param {number} end The end of the range. - * @returns {boolean} Returns `true` if `number` is in the range, else `false`. - */ - function baseInRange(number, start, end) { - return number >= nativeMin(start, end) && number < nativeMax(start, end); - } - - /** - * The base implementation of methods like `_.intersection`, without support - * for iteratee shorthands, that accepts an array of arrays to inspect. - * - * @private - * @param {Array} arrays The arrays to inspect. - * @param {Function} [iteratee] The iteratee invoked per element. - * @param {Function} [comparator] The comparator invoked per element. - * @returns {Array} Returns the new array of shared values. - */ - function baseIntersection(arrays, iteratee, comparator) { - var includes = comparator ? arrayIncludesWith : arrayIncludes, - length = arrays[0].length, - othLength = arrays.length, - othIndex = othLength, - caches = Array(othLength), - maxLength = Infinity, - result = []; - - while (othIndex--) { - var array = arrays[othIndex]; - if (othIndex && iteratee) { - array = arrayMap(array, baseUnary(iteratee)); - } - maxLength = nativeMin(array.length, maxLength); - caches[othIndex] = !comparator && (iteratee || (length >= 120 && array.length >= 120)) - ? new SetCache(othIndex && array) - : undefined; - } - array = arrays[0]; - - var index = -1, - seen = caches[0]; - - outer: - while (++index < length && result.length < maxLength) { - var value = array[index], - computed = iteratee ? iteratee(value) : value; - - value = (comparator || value !== 0) ? value : 0; - if (!(seen - ? cacheHas(seen, computed) - : includes(result, computed, comparator) - )) { - othIndex = othLength; - while (--othIndex) { - var cache = caches[othIndex]; - if (!(cache - ? cacheHas(cache, computed) - : includes(arrays[othIndex], computed, comparator)) - ) { - continue outer; - } - } - if (seen) { - seen.push(computed); - } - result.push(value); - } - } - return result; - } - - /** - * The base implementation of `_.invert` and `_.invertBy` which inverts - * `object` with values transformed by `iteratee` and set by `setter`. - * - * @private - * @param {Object} object The object to iterate over. - * @param {Function} setter The function to set `accumulator` values. - * @param {Function} iteratee The iteratee to transform values. - * @param {Object} accumulator The initial inverted object. - * @returns {Function} Returns `accumulator`. - */ - function baseInverter(object, setter, iteratee, accumulator) { - baseForOwn(object, function(value, key, object) { - setter(accumulator, iteratee(value), key, object); - }); - return accumulator; - } - - /** - * The base implementation of `_.invoke` without support for individual - * method arguments. - * - * @private - * @param {Object} object The object to query. - * @param {Array|string} path The path of the method to invoke. - * @param {Array} args The arguments to invoke the method with. - * @returns {*} Returns the result of the invoked method. - */ - function baseInvoke(object, path, args) { - path = castPath(path, object); - object = parent(object, path); - var func = object == null ? object : object[toKey(last(path))]; - return func == null ? undefined : apply(func, object, args); - } - - /** - * The base implementation of `_.isArguments`. - * - * @private - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` is an `arguments` object, - */ - function baseIsArguments(value) { - return isObjectLike(value) && baseGetTag(value) == argsTag; - } - - /** - * The base implementation of `_.isArrayBuffer` without Node.js optimizations. - * - * @private - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` is an array buffer, else `false`. - */ - function baseIsArrayBuffer(value) { - return isObjectLike(value) && baseGetTag(value) == arrayBufferTag; - } - - /** - * The base implementation of `_.isDate` without Node.js optimizations. - * - * @private - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` is a date object, else `false`. - */ - function baseIsDate(value) { - return isObjectLike(value) && baseGetTag(value) == dateTag; - } - - /** - * The base implementation of `_.isEqual` which supports partial comparisons - * and tracks traversed objects. - * - * @private - * @param {*} value The value to compare. - * @param {*} other The other value to compare. - * @param {boolean} bitmask The bitmask flags. - * 1 - Unordered comparison - * 2 - Partial comparison - * @param {Function} [customizer] The function to customize comparisons. - * @param {Object} [stack] Tracks traversed `value` and `other` objects. - * @returns {boolean} Returns `true` if the values are equivalent, else `false`. - */ - function baseIsEqual(value, other, bitmask, customizer, stack) { - if (value === other) { - return true; - } - if (value == null || other == null || (!isObjectLike(value) && !isObjectLike(other))) { - return value !== value && other !== other; - } - return baseIsEqualDeep(value, other, bitmask, customizer, baseIsEqual, stack); - } - - /** - * A specialized version of `baseIsEqual` for arrays and objects which performs - * deep comparisons and tracks traversed objects enabling objects with circular - * references to be compared. - * - * @private - * @param {Object} object The object to compare. - * @param {Object} other The other object to compare. - * @param {number} bitmask The bitmask flags. See `baseIsEqual` for more details. - * @param {Function} customizer The function to customize comparisons. - * @param {Function} equalFunc The function to determine equivalents of values. - * @param {Object} [stack] Tracks traversed `object` and `other` objects. - * @returns {boolean} Returns `true` if the objects are equivalent, else `false`. - */ - function baseIsEqualDeep(object, other, bitmask, customizer, equalFunc, stack) { - var objIsArr = isArray(object), - othIsArr = isArray(other), - objTag = objIsArr ? arrayTag : getTag(object), - othTag = othIsArr ? arrayTag : getTag(other); - - objTag = objTag == argsTag ? objectTag : objTag; - othTag = othTag == argsTag ? objectTag : othTag; - - var objIsObj = objTag == objectTag, - othIsObj = othTag == objectTag, - isSameTag = objTag == othTag; - - if (isSameTag && isBuffer(object)) { - if (!isBuffer(other)) { - return false; - } - objIsArr = true; - objIsObj = false; - } - if (isSameTag && !objIsObj) { - stack || (stack = new Stack); - return (objIsArr || isTypedArray(object)) - ? equalArrays(object, other, bitmask, customizer, equalFunc, stack) - : equalByTag(object, other, objTag, bitmask, customizer, equalFunc, stack); - } - if (!(bitmask & COMPARE_PARTIAL_FLAG)) { - var objIsWrapped = objIsObj && hasOwnProperty.call(object, '__wrapped__'), - othIsWrapped = othIsObj && hasOwnProperty.call(other, '__wrapped__'); - - if (objIsWrapped || othIsWrapped) { - var objUnwrapped = objIsWrapped ? object.value() : object, - othUnwrapped = othIsWrapped ? other.value() : other; - - stack || (stack = new Stack); - return equalFunc(objUnwrapped, othUnwrapped, bitmask, customizer, stack); - } - } - if (!isSameTag) { - return false; - } - stack || (stack = new Stack); - return equalObjects(object, other, bitmask, customizer, equalFunc, stack); - } - - /** - * The base implementation of `_.isMap` without Node.js optimizations. - * - * @private - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` is a map, else `false`. - */ - function baseIsMap(value) { - return isObjectLike(value) && getTag(value) == mapTag; - } - - /** - * The base implementation of `_.isMatch` without support for iteratee shorthands. - * - * @private - * @param {Object} object The object to inspect. - * @param {Object} source The object of property values to match. - * @param {Array} matchData The property names, values, and compare flags to match. - * @param {Function} [customizer] The function to customize comparisons. - * @returns {boolean} Returns `true` if `object` is a match, else `false`. - */ - function baseIsMatch(object, source, matchData, customizer) { - var index = matchData.length, - length = index, - noCustomizer = !customizer; - - if (object == null) { - return !length; - } - object = Object(object); - while (index--) { - var data = matchData[index]; - if ((noCustomizer && data[2]) - ? data[1] !== object[data[0]] - : !(data[0] in object) - ) { - return false; - } - } - while (++index < length) { - data = matchData[index]; - var key = data[0], - objValue = object[key], - srcValue = data[1]; - - if (noCustomizer && data[2]) { - if (objValue === undefined && !(key in object)) { - return false; - } - } else { - var stack = new Stack; - if (customizer) { - var result = customizer(objValue, srcValue, key, object, source, stack); - } - if (!(result === undefined - ? baseIsEqual(srcValue, objValue, COMPARE_PARTIAL_FLAG | COMPARE_UNORDERED_FLAG, customizer, stack) - : result - )) { - return false; - } - } - } - return true; - } - - /** - * The base implementation of `_.isNative` without bad shim checks. - * - * @private - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` is a native function, - * else `false`. - */ - function baseIsNative(value) { - if (!isObject(value) || isMasked(value)) { - return false; - } - var pattern = isFunction(value) ? reIsNative : reIsHostCtor; - return pattern.test(toSource(value)); - } - - /** - * The base implementation of `_.isRegExp` without Node.js optimizations. - * - * @private - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` is a regexp, else `false`. - */ - function baseIsRegExp(value) { - return isObjectLike(value) && baseGetTag(value) == regexpTag; - } - - /** - * The base implementation of `_.isSet` without Node.js optimizations. - * - * @private - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` is a set, else `false`. - */ - function baseIsSet(value) { - return isObjectLike(value) && getTag(value) == setTag; - } - - /** - * The base implementation of `_.isTypedArray` without Node.js optimizations. - * - * @private - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` is a typed array, else `false`. - */ - function baseIsTypedArray(value) { - return isObjectLike(value) && - isLength(value.length) && !!typedArrayTags[baseGetTag(value)]; - } - - /** - * The base implementation of `_.iteratee`. - * - * @private - * @param {*} [value=_.identity] The value to convert to an iteratee. - * @returns {Function} Returns the iteratee. - */ - function baseIteratee(value) { - // Don't store the `typeof` result in a variable to avoid a JIT bug in Safari 9. - // See https://bugs.webkit.org/show_bug.cgi?id=156034 for more details. - if (typeof value == 'function') { - return value; - } - if (value == null) { - return identity; - } - if (typeof value == 'object') { - return isArray(value) - ? baseMatchesProperty(value[0], value[1]) - : baseMatches(value); - } - return property(value); - } - - /** - * The base implementation of `_.keys` which doesn't treat sparse arrays as dense. - * - * @private - * @param {Object} object The object to query. - * @returns {Array} Returns the array of property names. - */ - function baseKeys(object) { - if (!isPrototype(object)) { - return nativeKeys(object); - } - var result = []; - for (var key in Object(object)) { - if (hasOwnProperty.call(object, key) && key != 'constructor') { - result.push(key); - } - } - return result; - } - - /** - * The base implementation of `_.keysIn` which doesn't treat sparse arrays as dense. - * - * @private - * @param {Object} object The object to query. - * @returns {Array} Returns the array of property names. - */ - function baseKeysIn(object) { - if (!isObject(object)) { - return nativeKeysIn(object); - } - var isProto = isPrototype(object), - result = []; - - for (var key in object) { - if (!(key == 'constructor' && (isProto || !hasOwnProperty.call(object, key)))) { - result.push(key); - } - } - return result; - } - - /** - * The base implementation of `_.lt` which doesn't coerce arguments. - * - * @private - * @param {*} value The value to compare. - * @param {*} other The other value to compare. - * @returns {boolean} Returns `true` if `value` is less than `other`, - * else `false`. - */ - function baseLt(value, other) { - return value < other; - } - - /** - * The base implementation of `_.map` without support for iteratee shorthands. - * - * @private - * @param {Array|Object} collection The collection to iterate over. - * @param {Function} iteratee The function invoked per iteration. - * @returns {Array} Returns the new mapped array. - */ - function baseMap(collection, iteratee) { - var index = -1, - result = isArrayLike(collection) ? Array(collection.length) : []; - - baseEach(collection, function(value, key, collection) { - result[++index] = iteratee(value, key, collection); - }); - return result; - } - - /** - * The base implementation of `_.matches` which doesn't clone `source`. - * - * @private - * @param {Object} source The object of property values to match. - * @returns {Function} Returns the new spec function. - */ - function baseMatches(source) { - var matchData = getMatchData(source); - if (matchData.length == 1 && matchData[0][2]) { - return matchesStrictComparable(matchData[0][0], matchData[0][1]); - } - return function(object) { - return object === source || baseIsMatch(object, source, matchData); - }; - } - - /** - * The base implementation of `_.matchesProperty` which doesn't clone `srcValue`. - * - * @private - * @param {string} path The path of the property to get. - * @param {*} srcValue The value to match. - * @returns {Function} Returns the new spec function. - */ - function baseMatchesProperty(path, srcValue) { - if (isKey(path) && isStrictComparable(srcValue)) { - return matchesStrictComparable(toKey(path), srcValue); - } - return function(object) { - var objValue = get(object, path); - return (objValue === undefined && objValue === srcValue) - ? hasIn(object, path) - : baseIsEqual(srcValue, objValue, COMPARE_PARTIAL_FLAG | COMPARE_UNORDERED_FLAG); - }; - } - - /** - * The base implementation of `_.merge` without support for multiple sources. - * - * @private - * @param {Object} object The destination object. - * @param {Object} source The source object. - * @param {number} srcIndex The index of `source`. - * @param {Function} [customizer] The function to customize merged values. - * @param {Object} [stack] Tracks traversed source values and their merged - * counterparts. - */ - function baseMerge(object, source, srcIndex, customizer, stack) { - if (object === source) { - return; - } - baseFor(source, function(srcValue, key) { - if (isObject(srcValue)) { - stack || (stack = new Stack); - baseMergeDeep(object, source, key, srcIndex, baseMerge, customizer, stack); - } - else { - var newValue = customizer - ? customizer(safeGet(object, key), srcValue, (key + ''), object, source, stack) - : undefined; - - if (newValue === undefined) { - newValue = srcValue; - } - assignMergeValue(object, key, newValue); - } - }, keysIn); - } - - /** - * A specialized version of `baseMerge` for arrays and objects which performs - * deep merges and tracks traversed objects enabling objects with circular - * references to be merged. - * - * @private - * @param {Object} object The destination object. - * @param {Object} source The source object. - * @param {string} key The key of the value to merge. - * @param {number} srcIndex The index of `source`. - * @param {Function} mergeFunc The function to merge values. - * @param {Function} [customizer] The function to customize assigned values. - * @param {Object} [stack] Tracks traversed source values and their merged - * counterparts. - */ - function baseMergeDeep(object, source, key, srcIndex, mergeFunc, customizer, stack) { - var objValue = safeGet(object, key), - srcValue = safeGet(source, key), - stacked = stack.get(srcValue); - - if (stacked) { - assignMergeValue(object, key, stacked); - return; - } - var newValue = customizer - ? customizer(objValue, srcValue, (key + ''), object, source, stack) - : undefined; - - var isCommon = newValue === undefined; - - if (isCommon) { - var isArr = isArray(srcValue), - isBuff = !isArr && isBuffer(srcValue), - isTyped = !isArr && !isBuff && isTypedArray(srcValue); - - newValue = srcValue; - if (isArr || isBuff || isTyped) { - if (isArray(objValue)) { - newValue = objValue; - } - else if (isArrayLikeObject(objValue)) { - newValue = copyArray(objValue); - } - else if (isBuff) { - isCommon = false; - newValue = cloneBuffer(srcValue, true); - } - else if (isTyped) { - isCommon = false; - newValue = cloneTypedArray(srcValue, true); - } - else { - newValue = []; - } - } - else if (isPlainObject(srcValue) || isArguments(srcValue)) { - newValue = objValue; - if (isArguments(objValue)) { - newValue = toPlainObject(objValue); - } - else if (!isObject(objValue) || (srcIndex && isFunction(objValue))) { - newValue = initCloneObject(srcValue); - } - } - else { - isCommon = false; - } - } - if (isCommon) { - // Recursively merge objects and arrays (susceptible to call stack limits). - stack.set(srcValue, newValue); - mergeFunc(newValue, srcValue, srcIndex, customizer, stack); - stack['delete'](srcValue); - } - assignMergeValue(object, key, newValue); - } - - /** - * The base implementation of `_.nth` which doesn't coerce arguments. - * - * @private - * @param {Array} array The array to query. - * @param {number} n The index of the element to return. - * @returns {*} Returns the nth element of `array`. - */ - function baseNth(array, n) { - var length = array.length; - if (!length) { - return; - } - n += n < 0 ? length : 0; - return isIndex(n, length) ? array[n] : undefined; - } - - /** - * The base implementation of `_.orderBy` without param guards. - * - * @private - * @param {Array|Object} collection The collection to iterate over. - * @param {Function[]|Object[]|string[]} iteratees The iteratees to sort by. - * @param {string[]} orders The sort orders of `iteratees`. - * @returns {Array} Returns the new sorted array. - */ - function baseOrderBy(collection, iteratees, orders) { - var index = -1; - iteratees = arrayMap(iteratees.length ? iteratees : [identity], baseUnary(getIteratee())); - - var result = baseMap(collection, function(value, key, collection) { - var criteria = arrayMap(iteratees, function(iteratee) { - return iteratee(value); - }); - return { 'criteria': criteria, 'index': ++index, 'value': value }; - }); - - return baseSortBy(result, function(object, other) { - return compareMultiple(object, other, orders); - }); - } - - /** - * The base implementation of `_.pick` without support for individual - * property identifiers. - * - * @private - * @param {Object} object The source object. - * @param {string[]} paths The property paths to pick. - * @returns {Object} Returns the new object. - */ - function basePick(object, paths) { - return basePickBy(object, paths, function(value, path) { - return hasIn(object, path); - }); - } - - /** - * The base implementation of `_.pickBy` without support for iteratee shorthands. - * - * @private - * @param {Object} object The source object. - * @param {string[]} paths The property paths to pick. - * @param {Function} predicate The function invoked per property. - * @returns {Object} Returns the new object. - */ - function basePickBy(object, paths, predicate) { - var index = -1, - length = paths.length, - result = {}; - - while (++index < length) { - var path = paths[index], - value = baseGet(object, path); - - if (predicate(value, path)) { - baseSet(result, castPath(path, object), value); - } - } - return result; - } - - /** - * A specialized version of `baseProperty` which supports deep paths. - * - * @private - * @param {Array|string} path The path of the property to get. - * @returns {Function} Returns the new accessor function. - */ - function basePropertyDeep(path) { - return function(object) { - return baseGet(object, path); - }; - } - - /** - * The base implementation of `_.pullAllBy` without support for iteratee - * shorthands. - * - * @private - * @param {Array} array The array to modify. - * @param {Array} values The values to remove. - * @param {Function} [iteratee] The iteratee invoked per element. - * @param {Function} [comparator] The comparator invoked per element. - * @returns {Array} Returns `array`. - */ - function basePullAll(array, values, iteratee, comparator) { - var indexOf = comparator ? baseIndexOfWith : baseIndexOf, - index = -1, - length = values.length, - seen = array; - - if (array === values) { - values = copyArray(values); - } - if (iteratee) { - seen = arrayMap(array, baseUnary(iteratee)); - } - while (++index < length) { - var fromIndex = 0, - value = values[index], - computed = iteratee ? iteratee(value) : value; - - while ((fromIndex = indexOf(seen, computed, fromIndex, comparator)) > -1) { - if (seen !== array) { - splice.call(seen, fromIndex, 1); - } - splice.call(array, fromIndex, 1); - } - } - return array; - } - - /** - * The base implementation of `_.pullAt` without support for individual - * indexes or capturing the removed elements. - * - * @private - * @param {Array} array The array to modify. - * @param {number[]} indexes The indexes of elements to remove. - * @returns {Array} Returns `array`. - */ - function basePullAt(array, indexes) { - var length = array ? indexes.length : 0, - lastIndex = length - 1; - - while (length--) { - var index = indexes[length]; - if (length == lastIndex || index !== previous) { - var previous = index; - if (isIndex(index)) { - splice.call(array, index, 1); - } else { - baseUnset(array, index); - } - } - } - return array; - } - - /** - * The base implementation of `_.random` without support for returning - * floating-point numbers. - * - * @private - * @param {number} lower The lower bound. - * @param {number} upper The upper bound. - * @returns {number} Returns the random number. - */ - function baseRandom(lower, upper) { - return lower + nativeFloor(nativeRandom() * (upper - lower + 1)); - } - - /** - * The base implementation of `_.range` and `_.rangeRight` which doesn't - * coerce arguments. - * - * @private - * @param {number} start The start of the range. - * @param {number} end The end of the range. - * @param {number} step The value to increment or decrement by. - * @param {boolean} [fromRight] Specify iterating from right to left. - * @returns {Array} Returns the range of numbers. - */ - function baseRange(start, end, step, fromRight) { - var index = -1, - length = nativeMax(nativeCeil((end - start) / (step || 1)), 0), - result = Array(length); - - while (length--) { - result[fromRight ? length : ++index] = start; - start += step; - } - return result; - } - - /** - * The base implementation of `_.repeat` which doesn't coerce arguments. - * - * @private - * @param {string} string The string to repeat. - * @param {number} n The number of times to repeat the string. - * @returns {string} Returns the repeated string. - */ - function baseRepeat(string, n) { - var result = ''; - if (!string || n < 1 || n > MAX_SAFE_INTEGER) { - return result; - } - // Leverage the exponentiation by squaring algorithm for a faster repeat. - // See https://en.wikipedia.org/wiki/Exponentiation_by_squaring for more details. - do { - if (n % 2) { - result += string; - } - n = nativeFloor(n / 2); - if (n) { - string += string; - } - } while (n); - - return result; - } - - /** - * The base implementation of `_.rest` which doesn't validate or coerce arguments. - * - * @private - * @param {Function} func The function to apply a rest parameter to. - * @param {number} [start=func.length-1] The start position of the rest parameter. - * @returns {Function} Returns the new function. - */ - function baseRest(func, start) { - return setToString(overRest(func, start, identity), func + ''); - } - - /** - * The base implementation of `_.sample`. - * - * @private - * @param {Array|Object} collection The collection to sample. - * @returns {*} Returns the random element. - */ - function baseSample(collection) { - return arraySample(values(collection)); - } - - /** - * The base implementation of `_.sampleSize` without param guards. - * - * @private - * @param {Array|Object} collection The collection to sample. - * @param {number} n The number of elements to sample. - * @returns {Array} Returns the random elements. - */ - function baseSampleSize(collection, n) { - var array = values(collection); - return shuffleSelf(array, baseClamp(n, 0, array.length)); - } - - /** - * The base implementation of `_.set`. - * - * @private - * @param {Object} object The object to modify. - * @param {Array|string} path The path of the property to set. - * @param {*} value The value to set. - * @param {Function} [customizer] The function to customize path creation. - * @returns {Object} Returns `object`. - */ - function baseSet(object, path, value, customizer) { - if (!isObject(object)) { - return object; - } - path = castPath(path, object); - - var index = -1, - length = path.length, - lastIndex = length - 1, - nested = object; - - while (nested != null && ++index < length) { - var key = toKey(path[index]), - newValue = value; - - if (index != lastIndex) { - var objValue = nested[key]; - newValue = customizer ? customizer(objValue, key, nested) : undefined; - if (newValue === undefined) { - newValue = isObject(objValue) - ? objValue - : (isIndex(path[index + 1]) ? [] : {}); - } - } - assignValue(nested, key, newValue); - nested = nested[key]; - } - return object; - } - - /** - * The base implementation of `setData` without support for hot loop shorting. - * - * @private - * @param {Function} func The function to associate metadata with. - * @param {*} data The metadata. - * @returns {Function} Returns `func`. - */ - var baseSetData = !metaMap ? identity : function(func, data) { - metaMap.set(func, data); - return func; - }; - - /** - * The base implementation of `setToString` without support for hot loop shorting. - * - * @private - * @param {Function} func The function to modify. - * @param {Function} string The `toString` result. - * @returns {Function} Returns `func`. - */ - var baseSetToString = !defineProperty ? identity : function(func, string) { - return defineProperty(func, 'toString', { - 'configurable': true, - 'enumerable': false, - 'value': constant(string), - 'writable': true - }); - }; - - /** - * The base implementation of `_.shuffle`. - * - * @private - * @param {Array|Object} collection The collection to shuffle. - * @returns {Array} Returns the new shuffled array. - */ - function baseShuffle(collection) { - return shuffleSelf(values(collection)); - } - - /** - * The base implementation of `_.slice` without an iteratee call guard. - * - * @private - * @param {Array} array The array to slice. - * @param {number} [start=0] The start position. - * @param {number} [end=array.length] The end position. - * @returns {Array} Returns the slice of `array`. - */ - function baseSlice(array, start, end) { - var index = -1, - length = array.length; - - if (start < 0) { - start = -start > length ? 0 : (length + start); - } - end = end > length ? length : end; - if (end < 0) { - end += length; - } - length = start > end ? 0 : ((end - start) >>> 0); - start >>>= 0; - - var result = Array(length); - while (++index < length) { - result[index] = array[index + start]; - } - return result; - } - - /** - * The base implementation of `_.some` without support for iteratee shorthands. - * - * @private - * @param {Array|Object} collection The collection to iterate over. - * @param {Function} predicate The function invoked per iteration. - * @returns {boolean} Returns `true` if any element passes the predicate check, - * else `false`. - */ - function baseSome(collection, predicate) { - var result; - - baseEach(collection, function(value, index, collection) { - result = predicate(value, index, collection); - return !result; - }); - return !!result; - } - - /** - * The base implementation of `_.sortedIndex` and `_.sortedLastIndex` which - * performs a binary search of `array` to determine the index at which `value` - * should be inserted into `array` in order to maintain its sort order. - * - * @private - * @param {Array} array The sorted array to inspect. - * @param {*} value The value to evaluate. - * @param {boolean} [retHighest] Specify returning the highest qualified index. - * @returns {number} Returns the index at which `value` should be inserted - * into `array`. - */ - function baseSortedIndex(array, value, retHighest) { - var low = 0, - high = array == null ? low : array.length; - - if (typeof value == 'number' && value === value && high <= HALF_MAX_ARRAY_LENGTH) { - while (low < high) { - var mid = (low + high) >>> 1, - computed = array[mid]; - - if (computed !== null && !isSymbol(computed) && - (retHighest ? (computed <= value) : (computed < value))) { - low = mid + 1; - } else { - high = mid; - } - } - return high; - } - return baseSortedIndexBy(array, value, identity, retHighest); - } - - /** - * The base implementation of `_.sortedIndexBy` and `_.sortedLastIndexBy` - * which invokes `iteratee` for `value` and each element of `array` to compute - * their sort ranking. The iteratee is invoked with one argument; (value). - * - * @private - * @param {Array} array The sorted array to inspect. - * @param {*} value The value to evaluate. - * @param {Function} iteratee The iteratee invoked per element. - * @param {boolean} [retHighest] Specify returning the highest qualified index. - * @returns {number} Returns the index at which `value` should be inserted - * into `array`. - */ - function baseSortedIndexBy(array, value, iteratee, retHighest) { - value = iteratee(value); - - var low = 0, - high = array == null ? 0 : array.length, - valIsNaN = value !== value, - valIsNull = value === null, - valIsSymbol = isSymbol(value), - valIsUndefined = value === undefined; - - while (low < high) { - var mid = nativeFloor((low + high) / 2), - computed = iteratee(array[mid]), - othIsDefined = computed !== undefined, - othIsNull = computed === null, - othIsReflexive = computed === computed, - othIsSymbol = isSymbol(computed); - - if (valIsNaN) { - var setLow = retHighest || othIsReflexive; - } else if (valIsUndefined) { - setLow = othIsReflexive && (retHighest || othIsDefined); - } else if (valIsNull) { - setLow = othIsReflexive && othIsDefined && (retHighest || !othIsNull); - } else if (valIsSymbol) { - setLow = othIsReflexive && othIsDefined && !othIsNull && (retHighest || !othIsSymbol); - } else if (othIsNull || othIsSymbol) { - setLow = false; - } else { - setLow = retHighest ? (computed <= value) : (computed < value); - } - if (setLow) { - low = mid + 1; - } else { - high = mid; - } - } - return nativeMin(high, MAX_ARRAY_INDEX); - } - - /** - * The base implementation of `_.sortedUniq` and `_.sortedUniqBy` without - * support for iteratee shorthands. - * - * @private - * @param {Array} array The array to inspect. - * @param {Function} [iteratee] The iteratee invoked per element. - * @returns {Array} Returns the new duplicate free array. - */ - function baseSortedUniq(array, iteratee) { - var index = -1, - length = array.length, - resIndex = 0, - result = []; - - while (++index < length) { - var value = array[index], - computed = iteratee ? iteratee(value) : value; - - if (!index || !eq(computed, seen)) { - var seen = computed; - result[resIndex++] = value === 0 ? 0 : value; - } - } - return result; - } - - /** - * The base implementation of `_.toNumber` which doesn't ensure correct - * conversions of binary, hexadecimal, or octal string values. - * - * @private - * @param {*} value The value to process. - * @returns {number} Returns the number. - */ - function baseToNumber(value) { - if (typeof value == 'number') { - return value; - } - if (isSymbol(value)) { - return NAN; - } - return +value; - } - - /** - * The base implementation of `_.toString` which doesn't convert nullish - * values to empty strings. - * - * @private - * @param {*} value The value to process. - * @returns {string} Returns the string. - */ - function baseToString(value) { - // Exit early for strings to avoid a performance hit in some environments. - if (typeof value == 'string') { - return value; - } - if (isArray(value)) { - // Recursively convert values (susceptible to call stack limits). - return arrayMap(value, baseToString) + ''; - } - if (isSymbol(value)) { - return symbolToString ? symbolToString.call(value) : ''; - } - var result = (value + ''); - return (result == '0' && (1 / value) == -INFINITY) ? '-0' : result; - } - - /** - * The base implementation of `_.uniqBy` without support for iteratee shorthands. - * - * @private - * @param {Array} array The array to inspect. - * @param {Function} [iteratee] The iteratee invoked per element. - * @param {Function} [comparator] The comparator invoked per element. - * @returns {Array} Returns the new duplicate free array. - */ - function baseUniq(array, iteratee, comparator) { - var index = -1, - includes = arrayIncludes, - length = array.length, - isCommon = true, - result = [], - seen = result; - - if (comparator) { - isCommon = false; - includes = arrayIncludesWith; - } - else if (length >= LARGE_ARRAY_SIZE) { - var set = iteratee ? null : createSet(array); - if (set) { - return setToArray(set); - } - isCommon = false; - includes = cacheHas; - seen = new SetCache; - } - else { - seen = iteratee ? [] : result; - } - outer: - while (++index < length) { - var value = array[index], - computed = iteratee ? iteratee(value) : value; - - value = (comparator || value !== 0) ? value : 0; - if (isCommon && computed === computed) { - var seenIndex = seen.length; - while (seenIndex--) { - if (seen[seenIndex] === computed) { - continue outer; - } - } - if (iteratee) { - seen.push(computed); - } - result.push(value); - } - else if (!includes(seen, computed, comparator)) { - if (seen !== result) { - seen.push(computed); - } - result.push(value); - } - } - return result; - } - - /** - * The base implementation of `_.unset`. - * - * @private - * @param {Object} object The object to modify. - * @param {Array|string} path The property path to unset. - * @returns {boolean} Returns `true` if the property is deleted, else `false`. - */ - function baseUnset(object, path) { - path = castPath(path, object); - object = parent(object, path); - return object == null || delete object[toKey(last(path))]; - } - - /** - * The base implementation of `_.update`. - * - * @private - * @param {Object} object The object to modify. - * @param {Array|string} path The path of the property to update. - * @param {Function} updater The function to produce the updated value. - * @param {Function} [customizer] The function to customize path creation. - * @returns {Object} Returns `object`. - */ - function baseUpdate(object, path, updater, customizer) { - return baseSet(object, path, updater(baseGet(object, path)), customizer); - } - - /** - * The base implementation of methods like `_.dropWhile` and `_.takeWhile` - * without support for iteratee shorthands. - * - * @private - * @param {Array} array The array to query. - * @param {Function} predicate The function invoked per iteration. - * @param {boolean} [isDrop] Specify dropping elements instead of taking them. - * @param {boolean} [fromRight] Specify iterating from right to left. - * @returns {Array} Returns the slice of `array`. - */ - function baseWhile(array, predicate, isDrop, fromRight) { - var length = array.length, - index = fromRight ? length : -1; - - while ((fromRight ? index-- : ++index < length) && - predicate(array[index], index, array)) {} - - return isDrop - ? baseSlice(array, (fromRight ? 0 : index), (fromRight ? index + 1 : length)) - : baseSlice(array, (fromRight ? index + 1 : 0), (fromRight ? length : index)); - } - - /** - * The base implementation of `wrapperValue` which returns the result of - * performing a sequence of actions on the unwrapped `value`, where each - * successive action is supplied the return value of the previous. - * - * @private - * @param {*} value The unwrapped value. - * @param {Array} actions Actions to perform to resolve the unwrapped value. - * @returns {*} Returns the resolved value. - */ - function baseWrapperValue(value, actions) { - var result = value; - if (result instanceof LazyWrapper) { - result = result.value(); - } - return arrayReduce(actions, function(result, action) { - return action.func.apply(action.thisArg, arrayPush([result], action.args)); - }, result); - } - - /** - * The base implementation of methods like `_.xor`, without support for - * iteratee shorthands, that accepts an array of arrays to inspect. - * - * @private - * @param {Array} arrays The arrays to inspect. - * @param {Function} [iteratee] The iteratee invoked per element. - * @param {Function} [comparator] The comparator invoked per element. - * @returns {Array} Returns the new array of values. - */ - function baseXor(arrays, iteratee, comparator) { - var length = arrays.length; - if (length < 2) { - return length ? baseUniq(arrays[0]) : []; - } - var index = -1, - result = Array(length); - - while (++index < length) { - var array = arrays[index], - othIndex = -1; - - while (++othIndex < length) { - if (othIndex != index) { - result[index] = baseDifference(result[index] || array, arrays[othIndex], iteratee, comparator); - } - } - } - return baseUniq(baseFlatten(result, 1), iteratee, comparator); - } - - /** - * This base implementation of `_.zipObject` which assigns values using `assignFunc`. - * - * @private - * @param {Array} props The property identifiers. - * @param {Array} values The property values. - * @param {Function} assignFunc The function to assign values. - * @returns {Object} Returns the new object. - */ - function baseZipObject(props, values, assignFunc) { - var index = -1, - length = props.length, - valsLength = values.length, - result = {}; - - while (++index < length) { - var value = index < valsLength ? values[index] : undefined; - assignFunc(result, props[index], value); - } - return result; - } - - /** - * Casts `value` to an empty array if it's not an array like object. - * - * @private - * @param {*} value The value to inspect. - * @returns {Array|Object} Returns the cast array-like object. - */ - function castArrayLikeObject(value) { - return isArrayLikeObject(value) ? value : []; - } - - /** - * Casts `value` to `identity` if it's not a function. - * - * @private - * @param {*} value The value to inspect. - * @returns {Function} Returns cast function. - */ - function castFunction(value) { - return typeof value == 'function' ? value : identity; - } - - /** - * Casts `value` to a path array if it's not one. - * - * @private - * @param {*} value The value to inspect. - * @param {Object} [object] The object to query keys on. - * @returns {Array} Returns the cast property path array. - */ - function castPath(value, object) { - if (isArray(value)) { - return value; - } - return isKey(value, object) ? [value] : stringToPath(toString(value)); - } - - /** - * A `baseRest` alias which can be replaced with `identity` by module - * replacement plugins. - * - * @private - * @type {Function} - * @param {Function} func The function to apply a rest parameter to. - * @returns {Function} Returns the new function. - */ - var castRest = baseRest; - - /** - * Casts `array` to a slice if it's needed. - * - * @private - * @param {Array} array The array to inspect. - * @param {number} start The start position. - * @param {number} [end=array.length] The end position. - * @returns {Array} Returns the cast slice. - */ - function castSlice(array, start, end) { - var length = array.length; - end = end === undefined ? length : end; - return (!start && end >= length) ? array : baseSlice(array, start, end); - } - - /** - * A simple wrapper around the global [`clearTimeout`](https://mdn.io/clearTimeout). - * - * @private - * @param {number|Object} id The timer id or timeout object of the timer to clear. - */ - var clearTimeout = ctxClearTimeout || function(id) { - return root.clearTimeout(id); - }; - - /** - * Creates a clone of `buffer`. - * - * @private - * @param {Buffer} buffer The buffer to clone. - * @param {boolean} [isDeep] Specify a deep clone. - * @returns {Buffer} Returns the cloned buffer. - */ - function cloneBuffer(buffer, isDeep) { - if (isDeep) { - return buffer.slice(); - } - var length = buffer.length, - result = allocUnsafe ? allocUnsafe(length) : new buffer.constructor(length); - - buffer.copy(result); - return result; - } - - /** - * Creates a clone of `arrayBuffer`. - * - * @private - * @param {ArrayBuffer} arrayBuffer The array buffer to clone. - * @returns {ArrayBuffer} Returns the cloned array buffer. - */ - function cloneArrayBuffer(arrayBuffer) { - var result = new arrayBuffer.constructor(arrayBuffer.byteLength); - new Uint8Array(result).set(new Uint8Array(arrayBuffer)); - return result; - } - - /** - * Creates a clone of `dataView`. - * - * @private - * @param {Object} dataView The data view to clone. - * @param {boolean} [isDeep] Specify a deep clone. - * @returns {Object} Returns the cloned data view. - */ - function cloneDataView(dataView, isDeep) { - var buffer = isDeep ? cloneArrayBuffer(dataView.buffer) : dataView.buffer; - return new dataView.constructor(buffer, dataView.byteOffset, dataView.byteLength); - } - - /** - * Creates a clone of `regexp`. - * - * @private - * @param {Object} regexp The regexp to clone. - * @returns {Object} Returns the cloned regexp. - */ - function cloneRegExp(regexp) { - var result = new regexp.constructor(regexp.source, reFlags.exec(regexp)); - result.lastIndex = regexp.lastIndex; - return result; - } - - /** - * Creates a clone of the `symbol` object. - * - * @private - * @param {Object} symbol The symbol object to clone. - * @returns {Object} Returns the cloned symbol object. - */ - function cloneSymbol(symbol) { - return symbolValueOf ? Object(symbolValueOf.call(symbol)) : {}; - } - - /** - * Creates a clone of `typedArray`. - * - * @private - * @param {Object} typedArray The typed array to clone. - * @param {boolean} [isDeep] Specify a deep clone. - * @returns {Object} Returns the cloned typed array. - */ - function cloneTypedArray(typedArray, isDeep) { - var buffer = isDeep ? cloneArrayBuffer(typedArray.buffer) : typedArray.buffer; - return new typedArray.constructor(buffer, typedArray.byteOffset, typedArray.length); - } - - /** - * Compares values to sort them in ascending order. - * - * @private - * @param {*} value The value to compare. - * @param {*} other The other value to compare. - * @returns {number} Returns the sort order indicator for `value`. - */ - function compareAscending(value, other) { - if (value !== other) { - var valIsDefined = value !== undefined, - valIsNull = value === null, - valIsReflexive = value === value, - valIsSymbol = isSymbol(value); - - var othIsDefined = other !== undefined, - othIsNull = other === null, - othIsReflexive = other === other, - othIsSymbol = isSymbol(other); - - if ((!othIsNull && !othIsSymbol && !valIsSymbol && value > other) || - (valIsSymbol && othIsDefined && othIsReflexive && !othIsNull && !othIsSymbol) || - (valIsNull && othIsDefined && othIsReflexive) || - (!valIsDefined && othIsReflexive) || - !valIsReflexive) { - return 1; - } - if ((!valIsNull && !valIsSymbol && !othIsSymbol && value < other) || - (othIsSymbol && valIsDefined && valIsReflexive && !valIsNull && !valIsSymbol) || - (othIsNull && valIsDefined && valIsReflexive) || - (!othIsDefined && valIsReflexive) || - !othIsReflexive) { - return -1; - } - } - return 0; - } - - /** - * Used by `_.orderBy` to compare multiple properties of a value to another - * and stable sort them. - * - * If `orders` is unspecified, all values are sorted in ascending order. Otherwise, - * specify an order of "desc" for descending or "asc" for ascending sort order - * of corresponding values. - * - * @private - * @param {Object} object The object to compare. - * @param {Object} other The other object to compare. - * @param {boolean[]|string[]} orders The order to sort by for each property. - * @returns {number} Returns the sort order indicator for `object`. - */ - function compareMultiple(object, other, orders) { - var index = -1, - objCriteria = object.criteria, - othCriteria = other.criteria, - length = objCriteria.length, - ordersLength = orders.length; - - while (++index < length) { - var result = compareAscending(objCriteria[index], othCriteria[index]); - if (result) { - if (index >= ordersLength) { - return result; - } - var order = orders[index]; - return result * (order == 'desc' ? -1 : 1); - } - } - // Fixes an `Array#sort` bug in the JS engine embedded in Adobe applications - // that causes it, under certain circumstances, to provide the same value for - // `object` and `other`. See https://github.com/jashkenas/underscore/pull/1247 - // for more details. - // - // This also ensures a stable sort in V8 and other engines. - // See https://bugs.chromium.org/p/v8/issues/detail?id=90 for more details. - return object.index - other.index; - } - - /** - * Creates an array that is the composition of partially applied arguments, - * placeholders, and provided arguments into a single array of arguments. - * - * @private - * @param {Array} args The provided arguments. - * @param {Array} partials The arguments to prepend to those provided. - * @param {Array} holders The `partials` placeholder indexes. - * @params {boolean} [isCurried] Specify composing for a curried function. - * @returns {Array} Returns the new array of composed arguments. - */ - function composeArgs(args, partials, holders, isCurried) { - var argsIndex = -1, - argsLength = args.length, - holdersLength = holders.length, - leftIndex = -1, - leftLength = partials.length, - rangeLength = nativeMax(argsLength - holdersLength, 0), - result = Array(leftLength + rangeLength), - isUncurried = !isCurried; - - while (++leftIndex < leftLength) { - result[leftIndex] = partials[leftIndex]; - } - while (++argsIndex < holdersLength) { - if (isUncurried || argsIndex < argsLength) { - result[holders[argsIndex]] = args[argsIndex]; - } - } - while (rangeLength--) { - result[leftIndex++] = args[argsIndex++]; - } - return result; - } - - /** - * This function is like `composeArgs` except that the arguments composition - * is tailored for `_.partialRight`. - * - * @private - * @param {Array} args The provided arguments. - * @param {Array} partials The arguments to append to those provided. - * @param {Array} holders The `partials` placeholder indexes. - * @params {boolean} [isCurried] Specify composing for a curried function. - * @returns {Array} Returns the new array of composed arguments. - */ - function composeArgsRight(args, partials, holders, isCurried) { - var argsIndex = -1, - argsLength = args.length, - holdersIndex = -1, - holdersLength = holders.length, - rightIndex = -1, - rightLength = partials.length, - rangeLength = nativeMax(argsLength - holdersLength, 0), - result = Array(rangeLength + rightLength), - isUncurried = !isCurried; - - while (++argsIndex < rangeLength) { - result[argsIndex] = args[argsIndex]; - } - var offset = argsIndex; - while (++rightIndex < rightLength) { - result[offset + rightIndex] = partials[rightIndex]; - } - while (++holdersIndex < holdersLength) { - if (isUncurried || argsIndex < argsLength) { - result[offset + holders[holdersIndex]] = args[argsIndex++]; - } - } - return result; - } - - /** - * Copies the values of `source` to `array`. - * - * @private - * @param {Array} source The array to copy values from. - * @param {Array} [array=[]] The array to copy values to. - * @returns {Array} Returns `array`. - */ - function copyArray(source, array) { - var index = -1, - length = source.length; - - array || (array = Array(length)); - while (++index < length) { - array[index] = source[index]; - } - return array; - } - - /** - * Copies properties of `source` to `object`. - * - * @private - * @param {Object} source The object to copy properties from. - * @param {Array} props The property identifiers to copy. - * @param {Object} [object={}] The object to copy properties to. - * @param {Function} [customizer] The function to customize copied values. - * @returns {Object} Returns `object`. - */ - function copyObject(source, props, object, customizer) { - var isNew = !object; - object || (object = {}); - - var index = -1, - length = props.length; - - while (++index < length) { - var key = props[index]; - - var newValue = customizer - ? customizer(object[key], source[key], key, object, source) - : undefined; - - if (newValue === undefined) { - newValue = source[key]; - } - if (isNew) { - baseAssignValue(object, key, newValue); - } else { - assignValue(object, key, newValue); - } - } - return object; - } - - /** - * Copies own symbols of `source` to `object`. - * - * @private - * @param {Object} source The object to copy symbols from. - * @param {Object} [object={}] The object to copy symbols to. - * @returns {Object} Returns `object`. - */ - function copySymbols(source, object) { - return copyObject(source, getSymbols(source), object); - } - - /** - * Copies own and inherited symbols of `source` to `object`. - * - * @private - * @param {Object} source The object to copy symbols from. - * @param {Object} [object={}] The object to copy symbols to. - * @returns {Object} Returns `object`. - */ - function copySymbolsIn(source, object) { - return copyObject(source, getSymbolsIn(source), object); - } - - /** - * Creates a function like `_.groupBy`. - * - * @private - * @param {Function} setter The function to set accumulator values. - * @param {Function} [initializer] The accumulator object initializer. - * @returns {Function} Returns the new aggregator function. - */ - function createAggregator(setter, initializer) { - return function(collection, iteratee) { - var func = isArray(collection) ? arrayAggregator : baseAggregator, - accumulator = initializer ? initializer() : {}; - - return func(collection, setter, getIteratee(iteratee, 2), accumulator); - }; - } - - /** - * Creates a function like `_.assign`. - * - * @private - * @param {Function} assigner The function to assign values. - * @returns {Function} Returns the new assigner function. - */ - function createAssigner(assigner) { - return baseRest(function(object, sources) { - var index = -1, - length = sources.length, - customizer = length > 1 ? sources[length - 1] : undefined, - guard = length > 2 ? sources[2] : undefined; - - customizer = (assigner.length > 3 && typeof customizer == 'function') - ? (length--, customizer) - : undefined; - - if (guard && isIterateeCall(sources[0], sources[1], guard)) { - customizer = length < 3 ? undefined : customizer; - length = 1; - } - object = Object(object); - while (++index < length) { - var source = sources[index]; - if (source) { - assigner(object, source, index, customizer); - } - } - return object; - }); - } - - /** - * Creates a `baseEach` or `baseEachRight` function. - * - * @private - * @param {Function} eachFunc The function to iterate over a collection. - * @param {boolean} [fromRight] Specify iterating from right to left. - * @returns {Function} Returns the new base function. - */ - function createBaseEach(eachFunc, fromRight) { - return function(collection, iteratee) { - if (collection == null) { - return collection; - } - if (!isArrayLike(collection)) { - return eachFunc(collection, iteratee); - } - var length = collection.length, - index = fromRight ? length : -1, - iterable = Object(collection); - - while ((fromRight ? index-- : ++index < length)) { - if (iteratee(iterable[index], index, iterable) === false) { - break; - } - } - return collection; - }; - } - - /** - * Creates a base function for methods like `_.forIn` and `_.forOwn`. - * - * @private - * @param {boolean} [fromRight] Specify iterating from right to left. - * @returns {Function} Returns the new base function. - */ - function createBaseFor(fromRight) { - return function(object, iteratee, keysFunc) { - var index = -1, - iterable = Object(object), - props = keysFunc(object), - length = props.length; - - while (length--) { - var key = props[fromRight ? length : ++index]; - if (iteratee(iterable[key], key, iterable) === false) { - break; - } - } - return object; - }; - } - - /** - * Creates a function that wraps `func` to invoke it with the optional `this` - * binding of `thisArg`. - * - * @private - * @param {Function} func The function to wrap. - * @param {number} bitmask The bitmask flags. See `createWrap` for more details. - * @param {*} [thisArg] The `this` binding of `func`. - * @returns {Function} Returns the new wrapped function. - */ - function createBind(func, bitmask, thisArg) { - var isBind = bitmask & WRAP_BIND_FLAG, - Ctor = createCtor(func); - - function wrapper() { - var fn = (this && this !== root && this instanceof wrapper) ? Ctor : func; - return fn.apply(isBind ? thisArg : this, arguments); - } - return wrapper; - } - - /** - * Creates a function like `_.lowerFirst`. - * - * @private - * @param {string} methodName The name of the `String` case method to use. - * @returns {Function} Returns the new case function. - */ - function createCaseFirst(methodName) { - return function(string) { - string = toString(string); - - var strSymbols = hasUnicode(string) - ? stringToArray(string) - : undefined; - - var chr = strSymbols - ? strSymbols[0] - : string.charAt(0); - - var trailing = strSymbols - ? castSlice(strSymbols, 1).join('') - : string.slice(1); - - return chr[methodName]() + trailing; - }; - } - - /** - * Creates a function like `_.camelCase`. - * - * @private - * @param {Function} callback The function to combine each word. - * @returns {Function} Returns the new compounder function. - */ - function createCompounder(callback) { - return function(string) { - return arrayReduce(words(deburr(string).replace(reApos, '')), callback, ''); - }; - } - - /** - * Creates a function that produces an instance of `Ctor` regardless of - * whether it was invoked as part of a `new` expression or by `call` or `apply`. - * - * @private - * @param {Function} Ctor The constructor to wrap. - * @returns {Function} Returns the new wrapped function. - */ - function createCtor(Ctor) { - return function() { - // Use a `switch` statement to work with class constructors. See - // http://ecma-international.org/ecma-262/7.0/#sec-ecmascript-function-objects-call-thisargument-argumentslist - // for more details. - var args = arguments; - switch (args.length) { - case 0: return new Ctor; - case 1: return new Ctor(args[0]); - case 2: return new Ctor(args[0], args[1]); - case 3: return new Ctor(args[0], args[1], args[2]); - case 4: return new Ctor(args[0], args[1], args[2], args[3]); - case 5: return new Ctor(args[0], args[1], args[2], args[3], args[4]); - case 6: return new Ctor(args[0], args[1], args[2], args[3], args[4], args[5]); - case 7: return new Ctor(args[0], args[1], args[2], args[3], args[4], args[5], args[6]); - } - var thisBinding = baseCreate(Ctor.prototype), - result = Ctor.apply(thisBinding, args); - - // Mimic the constructor's `return` behavior. - // See https://es5.github.io/#x13.2.2 for more details. - return isObject(result) ? result : thisBinding; - }; - } - - /** - * Creates a function that wraps `func` to enable currying. - * - * @private - * @param {Function} func The function to wrap. - * @param {number} bitmask The bitmask flags. See `createWrap` for more details. - * @param {number} arity The arity of `func`. - * @returns {Function} Returns the new wrapped function. - */ - function createCurry(func, bitmask, arity) { - var Ctor = createCtor(func); - - function wrapper() { - var length = arguments.length, - args = Array(length), - index = length, - placeholder = getHolder(wrapper); - - while (index--) { - args[index] = arguments[index]; - } - var holders = (length < 3 && args[0] !== placeholder && args[length - 1] !== placeholder) - ? [] - : replaceHolders(args, placeholder); - - length -= holders.length; - if (length < arity) { - return createRecurry( - func, bitmask, createHybrid, wrapper.placeholder, undefined, - args, holders, undefined, undefined, arity - length); - } - var fn = (this && this !== root && this instanceof wrapper) ? Ctor : func; - return apply(fn, this, args); - } - return wrapper; - } - - /** - * Creates a `_.find` or `_.findLast` function. - * - * @private - * @param {Function} findIndexFunc The function to find the collection index. - * @returns {Function} Returns the new find function. - */ - function createFind(findIndexFunc) { - return function(collection, predicate, fromIndex) { - var iterable = Object(collection); - if (!isArrayLike(collection)) { - var iteratee = getIteratee(predicate, 3); - collection = keys(collection); - predicate = function(key) { return iteratee(iterable[key], key, iterable); }; - } - var index = findIndexFunc(collection, predicate, fromIndex); - return index > -1 ? iterable[iteratee ? collection[index] : index] : undefined; - }; - } - - /** - * Creates a `_.flow` or `_.flowRight` function. - * - * @private - * @param {boolean} [fromRight] Specify iterating from right to left. - * @returns {Function} Returns the new flow function. - */ - function createFlow(fromRight) { - return flatRest(function(funcs) { - var length = funcs.length, - index = length, - prereq = LodashWrapper.prototype.thru; - - if (fromRight) { - funcs.reverse(); - } - while (index--) { - var func = funcs[index]; - if (typeof func != 'function') { - throw new TypeError(FUNC_ERROR_TEXT); - } - if (prereq && !wrapper && getFuncName(func) == 'wrapper') { - var wrapper = new LodashWrapper([], true); - } - } - index = wrapper ? index : length; - while (++index < length) { - func = funcs[index]; - - var funcName = getFuncName(func), - data = funcName == 'wrapper' ? getData(func) : undefined; - - if (data && isLaziable(data[0]) && - data[1] == (WRAP_ARY_FLAG | WRAP_CURRY_FLAG | WRAP_PARTIAL_FLAG | WRAP_REARG_FLAG) && - !data[4].length && data[9] == 1 - ) { - wrapper = wrapper[getFuncName(data[0])].apply(wrapper, data[3]); - } else { - wrapper = (func.length == 1 && isLaziable(func)) - ? wrapper[funcName]() - : wrapper.thru(func); - } - } - return function() { - var args = arguments, - value = args[0]; - - if (wrapper && args.length == 1 && isArray(value)) { - return wrapper.plant(value).value(); - } - var index = 0, - result = length ? funcs[index].apply(this, args) : value; - - while (++index < length) { - result = funcs[index].call(this, result); - } - return result; - }; - }); - } - - /** - * Creates a function that wraps `func` to invoke it with optional `this` - * binding of `thisArg`, partial application, and currying. - * - * @private - * @param {Function|string} func The function or method name to wrap. - * @param {number} bitmask The bitmask flags. See `createWrap` for more details. - * @param {*} [thisArg] The `this` binding of `func`. - * @param {Array} [partials] The arguments to prepend to those provided to - * the new function. - * @param {Array} [holders] The `partials` placeholder indexes. - * @param {Array} [partialsRight] The arguments to append to those provided - * to the new function. - * @param {Array} [holdersRight] The `partialsRight` placeholder indexes. - * @param {Array} [argPos] The argument positions of the new function. - * @param {number} [ary] The arity cap of `func`. - * @param {number} [arity] The arity of `func`. - * @returns {Function} Returns the new wrapped function. - */ - function createHybrid(func, bitmask, thisArg, partials, holders, partialsRight, holdersRight, argPos, ary, arity) { - var isAry = bitmask & WRAP_ARY_FLAG, - isBind = bitmask & WRAP_BIND_FLAG, - isBindKey = bitmask & WRAP_BIND_KEY_FLAG, - isCurried = bitmask & (WRAP_CURRY_FLAG | WRAP_CURRY_RIGHT_FLAG), - isFlip = bitmask & WRAP_FLIP_FLAG, - Ctor = isBindKey ? undefined : createCtor(func); - - function wrapper() { - var length = arguments.length, - args = Array(length), - index = length; - - while (index--) { - args[index] = arguments[index]; - } - if (isCurried) { - var placeholder = getHolder(wrapper), - holdersCount = countHolders(args, placeholder); - } - if (partials) { - args = composeArgs(args, partials, holders, isCurried); - } - if (partialsRight) { - args = composeArgsRight(args, partialsRight, holdersRight, isCurried); - } - length -= holdersCount; - if (isCurried && length < arity) { - var newHolders = replaceHolders(args, placeholder); - return createRecurry( - func, bitmask, createHybrid, wrapper.placeholder, thisArg, - args, newHolders, argPos, ary, arity - length - ); - } - var thisBinding = isBind ? thisArg : this, - fn = isBindKey ? thisBinding[func] : func; - - length = args.length; - if (argPos) { - args = reorder(args, argPos); - } else if (isFlip && length > 1) { - args.reverse(); - } - if (isAry && ary < length) { - args.length = ary; - } - if (this && this !== root && this instanceof wrapper) { - fn = Ctor || createCtor(fn); - } - return fn.apply(thisBinding, args); - } - return wrapper; - } - - /** - * Creates a function like `_.invertBy`. - * - * @private - * @param {Function} setter The function to set accumulator values. - * @param {Function} toIteratee The function to resolve iteratees. - * @returns {Function} Returns the new inverter function. - */ - function createInverter(setter, toIteratee) { - return function(object, iteratee) { - return baseInverter(object, setter, toIteratee(iteratee), {}); - }; - } - - /** - * Creates a function that performs a mathematical operation on two values. - * - * @private - * @param {Function} operator The function to perform the operation. - * @param {number} [defaultValue] The value used for `undefined` arguments. - * @returns {Function} Returns the new mathematical operation function. - */ - function createMathOperation(operator, defaultValue) { - return function(value, other) { - var result; - if (value === undefined && other === undefined) { - return defaultValue; - } - if (value !== undefined) { - result = value; - } - if (other !== undefined) { - if (result === undefined) { - return other; - } - if (typeof value == 'string' || typeof other == 'string') { - value = baseToString(value); - other = baseToString(other); - } else { - value = baseToNumber(value); - other = baseToNumber(other); - } - result = operator(value, other); - } - return result; - }; - } - - /** - * Creates a function like `_.over`. - * - * @private - * @param {Function} arrayFunc The function to iterate over iteratees. - * @returns {Function} Returns the new over function. - */ - function createOver(arrayFunc) { - return flatRest(function(iteratees) { - iteratees = arrayMap(iteratees, baseUnary(getIteratee())); - return baseRest(function(args) { - var thisArg = this; - return arrayFunc(iteratees, function(iteratee) { - return apply(iteratee, thisArg, args); - }); - }); - }); - } - - /** - * Creates the padding for `string` based on `length`. The `chars` string - * is truncated if the number of characters exceeds `length`. - * - * @private - * @param {number} length The padding length. - * @param {string} [chars=' '] The string used as padding. - * @returns {string} Returns the padding for `string`. - */ - function createPadding(length, chars) { - chars = chars === undefined ? ' ' : baseToString(chars); - - var charsLength = chars.length; - if (charsLength < 2) { - return charsLength ? baseRepeat(chars, length) : chars; - } - var result = baseRepeat(chars, nativeCeil(length / stringSize(chars))); - return hasUnicode(chars) - ? castSlice(stringToArray(result), 0, length).join('') - : result.slice(0, length); - } - - /** - * Creates a function that wraps `func` to invoke it with the `this` binding - * of `thisArg` and `partials` prepended to the arguments it receives. - * - * @private - * @param {Function} func The function to wrap. - * @param {number} bitmask The bitmask flags. See `createWrap` for more details. - * @param {*} thisArg The `this` binding of `func`. - * @param {Array} partials The arguments to prepend to those provided to - * the new function. - * @returns {Function} Returns the new wrapped function. - */ - function createPartial(func, bitmask, thisArg, partials) { - var isBind = bitmask & WRAP_BIND_FLAG, - Ctor = createCtor(func); - - function wrapper() { - var argsIndex = -1, - argsLength = arguments.length, - leftIndex = -1, - leftLength = partials.length, - args = Array(leftLength + argsLength), - fn = (this && this !== root && this instanceof wrapper) ? Ctor : func; - - while (++leftIndex < leftLength) { - args[leftIndex] = partials[leftIndex]; - } - while (argsLength--) { - args[leftIndex++] = arguments[++argsIndex]; - } - return apply(fn, isBind ? thisArg : this, args); - } - return wrapper; - } - - /** - * Creates a `_.range` or `_.rangeRight` function. - * - * @private - * @param {boolean} [fromRight] Specify iterating from right to left. - * @returns {Function} Returns the new range function. - */ - function createRange(fromRight) { - return function(start, end, step) { - if (step && typeof step != 'number' && isIterateeCall(start, end, step)) { - end = step = undefined; - } - // Ensure the sign of `-0` is preserved. - start = toFinite(start); - if (end === undefined) { - end = start; - start = 0; - } else { - end = toFinite(end); - } - step = step === undefined ? (start < end ? 1 : -1) : toFinite(step); - return baseRange(start, end, step, fromRight); - }; - } - - /** - * Creates a function that performs a relational operation on two values. - * - * @private - * @param {Function} operator The function to perform the operation. - * @returns {Function} Returns the new relational operation function. - */ - function createRelationalOperation(operator) { - return function(value, other) { - if (!(typeof value == 'string' && typeof other == 'string')) { - value = toNumber(value); - other = toNumber(other); - } - return operator(value, other); - }; - } - - /** - * Creates a function that wraps `func` to continue currying. - * - * @private - * @param {Function} func The function to wrap. - * @param {number} bitmask The bitmask flags. See `createWrap` for more details. - * @param {Function} wrapFunc The function to create the `func` wrapper. - * @param {*} placeholder The placeholder value. - * @param {*} [thisArg] The `this` binding of `func`. - * @param {Array} [partials] The arguments to prepend to those provided to - * the new function. - * @param {Array} [holders] The `partials` placeholder indexes. - * @param {Array} [argPos] The argument positions of the new function. - * @param {number} [ary] The arity cap of `func`. - * @param {number} [arity] The arity of `func`. - * @returns {Function} Returns the new wrapped function. - */ - function createRecurry(func, bitmask, wrapFunc, placeholder, thisArg, partials, holders, argPos, ary, arity) { - var isCurry = bitmask & WRAP_CURRY_FLAG, - newHolders = isCurry ? holders : undefined, - newHoldersRight = isCurry ? undefined : holders, - newPartials = isCurry ? partials : undefined, - newPartialsRight = isCurry ? undefined : partials; - - bitmask |= (isCurry ? WRAP_PARTIAL_FLAG : WRAP_PARTIAL_RIGHT_FLAG); - bitmask &= ~(isCurry ? WRAP_PARTIAL_RIGHT_FLAG : WRAP_PARTIAL_FLAG); - - if (!(bitmask & WRAP_CURRY_BOUND_FLAG)) { - bitmask &= ~(WRAP_BIND_FLAG | WRAP_BIND_KEY_FLAG); - } - var newData = [ - func, bitmask, thisArg, newPartials, newHolders, newPartialsRight, - newHoldersRight, argPos, ary, arity - ]; - - var result = wrapFunc.apply(undefined, newData); - if (isLaziable(func)) { - setData(result, newData); - } - result.placeholder = placeholder; - return setWrapToString(result, func, bitmask); - } - - /** - * Creates a function like `_.round`. - * - * @private - * @param {string} methodName The name of the `Math` method to use when rounding. - * @returns {Function} Returns the new round function. - */ - function createRound(methodName) { - var func = Math[methodName]; - return function(number, precision) { - number = toNumber(number); - precision = precision == null ? 0 : nativeMin(toInteger(precision), 292); - if (precision) { - // Shift with exponential notation to avoid floating-point issues. - // See [MDN](https://mdn.io/round#Examples) for more details. - var pair = (toString(number) + 'e').split('e'), - value = func(pair[0] + 'e' + (+pair[1] + precision)); - - pair = (toString(value) + 'e').split('e'); - return +(pair[0] + 'e' + (+pair[1] - precision)); - } - return func(number); - }; - } - - /** - * Creates a set object of `values`. - * - * @private - * @param {Array} values The values to add to the set. - * @returns {Object} Returns the new set. - */ - var createSet = !(Set && (1 / setToArray(new Set([,-0]))[1]) == INFINITY) ? noop : function(values) { - return new Set(values); - }; - - /** - * Creates a `_.toPairs` or `_.toPairsIn` function. - * - * @private - * @param {Function} keysFunc The function to get the keys of a given object. - * @returns {Function} Returns the new pairs function. - */ - function createToPairs(keysFunc) { - return function(object) { - var tag = getTag(object); - if (tag == mapTag) { - return mapToArray(object); - } - if (tag == setTag) { - return setToPairs(object); - } - return baseToPairs(object, keysFunc(object)); - }; - } - - /** - * Creates a function that either curries or invokes `func` with optional - * `this` binding and partially applied arguments. - * - * @private - * @param {Function|string} func The function or method name to wrap. - * @param {number} bitmask The bitmask flags. - * 1 - `_.bind` - * 2 - `_.bindKey` - * 4 - `_.curry` or `_.curryRight` of a bound function - * 8 - `_.curry` - * 16 - `_.curryRight` - * 32 - `_.partial` - * 64 - `_.partialRight` - * 128 - `_.rearg` - * 256 - `_.ary` - * 512 - `_.flip` - * @param {*} [thisArg] The `this` binding of `func`. - * @param {Array} [partials] The arguments to be partially applied. - * @param {Array} [holders] The `partials` placeholder indexes. - * @param {Array} [argPos] The argument positions of the new function. - * @param {number} [ary] The arity cap of `func`. - * @param {number} [arity] The arity of `func`. - * @returns {Function} Returns the new wrapped function. - */ - function createWrap(func, bitmask, thisArg, partials, holders, argPos, ary, arity) { - var isBindKey = bitmask & WRAP_BIND_KEY_FLAG; - if (!isBindKey && typeof func != 'function') { - throw new TypeError(FUNC_ERROR_TEXT); - } - var length = partials ? partials.length : 0; - if (!length) { - bitmask &= ~(WRAP_PARTIAL_FLAG | WRAP_PARTIAL_RIGHT_FLAG); - partials = holders = undefined; - } - ary = ary === undefined ? ary : nativeMax(toInteger(ary), 0); - arity = arity === undefined ? arity : toInteger(arity); - length -= holders ? holders.length : 0; - - if (bitmask & WRAP_PARTIAL_RIGHT_FLAG) { - var partialsRight = partials, - holdersRight = holders; - - partials = holders = undefined; - } - var data = isBindKey ? undefined : getData(func); - - var newData = [ - func, bitmask, thisArg, partials, holders, partialsRight, holdersRight, - argPos, ary, arity - ]; - - if (data) { - mergeData(newData, data); - } - func = newData[0]; - bitmask = newData[1]; - thisArg = newData[2]; - partials = newData[3]; - holders = newData[4]; - arity = newData[9] = newData[9] === undefined - ? (isBindKey ? 0 : func.length) - : nativeMax(newData[9] - length, 0); - - if (!arity && bitmask & (WRAP_CURRY_FLAG | WRAP_CURRY_RIGHT_FLAG)) { - bitmask &= ~(WRAP_CURRY_FLAG | WRAP_CURRY_RIGHT_FLAG); - } - if (!bitmask || bitmask == WRAP_BIND_FLAG) { - var result = createBind(func, bitmask, thisArg); - } else if (bitmask == WRAP_CURRY_FLAG || bitmask == WRAP_CURRY_RIGHT_FLAG) { - result = createCurry(func, bitmask, arity); - } else if ((bitmask == WRAP_PARTIAL_FLAG || bitmask == (WRAP_BIND_FLAG | WRAP_PARTIAL_FLAG)) && !holders.length) { - result = createPartial(func, bitmask, thisArg, partials); - } else { - result = createHybrid.apply(undefined, newData); - } - var setter = data ? baseSetData : setData; - return setWrapToString(setter(result, newData), func, bitmask); - } - - /** - * Used by `_.defaults` to customize its `_.assignIn` use to assign properties - * of source objects to the destination object for all destination properties - * that resolve to `undefined`. - * - * @private - * @param {*} objValue The destination value. - * @param {*} srcValue The source value. - * @param {string} key The key of the property to assign. - * @param {Object} object The parent object of `objValue`. - * @returns {*} Returns the value to assign. - */ - function customDefaultsAssignIn(objValue, srcValue, key, object) { - if (objValue === undefined || - (eq(objValue, objectProto[key]) && !hasOwnProperty.call(object, key))) { - return srcValue; - } - return objValue; - } - - /** - * Used by `_.defaultsDeep` to customize its `_.merge` use to merge source - * objects into destination objects that are passed thru. - * - * @private - * @param {*} objValue The destination value. - * @param {*} srcValue The source value. - * @param {string} key The key of the property to merge. - * @param {Object} object The parent object of `objValue`. - * @param {Object} source The parent object of `srcValue`. - * @param {Object} [stack] Tracks traversed source values and their merged - * counterparts. - * @returns {*} Returns the value to assign. - */ - function customDefaultsMerge(objValue, srcValue, key, object, source, stack) { - if (isObject(objValue) && isObject(srcValue)) { - // Recursively merge objects and arrays (susceptible to call stack limits). - stack.set(srcValue, objValue); - baseMerge(objValue, srcValue, undefined, customDefaultsMerge, stack); - stack['delete'](srcValue); - } - return objValue; - } - - /** - * Used by `_.omit` to customize its `_.cloneDeep` use to only clone plain - * objects. - * - * @private - * @param {*} value The value to inspect. - * @param {string} key The key of the property to inspect. - * @returns {*} Returns the uncloned value or `undefined` to defer cloning to `_.cloneDeep`. - */ - function customOmitClone(value) { - return isPlainObject(value) ? undefined : value; - } - - /** - * A specialized version of `baseIsEqualDeep` for arrays with support for - * partial deep comparisons. - * - * @private - * @param {Array} array The array to compare. - * @param {Array} other The other array to compare. - * @param {number} bitmask The bitmask flags. See `baseIsEqual` for more details. - * @param {Function} customizer The function to customize comparisons. - * @param {Function} equalFunc The function to determine equivalents of values. - * @param {Object} stack Tracks traversed `array` and `other` objects. - * @returns {boolean} Returns `true` if the arrays are equivalent, else `false`. - */ - function equalArrays(array, other, bitmask, customizer, equalFunc, stack) { - var isPartial = bitmask & COMPARE_PARTIAL_FLAG, - arrLength = array.length, - othLength = other.length; - - if (arrLength != othLength && !(isPartial && othLength > arrLength)) { - return false; - } - // Assume cyclic values are equal. - var stacked = stack.get(array); - if (stacked && stack.get(other)) { - return stacked == other; - } - var index = -1, - result = true, - seen = (bitmask & COMPARE_UNORDERED_FLAG) ? new SetCache : undefined; - - stack.set(array, other); - stack.set(other, array); - - // Ignore non-index properties. - while (++index < arrLength) { - var arrValue = array[index], - othValue = other[index]; - - if (customizer) { - var compared = isPartial - ? customizer(othValue, arrValue, index, other, array, stack) - : customizer(arrValue, othValue, index, array, other, stack); - } - if (compared !== undefined) { - if (compared) { - continue; - } - result = false; - break; - } - // Recursively compare arrays (susceptible to call stack limits). - if (seen) { - if (!arraySome(other, function(othValue, othIndex) { - if (!cacheHas(seen, othIndex) && - (arrValue === othValue || equalFunc(arrValue, othValue, bitmask, customizer, stack))) { - return seen.push(othIndex); - } - })) { - result = false; - break; - } - } else if (!( - arrValue === othValue || - equalFunc(arrValue, othValue, bitmask, customizer, stack) - )) { - result = false; - break; - } - } - stack['delete'](array); - stack['delete'](other); - return result; - } - - /** - * A specialized version of `baseIsEqualDeep` for comparing objects of - * the same `toStringTag`. - * - * **Note:** This function only supports comparing values with tags of - * `Boolean`, `Date`, `Error`, `Number`, `RegExp`, or `String`. - * - * @private - * @param {Object} object The object to compare. - * @param {Object} other The other object to compare. - * @param {string} tag The `toStringTag` of the objects to compare. - * @param {number} bitmask The bitmask flags. See `baseIsEqual` for more details. - * @param {Function} customizer The function to customize comparisons. - * @param {Function} equalFunc The function to determine equivalents of values. - * @param {Object} stack Tracks traversed `object` and `other` objects. - * @returns {boolean} Returns `true` if the objects are equivalent, else `false`. - */ - function equalByTag(object, other, tag, bitmask, customizer, equalFunc, stack) { - switch (tag) { - case dataViewTag: - if ((object.byteLength != other.byteLength) || - (object.byteOffset != other.byteOffset)) { - return false; - } - object = object.buffer; - other = other.buffer; - - case arrayBufferTag: - if ((object.byteLength != other.byteLength) || - !equalFunc(new Uint8Array(object), new Uint8Array(other))) { - return false; - } - return true; - - case boolTag: - case dateTag: - case numberTag: - // Coerce booleans to `1` or `0` and dates to milliseconds. - // Invalid dates are coerced to `NaN`. - return eq(+object, +other); - - case errorTag: - return object.name == other.name && object.message == other.message; - - case regexpTag: - case stringTag: - // Coerce regexes to strings and treat strings, primitives and objects, - // as equal. See http://www.ecma-international.org/ecma-262/7.0/#sec-regexp.prototype.tostring - // for more details. - return object == (other + ''); - - case mapTag: - var convert = mapToArray; - - case setTag: - var isPartial = bitmask & COMPARE_PARTIAL_FLAG; - convert || (convert = setToArray); - - if (object.size != other.size && !isPartial) { - return false; - } - // Assume cyclic values are equal. - var stacked = stack.get(object); - if (stacked) { - return stacked == other; - } - bitmask |= COMPARE_UNORDERED_FLAG; - - // Recursively compare objects (susceptible to call stack limits). - stack.set(object, other); - var result = equalArrays(convert(object), convert(other), bitmask, customizer, equalFunc, stack); - stack['delete'](object); - return result; - - case symbolTag: - if (symbolValueOf) { - return symbolValueOf.call(object) == symbolValueOf.call(other); - } - } - return false; - } - - /** - * A specialized version of `baseIsEqualDeep` for objects with support for - * partial deep comparisons. - * - * @private - * @param {Object} object The object to compare. - * @param {Object} other The other object to compare. - * @param {number} bitmask The bitmask flags. See `baseIsEqual` for more details. - * @param {Function} customizer The function to customize comparisons. - * @param {Function} equalFunc The function to determine equivalents of values. - * @param {Object} stack Tracks traversed `object` and `other` objects. - * @returns {boolean} Returns `true` if the objects are equivalent, else `false`. - */ - function equalObjects(object, other, bitmask, customizer, equalFunc, stack) { - var isPartial = bitmask & COMPARE_PARTIAL_FLAG, - objProps = getAllKeys(object), - objLength = objProps.length, - othProps = getAllKeys(other), - othLength = othProps.length; - - if (objLength != othLength && !isPartial) { - return false; - } - var index = objLength; - while (index--) { - var key = objProps[index]; - if (!(isPartial ? key in other : hasOwnProperty.call(other, key))) { - return false; - } - } - // Assume cyclic values are equal. - var stacked = stack.get(object); - if (stacked && stack.get(other)) { - return stacked == other; - } - var result = true; - stack.set(object, other); - stack.set(other, object); - - var skipCtor = isPartial; - while (++index < objLength) { - key = objProps[index]; - var objValue = object[key], - othValue = other[key]; - - if (customizer) { - var compared = isPartial - ? customizer(othValue, objValue, key, other, object, stack) - : customizer(objValue, othValue, key, object, other, stack); - } - // Recursively compare objects (susceptible to call stack limits). - if (!(compared === undefined - ? (objValue === othValue || equalFunc(objValue, othValue, bitmask, customizer, stack)) - : compared - )) { - result = false; - break; - } - skipCtor || (skipCtor = key == 'constructor'); - } - if (result && !skipCtor) { - var objCtor = object.constructor, - othCtor = other.constructor; - - // Non `Object` object instances with different constructors are not equal. - if (objCtor != othCtor && - ('constructor' in object && 'constructor' in other) && - !(typeof objCtor == 'function' && objCtor instanceof objCtor && - typeof othCtor == 'function' && othCtor instanceof othCtor)) { - result = false; - } - } - stack['delete'](object); - stack['delete'](other); - return result; - } - - /** - * A specialized version of `baseRest` which flattens the rest array. - * - * @private - * @param {Function} func The function to apply a rest parameter to. - * @returns {Function} Returns the new function. - */ - function flatRest(func) { - return setToString(overRest(func, undefined, flatten), func + ''); - } - - /** - * Creates an array of own enumerable property names and symbols of `object`. - * - * @private - * @param {Object} object The object to query. - * @returns {Array} Returns the array of property names and symbols. - */ - function getAllKeys(object) { - return baseGetAllKeys(object, keys, getSymbols); - } - - /** - * Creates an array of own and inherited enumerable property names and - * symbols of `object`. - * - * @private - * @param {Object} object The object to query. - * @returns {Array} Returns the array of property names and symbols. - */ - function getAllKeysIn(object) { - return baseGetAllKeys(object, keysIn, getSymbolsIn); - } - - /** - * Gets metadata for `func`. - * - * @private - * @param {Function} func The function to query. - * @returns {*} Returns the metadata for `func`. - */ - var getData = !metaMap ? noop : function(func) { - return metaMap.get(func); - }; - - /** - * Gets the name of `func`. - * - * @private - * @param {Function} func The function to query. - * @returns {string} Returns the function name. - */ - function getFuncName(func) { - var result = (func.name + ''), - array = realNames[result], - length = hasOwnProperty.call(realNames, result) ? array.length : 0; - - while (length--) { - var data = array[length], - otherFunc = data.func; - if (otherFunc == null || otherFunc == func) { - return data.name; - } - } - return result; - } - - /** - * Gets the argument placeholder value for `func`. - * - * @private - * @param {Function} func The function to inspect. - * @returns {*} Returns the placeholder value. - */ - function getHolder(func) { - var object = hasOwnProperty.call(lodash, 'placeholder') ? lodash : func; - return object.placeholder; - } - - /** - * Gets the appropriate "iteratee" function. If `_.iteratee` is customized, - * this function returns the custom method, otherwise it returns `baseIteratee`. - * If arguments are provided, the chosen function is invoked with them and - * its result is returned. - * - * @private - * @param {*} [value] The value to convert to an iteratee. - * @param {number} [arity] The arity of the created iteratee. - * @returns {Function} Returns the chosen function or its result. - */ - function getIteratee() { - var result = lodash.iteratee || iteratee; - result = result === iteratee ? baseIteratee : result; - return arguments.length ? result(arguments[0], arguments[1]) : result; - } - - /** - * Gets the data for `map`. - * - * @private - * @param {Object} map The map to query. - * @param {string} key The reference key. - * @returns {*} Returns the map data. - */ - function getMapData(map, key) { - var data = map.__data__; - return isKeyable(key) - ? data[typeof key == 'string' ? 'string' : 'hash'] - : data.map; - } - - /** - * Gets the property names, values, and compare flags of `object`. - * - * @private - * @param {Object} object The object to query. - * @returns {Array} Returns the match data of `object`. - */ - function getMatchData(object) { - var result = keys(object), - length = result.length; - - while (length--) { - var key = result[length], - value = object[key]; - - result[length] = [key, value, isStrictComparable(value)]; - } - return result; - } - - /** - * Gets the native function at `key` of `object`. - * - * @private - * @param {Object} object The object to query. - * @param {string} key The key of the method to get. - * @returns {*} Returns the function if it's native, else `undefined`. - */ - function getNative(object, key) { - var value = getValue(object, key); - return baseIsNative(value) ? value : undefined; - } - - /** - * A specialized version of `baseGetTag` which ignores `Symbol.toStringTag` values. - * - * @private - * @param {*} value The value to query. - * @returns {string} Returns the raw `toStringTag`. - */ - function getRawTag(value) { - var isOwn = hasOwnProperty.call(value, symToStringTag), - tag = value[symToStringTag]; - - try { - value[symToStringTag] = undefined; - var unmasked = true; - } catch (e) {} - - var result = nativeObjectToString.call(value); - if (unmasked) { - if (isOwn) { - value[symToStringTag] = tag; - } else { - delete value[symToStringTag]; - } - } - return result; - } - - /** - * Creates an array of the own enumerable symbols of `object`. - * - * @private - * @param {Object} object The object to query. - * @returns {Array} Returns the array of symbols. - */ - var getSymbols = !nativeGetSymbols ? stubArray : function(object) { - if (object == null) { - return []; - } - object = Object(object); - return arrayFilter(nativeGetSymbols(object), function(symbol) { - return propertyIsEnumerable.call(object, symbol); - }); - }; - - /** - * Creates an array of the own and inherited enumerable symbols of `object`. - * - * @private - * @param {Object} object The object to query. - * @returns {Array} Returns the array of symbols. - */ - var getSymbolsIn = !nativeGetSymbols ? stubArray : function(object) { - var result = []; - while (object) { - arrayPush(result, getSymbols(object)); - object = getPrototype(object); - } - return result; - }; - - /** - * Gets the `toStringTag` of `value`. - * - * @private - * @param {*} value The value to query. - * @returns {string} Returns the `toStringTag`. - */ - var getTag = baseGetTag; - - // Fallback for data views, maps, sets, and weak maps in IE 11 and promises in Node.js < 6. - if ((DataView && getTag(new DataView(new ArrayBuffer(1))) != dataViewTag) || - (Map && getTag(new Map) != mapTag) || - (Promise && getTag(Promise.resolve()) != promiseTag) || - (Set && getTag(new Set) != setTag) || - (WeakMap && getTag(new WeakMap) != weakMapTag)) { - getTag = function(value) { - var result = baseGetTag(value), - Ctor = result == objectTag ? value.constructor : undefined, - ctorString = Ctor ? toSource(Ctor) : ''; - - if (ctorString) { - switch (ctorString) { - case dataViewCtorString: return dataViewTag; - case mapCtorString: return mapTag; - case promiseCtorString: return promiseTag; - case setCtorString: return setTag; - case weakMapCtorString: return weakMapTag; - } - } - return result; - }; - } - - /** - * Gets the view, applying any `transforms` to the `start` and `end` positions. - * - * @private - * @param {number} start The start of the view. - * @param {number} end The end of the view. - * @param {Array} transforms The transformations to apply to the view. - * @returns {Object} Returns an object containing the `start` and `end` - * positions of the view. - */ - function getView(start, end, transforms) { - var index = -1, - length = transforms.length; - - while (++index < length) { - var data = transforms[index], - size = data.size; - - switch (data.type) { - case 'drop': start += size; break; - case 'dropRight': end -= size; break; - case 'take': end = nativeMin(end, start + size); break; - case 'takeRight': start = nativeMax(start, end - size); break; - } - } - return { 'start': start, 'end': end }; - } - - /** - * Extracts wrapper details from the `source` body comment. - * - * @private - * @param {string} source The source to inspect. - * @returns {Array} Returns the wrapper details. - */ - function getWrapDetails(source) { - var match = source.match(reWrapDetails); - return match ? match[1].split(reSplitDetails) : []; - } - - /** - * Checks if `path` exists on `object`. - * - * @private - * @param {Object} object The object to query. - * @param {Array|string} path The path to check. - * @param {Function} hasFunc The function to check properties. - * @returns {boolean} Returns `true` if `path` exists, else `false`. - */ - function hasPath(object, path, hasFunc) { - path = castPath(path, object); - - var index = -1, - length = path.length, - result = false; - - while (++index < length) { - var key = toKey(path[index]); - if (!(result = object != null && hasFunc(object, key))) { - break; - } - object = object[key]; - } - if (result || ++index != length) { - return result; - } - length = object == null ? 0 : object.length; - return !!length && isLength(length) && isIndex(key, length) && - (isArray(object) || isArguments(object)); - } - - /** - * Initializes an array clone. - * - * @private - * @param {Array} array The array to clone. - * @returns {Array} Returns the initialized clone. - */ - function initCloneArray(array) { - var length = array.length, - result = new array.constructor(length); - - // Add properties assigned by `RegExp#exec`. - if (length && typeof array[0] == 'string' && hasOwnProperty.call(array, 'index')) { - result.index = array.index; - result.input = array.input; - } - return result; - } - - /** - * Initializes an object clone. - * - * @private - * @param {Object} object The object to clone. - * @returns {Object} Returns the initialized clone. - */ - function initCloneObject(object) { - return (typeof object.constructor == 'function' && !isPrototype(object)) - ? baseCreate(getPrototype(object)) - : {}; - } - - /** - * Initializes an object clone based on its `toStringTag`. - * - * **Note:** This function only supports cloning values with tags of - * `Boolean`, `Date`, `Error`, `Map`, `Number`, `RegExp`, `Set`, or `String`. - * - * @private - * @param {Object} object The object to clone. - * @param {string} tag The `toStringTag` of the object to clone. - * @param {boolean} [isDeep] Specify a deep clone. - * @returns {Object} Returns the initialized clone. - */ - function initCloneByTag(object, tag, isDeep) { - var Ctor = object.constructor; - switch (tag) { - case arrayBufferTag: - return cloneArrayBuffer(object); - - case boolTag: - case dateTag: - return new Ctor(+object); - - case dataViewTag: - return cloneDataView(object, isDeep); - - case float32Tag: case float64Tag: - case int8Tag: case int16Tag: case int32Tag: - case uint8Tag: case uint8ClampedTag: case uint16Tag: case uint32Tag: - return cloneTypedArray(object, isDeep); - - case mapTag: - return new Ctor; - - case numberTag: - case stringTag: - return new Ctor(object); - - case regexpTag: - return cloneRegExp(object); - - case setTag: - return new Ctor; - - case symbolTag: - return cloneSymbol(object); - } - } - - /** - * Inserts wrapper `details` in a comment at the top of the `source` body. - * - * @private - * @param {string} source The source to modify. - * @returns {Array} details The details to insert. - * @returns {string} Returns the modified source. - */ - function insertWrapDetails(source, details) { - var length = details.length; - if (!length) { - return source; - } - var lastIndex = length - 1; - details[lastIndex] = (length > 1 ? '& ' : '') + details[lastIndex]; - details = details.join(length > 2 ? ', ' : ' '); - return source.replace(reWrapComment, '{\n/* [wrapped with ' + details + '] */\n'); - } - - /** - * Checks if `value` is a flattenable `arguments` object or array. - * - * @private - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` is flattenable, else `false`. - */ - function isFlattenable(value) { - return isArray(value) || isArguments(value) || - !!(spreadableSymbol && value && value[spreadableSymbol]); - } - - /** - * Checks if `value` is a valid array-like index. - * - * @private - * @param {*} value The value to check. - * @param {number} [length=MAX_SAFE_INTEGER] The upper bounds of a valid index. - * @returns {boolean} Returns `true` if `value` is a valid index, else `false`. - */ - function isIndex(value, length) { - var type = typeof value; - length = length == null ? MAX_SAFE_INTEGER : length; - - return !!length && - (type == 'number' || - (type != 'symbol' && reIsUint.test(value))) && - (value > -1 && value % 1 == 0 && value < length); - } - - /** - * Checks if the given arguments are from an iteratee call. - * - * @private - * @param {*} value The potential iteratee value argument. - * @param {*} index The potential iteratee index or key argument. - * @param {*} object The potential iteratee object argument. - * @returns {boolean} Returns `true` if the arguments are from an iteratee call, - * else `false`. - */ - function isIterateeCall(value, index, object) { - if (!isObject(object)) { - return false; - } - var type = typeof index; - if (type == 'number' - ? (isArrayLike(object) && isIndex(index, object.length)) - : (type == 'string' && index in object) - ) { - return eq(object[index], value); - } - return false; - } - - /** - * Checks if `value` is a property name and not a property path. - * - * @private - * @param {*} value The value to check. - * @param {Object} [object] The object to query keys on. - * @returns {boolean} Returns `true` if `value` is a property name, else `false`. - */ - function isKey(value, object) { - if (isArray(value)) { - return false; - } - var type = typeof value; - if (type == 'number' || type == 'symbol' || type == 'boolean' || - value == null || isSymbol(value)) { - return true; - } - return reIsPlainProp.test(value) || !reIsDeepProp.test(value) || - (object != null && value in Object(object)); - } - - /** - * Checks if `value` is suitable for use as unique object key. - * - * @private - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` is suitable, else `false`. - */ - function isKeyable(value) { - var type = typeof value; - return (type == 'string' || type == 'number' || type == 'symbol' || type == 'boolean') - ? (value !== '__proto__') - : (value === null); - } - - /** - * Checks if `func` has a lazy counterpart. - * - * @private - * @param {Function} func The function to check. - * @returns {boolean} Returns `true` if `func` has a lazy counterpart, - * else `false`. - */ - function isLaziable(func) { - var funcName = getFuncName(func), - other = lodash[funcName]; - - if (typeof other != 'function' || !(funcName in LazyWrapper.prototype)) { - return false; - } - if (func === other) { - return true; - } - var data = getData(other); - return !!data && func === data[0]; - } - - /** - * Checks if `func` has its source masked. - * - * @private - * @param {Function} func The function to check. - * @returns {boolean} Returns `true` if `func` is masked, else `false`. - */ - function isMasked(func) { - return !!maskSrcKey && (maskSrcKey in func); - } - - /** - * Checks if `func` is capable of being masked. - * - * @private - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `func` is maskable, else `false`. - */ - var isMaskable = coreJsData ? isFunction : stubFalse; - - /** - * Checks if `value` is likely a prototype object. - * - * @private - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` is a prototype, else `false`. - */ - function isPrototype(value) { - var Ctor = value && value.constructor, - proto = (typeof Ctor == 'function' && Ctor.prototype) || objectProto; - - return value === proto; - } - - /** - * Checks if `value` is suitable for strict equality comparisons, i.e. `===`. - * - * @private - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` if suitable for strict - * equality comparisons, else `false`. - */ - function isStrictComparable(value) { - return value === value && !isObject(value); - } - - /** - * A specialized version of `matchesProperty` for source values suitable - * for strict equality comparisons, i.e. `===`. - * - * @private - * @param {string} key The key of the property to get. - * @param {*} srcValue The value to match. - * @returns {Function} Returns the new spec function. - */ - function matchesStrictComparable(key, srcValue) { - return function(object) { - if (object == null) { - return false; - } - return object[key] === srcValue && - (srcValue !== undefined || (key in Object(object))); - }; - } - - /** - * A specialized version of `_.memoize` which clears the memoized function's - * cache when it exceeds `MAX_MEMOIZE_SIZE`. - * - * @private - * @param {Function} func The function to have its output memoized. - * @returns {Function} Returns the new memoized function. - */ - function memoizeCapped(func) { - var result = memoize(func, function(key) { - if (cache.size === MAX_MEMOIZE_SIZE) { - cache.clear(); - } - return key; - }); - - var cache = result.cache; - return result; - } - - /** - * Merges the function metadata of `source` into `data`. - * - * Merging metadata reduces the number of wrappers used to invoke a function. - * This is possible because methods like `_.bind`, `_.curry`, and `_.partial` - * may be applied regardless of execution order. Methods like `_.ary` and - * `_.rearg` modify function arguments, making the order in which they are - * executed important, preventing the merging of metadata. However, we make - * an exception for a safe combined case where curried functions have `_.ary` - * and or `_.rearg` applied. - * - * @private - * @param {Array} data The destination metadata. - * @param {Array} source The source metadata. - * @returns {Array} Returns `data`. - */ - function mergeData(data, source) { - var bitmask = data[1], - srcBitmask = source[1], - newBitmask = bitmask | srcBitmask, - isCommon = newBitmask < (WRAP_BIND_FLAG | WRAP_BIND_KEY_FLAG | WRAP_ARY_FLAG); - - var isCombo = - ((srcBitmask == WRAP_ARY_FLAG) && (bitmask == WRAP_CURRY_FLAG)) || - ((srcBitmask == WRAP_ARY_FLAG) && (bitmask == WRAP_REARG_FLAG) && (data[7].length <= source[8])) || - ((srcBitmask == (WRAP_ARY_FLAG | WRAP_REARG_FLAG)) && (source[7].length <= source[8]) && (bitmask == WRAP_CURRY_FLAG)); - - // Exit early if metadata can't be merged. - if (!(isCommon || isCombo)) { - return data; - } - // Use source `thisArg` if available. - if (srcBitmask & WRAP_BIND_FLAG) { - data[2] = source[2]; - // Set when currying a bound function. - newBitmask |= bitmask & WRAP_BIND_FLAG ? 0 : WRAP_CURRY_BOUND_FLAG; - } - // Compose partial arguments. - var value = source[3]; - if (value) { - var partials = data[3]; - data[3] = partials ? composeArgs(partials, value, source[4]) : value; - data[4] = partials ? replaceHolders(data[3], PLACEHOLDER) : source[4]; - } - // Compose partial right arguments. - value = source[5]; - if (value) { - partials = data[5]; - data[5] = partials ? composeArgsRight(partials, value, source[6]) : value; - data[6] = partials ? replaceHolders(data[5], PLACEHOLDER) : source[6]; - } - // Use source `argPos` if available. - value = source[7]; - if (value) { - data[7] = value; - } - // Use source `ary` if it's smaller. - if (srcBitmask & WRAP_ARY_FLAG) { - data[8] = data[8] == null ? source[8] : nativeMin(data[8], source[8]); - } - // Use source `arity` if one is not provided. - if (data[9] == null) { - data[9] = source[9]; - } - // Use source `func` and merge bitmasks. - data[0] = source[0]; - data[1] = newBitmask; - - return data; - } - - /** - * This function is like - * [`Object.keys`](http://ecma-international.org/ecma-262/7.0/#sec-object.keys) - * except that it includes inherited enumerable properties. - * - * @private - * @param {Object} object The object to query. - * @returns {Array} Returns the array of property names. - */ - function nativeKeysIn(object) { - var result = []; - if (object != null) { - for (var key in Object(object)) { - result.push(key); - } - } - return result; - } - - /** - * Converts `value` to a string using `Object.prototype.toString`. - * - * @private - * @param {*} value The value to convert. - * @returns {string} Returns the converted string. - */ - function objectToString(value) { - return nativeObjectToString.call(value); - } - - /** - * A specialized version of `baseRest` which transforms the rest array. - * - * @private - * @param {Function} func The function to apply a rest parameter to. - * @param {number} [start=func.length-1] The start position of the rest parameter. - * @param {Function} transform The rest array transform. - * @returns {Function} Returns the new function. - */ - function overRest(func, start, transform) { - start = nativeMax(start === undefined ? (func.length - 1) : start, 0); - return function() { - var args = arguments, - index = -1, - length = nativeMax(args.length - start, 0), - array = Array(length); - - while (++index < length) { - array[index] = args[start + index]; - } - index = -1; - var otherArgs = Array(start + 1); - while (++index < start) { - otherArgs[index] = args[index]; - } - otherArgs[start] = transform(array); - return apply(func, this, otherArgs); - }; - } - - /** - * Gets the parent value at `path` of `object`. - * - * @private - * @param {Object} object The object to query. - * @param {Array} path The path to get the parent value of. - * @returns {*} Returns the parent value. - */ - function parent(object, path) { - return path.length < 2 ? object : baseGet(object, baseSlice(path, 0, -1)); - } - - /** - * Reorder `array` according to the specified indexes where the element at - * the first index is assigned as the first element, the element at - * the second index is assigned as the second element, and so on. - * - * @private - * @param {Array} array The array to reorder. - * @param {Array} indexes The arranged array indexes. - * @returns {Array} Returns `array`. - */ - function reorder(array, indexes) { - var arrLength = array.length, - length = nativeMin(indexes.length, arrLength), - oldArray = copyArray(array); - - while (length--) { - var index = indexes[length]; - array[length] = isIndex(index, arrLength) ? oldArray[index] : undefined; - } - return array; - } - - /** - * Sets metadata for `func`. - * - * **Note:** If this function becomes hot, i.e. is invoked a lot in a short - * period of time, it will trip its breaker and transition to an identity - * function to avoid garbage collection pauses in V8. See - * [V8 issue 2070](https://bugs.chromium.org/p/v8/issues/detail?id=2070) - * for more details. - * - * @private - * @param {Function} func The function to associate metadata with. - * @param {*} data The metadata. - * @returns {Function} Returns `func`. - */ - var setData = shortOut(baseSetData); - - /** - * A simple wrapper around the global [`setTimeout`](https://mdn.io/setTimeout). - * - * @private - * @param {Function} func The function to delay. - * @param {number} wait The number of milliseconds to delay invocation. - * @returns {number|Object} Returns the timer id or timeout object. - */ - var setTimeout = ctxSetTimeout || function(func, wait) { - return root.setTimeout(func, wait); - }; - - /** - * Sets the `toString` method of `func` to return `string`. - * - * @private - * @param {Function} func The function to modify. - * @param {Function} string The `toString` result. - * @returns {Function} Returns `func`. - */ - var setToString = shortOut(baseSetToString); - - /** - * Sets the `toString` method of `wrapper` to mimic the source of `reference` - * with wrapper details in a comment at the top of the source body. - * - * @private - * @param {Function} wrapper The function to modify. - * @param {Function} reference The reference function. - * @param {number} bitmask The bitmask flags. See `createWrap` for more details. - * @returns {Function} Returns `wrapper`. - */ - function setWrapToString(wrapper, reference, bitmask) { - var source = (reference + ''); - return setToString(wrapper, insertWrapDetails(source, updateWrapDetails(getWrapDetails(source), bitmask))); - } - - /** - * Creates a function that'll short out and invoke `identity` instead - * of `func` when it's called `HOT_COUNT` or more times in `HOT_SPAN` - * milliseconds. - * - * @private - * @param {Function} func The function to restrict. - * @returns {Function} Returns the new shortable function. - */ - function shortOut(func) { - var count = 0, - lastCalled = 0; - - return function() { - var stamp = nativeNow(), - remaining = HOT_SPAN - (stamp - lastCalled); - - lastCalled = stamp; - if (remaining > 0) { - if (++count >= HOT_COUNT) { - return arguments[0]; - } - } else { - count = 0; - } - return func.apply(undefined, arguments); - }; - } - - /** - * A specialized version of `_.shuffle` which mutates and sets the size of `array`. - * - * @private - * @param {Array} array The array to shuffle. - * @param {number} [size=array.length] The size of `array`. - * @returns {Array} Returns `array`. - */ - function shuffleSelf(array, size) { - var index = -1, - length = array.length, - lastIndex = length - 1; - - size = size === undefined ? length : size; - while (++index < size) { - var rand = baseRandom(index, lastIndex), - value = array[rand]; - - array[rand] = array[index]; - array[index] = value; - } - array.length = size; - return array; - } - - /** - * Converts `string` to a property path array. - * - * @private - * @param {string} string The string to convert. - * @returns {Array} Returns the property path array. - */ - var stringToPath = memoizeCapped(function(string) { - var result = []; - if (string.charCodeAt(0) === 46 /* . */) { - result.push(''); - } - string.replace(rePropName, function(match, number, quote, subString) { - result.push(quote ? subString.replace(reEscapeChar, '$1') : (number || match)); - }); - return result; - }); - - /** - * Converts `value` to a string key if it's not a string or symbol. - * - * @private - * @param {*} value The value to inspect. - * @returns {string|symbol} Returns the key. - */ - function toKey(value) { - if (typeof value == 'string' || isSymbol(value)) { - return value; - } - var result = (value + ''); - return (result == '0' && (1 / value) == -INFINITY) ? '-0' : result; - } - - /** - * Converts `func` to its source code. - * - * @private - * @param {Function} func The function to convert. - * @returns {string} Returns the source code. - */ - function toSource(func) { - if (func != null) { - try { - return funcToString.call(func); - } catch (e) {} - try { - return (func + ''); - } catch (e) {} - } - return ''; - } - - /** - * Updates wrapper `details` based on `bitmask` flags. - * - * @private - * @returns {Array} details The details to modify. - * @param {number} bitmask The bitmask flags. See `createWrap` for more details. - * @returns {Array} Returns `details`. - */ - function updateWrapDetails(details, bitmask) { - arrayEach(wrapFlags, function(pair) { - var value = '_.' + pair[0]; - if ((bitmask & pair[1]) && !arrayIncludes(details, value)) { - details.push(value); - } - }); - return details.sort(); - } - - /** - * Creates a clone of `wrapper`. - * - * @private - * @param {Object} wrapper The wrapper to clone. - * @returns {Object} Returns the cloned wrapper. - */ - function wrapperClone(wrapper) { - if (wrapper instanceof LazyWrapper) { - return wrapper.clone(); - } - var result = new LodashWrapper(wrapper.__wrapped__, wrapper.__chain__); - result.__actions__ = copyArray(wrapper.__actions__); - result.__index__ = wrapper.__index__; - result.__values__ = wrapper.__values__; - return result; - } - - /*------------------------------------------------------------------------*/ - - /** - * Creates an array of elements split into groups the length of `size`. - * If `array` can't be split evenly, the final chunk will be the remaining - * elements. - * - * @static - * @memberOf _ - * @since 3.0.0 - * @category Array - * @param {Array} array The array to process. - * @param {number} [size=1] The length of each chunk - * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`. - * @returns {Array} Returns the new array of chunks. - * @example - * - * _.chunk(['a', 'b', 'c', 'd'], 2); - * // => [['a', 'b'], ['c', 'd']] - * - * _.chunk(['a', 'b', 'c', 'd'], 3); - * // => [['a', 'b', 'c'], ['d']] - */ - function chunk(array, size, guard) { - if ((guard ? isIterateeCall(array, size, guard) : size === undefined)) { - size = 1; - } else { - size = nativeMax(toInteger(size), 0); - } - var length = array == null ? 0 : array.length; - if (!length || size < 1) { - return []; - } - var index = 0, - resIndex = 0, - result = Array(nativeCeil(length / size)); - - while (index < length) { - result[resIndex++] = baseSlice(array, index, (index += size)); - } - return result; - } - - /** - * Creates an array with all falsey values removed. The values `false`, `null`, - * `0`, `""`, `undefined`, and `NaN` are falsey. - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Array - * @param {Array} array The array to compact. - * @returns {Array} Returns the new array of filtered values. - * @example - * - * _.compact([0, 1, false, 2, '', 3]); - * // => [1, 2, 3] - */ - function compact(array) { - var index = -1, - length = array == null ? 0 : array.length, - resIndex = 0, - result = []; - - while (++index < length) { - var value = array[index]; - if (value) { - result[resIndex++] = value; - } - } - return result; - } - - /** - * Creates a new array concatenating `array` with any additional arrays - * and/or values. - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Array - * @param {Array} array The array to concatenate. - * @param {...*} [values] The values to concatenate. - * @returns {Array} Returns the new concatenated array. - * @example - * - * var array = [1]; - * var other = _.concat(array, 2, [3], [[4]]); - * - * console.log(other); - * // => [1, 2, 3, [4]] - * - * console.log(array); - * // => [1] - */ - function concat() { - var length = arguments.length; - if (!length) { - return []; - } - var args = Array(length - 1), - array = arguments[0], - index = length; - - while (index--) { - args[index - 1] = arguments[index]; - } - return arrayPush(isArray(array) ? copyArray(array) : [array], baseFlatten(args, 1)); - } - - /** - * Creates an array of `array` values not included in the other given arrays - * using [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero) - * for equality comparisons. The order and references of result values are - * determined by the first array. - * - * **Note:** Unlike `_.pullAll`, this method returns a new array. - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Array - * @param {Array} array The array to inspect. - * @param {...Array} [values] The values to exclude. - * @returns {Array} Returns the new array of filtered values. - * @see _.without, _.xor - * @example - * - * _.difference([2, 1], [2, 3]); - * // => [1] - */ - var difference = baseRest(function(array, values) { - return isArrayLikeObject(array) - ? baseDifference(array, baseFlatten(values, 1, isArrayLikeObject, true)) - : []; - }); - - /** - * This method is like `_.difference` except that it accepts `iteratee` which - * is invoked for each element of `array` and `values` to generate the criterion - * by which they're compared. The order and references of result values are - * determined by the first array. The iteratee is invoked with one argument: - * (value). - * - * **Note:** Unlike `_.pullAllBy`, this method returns a new array. - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Array - * @param {Array} array The array to inspect. - * @param {...Array} [values] The values to exclude. - * @param {Function} [iteratee=_.identity] The iteratee invoked per element. - * @returns {Array} Returns the new array of filtered values. - * @example - * - * _.differenceBy([2.1, 1.2], [2.3, 3.4], Math.floor); - * // => [1.2] - * - * // The `_.property` iteratee shorthand. - * _.differenceBy([{ 'x': 2 }, { 'x': 1 }], [{ 'x': 1 }], 'x'); - * // => [{ 'x': 2 }] - */ - var differenceBy = baseRest(function(array, values) { - var iteratee = last(values); - if (isArrayLikeObject(iteratee)) { - iteratee = undefined; - } - return isArrayLikeObject(array) - ? baseDifference(array, baseFlatten(values, 1, isArrayLikeObject, true), getIteratee(iteratee, 2)) - : []; - }); - - /** - * This method is like `_.difference` except that it accepts `comparator` - * which is invoked to compare elements of `array` to `values`. The order and - * references of result values are determined by the first array. The comparator - * is invoked with two arguments: (arrVal, othVal). - * - * **Note:** Unlike `_.pullAllWith`, this method returns a new array. - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Array - * @param {Array} array The array to inspect. - * @param {...Array} [values] The values to exclude. - * @param {Function} [comparator] The comparator invoked per element. - * @returns {Array} Returns the new array of filtered values. - * @example - * - * var objects = [{ 'x': 1, 'y': 2 }, { 'x': 2, 'y': 1 }]; - * - * _.differenceWith(objects, [{ 'x': 1, 'y': 2 }], _.isEqual); - * // => [{ 'x': 2, 'y': 1 }] - */ - var differenceWith = baseRest(function(array, values) { - var comparator = last(values); - if (isArrayLikeObject(comparator)) { - comparator = undefined; - } - return isArrayLikeObject(array) - ? baseDifference(array, baseFlatten(values, 1, isArrayLikeObject, true), undefined, comparator) - : []; - }); - - /** - * Creates a slice of `array` with `n` elements dropped from the beginning. - * - * @static - * @memberOf _ - * @since 0.5.0 - * @category Array - * @param {Array} array The array to query. - * @param {number} [n=1] The number of elements to drop. - * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`. - * @returns {Array} Returns the slice of `array`. - * @example - * - * _.drop([1, 2, 3]); - * // => [2, 3] - * - * _.drop([1, 2, 3], 2); - * // => [3] - * - * _.drop([1, 2, 3], 5); - * // => [] - * - * _.drop([1, 2, 3], 0); - * // => [1, 2, 3] - */ - function drop(array, n, guard) { - var length = array == null ? 0 : array.length; - if (!length) { - return []; - } - n = (guard || n === undefined) ? 1 : toInteger(n); - return baseSlice(array, n < 0 ? 0 : n, length); - } - - /** - * Creates a slice of `array` with `n` elements dropped from the end. - * - * @static - * @memberOf _ - * @since 3.0.0 - * @category Array - * @param {Array} array The array to query. - * @param {number} [n=1] The number of elements to drop. - * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`. - * @returns {Array} Returns the slice of `array`. - * @example - * - * _.dropRight([1, 2, 3]); - * // => [1, 2] - * - * _.dropRight([1, 2, 3], 2); - * // => [1] - * - * _.dropRight([1, 2, 3], 5); - * // => [] - * - * _.dropRight([1, 2, 3], 0); - * // => [1, 2, 3] - */ - function dropRight(array, n, guard) { - var length = array == null ? 0 : array.length; - if (!length) { - return []; - } - n = (guard || n === undefined) ? 1 : toInteger(n); - n = length - n; - return baseSlice(array, 0, n < 0 ? 0 : n); - } - - /** - * Creates a slice of `array` excluding elements dropped from the end. - * Elements are dropped until `predicate` returns falsey. The predicate is - * invoked with three arguments: (value, index, array). - * - * @static - * @memberOf _ - * @since 3.0.0 - * @category Array - * @param {Array} array The array to query. - * @param {Function} [predicate=_.identity] The function invoked per iteration. - * @returns {Array} Returns the slice of `array`. - * @example - * - * var users = [ - * { 'user': 'barney', 'active': true }, - * { 'user': 'fred', 'active': false }, - * { 'user': 'pebbles', 'active': false } - * ]; - * - * _.dropRightWhile(users, function(o) { return !o.active; }); - * // => objects for ['barney'] - * - * // The `_.matches` iteratee shorthand. - * _.dropRightWhile(users, { 'user': 'pebbles', 'active': false }); - * // => objects for ['barney', 'fred'] - * - * // The `_.matchesProperty` iteratee shorthand. - * _.dropRightWhile(users, ['active', false]); - * // => objects for ['barney'] - * - * // The `_.property` iteratee shorthand. - * _.dropRightWhile(users, 'active'); - * // => objects for ['barney', 'fred', 'pebbles'] - */ - function dropRightWhile(array, predicate) { - return (array && array.length) - ? baseWhile(array, getIteratee(predicate, 3), true, true) - : []; - } - - /** - * Creates a slice of `array` excluding elements dropped from the beginning. - * Elements are dropped until `predicate` returns falsey. The predicate is - * invoked with three arguments: (value, index, array). - * - * @static - * @memberOf _ - * @since 3.0.0 - * @category Array - * @param {Array} array The array to query. - * @param {Function} [predicate=_.identity] The function invoked per iteration. - * @returns {Array} Returns the slice of `array`. - * @example - * - * var users = [ - * { 'user': 'barney', 'active': false }, - * { 'user': 'fred', 'active': false }, - * { 'user': 'pebbles', 'active': true } - * ]; - * - * _.dropWhile(users, function(o) { return !o.active; }); - * // => objects for ['pebbles'] - * - * // The `_.matches` iteratee shorthand. - * _.dropWhile(users, { 'user': 'barney', 'active': false }); - * // => objects for ['fred', 'pebbles'] - * - * // The `_.matchesProperty` iteratee shorthand. - * _.dropWhile(users, ['active', false]); - * // => objects for ['pebbles'] - * - * // The `_.property` iteratee shorthand. - * _.dropWhile(users, 'active'); - * // => objects for ['barney', 'fred', 'pebbles'] - */ - function dropWhile(array, predicate) { - return (array && array.length) - ? baseWhile(array, getIteratee(predicate, 3), true) - : []; - } - - /** - * Fills elements of `array` with `value` from `start` up to, but not - * including, `end`. - * - * **Note:** This method mutates `array`. - * - * @static - * @memberOf _ - * @since 3.2.0 - * @category Array - * @param {Array} array The array to fill. - * @param {*} value The value to fill `array` with. - * @param {number} [start=0] The start position. - * @param {number} [end=array.length] The end position. - * @returns {Array} Returns `array`. - * @example - * - * var array = [1, 2, 3]; - * - * _.fill(array, 'a'); - * console.log(array); - * // => ['a', 'a', 'a'] - * - * _.fill(Array(3), 2); - * // => [2, 2, 2] - * - * _.fill([4, 6, 8, 10], '*', 1, 3); - * // => [4, '*', '*', 10] - */ - function fill(array, value, start, end) { - var length = array == null ? 0 : array.length; - if (!length) { - return []; - } - if (start && typeof start != 'number' && isIterateeCall(array, value, start)) { - start = 0; - end = length; - } - return baseFill(array, value, start, end); - } - - /** - * This method is like `_.find` except that it returns the index of the first - * element `predicate` returns truthy for instead of the element itself. - * - * @static - * @memberOf _ - * @since 1.1.0 - * @category Array - * @param {Array} array The array to inspect. - * @param {Function} [predicate=_.identity] The function invoked per iteration. - * @param {number} [fromIndex=0] The index to search from. - * @returns {number} Returns the index of the found element, else `-1`. - * @example - * - * var users = [ - * { 'user': 'barney', 'active': false }, - * { 'user': 'fred', 'active': false }, - * { 'user': 'pebbles', 'active': true } - * ]; - * - * _.findIndex(users, function(o) { return o.user == 'barney'; }); - * // => 0 - * - * // The `_.matches` iteratee shorthand. - * _.findIndex(users, { 'user': 'fred', 'active': false }); - * // => 1 - * - * // The `_.matchesProperty` iteratee shorthand. - * _.findIndex(users, ['active', false]); - * // => 0 - * - * // The `_.property` iteratee shorthand. - * _.findIndex(users, 'active'); - * // => 2 - */ - function findIndex(array, predicate, fromIndex) { - var length = array == null ? 0 : array.length; - if (!length) { - return -1; - } - var index = fromIndex == null ? 0 : toInteger(fromIndex); - if (index < 0) { - index = nativeMax(length + index, 0); - } - return baseFindIndex(array, getIteratee(predicate, 3), index); - } - - /** - * This method is like `_.findIndex` except that it iterates over elements - * of `collection` from right to left. - * - * @static - * @memberOf _ - * @since 2.0.0 - * @category Array - * @param {Array} array The array to inspect. - * @param {Function} [predicate=_.identity] The function invoked per iteration. - * @param {number} [fromIndex=array.length-1] The index to search from. - * @returns {number} Returns the index of the found element, else `-1`. - * @example - * - * var users = [ - * { 'user': 'barney', 'active': true }, - * { 'user': 'fred', 'active': false }, - * { 'user': 'pebbles', 'active': false } - * ]; - * - * _.findLastIndex(users, function(o) { return o.user == 'pebbles'; }); - * // => 2 - * - * // The `_.matches` iteratee shorthand. - * _.findLastIndex(users, { 'user': 'barney', 'active': true }); - * // => 0 - * - * // The `_.matchesProperty` iteratee shorthand. - * _.findLastIndex(users, ['active', false]); - * // => 2 - * - * // The `_.property` iteratee shorthand. - * _.findLastIndex(users, 'active'); - * // => 0 - */ - function findLastIndex(array, predicate, fromIndex) { - var length = array == null ? 0 : array.length; - if (!length) { - return -1; - } - var index = length - 1; - if (fromIndex !== undefined) { - index = toInteger(fromIndex); - index = fromIndex < 0 - ? nativeMax(length + index, 0) - : nativeMin(index, length - 1); - } - return baseFindIndex(array, getIteratee(predicate, 3), index, true); - } - - /** - * Flattens `array` a single level deep. - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Array - * @param {Array} array The array to flatten. - * @returns {Array} Returns the new flattened array. - * @example - * - * _.flatten([1, [2, [3, [4]], 5]]); - * // => [1, 2, [3, [4]], 5] - */ - function flatten(array) { - var length = array == null ? 0 : array.length; - return length ? baseFlatten(array, 1) : []; - } - - /** - * Recursively flattens `array`. - * - * @static - * @memberOf _ - * @since 3.0.0 - * @category Array - * @param {Array} array The array to flatten. - * @returns {Array} Returns the new flattened array. - * @example - * - * _.flattenDeep([1, [2, [3, [4]], 5]]); - * // => [1, 2, 3, 4, 5] - */ - function flattenDeep(array) { - var length = array == null ? 0 : array.length; - return length ? baseFlatten(array, INFINITY) : []; - } - - /** - * Recursively flatten `array` up to `depth` times. - * - * @static - * @memberOf _ - * @since 4.4.0 - * @category Array - * @param {Array} array The array to flatten. - * @param {number} [depth=1] The maximum recursion depth. - * @returns {Array} Returns the new flattened array. - * @example - * - * var array = [1, [2, [3, [4]], 5]]; - * - * _.flattenDepth(array, 1); - * // => [1, 2, [3, [4]], 5] - * - * _.flattenDepth(array, 2); - * // => [1, 2, 3, [4], 5] - */ - function flattenDepth(array, depth) { - var length = array == null ? 0 : array.length; - if (!length) { - return []; - } - depth = depth === undefined ? 1 : toInteger(depth); - return baseFlatten(array, depth); - } - - /** - * The inverse of `_.toPairs`; this method returns an object composed - * from key-value `pairs`. - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Array - * @param {Array} pairs The key-value pairs. - * @returns {Object} Returns the new object. - * @example - * - * _.fromPairs([['a', 1], ['b', 2]]); - * // => { 'a': 1, 'b': 2 } - */ - function fromPairs(pairs) { - var index = -1, - length = pairs == null ? 0 : pairs.length, - result = {}; - - while (++index < length) { - var pair = pairs[index]; - result[pair[0]] = pair[1]; - } - return result; - } - - /** - * Gets the first element of `array`. - * - * @static - * @memberOf _ - * @since 0.1.0 - * @alias first - * @category Array - * @param {Array} array The array to query. - * @returns {*} Returns the first element of `array`. - * @example - * - * _.head([1, 2, 3]); - * // => 1 - * - * _.head([]); - * // => undefined - */ - function head(array) { - return (array && array.length) ? array[0] : undefined; - } - - /** - * Gets the index at which the first occurrence of `value` is found in `array` - * using [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero) - * for equality comparisons. If `fromIndex` is negative, it's used as the - * offset from the end of `array`. - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Array - * @param {Array} array The array to inspect. - * @param {*} value The value to search for. - * @param {number} [fromIndex=0] The index to search from. - * @returns {number} Returns the index of the matched value, else `-1`. - * @example - * - * _.indexOf([1, 2, 1, 2], 2); - * // => 1 - * - * // Search from the `fromIndex`. - * _.indexOf([1, 2, 1, 2], 2, 2); - * // => 3 - */ - function indexOf(array, value, fromIndex) { - var length = array == null ? 0 : array.length; - if (!length) { - return -1; - } - var index = fromIndex == null ? 0 : toInteger(fromIndex); - if (index < 0) { - index = nativeMax(length + index, 0); - } - return baseIndexOf(array, value, index); - } - - /** - * Gets all but the last element of `array`. - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Array - * @param {Array} array The array to query. - * @returns {Array} Returns the slice of `array`. - * @example - * - * _.initial([1, 2, 3]); - * // => [1, 2] - */ - function initial(array) { - var length = array == null ? 0 : array.length; - return length ? baseSlice(array, 0, -1) : []; - } - - /** - * Creates an array of unique values that are included in all given arrays - * using [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero) - * for equality comparisons. The order and references of result values are - * determined by the first array. - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Array - * @param {...Array} [arrays] The arrays to inspect. - * @returns {Array} Returns the new array of intersecting values. - * @example - * - * _.intersection([2, 1], [2, 3]); - * // => [2] - */ - var intersection = baseRest(function(arrays) { - var mapped = arrayMap(arrays, castArrayLikeObject); - return (mapped.length && mapped[0] === arrays[0]) - ? baseIntersection(mapped) - : []; - }); - - /** - * This method is like `_.intersection` except that it accepts `iteratee` - * which is invoked for each element of each `arrays` to generate the criterion - * by which they're compared. The order and references of result values are - * determined by the first array. The iteratee is invoked with one argument: - * (value). - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Array - * @param {...Array} [arrays] The arrays to inspect. - * @param {Function} [iteratee=_.identity] The iteratee invoked per element. - * @returns {Array} Returns the new array of intersecting values. - * @example - * - * _.intersectionBy([2.1, 1.2], [2.3, 3.4], Math.floor); - * // => [2.1] - * - * // The `_.property` iteratee shorthand. - * _.intersectionBy([{ 'x': 1 }], [{ 'x': 2 }, { 'x': 1 }], 'x'); - * // => [{ 'x': 1 }] - */ - var intersectionBy = baseRest(function(arrays) { - var iteratee = last(arrays), - mapped = arrayMap(arrays, castArrayLikeObject); - - if (iteratee === last(mapped)) { - iteratee = undefined; - } else { - mapped.pop(); - } - return (mapped.length && mapped[0] === arrays[0]) - ? baseIntersection(mapped, getIteratee(iteratee, 2)) - : []; - }); - - /** - * This method is like `_.intersection` except that it accepts `comparator` - * which is invoked to compare elements of `arrays`. The order and references - * of result values are determined by the first array. The comparator is - * invoked with two arguments: (arrVal, othVal). - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Array - * @param {...Array} [arrays] The arrays to inspect. - * @param {Function} [comparator] The comparator invoked per element. - * @returns {Array} Returns the new array of intersecting values. - * @example - * - * var objects = [{ 'x': 1, 'y': 2 }, { 'x': 2, 'y': 1 }]; - * var others = [{ 'x': 1, 'y': 1 }, { 'x': 1, 'y': 2 }]; - * - * _.intersectionWith(objects, others, _.isEqual); - * // => [{ 'x': 1, 'y': 2 }] - */ - var intersectionWith = baseRest(function(arrays) { - var comparator = last(arrays), - mapped = arrayMap(arrays, castArrayLikeObject); - - comparator = typeof comparator == 'function' ? comparator : undefined; - if (comparator) { - mapped.pop(); - } - return (mapped.length && mapped[0] === arrays[0]) - ? baseIntersection(mapped, undefined, comparator) - : []; - }); - - /** - * Converts all elements in `array` into a string separated by `separator`. - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Array - * @param {Array} array The array to convert. - * @param {string} [separator=','] The element separator. - * @returns {string} Returns the joined string. - * @example - * - * _.join(['a', 'b', 'c'], '~'); - * // => 'a~b~c' - */ - function join(array, separator) { - return array == null ? '' : nativeJoin.call(array, separator); - } - - /** - * Gets the last element of `array`. - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Array - * @param {Array} array The array to query. - * @returns {*} Returns the last element of `array`. - * @example - * - * _.last([1, 2, 3]); - * // => 3 - */ - function last(array) { - var length = array == null ? 0 : array.length; - return length ? array[length - 1] : undefined; - } - - /** - * This method is like `_.indexOf` except that it iterates over elements of - * `array` from right to left. - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Array - * @param {Array} array The array to inspect. - * @param {*} value The value to search for. - * @param {number} [fromIndex=array.length-1] The index to search from. - * @returns {number} Returns the index of the matched value, else `-1`. - * @example - * - * _.lastIndexOf([1, 2, 1, 2], 2); - * // => 3 - * - * // Search from the `fromIndex`. - * _.lastIndexOf([1, 2, 1, 2], 2, 2); - * // => 1 - */ - function lastIndexOf(array, value, fromIndex) { - var length = array == null ? 0 : array.length; - if (!length) { - return -1; - } - var index = length; - if (fromIndex !== undefined) { - index = toInteger(fromIndex); - index = index < 0 ? nativeMax(length + index, 0) : nativeMin(index, length - 1); - } - return value === value - ? strictLastIndexOf(array, value, index) - : baseFindIndex(array, baseIsNaN, index, true); - } - - /** - * Gets the element at index `n` of `array`. If `n` is negative, the nth - * element from the end is returned. - * - * @static - * @memberOf _ - * @since 4.11.0 - * @category Array - * @param {Array} array The array to query. - * @param {number} [n=0] The index of the element to return. - * @returns {*} Returns the nth element of `array`. - * @example - * - * var array = ['a', 'b', 'c', 'd']; - * - * _.nth(array, 1); - * // => 'b' - * - * _.nth(array, -2); - * // => 'c'; - */ - function nth(array, n) { - return (array && array.length) ? baseNth(array, toInteger(n)) : undefined; - } - - /** - * Removes all given values from `array` using - * [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero) - * for equality comparisons. - * - * **Note:** Unlike `_.without`, this method mutates `array`. Use `_.remove` - * to remove elements from an array by predicate. - * - * @static - * @memberOf _ - * @since 2.0.0 - * @category Array - * @param {Array} array The array to modify. - * @param {...*} [values] The values to remove. - * @returns {Array} Returns `array`. - * @example - * - * var array = ['a', 'b', 'c', 'a', 'b', 'c']; - * - * _.pull(array, 'a', 'c'); - * console.log(array); - * // => ['b', 'b'] - */ - var pull = baseRest(pullAll); - - /** - * This method is like `_.pull` except that it accepts an array of values to remove. - * - * **Note:** Unlike `_.difference`, this method mutates `array`. - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Array - * @param {Array} array The array to modify. - * @param {Array} values The values to remove. - * @returns {Array} Returns `array`. - * @example - * - * var array = ['a', 'b', 'c', 'a', 'b', 'c']; - * - * _.pullAll(array, ['a', 'c']); - * console.log(array); - * // => ['b', 'b'] - */ - function pullAll(array, values) { - return (array && array.length && values && values.length) - ? basePullAll(array, values) - : array; - } - - /** - * This method is like `_.pullAll` except that it accepts `iteratee` which is - * invoked for each element of `array` and `values` to generate the criterion - * by which they're compared. The iteratee is invoked with one argument: (value). - * - * **Note:** Unlike `_.differenceBy`, this method mutates `array`. - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Array - * @param {Array} array The array to modify. - * @param {Array} values The values to remove. - * @param {Function} [iteratee=_.identity] The iteratee invoked per element. - * @returns {Array} Returns `array`. - * @example - * - * var array = [{ 'x': 1 }, { 'x': 2 }, { 'x': 3 }, { 'x': 1 }]; - * - * _.pullAllBy(array, [{ 'x': 1 }, { 'x': 3 }], 'x'); - * console.log(array); - * // => [{ 'x': 2 }] - */ - function pullAllBy(array, values, iteratee) { - return (array && array.length && values && values.length) - ? basePullAll(array, values, getIteratee(iteratee, 2)) - : array; - } - - /** - * This method is like `_.pullAll` except that it accepts `comparator` which - * is invoked to compare elements of `array` to `values`. The comparator is - * invoked with two arguments: (arrVal, othVal). - * - * **Note:** Unlike `_.differenceWith`, this method mutates `array`. - * - * @static - * @memberOf _ - * @since 4.6.0 - * @category Array - * @param {Array} array The array to modify. - * @param {Array} values The values to remove. - * @param {Function} [comparator] The comparator invoked per element. - * @returns {Array} Returns `array`. - * @example - * - * var array = [{ 'x': 1, 'y': 2 }, { 'x': 3, 'y': 4 }, { 'x': 5, 'y': 6 }]; - * - * _.pullAllWith(array, [{ 'x': 3, 'y': 4 }], _.isEqual); - * console.log(array); - * // => [{ 'x': 1, 'y': 2 }, { 'x': 5, 'y': 6 }] - */ - function pullAllWith(array, values, comparator) { - return (array && array.length && values && values.length) - ? basePullAll(array, values, undefined, comparator) - : array; - } - - /** - * Removes elements from `array` corresponding to `indexes` and returns an - * array of removed elements. - * - * **Note:** Unlike `_.at`, this method mutates `array`. - * - * @static - * @memberOf _ - * @since 3.0.0 - * @category Array - * @param {Array} array The array to modify. - * @param {...(number|number[])} [indexes] The indexes of elements to remove. - * @returns {Array} Returns the new array of removed elements. - * @example - * - * var array = ['a', 'b', 'c', 'd']; - * var pulled = _.pullAt(array, [1, 3]); - * - * console.log(array); - * // => ['a', 'c'] - * - * console.log(pulled); - * // => ['b', 'd'] - */ - var pullAt = flatRest(function(array, indexes) { - var length = array == null ? 0 : array.length, - result = baseAt(array, indexes); - - basePullAt(array, arrayMap(indexes, function(index) { - return isIndex(index, length) ? +index : index; - }).sort(compareAscending)); - - return result; - }); - - /** - * Removes all elements from `array` that `predicate` returns truthy for - * and returns an array of the removed elements. The predicate is invoked - * with three arguments: (value, index, array). - * - * **Note:** Unlike `_.filter`, this method mutates `array`. Use `_.pull` - * to pull elements from an array by value. - * - * @static - * @memberOf _ - * @since 2.0.0 - * @category Array - * @param {Array} array The array to modify. - * @param {Function} [predicate=_.identity] The function invoked per iteration. - * @returns {Array} Returns the new array of removed elements. - * @example - * - * var array = [1, 2, 3, 4]; - * var evens = _.remove(array, function(n) { - * return n % 2 == 0; - * }); - * - * console.log(array); - * // => [1, 3] - * - * console.log(evens); - * // => [2, 4] - */ - function remove(array, predicate) { - var result = []; - if (!(array && array.length)) { - return result; - } - var index = -1, - indexes = [], - length = array.length; - - predicate = getIteratee(predicate, 3); - while (++index < length) { - var value = array[index]; - if (predicate(value, index, array)) { - result.push(value); - indexes.push(index); - } - } - basePullAt(array, indexes); - return result; - } - - /** - * Reverses `array` so that the first element becomes the last, the second - * element becomes the second to last, and so on. - * - * **Note:** This method mutates `array` and is based on - * [`Array#reverse`](https://mdn.io/Array/reverse). - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Array - * @param {Array} array The array to modify. - * @returns {Array} Returns `array`. - * @example - * - * var array = [1, 2, 3]; - * - * _.reverse(array); - * // => [3, 2, 1] - * - * console.log(array); - * // => [3, 2, 1] - */ - function reverse(array) { - return array == null ? array : nativeReverse.call(array); - } - - /** - * Creates a slice of `array` from `start` up to, but not including, `end`. - * - * **Note:** This method is used instead of - * [`Array#slice`](https://mdn.io/Array/slice) to ensure dense arrays are - * returned. - * - * @static - * @memberOf _ - * @since 3.0.0 - * @category Array - * @param {Array} array The array to slice. - * @param {number} [start=0] The start position. - * @param {number} [end=array.length] The end position. - * @returns {Array} Returns the slice of `array`. - */ - function slice(array, start, end) { - var length = array == null ? 0 : array.length; - if (!length) { - return []; - } - if (end && typeof end != 'number' && isIterateeCall(array, start, end)) { - start = 0; - end = length; - } - else { - start = start == null ? 0 : toInteger(start); - end = end === undefined ? length : toInteger(end); - } - return baseSlice(array, start, end); - } - - /** - * Uses a binary search to determine the lowest index at which `value` - * should be inserted into `array` in order to maintain its sort order. - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Array - * @param {Array} array The sorted array to inspect. - * @param {*} value The value to evaluate. - * @returns {number} Returns the index at which `value` should be inserted - * into `array`. - * @example - * - * _.sortedIndex([30, 50], 40); - * // => 1 - */ - function sortedIndex(array, value) { - return baseSortedIndex(array, value); - } - - /** - * This method is like `_.sortedIndex` except that it accepts `iteratee` - * which is invoked for `value` and each element of `array` to compute their - * sort ranking. The iteratee is invoked with one argument: (value). - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Array - * @param {Array} array The sorted array to inspect. - * @param {*} value The value to evaluate. - * @param {Function} [iteratee=_.identity] The iteratee invoked per element. - * @returns {number} Returns the index at which `value` should be inserted - * into `array`. - * @example - * - * var objects = [{ 'x': 4 }, { 'x': 5 }]; - * - * _.sortedIndexBy(objects, { 'x': 4 }, function(o) { return o.x; }); - * // => 0 - * - * // The `_.property` iteratee shorthand. - * _.sortedIndexBy(objects, { 'x': 4 }, 'x'); - * // => 0 - */ - function sortedIndexBy(array, value, iteratee) { - return baseSortedIndexBy(array, value, getIteratee(iteratee, 2)); - } - - /** - * This method is like `_.indexOf` except that it performs a binary - * search on a sorted `array`. - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Array - * @param {Array} array The array to inspect. - * @param {*} value The value to search for. - * @returns {number} Returns the index of the matched value, else `-1`. - * @example - * - * _.sortedIndexOf([4, 5, 5, 5, 6], 5); - * // => 1 - */ - function sortedIndexOf(array, value) { - var length = array == null ? 0 : array.length; - if (length) { - var index = baseSortedIndex(array, value); - if (index < length && eq(array[index], value)) { - return index; - } - } - return -1; - } - - /** - * This method is like `_.sortedIndex` except that it returns the highest - * index at which `value` should be inserted into `array` in order to - * maintain its sort order. - * - * @static - * @memberOf _ - * @since 3.0.0 - * @category Array - * @param {Array} array The sorted array to inspect. - * @param {*} value The value to evaluate. - * @returns {number} Returns the index at which `value` should be inserted - * into `array`. - * @example - * - * _.sortedLastIndex([4, 5, 5, 5, 6], 5); - * // => 4 - */ - function sortedLastIndex(array, value) { - return baseSortedIndex(array, value, true); - } - - /** - * This method is like `_.sortedLastIndex` except that it accepts `iteratee` - * which is invoked for `value` and each element of `array` to compute their - * sort ranking. The iteratee is invoked with one argument: (value). - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Array - * @param {Array} array The sorted array to inspect. - * @param {*} value The value to evaluate. - * @param {Function} [iteratee=_.identity] The iteratee invoked per element. - * @returns {number} Returns the index at which `value` should be inserted - * into `array`. - * @example - * - * var objects = [{ 'x': 4 }, { 'x': 5 }]; - * - * _.sortedLastIndexBy(objects, { 'x': 4 }, function(o) { return o.x; }); - * // => 1 - * - * // The `_.property` iteratee shorthand. - * _.sortedLastIndexBy(objects, { 'x': 4 }, 'x'); - * // => 1 - */ - function sortedLastIndexBy(array, value, iteratee) { - return baseSortedIndexBy(array, value, getIteratee(iteratee, 2), true); - } - - /** - * This method is like `_.lastIndexOf` except that it performs a binary - * search on a sorted `array`. - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Array - * @param {Array} array The array to inspect. - * @param {*} value The value to search for. - * @returns {number} Returns the index of the matched value, else `-1`. - * @example - * - * _.sortedLastIndexOf([4, 5, 5, 5, 6], 5); - * // => 3 - */ - function sortedLastIndexOf(array, value) { - var length = array == null ? 0 : array.length; - if (length) { - var index = baseSortedIndex(array, value, true) - 1; - if (eq(array[index], value)) { - return index; - } - } - return -1; - } - - /** - * This method is like `_.uniq` except that it's designed and optimized - * for sorted arrays. - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Array - * @param {Array} array The array to inspect. - * @returns {Array} Returns the new duplicate free array. - * @example - * - * _.sortedUniq([1, 1, 2]); - * // => [1, 2] - */ - function sortedUniq(array) { - return (array && array.length) - ? baseSortedUniq(array) - : []; - } - - /** - * This method is like `_.uniqBy` except that it's designed and optimized - * for sorted arrays. - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Array - * @param {Array} array The array to inspect. - * @param {Function} [iteratee] The iteratee invoked per element. - * @returns {Array} Returns the new duplicate free array. - * @example - * - * _.sortedUniqBy([1.1, 1.2, 2.3, 2.4], Math.floor); - * // => [1.1, 2.3] - */ - function sortedUniqBy(array, iteratee) { - return (array && array.length) - ? baseSortedUniq(array, getIteratee(iteratee, 2)) - : []; - } - - /** - * Gets all but the first element of `array`. - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Array - * @param {Array} array The array to query. - * @returns {Array} Returns the slice of `array`. - * @example - * - * _.tail([1, 2, 3]); - * // => [2, 3] - */ - function tail(array) { - var length = array == null ? 0 : array.length; - return length ? baseSlice(array, 1, length) : []; - } - - /** - * Creates a slice of `array` with `n` elements taken from the beginning. - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Array - * @param {Array} array The array to query. - * @param {number} [n=1] The number of elements to take. - * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`. - * @returns {Array} Returns the slice of `array`. - * @example - * - * _.take([1, 2, 3]); - * // => [1] - * - * _.take([1, 2, 3], 2); - * // => [1, 2] - * - * _.take([1, 2, 3], 5); - * // => [1, 2, 3] - * - * _.take([1, 2, 3], 0); - * // => [] - */ - function take(array, n, guard) { - if (!(array && array.length)) { - return []; - } - n = (guard || n === undefined) ? 1 : toInteger(n); - return baseSlice(array, 0, n < 0 ? 0 : n); - } - - /** - * Creates a slice of `array` with `n` elements taken from the end. - * - * @static - * @memberOf _ - * @since 3.0.0 - * @category Array - * @param {Array} array The array to query. - * @param {number} [n=1] The number of elements to take. - * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`. - * @returns {Array} Returns the slice of `array`. - * @example - * - * _.takeRight([1, 2, 3]); - * // => [3] - * - * _.takeRight([1, 2, 3], 2); - * // => [2, 3] - * - * _.takeRight([1, 2, 3], 5); - * // => [1, 2, 3] - * - * _.takeRight([1, 2, 3], 0); - * // => [] - */ - function takeRight(array, n, guard) { - var length = array == null ? 0 : array.length; - if (!length) { - return []; - } - n = (guard || n === undefined) ? 1 : toInteger(n); - n = length - n; - return baseSlice(array, n < 0 ? 0 : n, length); - } - - /** - * Creates a slice of `array` with elements taken from the end. Elements are - * taken until `predicate` returns falsey. The predicate is invoked with - * three arguments: (value, index, array). - * - * @static - * @memberOf _ - * @since 3.0.0 - * @category Array - * @param {Array} array The array to query. - * @param {Function} [predicate=_.identity] The function invoked per iteration. - * @returns {Array} Returns the slice of `array`. - * @example - * - * var users = [ - * { 'user': 'barney', 'active': true }, - * { 'user': 'fred', 'active': false }, - * { 'user': 'pebbles', 'active': false } - * ]; - * - * _.takeRightWhile(users, function(o) { return !o.active; }); - * // => objects for ['fred', 'pebbles'] - * - * // The `_.matches` iteratee shorthand. - * _.takeRightWhile(users, { 'user': 'pebbles', 'active': false }); - * // => objects for ['pebbles'] - * - * // The `_.matchesProperty` iteratee shorthand. - * _.takeRightWhile(users, ['active', false]); - * // => objects for ['fred', 'pebbles'] - * - * // The `_.property` iteratee shorthand. - * _.takeRightWhile(users, 'active'); - * // => [] - */ - function takeRightWhile(array, predicate) { - return (array && array.length) - ? baseWhile(array, getIteratee(predicate, 3), false, true) - : []; - } - - /** - * Creates a slice of `array` with elements taken from the beginning. Elements - * are taken until `predicate` returns falsey. The predicate is invoked with - * three arguments: (value, index, array). - * - * @static - * @memberOf _ - * @since 3.0.0 - * @category Array - * @param {Array} array The array to query. - * @param {Function} [predicate=_.identity] The function invoked per iteration. - * @returns {Array} Returns the slice of `array`. - * @example - * - * var users = [ - * { 'user': 'barney', 'active': false }, - * { 'user': 'fred', 'active': false }, - * { 'user': 'pebbles', 'active': true } - * ]; - * - * _.takeWhile(users, function(o) { return !o.active; }); - * // => objects for ['barney', 'fred'] - * - * // The `_.matches` iteratee shorthand. - * _.takeWhile(users, { 'user': 'barney', 'active': false }); - * // => objects for ['barney'] - * - * // The `_.matchesProperty` iteratee shorthand. - * _.takeWhile(users, ['active', false]); - * // => objects for ['barney', 'fred'] - * - * // The `_.property` iteratee shorthand. - * _.takeWhile(users, 'active'); - * // => [] - */ - function takeWhile(array, predicate) { - return (array && array.length) - ? baseWhile(array, getIteratee(predicate, 3)) - : []; - } - - /** - * Creates an array of unique values, in order, from all given arrays using - * [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero) - * for equality comparisons. - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Array - * @param {...Array} [arrays] The arrays to inspect. - * @returns {Array} Returns the new array of combined values. - * @example - * - * _.union([2], [1, 2]); - * // => [2, 1] - */ - var union = baseRest(function(arrays) { - return baseUniq(baseFlatten(arrays, 1, isArrayLikeObject, true)); - }); - - /** - * This method is like `_.union` except that it accepts `iteratee` which is - * invoked for each element of each `arrays` to generate the criterion by - * which uniqueness is computed. Result values are chosen from the first - * array in which the value occurs. The iteratee is invoked with one argument: - * (value). - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Array - * @param {...Array} [arrays] The arrays to inspect. - * @param {Function} [iteratee=_.identity] The iteratee invoked per element. - * @returns {Array} Returns the new array of combined values. - * @example - * - * _.unionBy([2.1], [1.2, 2.3], Math.floor); - * // => [2.1, 1.2] - * - * // The `_.property` iteratee shorthand. - * _.unionBy([{ 'x': 1 }], [{ 'x': 2 }, { 'x': 1 }], 'x'); - * // => [{ 'x': 1 }, { 'x': 2 }] - */ - var unionBy = baseRest(function(arrays) { - var iteratee = last(arrays); - if (isArrayLikeObject(iteratee)) { - iteratee = undefined; - } - return baseUniq(baseFlatten(arrays, 1, isArrayLikeObject, true), getIteratee(iteratee, 2)); - }); - - /** - * This method is like `_.union` except that it accepts `comparator` which - * is invoked to compare elements of `arrays`. Result values are chosen from - * the first array in which the value occurs. The comparator is invoked - * with two arguments: (arrVal, othVal). - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Array - * @param {...Array} [arrays] The arrays to inspect. - * @param {Function} [comparator] The comparator invoked per element. - * @returns {Array} Returns the new array of combined values. - * @example - * - * var objects = [{ 'x': 1, 'y': 2 }, { 'x': 2, 'y': 1 }]; - * var others = [{ 'x': 1, 'y': 1 }, { 'x': 1, 'y': 2 }]; - * - * _.unionWith(objects, others, _.isEqual); - * // => [{ 'x': 1, 'y': 2 }, { 'x': 2, 'y': 1 }, { 'x': 1, 'y': 1 }] - */ - var unionWith = baseRest(function(arrays) { - var comparator = last(arrays); - comparator = typeof comparator == 'function' ? comparator : undefined; - return baseUniq(baseFlatten(arrays, 1, isArrayLikeObject, true), undefined, comparator); - }); - - /** - * Creates a duplicate-free version of an array, using - * [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero) - * for equality comparisons, in which only the first occurrence of each element - * is kept. The order of result values is determined by the order they occur - * in the array. - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Array - * @param {Array} array The array to inspect. - * @returns {Array} Returns the new duplicate free array. - * @example - * - * _.uniq([2, 1, 2]); - * // => [2, 1] - */ - function uniq(array) { - return (array && array.length) ? baseUniq(array) : []; - } - - /** - * This method is like `_.uniq` except that it accepts `iteratee` which is - * invoked for each element in `array` to generate the criterion by which - * uniqueness is computed. The order of result values is determined by the - * order they occur in the array. The iteratee is invoked with one argument: - * (value). - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Array - * @param {Array} array The array to inspect. - * @param {Function} [iteratee=_.identity] The iteratee invoked per element. - * @returns {Array} Returns the new duplicate free array. - * @example - * - * _.uniqBy([2.1, 1.2, 2.3], Math.floor); - * // => [2.1, 1.2] - * - * // The `_.property` iteratee shorthand. - * _.uniqBy([{ 'x': 1 }, { 'x': 2 }, { 'x': 1 }], 'x'); - * // => [{ 'x': 1 }, { 'x': 2 }] - */ - function uniqBy(array, iteratee) { - return (array && array.length) ? baseUniq(array, getIteratee(iteratee, 2)) : []; - } - - /** - * This method is like `_.uniq` except that it accepts `comparator` which - * is invoked to compare elements of `array`. The order of result values is - * determined by the order they occur in the array.The comparator is invoked - * with two arguments: (arrVal, othVal). - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Array - * @param {Array} array The array to inspect. - * @param {Function} [comparator] The comparator invoked per element. - * @returns {Array} Returns the new duplicate free array. - * @example - * - * var objects = [{ 'x': 1, 'y': 2 }, { 'x': 2, 'y': 1 }, { 'x': 1, 'y': 2 }]; - * - * _.uniqWith(objects, _.isEqual); - * // => [{ 'x': 1, 'y': 2 }, { 'x': 2, 'y': 1 }] - */ - function uniqWith(array, comparator) { - comparator = typeof comparator == 'function' ? comparator : undefined; - return (array && array.length) ? baseUniq(array, undefined, comparator) : []; - } - - /** - * This method is like `_.zip` except that it accepts an array of grouped - * elements and creates an array regrouping the elements to their pre-zip - * configuration. - * - * @static - * @memberOf _ - * @since 1.2.0 - * @category Array - * @param {Array} array The array of grouped elements to process. - * @returns {Array} Returns the new array of regrouped elements. - * @example - * - * var zipped = _.zip(['a', 'b'], [1, 2], [true, false]); - * // => [['a', 1, true], ['b', 2, false]] - * - * _.unzip(zipped); - * // => [['a', 'b'], [1, 2], [true, false]] - */ - function unzip(array) { - if (!(array && array.length)) { - return []; - } - var length = 0; - array = arrayFilter(array, function(group) { - if (isArrayLikeObject(group)) { - length = nativeMax(group.length, length); - return true; - } - }); - return baseTimes(length, function(index) { - return arrayMap(array, baseProperty(index)); - }); - } - - /** - * This method is like `_.unzip` except that it accepts `iteratee` to specify - * how regrouped values should be combined. The iteratee is invoked with the - * elements of each group: (...group). - * - * @static - * @memberOf _ - * @since 3.8.0 - * @category Array - * @param {Array} array The array of grouped elements to process. - * @param {Function} [iteratee=_.identity] The function to combine - * regrouped values. - * @returns {Array} Returns the new array of regrouped elements. - * @example - * - * var zipped = _.zip([1, 2], [10, 20], [100, 200]); - * // => [[1, 10, 100], [2, 20, 200]] - * - * _.unzipWith(zipped, _.add); - * // => [3, 30, 300] - */ - function unzipWith(array, iteratee) { - if (!(array && array.length)) { - return []; - } - var result = unzip(array); - if (iteratee == null) { - return result; - } - return arrayMap(result, function(group) { - return apply(iteratee, undefined, group); - }); - } - - /** - * Creates an array excluding all given values using - * [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero) - * for equality comparisons. - * - * **Note:** Unlike `_.pull`, this method returns a new array. - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Array - * @param {Array} array The array to inspect. - * @param {...*} [values] The values to exclude. - * @returns {Array} Returns the new array of filtered values. - * @see _.difference, _.xor - * @example - * - * _.without([2, 1, 2, 3], 1, 2); - * // => [3] - */ - var without = baseRest(function(array, values) { - return isArrayLikeObject(array) - ? baseDifference(array, values) - : []; - }); - - /** - * Creates an array of unique values that is the - * [symmetric difference](https://en.wikipedia.org/wiki/Symmetric_difference) - * of the given arrays. The order of result values is determined by the order - * they occur in the arrays. - * - * @static - * @memberOf _ - * @since 2.4.0 - * @category Array - * @param {...Array} [arrays] The arrays to inspect. - * @returns {Array} Returns the new array of filtered values. - * @see _.difference, _.without - * @example - * - * _.xor([2, 1], [2, 3]); - * // => [1, 3] - */ - var xor = baseRest(function(arrays) { - return baseXor(arrayFilter(arrays, isArrayLikeObject)); - }); - - /** - * This method is like `_.xor` except that it accepts `iteratee` which is - * invoked for each element of each `arrays` to generate the criterion by - * which by which they're compared. The order of result values is determined - * by the order they occur in the arrays. The iteratee is invoked with one - * argument: (value). - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Array - * @param {...Array} [arrays] The arrays to inspect. - * @param {Function} [iteratee=_.identity] The iteratee invoked per element. - * @returns {Array} Returns the new array of filtered values. - * @example - * - * _.xorBy([2.1, 1.2], [2.3, 3.4], Math.floor); - * // => [1.2, 3.4] - * - * // The `_.property` iteratee shorthand. - * _.xorBy([{ 'x': 1 }], [{ 'x': 2 }, { 'x': 1 }], 'x'); - * // => [{ 'x': 2 }] - */ - var xorBy = baseRest(function(arrays) { - var iteratee = last(arrays); - if (isArrayLikeObject(iteratee)) { - iteratee = undefined; - } - return baseXor(arrayFilter(arrays, isArrayLikeObject), getIteratee(iteratee, 2)); - }); - - /** - * This method is like `_.xor` except that it accepts `comparator` which is - * invoked to compare elements of `arrays`. The order of result values is - * determined by the order they occur in the arrays. The comparator is invoked - * with two arguments: (arrVal, othVal). - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Array - * @param {...Array} [arrays] The arrays to inspect. - * @param {Function} [comparator] The comparator invoked per element. - * @returns {Array} Returns the new array of filtered values. - * @example - * - * var objects = [{ 'x': 1, 'y': 2 }, { 'x': 2, 'y': 1 }]; - * var others = [{ 'x': 1, 'y': 1 }, { 'x': 1, 'y': 2 }]; - * - * _.xorWith(objects, others, _.isEqual); - * // => [{ 'x': 2, 'y': 1 }, { 'x': 1, 'y': 1 }] - */ - var xorWith = baseRest(function(arrays) { - var comparator = last(arrays); - comparator = typeof comparator == 'function' ? comparator : undefined; - return baseXor(arrayFilter(arrays, isArrayLikeObject), undefined, comparator); - }); - - /** - * Creates an array of grouped elements, the first of which contains the - * first elements of the given arrays, the second of which contains the - * second elements of the given arrays, and so on. - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Array - * @param {...Array} [arrays] The arrays to process. - * @returns {Array} Returns the new array of grouped elements. - * @example - * - * _.zip(['a', 'b'], [1, 2], [true, false]); - * // => [['a', 1, true], ['b', 2, false]] - */ - var zip = baseRest(unzip); - - /** - * This method is like `_.fromPairs` except that it accepts two arrays, - * one of property identifiers and one of corresponding values. - * - * @static - * @memberOf _ - * @since 0.4.0 - * @category Array - * @param {Array} [props=[]] The property identifiers. - * @param {Array} [values=[]] The property values. - * @returns {Object} Returns the new object. - * @example - * - * _.zipObject(['a', 'b'], [1, 2]); - * // => { 'a': 1, 'b': 2 } - */ - function zipObject(props, values) { - return baseZipObject(props || [], values || [], assignValue); - } - - /** - * This method is like `_.zipObject` except that it supports property paths. - * - * @static - * @memberOf _ - * @since 4.1.0 - * @category Array - * @param {Array} [props=[]] The property identifiers. - * @param {Array} [values=[]] The property values. - * @returns {Object} Returns the new object. - * @example - * - * _.zipObjectDeep(['a.b[0].c', 'a.b[1].d'], [1, 2]); - * // => { 'a': { 'b': [{ 'c': 1 }, { 'd': 2 }] } } - */ - function zipObjectDeep(props, values) { - return baseZipObject(props || [], values || [], baseSet); - } - - /** - * This method is like `_.zip` except that it accepts `iteratee` to specify - * how grouped values should be combined. The iteratee is invoked with the - * elements of each group: (...group). - * - * @static - * @memberOf _ - * @since 3.8.0 - * @category Array - * @param {...Array} [arrays] The arrays to process. - * @param {Function} [iteratee=_.identity] The function to combine - * grouped values. - * @returns {Array} Returns the new array of grouped elements. - * @example - * - * _.zipWith([1, 2], [10, 20], [100, 200], function(a, b, c) { - * return a + b + c; - * }); - * // => [111, 222] - */ - var zipWith = baseRest(function(arrays) { - var length = arrays.length, - iteratee = length > 1 ? arrays[length - 1] : undefined; - - iteratee = typeof iteratee == 'function' ? (arrays.pop(), iteratee) : undefined; - return unzipWith(arrays, iteratee); - }); - - /*------------------------------------------------------------------------*/ - - /** - * Creates a `lodash` wrapper instance that wraps `value` with explicit method - * chain sequences enabled. The result of such sequences must be unwrapped - * with `_#value`. - * - * @static - * @memberOf _ - * @since 1.3.0 - * @category Seq - * @param {*} value The value to wrap. - * @returns {Object} Returns the new `lodash` wrapper instance. - * @example - * - * var users = [ - * { 'user': 'barney', 'age': 36 }, - * { 'user': 'fred', 'age': 40 }, - * { 'user': 'pebbles', 'age': 1 } - * ]; - * - * var youngest = _ - * .chain(users) - * .sortBy('age') - * .map(function(o) { - * return o.user + ' is ' + o.age; - * }) - * .head() - * .value(); - * // => 'pebbles is 1' - */ - function chain(value) { - var result = lodash(value); - result.__chain__ = true; - return result; - } - - /** - * This method invokes `interceptor` and returns `value`. The interceptor - * is invoked with one argument; (value). The purpose of this method is to - * "tap into" a method chain sequence in order to modify intermediate results. - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Seq - * @param {*} value The value to provide to `interceptor`. - * @param {Function} interceptor The function to invoke. - * @returns {*} Returns `value`. - * @example - * - * _([1, 2, 3]) - * .tap(function(array) { - * // Mutate input array. - * array.pop(); - * }) - * .reverse() - * .value(); - * // => [2, 1] - */ - function tap(value, interceptor) { - interceptor(value); - return value; - } - - /** - * This method is like `_.tap` except that it returns the result of `interceptor`. - * The purpose of this method is to "pass thru" values replacing intermediate - * results in a method chain sequence. - * - * @static - * @memberOf _ - * @since 3.0.0 - * @category Seq - * @param {*} value The value to provide to `interceptor`. - * @param {Function} interceptor The function to invoke. - * @returns {*} Returns the result of `interceptor`. - * @example - * - * _(' abc ') - * .chain() - * .trim() - * .thru(function(value) { - * return [value]; - * }) - * .value(); - * // => ['abc'] - */ - function thru(value, interceptor) { - return interceptor(value); - } - - /** - * This method is the wrapper version of `_.at`. - * - * @name at - * @memberOf _ - * @since 1.0.0 - * @category Seq - * @param {...(string|string[])} [paths] The property paths to pick. - * @returns {Object} Returns the new `lodash` wrapper instance. - * @example - * - * var object = { 'a': [{ 'b': { 'c': 3 } }, 4] }; - * - * _(object).at(['a[0].b.c', 'a[1]']).value(); - * // => [3, 4] - */ - var wrapperAt = flatRest(function(paths) { - var length = paths.length, - start = length ? paths[0] : 0, - value = this.__wrapped__, - interceptor = function(object) { return baseAt(object, paths); }; - - if (length > 1 || this.__actions__.length || - !(value instanceof LazyWrapper) || !isIndex(start)) { - return this.thru(interceptor); - } - value = value.slice(start, +start + (length ? 1 : 0)); - value.__actions__.push({ - 'func': thru, - 'args': [interceptor], - 'thisArg': undefined - }); - return new LodashWrapper(value, this.__chain__).thru(function(array) { - if (length && !array.length) { - array.push(undefined); - } - return array; - }); - }); - - /** - * Creates a `lodash` wrapper instance with explicit method chain sequences enabled. - * - * @name chain - * @memberOf _ - * @since 0.1.0 - * @category Seq - * @returns {Object} Returns the new `lodash` wrapper instance. - * @example - * - * var users = [ - * { 'user': 'barney', 'age': 36 }, - * { 'user': 'fred', 'age': 40 } - * ]; - * - * // A sequence without explicit chaining. - * _(users).head(); - * // => { 'user': 'barney', 'age': 36 } - * - * // A sequence with explicit chaining. - * _(users) - * .chain() - * .head() - * .pick('user') - * .value(); - * // => { 'user': 'barney' } - */ - function wrapperChain() { - return chain(this); - } - - /** - * Executes the chain sequence and returns the wrapped result. - * - * @name commit - * @memberOf _ - * @since 3.2.0 - * @category Seq - * @returns {Object} Returns the new `lodash` wrapper instance. - * @example - * - * var array = [1, 2]; - * var wrapped = _(array).push(3); - * - * console.log(array); - * // => [1, 2] - * - * wrapped = wrapped.commit(); - * console.log(array); - * // => [1, 2, 3] - * - * wrapped.last(); - * // => 3 - * - * console.log(array); - * // => [1, 2, 3] - */ - function wrapperCommit() { - return new LodashWrapper(this.value(), this.__chain__); - } - - /** - * Gets the next value on a wrapped object following the - * [iterator protocol](https://mdn.io/iteration_protocols#iterator). - * - * @name next - * @memberOf _ - * @since 4.0.0 - * @category Seq - * @returns {Object} Returns the next iterator value. - * @example - * - * var wrapped = _([1, 2]); - * - * wrapped.next(); - * // => { 'done': false, 'value': 1 } - * - * wrapped.next(); - * // => { 'done': false, 'value': 2 } - * - * wrapped.next(); - * // => { 'done': true, 'value': undefined } - */ - function wrapperNext() { - if (this.__values__ === undefined) { - this.__values__ = toArray(this.value()); - } - var done = this.__index__ >= this.__values__.length, - value = done ? undefined : this.__values__[this.__index__++]; - - return { 'done': done, 'value': value }; - } - - /** - * Enables the wrapper to be iterable. - * - * @name Symbol.iterator - * @memberOf _ - * @since 4.0.0 - * @category Seq - * @returns {Object} Returns the wrapper object. - * @example - * - * var wrapped = _([1, 2]); - * - * wrapped[Symbol.iterator]() === wrapped; - * // => true - * - * Array.from(wrapped); - * // => [1, 2] - */ - function wrapperToIterator() { - return this; - } - - /** - * Creates a clone of the chain sequence planting `value` as the wrapped value. - * - * @name plant - * @memberOf _ - * @since 3.2.0 - * @category Seq - * @param {*} value The value to plant. - * @returns {Object} Returns the new `lodash` wrapper instance. - * @example - * - * function square(n) { - * return n * n; - * } - * - * var wrapped = _([1, 2]).map(square); - * var other = wrapped.plant([3, 4]); - * - * other.value(); - * // => [9, 16] - * - * wrapped.value(); - * // => [1, 4] - */ - function wrapperPlant(value) { - var result, - parent = this; - - while (parent instanceof baseLodash) { - var clone = wrapperClone(parent); - clone.__index__ = 0; - clone.__values__ = undefined; - if (result) { - previous.__wrapped__ = clone; - } else { - result = clone; - } - var previous = clone; - parent = parent.__wrapped__; - } - previous.__wrapped__ = value; - return result; - } - - /** - * This method is the wrapper version of `_.reverse`. - * - * **Note:** This method mutates the wrapped array. - * - * @name reverse - * @memberOf _ - * @since 0.1.0 - * @category Seq - * @returns {Object} Returns the new `lodash` wrapper instance. - * @example - * - * var array = [1, 2, 3]; - * - * _(array).reverse().value() - * // => [3, 2, 1] - * - * console.log(array); - * // => [3, 2, 1] - */ - function wrapperReverse() { - var value = this.__wrapped__; - if (value instanceof LazyWrapper) { - var wrapped = value; - if (this.__actions__.length) { - wrapped = new LazyWrapper(this); - } - wrapped = wrapped.reverse(); - wrapped.__actions__.push({ - 'func': thru, - 'args': [reverse], - 'thisArg': undefined - }); - return new LodashWrapper(wrapped, this.__chain__); - } - return this.thru(reverse); - } - - /** - * Executes the chain sequence to resolve the unwrapped value. - * - * @name value - * @memberOf _ - * @since 0.1.0 - * @alias toJSON, valueOf - * @category Seq - * @returns {*} Returns the resolved unwrapped value. - * @example - * - * _([1, 2, 3]).value(); - * // => [1, 2, 3] - */ - function wrapperValue() { - return baseWrapperValue(this.__wrapped__, this.__actions__); - } - - /*------------------------------------------------------------------------*/ - - /** - * Creates an object composed of keys generated from the results of running - * each element of `collection` thru `iteratee`. The corresponding value of - * each key is the number of times the key was returned by `iteratee`. The - * iteratee is invoked with one argument: (value). - * - * @static - * @memberOf _ - * @since 0.5.0 - * @category Collection - * @param {Array|Object} collection The collection to iterate over. - * @param {Function} [iteratee=_.identity] The iteratee to transform keys. - * @returns {Object} Returns the composed aggregate object. - * @example - * - * _.countBy([6.1, 4.2, 6.3], Math.floor); - * // => { '4': 1, '6': 2 } - * - * // The `_.property` iteratee shorthand. - * _.countBy(['one', 'two', 'three'], 'length'); - * // => { '3': 2, '5': 1 } - */ - var countBy = createAggregator(function(result, value, key) { - if (hasOwnProperty.call(result, key)) { - ++result[key]; - } else { - baseAssignValue(result, key, 1); - } - }); - - /** - * Checks if `predicate` returns truthy for **all** elements of `collection`. - * Iteration is stopped once `predicate` returns falsey. The predicate is - * invoked with three arguments: (value, index|key, collection). - * - * **Note:** This method returns `true` for - * [empty collections](https://en.wikipedia.org/wiki/Empty_set) because - * [everything is true](https://en.wikipedia.org/wiki/Vacuous_truth) of - * elements of empty collections. - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Collection - * @param {Array|Object} collection The collection to iterate over. - * @param {Function} [predicate=_.identity] The function invoked per iteration. - * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`. - * @returns {boolean} Returns `true` if all elements pass the predicate check, - * else `false`. - * @example - * - * _.every([true, 1, null, 'yes'], Boolean); - * // => false - * - * var users = [ - * { 'user': 'barney', 'age': 36, 'active': false }, - * { 'user': 'fred', 'age': 40, 'active': false } - * ]; - * - * // The `_.matches` iteratee shorthand. - * _.every(users, { 'user': 'barney', 'active': false }); - * // => false - * - * // The `_.matchesProperty` iteratee shorthand. - * _.every(users, ['active', false]); - * // => true - * - * // The `_.property` iteratee shorthand. - * _.every(users, 'active'); - * // => false - */ - function every(collection, predicate, guard) { - var func = isArray(collection) ? arrayEvery : baseEvery; - if (guard && isIterateeCall(collection, predicate, guard)) { - predicate = undefined; - } - return func(collection, getIteratee(predicate, 3)); - } - - /** - * Iterates over elements of `collection`, returning an array of all elements - * `predicate` returns truthy for. The predicate is invoked with three - * arguments: (value, index|key, collection). - * - * **Note:** Unlike `_.remove`, this method returns a new array. - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Collection - * @param {Array|Object} collection The collection to iterate over. - * @param {Function} [predicate=_.identity] The function invoked per iteration. - * @returns {Array} Returns the new filtered array. - * @see _.reject - * @example - * - * var users = [ - * { 'user': 'barney', 'age': 36, 'active': true }, - * { 'user': 'fred', 'age': 40, 'active': false } - * ]; - * - * _.filter(users, function(o) { return !o.active; }); - * // => objects for ['fred'] - * - * // The `_.matches` iteratee shorthand. - * _.filter(users, { 'age': 36, 'active': true }); - * // => objects for ['barney'] - * - * // The `_.matchesProperty` iteratee shorthand. - * _.filter(users, ['active', false]); - * // => objects for ['fred'] - * - * // The `_.property` iteratee shorthand. - * _.filter(users, 'active'); - * // => objects for ['barney'] - */ - function filter(collection, predicate) { - var func = isArray(collection) ? arrayFilter : baseFilter; - return func(collection, getIteratee(predicate, 3)); - } - - /** - * Iterates over elements of `collection`, returning the first element - * `predicate` returns truthy for. The predicate is invoked with three - * arguments: (value, index|key, collection). - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Collection - * @param {Array|Object} collection The collection to inspect. - * @param {Function} [predicate=_.identity] The function invoked per iteration. - * @param {number} [fromIndex=0] The index to search from. - * @returns {*} Returns the matched element, else `undefined`. - * @example - * - * var users = [ - * { 'user': 'barney', 'age': 36, 'active': true }, - * { 'user': 'fred', 'age': 40, 'active': false }, - * { 'user': 'pebbles', 'age': 1, 'active': true } - * ]; - * - * _.find(users, function(o) { return o.age < 40; }); - * // => object for 'barney' - * - * // The `_.matches` iteratee shorthand. - * _.find(users, { 'age': 1, 'active': true }); - * // => object for 'pebbles' - * - * // The `_.matchesProperty` iteratee shorthand. - * _.find(users, ['active', false]); - * // => object for 'fred' - * - * // The `_.property` iteratee shorthand. - * _.find(users, 'active'); - * // => object for 'barney' - */ - var find = createFind(findIndex); - - /** - * This method is like `_.find` except that it iterates over elements of - * `collection` from right to left. - * - * @static - * @memberOf _ - * @since 2.0.0 - * @category Collection - * @param {Array|Object} collection The collection to inspect. - * @param {Function} [predicate=_.identity] The function invoked per iteration. - * @param {number} [fromIndex=collection.length-1] The index to search from. - * @returns {*} Returns the matched element, else `undefined`. - * @example - * - * _.findLast([1, 2, 3, 4], function(n) { - * return n % 2 == 1; - * }); - * // => 3 - */ - var findLast = createFind(findLastIndex); - - /** - * Creates a flattened array of values by running each element in `collection` - * thru `iteratee` and flattening the mapped results. The iteratee is invoked - * with three arguments: (value, index|key, collection). - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Collection - * @param {Array|Object} collection The collection to iterate over. - * @param {Function} [iteratee=_.identity] The function invoked per iteration. - * @returns {Array} Returns the new flattened array. - * @example - * - * function duplicate(n) { - * return [n, n]; - * } - * - * _.flatMap([1, 2], duplicate); - * // => [1, 1, 2, 2] - */ - function flatMap(collection, iteratee) { - return baseFlatten(map(collection, iteratee), 1); - } - - /** - * This method is like `_.flatMap` except that it recursively flattens the - * mapped results. - * - * @static - * @memberOf _ - * @since 4.7.0 - * @category Collection - * @param {Array|Object} collection The collection to iterate over. - * @param {Function} [iteratee=_.identity] The function invoked per iteration. - * @returns {Array} Returns the new flattened array. - * @example - * - * function duplicate(n) { - * return [[[n, n]]]; - * } - * - * _.flatMapDeep([1, 2], duplicate); - * // => [1, 1, 2, 2] - */ - function flatMapDeep(collection, iteratee) { - return baseFlatten(map(collection, iteratee), INFINITY); - } - - /** - * This method is like `_.flatMap` except that it recursively flattens the - * mapped results up to `depth` times. - * - * @static - * @memberOf _ - * @since 4.7.0 - * @category Collection - * @param {Array|Object} collection The collection to iterate over. - * @param {Function} [iteratee=_.identity] The function invoked per iteration. - * @param {number} [depth=1] The maximum recursion depth. - * @returns {Array} Returns the new flattened array. - * @example - * - * function duplicate(n) { - * return [[[n, n]]]; - * } - * - * _.flatMapDepth([1, 2], duplicate, 2); - * // => [[1, 1], [2, 2]] - */ - function flatMapDepth(collection, iteratee, depth) { - depth = depth === undefined ? 1 : toInteger(depth); - return baseFlatten(map(collection, iteratee), depth); - } - - /** - * Iterates over elements of `collection` and invokes `iteratee` for each element. - * The iteratee is invoked with three arguments: (value, index|key, collection). - * Iteratee functions may exit iteration early by explicitly returning `false`. - * - * **Note:** As with other "Collections" methods, objects with a "length" - * property are iterated like arrays. To avoid this behavior use `_.forIn` - * or `_.forOwn` for object iteration. - * - * @static - * @memberOf _ - * @since 0.1.0 - * @alias each - * @category Collection - * @param {Array|Object} collection The collection to iterate over. - * @param {Function} [iteratee=_.identity] The function invoked per iteration. - * @returns {Array|Object} Returns `collection`. - * @see _.forEachRight - * @example - * - * _.forEach([1, 2], function(value) { - * console.log(value); - * }); - * // => Logs `1` then `2`. - * - * _.forEach({ 'a': 1, 'b': 2 }, function(value, key) { - * console.log(key); - * }); - * // => Logs 'a' then 'b' (iteration order is not guaranteed). - */ - function forEach(collection, iteratee) { - var func = isArray(collection) ? arrayEach : baseEach; - return func(collection, getIteratee(iteratee, 3)); - } - - /** - * This method is like `_.forEach` except that it iterates over elements of - * `collection` from right to left. - * - * @static - * @memberOf _ - * @since 2.0.0 - * @alias eachRight - * @category Collection - * @param {Array|Object} collection The collection to iterate over. - * @param {Function} [iteratee=_.identity] The function invoked per iteration. - * @returns {Array|Object} Returns `collection`. - * @see _.forEach - * @example - * - * _.forEachRight([1, 2], function(value) { - * console.log(value); - * }); - * // => Logs `2` then `1`. - */ - function forEachRight(collection, iteratee) { - var func = isArray(collection) ? arrayEachRight : baseEachRight; - return func(collection, getIteratee(iteratee, 3)); - } - - /** - * Creates an object composed of keys generated from the results of running - * each element of `collection` thru `iteratee`. The order of grouped values - * is determined by the order they occur in `collection`. The corresponding - * value of each key is an array of elements responsible for generating the - * key. The iteratee is invoked with one argument: (value). - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Collection - * @param {Array|Object} collection The collection to iterate over. - * @param {Function} [iteratee=_.identity] The iteratee to transform keys. - * @returns {Object} Returns the composed aggregate object. - * @example - * - * _.groupBy([6.1, 4.2, 6.3], Math.floor); - * // => { '4': [4.2], '6': [6.1, 6.3] } - * - * // The `_.property` iteratee shorthand. - * _.groupBy(['one', 'two', 'three'], 'length'); - * // => { '3': ['one', 'two'], '5': ['three'] } - */ - var groupBy = createAggregator(function(result, value, key) { - if (hasOwnProperty.call(result, key)) { - result[key].push(value); - } else { - baseAssignValue(result, key, [value]); - } - }); - - /** - * Checks if `value` is in `collection`. If `collection` is a string, it's - * checked for a substring of `value`, otherwise - * [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero) - * is used for equality comparisons. If `fromIndex` is negative, it's used as - * the offset from the end of `collection`. - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Collection - * @param {Array|Object|string} collection The collection to inspect. - * @param {*} value The value to search for. - * @param {number} [fromIndex=0] The index to search from. - * @param- {Object} [guard] Enables use as an iteratee for methods like `_.reduce`. - * @returns {boolean} Returns `true` if `value` is found, else `false`. - * @example - * - * _.includes([1, 2, 3], 1); - * // => true - * - * _.includes([1, 2, 3], 1, 2); - * // => false - * - * _.includes({ 'a': 1, 'b': 2 }, 1); - * // => true - * - * _.includes('abcd', 'bc'); - * // => true - */ - function includes(collection, value, fromIndex, guard) { - collection = isArrayLike(collection) ? collection : values(collection); - fromIndex = (fromIndex && !guard) ? toInteger(fromIndex) : 0; - - var length = collection.length; - if (fromIndex < 0) { - fromIndex = nativeMax(length + fromIndex, 0); - } - return isString(collection) - ? (fromIndex <= length && collection.indexOf(value, fromIndex) > -1) - : (!!length && baseIndexOf(collection, value, fromIndex) > -1); - } - - /** - * Invokes the method at `path` of each element in `collection`, returning - * an array of the results of each invoked method. Any additional arguments - * are provided to each invoked method. If `path` is a function, it's invoked - * for, and `this` bound to, each element in `collection`. - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Collection - * @param {Array|Object} collection The collection to iterate over. - * @param {Array|Function|string} path The path of the method to invoke or - * the function invoked per iteration. - * @param {...*} [args] The arguments to invoke each method with. - * @returns {Array} Returns the array of results. - * @example - * - * _.invokeMap([[5, 1, 7], [3, 2, 1]], 'sort'); - * // => [[1, 5, 7], [1, 2, 3]] - * - * _.invokeMap([123, 456], String.prototype.split, ''); - * // => [['1', '2', '3'], ['4', '5', '6']] - */ - var invokeMap = baseRest(function(collection, path, args) { - var index = -1, - isFunc = typeof path == 'function', - result = isArrayLike(collection) ? Array(collection.length) : []; - - baseEach(collection, function(value) { - result[++index] = isFunc ? apply(path, value, args) : baseInvoke(value, path, args); - }); - return result; - }); - - /** - * Creates an object composed of keys generated from the results of running - * each element of `collection` thru `iteratee`. The corresponding value of - * each key is the last element responsible for generating the key. The - * iteratee is invoked with one argument: (value). - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Collection - * @param {Array|Object} collection The collection to iterate over. - * @param {Function} [iteratee=_.identity] The iteratee to transform keys. - * @returns {Object} Returns the composed aggregate object. - * @example - * - * var array = [ - * { 'dir': 'left', 'code': 97 }, - * { 'dir': 'right', 'code': 100 } - * ]; - * - * _.keyBy(array, function(o) { - * return String.fromCharCode(o.code); - * }); - * // => { 'a': { 'dir': 'left', 'code': 97 }, 'd': { 'dir': 'right', 'code': 100 } } - * - * _.keyBy(array, 'dir'); - * // => { 'left': { 'dir': 'left', 'code': 97 }, 'right': { 'dir': 'right', 'code': 100 } } - */ - var keyBy = createAggregator(function(result, value, key) { - baseAssignValue(result, key, value); - }); - - /** - * Creates an array of values by running each element in `collection` thru - * `iteratee`. The iteratee is invoked with three arguments: - * (value, index|key, collection). - * - * Many lodash methods are guarded to work as iteratees for methods like - * `_.every`, `_.filter`, `_.map`, `_.mapValues`, `_.reject`, and `_.some`. - * - * The guarded methods are: - * `ary`, `chunk`, `curry`, `curryRight`, `drop`, `dropRight`, `every`, - * `fill`, `invert`, `parseInt`, `random`, `range`, `rangeRight`, `repeat`, - * `sampleSize`, `slice`, `some`, `sortBy`, `split`, `take`, `takeRight`, - * `template`, `trim`, `trimEnd`, `trimStart`, and `words` - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Collection - * @param {Array|Object} collection The collection to iterate over. - * @param {Function} [iteratee=_.identity] The function invoked per iteration. - * @returns {Array} Returns the new mapped array. - * @example - * - * function square(n) { - * return n * n; - * } - * - * _.map([4, 8], square); - * // => [16, 64] - * - * _.map({ 'a': 4, 'b': 8 }, square); - * // => [16, 64] (iteration order is not guaranteed) - * - * var users = [ - * { 'user': 'barney' }, - * { 'user': 'fred' } - * ]; - * - * // The `_.property` iteratee shorthand. - * _.map(users, 'user'); - * // => ['barney', 'fred'] - */ - function map(collection, iteratee) { - var func = isArray(collection) ? arrayMap : baseMap; - return func(collection, getIteratee(iteratee, 3)); - } - - /** - * This method is like `_.sortBy` except that it allows specifying the sort - * orders of the iteratees to sort by. If `orders` is unspecified, all values - * are sorted in ascending order. Otherwise, specify an order of "desc" for - * descending or "asc" for ascending sort order of corresponding values. - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Collection - * @param {Array|Object} collection The collection to iterate over. - * @param {Array[]|Function[]|Object[]|string[]} [iteratees=[_.identity]] - * The iteratees to sort by. - * @param {string[]} [orders] The sort orders of `iteratees`. - * @param- {Object} [guard] Enables use as an iteratee for methods like `_.reduce`. - * @returns {Array} Returns the new sorted array. - * @example - * - * var users = [ - * { 'user': 'fred', 'age': 48 }, - * { 'user': 'barney', 'age': 34 }, - * { 'user': 'fred', 'age': 40 }, - * { 'user': 'barney', 'age': 36 } - * ]; - * - * // Sort by `user` in ascending order and by `age` in descending order. - * _.orderBy(users, ['user', 'age'], ['asc', 'desc']); - * // => objects for [['barney', 36], ['barney', 34], ['fred', 48], ['fred', 40]] - */ - function orderBy(collection, iteratees, orders, guard) { - if (collection == null) { - return []; - } - if (!isArray(iteratees)) { - iteratees = iteratees == null ? [] : [iteratees]; - } - orders = guard ? undefined : orders; - if (!isArray(orders)) { - orders = orders == null ? [] : [orders]; - } - return baseOrderBy(collection, iteratees, orders); - } - - /** - * Creates an array of elements split into two groups, the first of which - * contains elements `predicate` returns truthy for, the second of which - * contains elements `predicate` returns falsey for. The predicate is - * invoked with one argument: (value). - * - * @static - * @memberOf _ - * @since 3.0.0 - * @category Collection - * @param {Array|Object} collection The collection to iterate over. - * @param {Function} [predicate=_.identity] The function invoked per iteration. - * @returns {Array} Returns the array of grouped elements. - * @example - * - * var users = [ - * { 'user': 'barney', 'age': 36, 'active': false }, - * { 'user': 'fred', 'age': 40, 'active': true }, - * { 'user': 'pebbles', 'age': 1, 'active': false } - * ]; - * - * _.partition(users, function(o) { return o.active; }); - * // => objects for [['fred'], ['barney', 'pebbles']] - * - * // The `_.matches` iteratee shorthand. - * _.partition(users, { 'age': 1, 'active': false }); - * // => objects for [['pebbles'], ['barney', 'fred']] - * - * // The `_.matchesProperty` iteratee shorthand. - * _.partition(users, ['active', false]); - * // => objects for [['barney', 'pebbles'], ['fred']] - * - * // The `_.property` iteratee shorthand. - * _.partition(users, 'active'); - * // => objects for [['fred'], ['barney', 'pebbles']] - */ - var partition = createAggregator(function(result, value, key) { - result[key ? 0 : 1].push(value); - }, function() { return [[], []]; }); - - /** - * Reduces `collection` to a value which is the accumulated result of running - * each element in `collection` thru `iteratee`, where each successive - * invocation is supplied the return value of the previous. If `accumulator` - * is not given, the first element of `collection` is used as the initial - * value. The iteratee is invoked with four arguments: - * (accumulator, value, index|key, collection). - * - * Many lodash methods are guarded to work as iteratees for methods like - * `_.reduce`, `_.reduceRight`, and `_.transform`. - * - * The guarded methods are: - * `assign`, `defaults`, `defaultsDeep`, `includes`, `merge`, `orderBy`, - * and `sortBy` - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Collection - * @param {Array|Object} collection The collection to iterate over. - * @param {Function} [iteratee=_.identity] The function invoked per iteration. - * @param {*} [accumulator] The initial value. - * @returns {*} Returns the accumulated value. - * @see _.reduceRight - * @example - * - * _.reduce([1, 2], function(sum, n) { - * return sum + n; - * }, 0); - * // => 3 - * - * _.reduce({ 'a': 1, 'b': 2, 'c': 1 }, function(result, value, key) { - * (result[value] || (result[value] = [])).push(key); - * return result; - * }, {}); - * // => { '1': ['a', 'c'], '2': ['b'] } (iteration order is not guaranteed) - */ - function reduce(collection, iteratee, accumulator) { - var func = isArray(collection) ? arrayReduce : baseReduce, - initAccum = arguments.length < 3; - - return func(collection, getIteratee(iteratee, 4), accumulator, initAccum, baseEach); - } - - /** - * This method is like `_.reduce` except that it iterates over elements of - * `collection` from right to left. - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Collection - * @param {Array|Object} collection The collection to iterate over. - * @param {Function} [iteratee=_.identity] The function invoked per iteration. - * @param {*} [accumulator] The initial value. - * @returns {*} Returns the accumulated value. - * @see _.reduce - * @example - * - * var array = [[0, 1], [2, 3], [4, 5]]; - * - * _.reduceRight(array, function(flattened, other) { - * return flattened.concat(other); - * }, []); - * // => [4, 5, 2, 3, 0, 1] - */ - function reduceRight(collection, iteratee, accumulator) { - var func = isArray(collection) ? arrayReduceRight : baseReduce, - initAccum = arguments.length < 3; - - return func(collection, getIteratee(iteratee, 4), accumulator, initAccum, baseEachRight); - } - - /** - * The opposite of `_.filter`; this method returns the elements of `collection` - * that `predicate` does **not** return truthy for. - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Collection - * @param {Array|Object} collection The collection to iterate over. - * @param {Function} [predicate=_.identity] The function invoked per iteration. - * @returns {Array} Returns the new filtered array. - * @see _.filter - * @example - * - * var users = [ - * { 'user': 'barney', 'age': 36, 'active': false }, - * { 'user': 'fred', 'age': 40, 'active': true } - * ]; - * - * _.reject(users, function(o) { return !o.active; }); - * // => objects for ['fred'] - * - * // The `_.matches` iteratee shorthand. - * _.reject(users, { 'age': 40, 'active': true }); - * // => objects for ['barney'] - * - * // The `_.matchesProperty` iteratee shorthand. - * _.reject(users, ['active', false]); - * // => objects for ['fred'] - * - * // The `_.property` iteratee shorthand. - * _.reject(users, 'active'); - * // => objects for ['barney'] - */ - function reject(collection, predicate) { - var func = isArray(collection) ? arrayFilter : baseFilter; - return func(collection, negate(getIteratee(predicate, 3))); - } - - /** - * Gets a random element from `collection`. - * - * @static - * @memberOf _ - * @since 2.0.0 - * @category Collection - * @param {Array|Object} collection The collection to sample. - * @returns {*} Returns the random element. - * @example - * - * _.sample([1, 2, 3, 4]); - * // => 2 - */ - function sample(collection) { - var func = isArray(collection) ? arraySample : baseSample; - return func(collection); - } - - /** - * Gets `n` random elements at unique keys from `collection` up to the - * size of `collection`. - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Collection - * @param {Array|Object} collection The collection to sample. - * @param {number} [n=1] The number of elements to sample. - * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`. - * @returns {Array} Returns the random elements. - * @example - * - * _.sampleSize([1, 2, 3], 2); - * // => [3, 1] - * - * _.sampleSize([1, 2, 3], 4); - * // => [2, 3, 1] - */ - function sampleSize(collection, n, guard) { - if ((guard ? isIterateeCall(collection, n, guard) : n === undefined)) { - n = 1; - } else { - n = toInteger(n); - } - var func = isArray(collection) ? arraySampleSize : baseSampleSize; - return func(collection, n); - } - - /** - * Creates an array of shuffled values, using a version of the - * [Fisher-Yates shuffle](https://en.wikipedia.org/wiki/Fisher-Yates_shuffle). - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Collection - * @param {Array|Object} collection The collection to shuffle. - * @returns {Array} Returns the new shuffled array. - * @example - * - * _.shuffle([1, 2, 3, 4]); - * // => [4, 1, 3, 2] - */ - function shuffle(collection) { - var func = isArray(collection) ? arrayShuffle : baseShuffle; - return func(collection); - } - - /** - * Gets the size of `collection` by returning its length for array-like - * values or the number of own enumerable string keyed properties for objects. - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Collection - * @param {Array|Object|string} collection The collection to inspect. - * @returns {number} Returns the collection size. - * @example - * - * _.size([1, 2, 3]); - * // => 3 - * - * _.size({ 'a': 1, 'b': 2 }); - * // => 2 - * - * _.size('pebbles'); - * // => 7 - */ - function size(collection) { - if (collection == null) { - return 0; - } - if (isArrayLike(collection)) { - return isString(collection) ? stringSize(collection) : collection.length; - } - var tag = getTag(collection); - if (tag == mapTag || tag == setTag) { - return collection.size; - } - return baseKeys(collection).length; - } - - /** - * Checks if `predicate` returns truthy for **any** element of `collection`. - * Iteration is stopped once `predicate` returns truthy. The predicate is - * invoked with three arguments: (value, index|key, collection). - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Collection - * @param {Array|Object} collection The collection to iterate over. - * @param {Function} [predicate=_.identity] The function invoked per iteration. - * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`. - * @returns {boolean} Returns `true` if any element passes the predicate check, - * else `false`. - * @example - * - * _.some([null, 0, 'yes', false], Boolean); - * // => true - * - * var users = [ - * { 'user': 'barney', 'active': true }, - * { 'user': 'fred', 'active': false } - * ]; - * - * // The `_.matches` iteratee shorthand. - * _.some(users, { 'user': 'barney', 'active': false }); - * // => false - * - * // The `_.matchesProperty` iteratee shorthand. - * _.some(users, ['active', false]); - * // => true - * - * // The `_.property` iteratee shorthand. - * _.some(users, 'active'); - * // => true - */ - function some(collection, predicate, guard) { - var func = isArray(collection) ? arraySome : baseSome; - if (guard && isIterateeCall(collection, predicate, guard)) { - predicate = undefined; - } - return func(collection, getIteratee(predicate, 3)); - } - - /** - * Creates an array of elements, sorted in ascending order by the results of - * running each element in a collection thru each iteratee. This method - * performs a stable sort, that is, it preserves the original sort order of - * equal elements. The iteratees are invoked with one argument: (value). - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Collection - * @param {Array|Object} collection The collection to iterate over. - * @param {...(Function|Function[])} [iteratees=[_.identity]] - * The iteratees to sort by. - * @returns {Array} Returns the new sorted array. - * @example - * - * var users = [ - * { 'user': 'fred', 'age': 48 }, - * { 'user': 'barney', 'age': 36 }, - * { 'user': 'fred', 'age': 40 }, - * { 'user': 'barney', 'age': 34 } - * ]; - * - * _.sortBy(users, [function(o) { return o.user; }]); - * // => objects for [['barney', 36], ['barney', 34], ['fred', 48], ['fred', 40]] - * - * _.sortBy(users, ['user', 'age']); - * // => objects for [['barney', 34], ['barney', 36], ['fred', 40], ['fred', 48]] - */ - var sortBy = baseRest(function(collection, iteratees) { - if (collection == null) { - return []; - } - var length = iteratees.length; - if (length > 1 && isIterateeCall(collection, iteratees[0], iteratees[1])) { - iteratees = []; - } else if (length > 2 && isIterateeCall(iteratees[0], iteratees[1], iteratees[2])) { - iteratees = [iteratees[0]]; - } - return baseOrderBy(collection, baseFlatten(iteratees, 1), []); - }); - - /*------------------------------------------------------------------------*/ - - /** - * Gets the timestamp of the number of milliseconds that have elapsed since - * the Unix epoch (1 January 1970 00:00:00 UTC). - * - * @static - * @memberOf _ - * @since 2.4.0 - * @category Date - * @returns {number} Returns the timestamp. - * @example - * - * _.defer(function(stamp) { - * console.log(_.now() - stamp); - * }, _.now()); - * // => Logs the number of milliseconds it took for the deferred invocation. - */ - var now = ctxNow || function() { - return root.Date.now(); - }; - - /*------------------------------------------------------------------------*/ - - /** - * The opposite of `_.before`; this method creates a function that invokes - * `func` once it's called `n` or more times. - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Function - * @param {number} n The number of calls before `func` is invoked. - * @param {Function} func The function to restrict. - * @returns {Function} Returns the new restricted function. - * @example - * - * var saves = ['profile', 'settings']; - * - * var done = _.after(saves.length, function() { - * console.log('done saving!'); - * }); - * - * _.forEach(saves, function(type) { - * asyncSave({ 'type': type, 'complete': done }); - * }); - * // => Logs 'done saving!' after the two async saves have completed. - */ - function after(n, func) { - if (typeof func != 'function') { - throw new TypeError(FUNC_ERROR_TEXT); - } - n = toInteger(n); - return function() { - if (--n < 1) { - return func.apply(this, arguments); - } - }; - } - - /** - * Creates a function that invokes `func`, with up to `n` arguments, - * ignoring any additional arguments. - * - * @static - * @memberOf _ - * @since 3.0.0 - * @category Function - * @param {Function} func The function to cap arguments for. - * @param {number} [n=func.length] The arity cap. - * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`. - * @returns {Function} Returns the new capped function. - * @example - * - * _.map(['6', '8', '10'], _.ary(parseInt, 1)); - * // => [6, 8, 10] - */ - function ary(func, n, guard) { - n = guard ? undefined : n; - n = (func && n == null) ? func.length : n; - return createWrap(func, WRAP_ARY_FLAG, undefined, undefined, undefined, undefined, n); - } - - /** - * Creates a function that invokes `func`, with the `this` binding and arguments - * of the created function, while it's called less than `n` times. Subsequent - * calls to the created function return the result of the last `func` invocation. - * - * @static - * @memberOf _ - * @since 3.0.0 - * @category Function - * @param {number} n The number of calls at which `func` is no longer invoked. - * @param {Function} func The function to restrict. - * @returns {Function} Returns the new restricted function. - * @example - * - * jQuery(element).on('click', _.before(5, addContactToList)); - * // => Allows adding up to 4 contacts to the list. - */ - function before(n, func) { - var result; - if (typeof func != 'function') { - throw new TypeError(FUNC_ERROR_TEXT); - } - n = toInteger(n); - return function() { - if (--n > 0) { - result = func.apply(this, arguments); - } - if (n <= 1) { - func = undefined; - } - return result; - }; - } - - /** - * Creates a function that invokes `func` with the `this` binding of `thisArg` - * and `partials` prepended to the arguments it receives. - * - * The `_.bind.placeholder` value, which defaults to `_` in monolithic builds, - * may be used as a placeholder for partially applied arguments. - * - * **Note:** Unlike native `Function#bind`, this method doesn't set the "length" - * property of bound functions. - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Function - * @param {Function} func The function to bind. - * @param {*} thisArg The `this` binding of `func`. - * @param {...*} [partials] The arguments to be partially applied. - * @returns {Function} Returns the new bound function. - * @example - * - * function greet(greeting, punctuation) { - * return greeting + ' ' + this.user + punctuation; - * } - * - * var object = { 'user': 'fred' }; - * - * var bound = _.bind(greet, object, 'hi'); - * bound('!'); - * // => 'hi fred!' - * - * // Bound with placeholders. - * var bound = _.bind(greet, object, _, '!'); - * bound('hi'); - * // => 'hi fred!' - */ - var bind = baseRest(function(func, thisArg, partials) { - var bitmask = WRAP_BIND_FLAG; - if (partials.length) { - var holders = replaceHolders(partials, getHolder(bind)); - bitmask |= WRAP_PARTIAL_FLAG; - } - return createWrap(func, bitmask, thisArg, partials, holders); - }); - - /** - * Creates a function that invokes the method at `object[key]` with `partials` - * prepended to the arguments it receives. - * - * This method differs from `_.bind` by allowing bound functions to reference - * methods that may be redefined or don't yet exist. See - * [Peter Michaux's article](http://peter.michaux.ca/articles/lazy-function-definition-pattern) - * for more details. - * - * The `_.bindKey.placeholder` value, which defaults to `_` in monolithic - * builds, may be used as a placeholder for partially applied arguments. - * - * @static - * @memberOf _ - * @since 0.10.0 - * @category Function - * @param {Object} object The object to invoke the method on. - * @param {string} key The key of the method. - * @param {...*} [partials] The arguments to be partially applied. - * @returns {Function} Returns the new bound function. - * @example - * - * var object = { - * 'user': 'fred', - * 'greet': function(greeting, punctuation) { - * return greeting + ' ' + this.user + punctuation; - * } - * }; - * - * var bound = _.bindKey(object, 'greet', 'hi'); - * bound('!'); - * // => 'hi fred!' - * - * object.greet = function(greeting, punctuation) { - * return greeting + 'ya ' + this.user + punctuation; - * }; - * - * bound('!'); - * // => 'hiya fred!' - * - * // Bound with placeholders. - * var bound = _.bindKey(object, 'greet', _, '!'); - * bound('hi'); - * // => 'hiya fred!' - */ - var bindKey = baseRest(function(object, key, partials) { - var bitmask = WRAP_BIND_FLAG | WRAP_BIND_KEY_FLAG; - if (partials.length) { - var holders = replaceHolders(partials, getHolder(bindKey)); - bitmask |= WRAP_PARTIAL_FLAG; - } - return createWrap(key, bitmask, object, partials, holders); - }); - - /** - * Creates a function that accepts arguments of `func` and either invokes - * `func` returning its result, if at least `arity` number of arguments have - * been provided, or returns a function that accepts the remaining `func` - * arguments, and so on. The arity of `func` may be specified if `func.length` - * is not sufficient. - * - * The `_.curry.placeholder` value, which defaults to `_` in monolithic builds, - * may be used as a placeholder for provided arguments. - * - * **Note:** This method doesn't set the "length" property of curried functions. - * - * @static - * @memberOf _ - * @since 2.0.0 - * @category Function - * @param {Function} func The function to curry. - * @param {number} [arity=func.length] The arity of `func`. - * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`. - * @returns {Function} Returns the new curried function. - * @example - * - * var abc = function(a, b, c) { - * return [a, b, c]; - * }; - * - * var curried = _.curry(abc); - * - * curried(1)(2)(3); - * // => [1, 2, 3] - * - * curried(1, 2)(3); - * // => [1, 2, 3] - * - * curried(1, 2, 3); - * // => [1, 2, 3] - * - * // Curried with placeholders. - * curried(1)(_, 3)(2); - * // => [1, 2, 3] - */ - function curry(func, arity, guard) { - arity = guard ? undefined : arity; - var result = createWrap(func, WRAP_CURRY_FLAG, undefined, undefined, undefined, undefined, undefined, arity); - result.placeholder = curry.placeholder; - return result; - } - - /** - * This method is like `_.curry` except that arguments are applied to `func` - * in the manner of `_.partialRight` instead of `_.partial`. - * - * The `_.curryRight.placeholder` value, which defaults to `_` in monolithic - * builds, may be used as a placeholder for provided arguments. - * - * **Note:** This method doesn't set the "length" property of curried functions. - * - * @static - * @memberOf _ - * @since 3.0.0 - * @category Function - * @param {Function} func The function to curry. - * @param {number} [arity=func.length] The arity of `func`. - * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`. - * @returns {Function} Returns the new curried function. - * @example - * - * var abc = function(a, b, c) { - * return [a, b, c]; - * }; - * - * var curried = _.curryRight(abc); - * - * curried(3)(2)(1); - * // => [1, 2, 3] - * - * curried(2, 3)(1); - * // => [1, 2, 3] - * - * curried(1, 2, 3); - * // => [1, 2, 3] - * - * // Curried with placeholders. - * curried(3)(1, _)(2); - * // => [1, 2, 3] - */ - function curryRight(func, arity, guard) { - arity = guard ? undefined : arity; - var result = createWrap(func, WRAP_CURRY_RIGHT_FLAG, undefined, undefined, undefined, undefined, undefined, arity); - result.placeholder = curryRight.placeholder; - return result; - } - - /** - * Creates a debounced function that delays invoking `func` until after `wait` - * milliseconds have elapsed since the last time the debounced function was - * invoked. The debounced function comes with a `cancel` method to cancel - * delayed `func` invocations and a `flush` method to immediately invoke them. - * Provide `options` to indicate whether `func` should be invoked on the - * leading and/or trailing edge of the `wait` timeout. The `func` is invoked - * with the last arguments provided to the debounced function. Subsequent - * calls to the debounced function return the result of the last `func` - * invocation. - * - * **Note:** If `leading` and `trailing` options are `true`, `func` is - * invoked on the trailing edge of the timeout only if the debounced function - * is invoked more than once during the `wait` timeout. - * - * If `wait` is `0` and `leading` is `false`, `func` invocation is deferred - * until to the next tick, similar to `setTimeout` with a timeout of `0`. - * - * See [David Corbacho's article](https://css-tricks.com/debouncing-throttling-explained-examples/) - * for details over the differences between `_.debounce` and `_.throttle`. - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Function - * @param {Function} func The function to debounce. - * @param {number} [wait=0] The number of milliseconds to delay. - * @param {Object} [options={}] The options object. - * @param {boolean} [options.leading=false] - * Specify invoking on the leading edge of the timeout. - * @param {number} [options.maxWait] - * The maximum time `func` is allowed to be delayed before it's invoked. - * @param {boolean} [options.trailing=true] - * Specify invoking on the trailing edge of the timeout. - * @returns {Function} Returns the new debounced function. - * @example - * - * // Avoid costly calculations while the window size is in flux. - * jQuery(window).on('resize', _.debounce(calculateLayout, 150)); - * - * // Invoke `sendMail` when clicked, debouncing subsequent calls. - * jQuery(element).on('click', _.debounce(sendMail, 300, { - * 'leading': true, - * 'trailing': false - * })); - * - * // Ensure `batchLog` is invoked once after 1 second of debounced calls. - * var debounced = _.debounce(batchLog, 250, { 'maxWait': 1000 }); - * var source = new EventSource('/stream'); - * jQuery(source).on('message', debounced); - * - * // Cancel the trailing debounced invocation. - * jQuery(window).on('popstate', debounced.cancel); - */ - function debounce(func, wait, options) { - var lastArgs, - lastThis, - maxWait, - result, - timerId, - lastCallTime, - lastInvokeTime = 0, - leading = false, - maxing = false, - trailing = true; - - if (typeof func != 'function') { - throw new TypeError(FUNC_ERROR_TEXT); - } - wait = toNumber(wait) || 0; - if (isObject(options)) { - leading = !!options.leading; - maxing = 'maxWait' in options; - maxWait = maxing ? nativeMax(toNumber(options.maxWait) || 0, wait) : maxWait; - trailing = 'trailing' in options ? !!options.trailing : trailing; - } - - function invokeFunc(time) { - var args = lastArgs, - thisArg = lastThis; - - lastArgs = lastThis = undefined; - lastInvokeTime = time; - result = func.apply(thisArg, args); - return result; - } - - function leadingEdge(time) { - // Reset any `maxWait` timer. - lastInvokeTime = time; - // Start the timer for the trailing edge. - timerId = setTimeout(timerExpired, wait); - // Invoke the leading edge. - return leading ? invokeFunc(time) : result; - } - - function remainingWait(time) { - var timeSinceLastCall = time - lastCallTime, - timeSinceLastInvoke = time - lastInvokeTime, - timeWaiting = wait - timeSinceLastCall; - - return maxing - ? nativeMin(timeWaiting, maxWait - timeSinceLastInvoke) - : timeWaiting; - } - - function shouldInvoke(time) { - var timeSinceLastCall = time - lastCallTime, - timeSinceLastInvoke = time - lastInvokeTime; - - // Either this is the first call, activity has stopped and we're at the - // trailing edge, the system time has gone backwards and we're treating - // it as the trailing edge, or we've hit the `maxWait` limit. - return (lastCallTime === undefined || (timeSinceLastCall >= wait) || - (timeSinceLastCall < 0) || (maxing && timeSinceLastInvoke >= maxWait)); - } - - function timerExpired() { - var time = now(); - if (shouldInvoke(time)) { - return trailingEdge(time); - } - // Restart the timer. - timerId = setTimeout(timerExpired, remainingWait(time)); - } - - function trailingEdge(time) { - timerId = undefined; - - // Only invoke if we have `lastArgs` which means `func` has been - // debounced at least once. - if (trailing && lastArgs) { - return invokeFunc(time); - } - lastArgs = lastThis = undefined; - return result; - } - - function cancel() { - if (timerId !== undefined) { - clearTimeout(timerId); - } - lastInvokeTime = 0; - lastArgs = lastCallTime = lastThis = timerId = undefined; - } - - function flush() { - return timerId === undefined ? result : trailingEdge(now()); - } - - function debounced() { - var time = now(), - isInvoking = shouldInvoke(time); - - lastArgs = arguments; - lastThis = this; - lastCallTime = time; - - if (isInvoking) { - if (timerId === undefined) { - return leadingEdge(lastCallTime); - } - if (maxing) { - // Handle invocations in a tight loop. - timerId = setTimeout(timerExpired, wait); - return invokeFunc(lastCallTime); - } - } - if (timerId === undefined) { - timerId = setTimeout(timerExpired, wait); - } - return result; - } - debounced.cancel = cancel; - debounced.flush = flush; - return debounced; - } - - /** - * Defers invoking the `func` until the current call stack has cleared. Any - * additional arguments are provided to `func` when it's invoked. - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Function - * @param {Function} func The function to defer. - * @param {...*} [args] The arguments to invoke `func` with. - * @returns {number} Returns the timer id. - * @example - * - * _.defer(function(text) { - * console.log(text); - * }, 'deferred'); - * // => Logs 'deferred' after one millisecond. - */ - var defer = baseRest(function(func, args) { - return baseDelay(func, 1, args); - }); - - /** - * Invokes `func` after `wait` milliseconds. Any additional arguments are - * provided to `func` when it's invoked. - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Function - * @param {Function} func The function to delay. - * @param {number} wait The number of milliseconds to delay invocation. - * @param {...*} [args] The arguments to invoke `func` with. - * @returns {number} Returns the timer id. - * @example - * - * _.delay(function(text) { - * console.log(text); - * }, 1000, 'later'); - * // => Logs 'later' after one second. - */ - var delay = baseRest(function(func, wait, args) { - return baseDelay(func, toNumber(wait) || 0, args); - }); - - /** - * Creates a function that invokes `func` with arguments reversed. - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Function - * @param {Function} func The function to flip arguments for. - * @returns {Function} Returns the new flipped function. - * @example - * - * var flipped = _.flip(function() { - * return _.toArray(arguments); - * }); - * - * flipped('a', 'b', 'c', 'd'); - * // => ['d', 'c', 'b', 'a'] - */ - function flip(func) { - return createWrap(func, WRAP_FLIP_FLAG); - } - - /** - * Creates a function that memoizes the result of `func`. If `resolver` is - * provided, it determines the cache key for storing the result based on the - * arguments provided to the memoized function. By default, the first argument - * provided to the memoized function is used as the map cache key. The `func` - * is invoked with the `this` binding of the memoized function. - * - * **Note:** The cache is exposed as the `cache` property on the memoized - * function. Its creation may be customized by replacing the `_.memoize.Cache` - * constructor with one whose instances implement the - * [`Map`](http://ecma-international.org/ecma-262/7.0/#sec-properties-of-the-map-prototype-object) - * method interface of `clear`, `delete`, `get`, `has`, and `set`. - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Function - * @param {Function} func The function to have its output memoized. - * @param {Function} [resolver] The function to resolve the cache key. - * @returns {Function} Returns the new memoized function. - * @example - * - * var object = { 'a': 1, 'b': 2 }; - * var other = { 'c': 3, 'd': 4 }; - * - * var values = _.memoize(_.values); - * values(object); - * // => [1, 2] - * - * values(other); - * // => [3, 4] - * - * object.a = 2; - * values(object); - * // => [1, 2] - * - * // Modify the result cache. - * values.cache.set(object, ['a', 'b']); - * values(object); - * // => ['a', 'b'] - * - * // Replace `_.memoize.Cache`. - * _.memoize.Cache = WeakMap; - */ - function memoize(func, resolver) { - if (typeof func != 'function' || (resolver != null && typeof resolver != 'function')) { - throw new TypeError(FUNC_ERROR_TEXT); - } - var memoized = function() { - var args = arguments, - key = resolver ? resolver.apply(this, args) : args[0], - cache = memoized.cache; - - if (cache.has(key)) { - return cache.get(key); - } - var result = func.apply(this, args); - memoized.cache = cache.set(key, result) || cache; - return result; - }; - memoized.cache = new (memoize.Cache || MapCache); - return memoized; - } - - // Expose `MapCache`. - memoize.Cache = MapCache; - - /** - * Creates a function that negates the result of the predicate `func`. The - * `func` predicate is invoked with the `this` binding and arguments of the - * created function. - * - * @static - * @memberOf _ - * @since 3.0.0 - * @category Function - * @param {Function} predicate The predicate to negate. - * @returns {Function} Returns the new negated function. - * @example - * - * function isEven(n) { - * return n % 2 == 0; - * } - * - * _.filter([1, 2, 3, 4, 5, 6], _.negate(isEven)); - * // => [1, 3, 5] - */ - function negate(predicate) { - if (typeof predicate != 'function') { - throw new TypeError(FUNC_ERROR_TEXT); - } - return function() { - var args = arguments; - switch (args.length) { - case 0: return !predicate.call(this); - case 1: return !predicate.call(this, args[0]); - case 2: return !predicate.call(this, args[0], args[1]); - case 3: return !predicate.call(this, args[0], args[1], args[2]); - } - return !predicate.apply(this, args); - }; - } - - /** - * Creates a function that is restricted to invoking `func` once. Repeat calls - * to the function return the value of the first invocation. The `func` is - * invoked with the `this` binding and arguments of the created function. - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Function - * @param {Function} func The function to restrict. - * @returns {Function} Returns the new restricted function. - * @example - * - * var initialize = _.once(createApplication); - * initialize(); - * initialize(); - * // => `createApplication` is invoked once - */ - function once(func) { - return before(2, func); - } - - /** - * Creates a function that invokes `func` with its arguments transformed. - * - * @static - * @since 4.0.0 - * @memberOf _ - * @category Function - * @param {Function} func The function to wrap. - * @param {...(Function|Function[])} [transforms=[_.identity]] - * The argument transforms. - * @returns {Function} Returns the new function. - * @example - * - * function doubled(n) { - * return n * 2; - * } - * - * function square(n) { - * return n * n; - * } - * - * var func = _.overArgs(function(x, y) { - * return [x, y]; - * }, [square, doubled]); - * - * func(9, 3); - * // => [81, 6] - * - * func(10, 5); - * // => [100, 10] - */ - var overArgs = castRest(function(func, transforms) { - transforms = (transforms.length == 1 && isArray(transforms[0])) - ? arrayMap(transforms[0], baseUnary(getIteratee())) - : arrayMap(baseFlatten(transforms, 1), baseUnary(getIteratee())); - - var funcsLength = transforms.length; - return baseRest(function(args) { - var index = -1, - length = nativeMin(args.length, funcsLength); - - while (++index < length) { - args[index] = transforms[index].call(this, args[index]); - } - return apply(func, this, args); - }); - }); - - /** - * Creates a function that invokes `func` with `partials` prepended to the - * arguments it receives. This method is like `_.bind` except it does **not** - * alter the `this` binding. - * - * The `_.partial.placeholder` value, which defaults to `_` in monolithic - * builds, may be used as a placeholder for partially applied arguments. - * - * **Note:** This method doesn't set the "length" property of partially - * applied functions. - * - * @static - * @memberOf _ - * @since 0.2.0 - * @category Function - * @param {Function} func The function to partially apply arguments to. - * @param {...*} [partials] The arguments to be partially applied. - * @returns {Function} Returns the new partially applied function. - * @example - * - * function greet(greeting, name) { - * return greeting + ' ' + name; - * } - * - * var sayHelloTo = _.partial(greet, 'hello'); - * sayHelloTo('fred'); - * // => 'hello fred' - * - * // Partially applied with placeholders. - * var greetFred = _.partial(greet, _, 'fred'); - * greetFred('hi'); - * // => 'hi fred' - */ - var partial = baseRest(function(func, partials) { - var holders = replaceHolders(partials, getHolder(partial)); - return createWrap(func, WRAP_PARTIAL_FLAG, undefined, partials, holders); - }); - - /** - * This method is like `_.partial` except that partially applied arguments - * are appended to the arguments it receives. - * - * The `_.partialRight.placeholder` value, which defaults to `_` in monolithic - * builds, may be used as a placeholder for partially applied arguments. - * - * **Note:** This method doesn't set the "length" property of partially - * applied functions. - * - * @static - * @memberOf _ - * @since 1.0.0 - * @category Function - * @param {Function} func The function to partially apply arguments to. - * @param {...*} [partials] The arguments to be partially applied. - * @returns {Function} Returns the new partially applied function. - * @example - * - * function greet(greeting, name) { - * return greeting + ' ' + name; - * } - * - * var greetFred = _.partialRight(greet, 'fred'); - * greetFred('hi'); - * // => 'hi fred' - * - * // Partially applied with placeholders. - * var sayHelloTo = _.partialRight(greet, 'hello', _); - * sayHelloTo('fred'); - * // => 'hello fred' - */ - var partialRight = baseRest(function(func, partials) { - var holders = replaceHolders(partials, getHolder(partialRight)); - return createWrap(func, WRAP_PARTIAL_RIGHT_FLAG, undefined, partials, holders); - }); - - /** - * Creates a function that invokes `func` with arguments arranged according - * to the specified `indexes` where the argument value at the first index is - * provided as the first argument, the argument value at the second index is - * provided as the second argument, and so on. - * - * @static - * @memberOf _ - * @since 3.0.0 - * @category Function - * @param {Function} func The function to rearrange arguments for. - * @param {...(number|number[])} indexes The arranged argument indexes. - * @returns {Function} Returns the new function. - * @example - * - * var rearged = _.rearg(function(a, b, c) { - * return [a, b, c]; - * }, [2, 0, 1]); - * - * rearged('b', 'c', 'a') - * // => ['a', 'b', 'c'] - */ - var rearg = flatRest(function(func, indexes) { - return createWrap(func, WRAP_REARG_FLAG, undefined, undefined, undefined, indexes); - }); - - /** - * Creates a function that invokes `func` with the `this` binding of the - * created function and arguments from `start` and beyond provided as - * an array. - * - * **Note:** This method is based on the - * [rest parameter](https://mdn.io/rest_parameters). - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Function - * @param {Function} func The function to apply a rest parameter to. - * @param {number} [start=func.length-1] The start position of the rest parameter. - * @returns {Function} Returns the new function. - * @example - * - * var say = _.rest(function(what, names) { - * return what + ' ' + _.initial(names).join(', ') + - * (_.size(names) > 1 ? ', & ' : '') + _.last(names); - * }); - * - * say('hello', 'fred', 'barney', 'pebbles'); - * // => 'hello fred, barney, & pebbles' - */ - function rest(func, start) { - if (typeof func != 'function') { - throw new TypeError(FUNC_ERROR_TEXT); - } - start = start === undefined ? start : toInteger(start); - return baseRest(func, start); - } - - /** - * Creates a function that invokes `func` with the `this` binding of the - * create function and an array of arguments much like - * [`Function#apply`](http://www.ecma-international.org/ecma-262/7.0/#sec-function.prototype.apply). - * - * **Note:** This method is based on the - * [spread operator](https://mdn.io/spread_operator). - * - * @static - * @memberOf _ - * @since 3.2.0 - * @category Function - * @param {Function} func The function to spread arguments over. - * @param {number} [start=0] The start position of the spread. - * @returns {Function} Returns the new function. - * @example - * - * var say = _.spread(function(who, what) { - * return who + ' says ' + what; - * }); - * - * say(['fred', 'hello']); - * // => 'fred says hello' - * - * var numbers = Promise.all([ - * Promise.resolve(40), - * Promise.resolve(36) - * ]); - * - * numbers.then(_.spread(function(x, y) { - * return x + y; - * })); - * // => a Promise of 76 - */ - function spread(func, start) { - if (typeof func != 'function') { - throw new TypeError(FUNC_ERROR_TEXT); - } - start = start == null ? 0 : nativeMax(toInteger(start), 0); - return baseRest(function(args) { - var array = args[start], - otherArgs = castSlice(args, 0, start); - - if (array) { - arrayPush(otherArgs, array); - } - return apply(func, this, otherArgs); - }); - } - - /** - * Creates a throttled function that only invokes `func` at most once per - * every `wait` milliseconds. The throttled function comes with a `cancel` - * method to cancel delayed `func` invocations and a `flush` method to - * immediately invoke them. Provide `options` to indicate whether `func` - * should be invoked on the leading and/or trailing edge of the `wait` - * timeout. The `func` is invoked with the last arguments provided to the - * throttled function. Subsequent calls to the throttled function return the - * result of the last `func` invocation. - * - * **Note:** If `leading` and `trailing` options are `true`, `func` is - * invoked on the trailing edge of the timeout only if the throttled function - * is invoked more than once during the `wait` timeout. - * - * If `wait` is `0` and `leading` is `false`, `func` invocation is deferred - * until to the next tick, similar to `setTimeout` with a timeout of `0`. - * - * See [David Corbacho's article](https://css-tricks.com/debouncing-throttling-explained-examples/) - * for details over the differences between `_.throttle` and `_.debounce`. - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Function - * @param {Function} func The function to throttle. - * @param {number} [wait=0] The number of milliseconds to throttle invocations to. - * @param {Object} [options={}] The options object. - * @param {boolean} [options.leading=true] - * Specify invoking on the leading edge of the timeout. - * @param {boolean} [options.trailing=true] - * Specify invoking on the trailing edge of the timeout. - * @returns {Function} Returns the new throttled function. - * @example - * - * // Avoid excessively updating the position while scrolling. - * jQuery(window).on('scroll', _.throttle(updatePosition, 100)); - * - * // Invoke `renewToken` when the click event is fired, but not more than once every 5 minutes. - * var throttled = _.throttle(renewToken, 300000, { 'trailing': false }); - * jQuery(element).on('click', throttled); - * - * // Cancel the trailing throttled invocation. - * jQuery(window).on('popstate', throttled.cancel); - */ - function throttle(func, wait, options) { - var leading = true, - trailing = true; - - if (typeof func != 'function') { - throw new TypeError(FUNC_ERROR_TEXT); - } - if (isObject(options)) { - leading = 'leading' in options ? !!options.leading : leading; - trailing = 'trailing' in options ? !!options.trailing : trailing; - } - return debounce(func, wait, { - 'leading': leading, - 'maxWait': wait, - 'trailing': trailing - }); - } - - /** - * Creates a function that accepts up to one argument, ignoring any - * additional arguments. - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Function - * @param {Function} func The function to cap arguments for. - * @returns {Function} Returns the new capped function. - * @example - * - * _.map(['6', '8', '10'], _.unary(parseInt)); - * // => [6, 8, 10] - */ - function unary(func) { - return ary(func, 1); - } - - /** - * Creates a function that provides `value` to `wrapper` as its first - * argument. Any additional arguments provided to the function are appended - * to those provided to the `wrapper`. The wrapper is invoked with the `this` - * binding of the created function. - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Function - * @param {*} value The value to wrap. - * @param {Function} [wrapper=identity] The wrapper function. - * @returns {Function} Returns the new function. - * @example - * - * var p = _.wrap(_.escape, function(func, text) { - * return '

' + func(text) + '

'; - * }); - * - * p('fred, barney, & pebbles'); - * // => '

fred, barney, & pebbles

' - */ - function wrap(value, wrapper) { - return partial(castFunction(wrapper), value); - } - - /*------------------------------------------------------------------------*/ - - /** - * Casts `value` as an array if it's not one. - * - * @static - * @memberOf _ - * @since 4.4.0 - * @category Lang - * @param {*} value The value to inspect. - * @returns {Array} Returns the cast array. - * @example - * - * _.castArray(1); - * // => [1] - * - * _.castArray({ 'a': 1 }); - * // => [{ 'a': 1 }] - * - * _.castArray('abc'); - * // => ['abc'] - * - * _.castArray(null); - * // => [null] - * - * _.castArray(undefined); - * // => [undefined] - * - * _.castArray(); - * // => [] - * - * var array = [1, 2, 3]; - * console.log(_.castArray(array) === array); - * // => true - */ - function castArray() { - if (!arguments.length) { - return []; - } - var value = arguments[0]; - return isArray(value) ? value : [value]; - } - - /** - * Creates a shallow clone of `value`. - * - * **Note:** This method is loosely based on the - * [structured clone algorithm](https://mdn.io/Structured_clone_algorithm) - * and supports cloning arrays, array buffers, booleans, date objects, maps, - * numbers, `Object` objects, regexes, sets, strings, symbols, and typed - * arrays. The own enumerable properties of `arguments` objects are cloned - * as plain objects. An empty object is returned for uncloneable values such - * as error objects, functions, DOM nodes, and WeakMaps. - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Lang - * @param {*} value The value to clone. - * @returns {*} Returns the cloned value. - * @see _.cloneDeep - * @example - * - * var objects = [{ 'a': 1 }, { 'b': 2 }]; - * - * var shallow = _.clone(objects); - * console.log(shallow[0] === objects[0]); - * // => true - */ - function clone(value) { - return baseClone(value, CLONE_SYMBOLS_FLAG); - } - - /** - * This method is like `_.clone` except that it accepts `customizer` which - * is invoked to produce the cloned value. If `customizer` returns `undefined`, - * cloning is handled by the method instead. The `customizer` is invoked with - * up to four arguments; (value [, index|key, object, stack]). - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Lang - * @param {*} value The value to clone. - * @param {Function} [customizer] The function to customize cloning. - * @returns {*} Returns the cloned value. - * @see _.cloneDeepWith - * @example - * - * function customizer(value) { - * if (_.isElement(value)) { - * return value.cloneNode(false); - * } - * } - * - * var el = _.cloneWith(document.body, customizer); - * - * console.log(el === document.body); - * // => false - * console.log(el.nodeName); - * // => 'BODY' - * console.log(el.childNodes.length); - * // => 0 - */ - function cloneWith(value, customizer) { - customizer = typeof customizer == 'function' ? customizer : undefined; - return baseClone(value, CLONE_SYMBOLS_FLAG, customizer); - } - - /** - * This method is like `_.clone` except that it recursively clones `value`. - * - * @static - * @memberOf _ - * @since 1.0.0 - * @category Lang - * @param {*} value The value to recursively clone. - * @returns {*} Returns the deep cloned value. - * @see _.clone - * @example - * - * var objects = [{ 'a': 1 }, { 'b': 2 }]; - * - * var deep = _.cloneDeep(objects); - * console.log(deep[0] === objects[0]); - * // => false - */ - function cloneDeep(value) { - return baseClone(value, CLONE_DEEP_FLAG | CLONE_SYMBOLS_FLAG); - } - - /** - * This method is like `_.cloneWith` except that it recursively clones `value`. - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Lang - * @param {*} value The value to recursively clone. - * @param {Function} [customizer] The function to customize cloning. - * @returns {*} Returns the deep cloned value. - * @see _.cloneWith - * @example - * - * function customizer(value) { - * if (_.isElement(value)) { - * return value.cloneNode(true); - * } - * } - * - * var el = _.cloneDeepWith(document.body, customizer); - * - * console.log(el === document.body); - * // => false - * console.log(el.nodeName); - * // => 'BODY' - * console.log(el.childNodes.length); - * // => 20 - */ - function cloneDeepWith(value, customizer) { - customizer = typeof customizer == 'function' ? customizer : undefined; - return baseClone(value, CLONE_DEEP_FLAG | CLONE_SYMBOLS_FLAG, customizer); - } - - /** - * Checks if `object` conforms to `source` by invoking the predicate - * properties of `source` with the corresponding property values of `object`. - * - * **Note:** This method is equivalent to `_.conforms` when `source` is - * partially applied. - * - * @static - * @memberOf _ - * @since 4.14.0 - * @category Lang - * @param {Object} object The object to inspect. - * @param {Object} source The object of property predicates to conform to. - * @returns {boolean} Returns `true` if `object` conforms, else `false`. - * @example - * - * var object = { 'a': 1, 'b': 2 }; - * - * _.conformsTo(object, { 'b': function(n) { return n > 1; } }); - * // => true - * - * _.conformsTo(object, { 'b': function(n) { return n > 2; } }); - * // => false - */ - function conformsTo(object, source) { - return source == null || baseConformsTo(object, source, keys(source)); - } - - /** - * Performs a - * [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero) - * comparison between two values to determine if they are equivalent. - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Lang - * @param {*} value The value to compare. - * @param {*} other The other value to compare. - * @returns {boolean} Returns `true` if the values are equivalent, else `false`. - * @example - * - * var object = { 'a': 1 }; - * var other = { 'a': 1 }; - * - * _.eq(object, object); - * // => true - * - * _.eq(object, other); - * // => false - * - * _.eq('a', 'a'); - * // => true - * - * _.eq('a', Object('a')); - * // => false - * - * _.eq(NaN, NaN); - * // => true - */ - function eq(value, other) { - return value === other || (value !== value && other !== other); - } - - /** - * Checks if `value` is greater than `other`. - * - * @static - * @memberOf _ - * @since 3.9.0 - * @category Lang - * @param {*} value The value to compare. - * @param {*} other The other value to compare. - * @returns {boolean} Returns `true` if `value` is greater than `other`, - * else `false`. - * @see _.lt - * @example - * - * _.gt(3, 1); - * // => true - * - * _.gt(3, 3); - * // => false - * - * _.gt(1, 3); - * // => false - */ - var gt = createRelationalOperation(baseGt); - - /** - * Checks if `value` is greater than or equal to `other`. - * - * @static - * @memberOf _ - * @since 3.9.0 - * @category Lang - * @param {*} value The value to compare. - * @param {*} other The other value to compare. - * @returns {boolean} Returns `true` if `value` is greater than or equal to - * `other`, else `false`. - * @see _.lte - * @example - * - * _.gte(3, 1); - * // => true - * - * _.gte(3, 3); - * // => true - * - * _.gte(1, 3); - * // => false - */ - var gte = createRelationalOperation(function(value, other) { - return value >= other; - }); - - /** - * Checks if `value` is likely an `arguments` object. - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Lang - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` is an `arguments` object, - * else `false`. - * @example - * - * _.isArguments(function() { return arguments; }()); - * // => true - * - * _.isArguments([1, 2, 3]); - * // => false - */ - var isArguments = baseIsArguments(function() { return arguments; }()) ? baseIsArguments : function(value) { - return isObjectLike(value) && hasOwnProperty.call(value, 'callee') && - !propertyIsEnumerable.call(value, 'callee'); - }; - - /** - * Checks if `value` is classified as an `Array` object. - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Lang - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` is an array, else `false`. - * @example - * - * _.isArray([1, 2, 3]); - * // => true - * - * _.isArray(document.body.children); - * // => false - * - * _.isArray('abc'); - * // => false - * - * _.isArray(_.noop); - * // => false - */ - var isArray = Array.isArray; - - /** - * Checks if `value` is classified as an `ArrayBuffer` object. - * - * @static - * @memberOf _ - * @since 4.3.0 - * @category Lang - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` is an array buffer, else `false`. - * @example - * - * _.isArrayBuffer(new ArrayBuffer(2)); - * // => true - * - * _.isArrayBuffer(new Array(2)); - * // => false - */ - var isArrayBuffer = nodeIsArrayBuffer ? baseUnary(nodeIsArrayBuffer) : baseIsArrayBuffer; - - /** - * Checks if `value` is array-like. A value is considered array-like if it's - * not a function and has a `value.length` that's an integer greater than or - * equal to `0` and less than or equal to `Number.MAX_SAFE_INTEGER`. - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Lang - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` is array-like, else `false`. - * @example - * - * _.isArrayLike([1, 2, 3]); - * // => true - * - * _.isArrayLike(document.body.children); - * // => true - * - * _.isArrayLike('abc'); - * // => true - * - * _.isArrayLike(_.noop); - * // => false - */ - function isArrayLike(value) { - return value != null && isLength(value.length) && !isFunction(value); - } - - /** - * This method is like `_.isArrayLike` except that it also checks if `value` - * is an object. - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Lang - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` is an array-like object, - * else `false`. - * @example - * - * _.isArrayLikeObject([1, 2, 3]); - * // => true - * - * _.isArrayLikeObject(document.body.children); - * // => true - * - * _.isArrayLikeObject('abc'); - * // => false - * - * _.isArrayLikeObject(_.noop); - * // => false - */ - function isArrayLikeObject(value) { - return isObjectLike(value) && isArrayLike(value); - } - - /** - * Checks if `value` is classified as a boolean primitive or object. - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Lang - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` is a boolean, else `false`. - * @example - * - * _.isBoolean(false); - * // => true - * - * _.isBoolean(null); - * // => false - */ - function isBoolean(value) { - return value === true || value === false || - (isObjectLike(value) && baseGetTag(value) == boolTag); - } - - /** - * Checks if `value` is a buffer. - * - * @static - * @memberOf _ - * @since 4.3.0 - * @category Lang - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` is a buffer, else `false`. - * @example - * - * _.isBuffer(new Buffer(2)); - * // => true - * - * _.isBuffer(new Uint8Array(2)); - * // => false - */ - var isBuffer = nativeIsBuffer || stubFalse; - - /** - * Checks if `value` is classified as a `Date` object. - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Lang - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` is a date object, else `false`. - * @example - * - * _.isDate(new Date); - * // => true - * - * _.isDate('Mon April 23 2012'); - * // => false - */ - var isDate = nodeIsDate ? baseUnary(nodeIsDate) : baseIsDate; - - /** - * Checks if `value` is likely a DOM element. - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Lang - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` is a DOM element, else `false`. - * @example - * - * _.isElement(document.body); - * // => true - * - * _.isElement(''); - * // => false - */ - function isElement(value) { - return isObjectLike(value) && value.nodeType === 1 && !isPlainObject(value); - } - - /** - * Checks if `value` is an empty object, collection, map, or set. - * - * Objects are considered empty if they have no own enumerable string keyed - * properties. - * - * Array-like values such as `arguments` objects, arrays, buffers, strings, or - * jQuery-like collections are considered empty if they have a `length` of `0`. - * Similarly, maps and sets are considered empty if they have a `size` of `0`. - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Lang - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` is empty, else `false`. - * @example - * - * _.isEmpty(null); - * // => true - * - * _.isEmpty(true); - * // => true - * - * _.isEmpty(1); - * // => true - * - * _.isEmpty([1, 2, 3]); - * // => false - * - * _.isEmpty({ 'a': 1 }); - * // => false - */ - function isEmpty(value) { - if (value == null) { - return true; - } - if (isArrayLike(value) && - (isArray(value) || typeof value == 'string' || typeof value.splice == 'function' || - isBuffer(value) || isTypedArray(value) || isArguments(value))) { - return !value.length; - } - var tag = getTag(value); - if (tag == mapTag || tag == setTag) { - return !value.size; - } - if (isPrototype(value)) { - return !baseKeys(value).length; - } - for (var key in value) { - if (hasOwnProperty.call(value, key)) { - return false; - } - } - return true; - } - - /** - * Performs a deep comparison between two values to determine if they are - * equivalent. - * - * **Note:** This method supports comparing arrays, array buffers, booleans, - * date objects, error objects, maps, numbers, `Object` objects, regexes, - * sets, strings, symbols, and typed arrays. `Object` objects are compared - * by their own, not inherited, enumerable properties. Functions and DOM - * nodes are compared by strict equality, i.e. `===`. - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Lang - * @param {*} value The value to compare. - * @param {*} other The other value to compare. - * @returns {boolean} Returns `true` if the values are equivalent, else `false`. - * @example - * - * var object = { 'a': 1 }; - * var other = { 'a': 1 }; - * - * _.isEqual(object, other); - * // => true - * - * object === other; - * // => false - */ - function isEqual(value, other) { - return baseIsEqual(value, other); - } - - /** - * This method is like `_.isEqual` except that it accepts `customizer` which - * is invoked to compare values. If `customizer` returns `undefined`, comparisons - * are handled by the method instead. The `customizer` is invoked with up to - * six arguments: (objValue, othValue [, index|key, object, other, stack]). - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Lang - * @param {*} value The value to compare. - * @param {*} other The other value to compare. - * @param {Function} [customizer] The function to customize comparisons. - * @returns {boolean} Returns `true` if the values are equivalent, else `false`. - * @example - * - * function isGreeting(value) { - * return /^h(?:i|ello)$/.test(value); - * } - * - * function customizer(objValue, othValue) { - * if (isGreeting(objValue) && isGreeting(othValue)) { - * return true; - * } - * } - * - * var array = ['hello', 'goodbye']; - * var other = ['hi', 'goodbye']; - * - * _.isEqualWith(array, other, customizer); - * // => true - */ - function isEqualWith(value, other, customizer) { - customizer = typeof customizer == 'function' ? customizer : undefined; - var result = customizer ? customizer(value, other) : undefined; - return result === undefined ? baseIsEqual(value, other, undefined, customizer) : !!result; - } - - /** - * Checks if `value` is an `Error`, `EvalError`, `RangeError`, `ReferenceError`, - * `SyntaxError`, `TypeError`, or `URIError` object. - * - * @static - * @memberOf _ - * @since 3.0.0 - * @category Lang - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` is an error object, else `false`. - * @example - * - * _.isError(new Error); - * // => true - * - * _.isError(Error); - * // => false - */ - function isError(value) { - if (!isObjectLike(value)) { - return false; - } - var tag = baseGetTag(value); - return tag == errorTag || tag == domExcTag || - (typeof value.message == 'string' && typeof value.name == 'string' && !isPlainObject(value)); - } - - /** - * Checks if `value` is a finite primitive number. - * - * **Note:** This method is based on - * [`Number.isFinite`](https://mdn.io/Number/isFinite). - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Lang - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` is a finite number, else `false`. - * @example - * - * _.isFinite(3); - * // => true - * - * _.isFinite(Number.MIN_VALUE); - * // => true - * - * _.isFinite(Infinity); - * // => false - * - * _.isFinite('3'); - * // => false - */ - function isFinite(value) { - return typeof value == 'number' && nativeIsFinite(value); - } - - /** - * Checks if `value` is classified as a `Function` object. - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Lang - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` is a function, else `false`. - * @example - * - * _.isFunction(_); - * // => true - * - * _.isFunction(/abc/); - * // => false - */ - function isFunction(value) { - if (!isObject(value)) { - return false; - } - // The use of `Object#toString` avoids issues with the `typeof` operator - // in Safari 9 which returns 'object' for typed arrays and other constructors. - var tag = baseGetTag(value); - return tag == funcTag || tag == genTag || tag == asyncTag || tag == proxyTag; - } - - /** - * Checks if `value` is an integer. - * - * **Note:** This method is based on - * [`Number.isInteger`](https://mdn.io/Number/isInteger). - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Lang - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` is an integer, else `false`. - * @example - * - * _.isInteger(3); - * // => true - * - * _.isInteger(Number.MIN_VALUE); - * // => false - * - * _.isInteger(Infinity); - * // => false - * - * _.isInteger('3'); - * // => false - */ - function isInteger(value) { - return typeof value == 'number' && value == toInteger(value); - } - - /** - * Checks if `value` is a valid array-like length. - * - * **Note:** This method is loosely based on - * [`ToLength`](http://ecma-international.org/ecma-262/7.0/#sec-tolength). - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Lang - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` is a valid length, else `false`. - * @example - * - * _.isLength(3); - * // => true - * - * _.isLength(Number.MIN_VALUE); - * // => false - * - * _.isLength(Infinity); - * // => false - * - * _.isLength('3'); - * // => false - */ - function isLength(value) { - return typeof value == 'number' && - value > -1 && value % 1 == 0 && value <= MAX_SAFE_INTEGER; - } - - /** - * Checks if `value` is the - * [language type](http://www.ecma-international.org/ecma-262/7.0/#sec-ecmascript-language-types) - * of `Object`. (e.g. arrays, functions, objects, regexes, `new Number(0)`, and `new String('')`) - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Lang - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` is an object, else `false`. - * @example - * - * _.isObject({}); - * // => true - * - * _.isObject([1, 2, 3]); - * // => true - * - * _.isObject(_.noop); - * // => true - * - * _.isObject(null); - * // => false - */ - function isObject(value) { - var type = typeof value; - return value != null && (type == 'object' || type == 'function'); - } - - /** - * Checks if `value` is object-like. A value is object-like if it's not `null` - * and has a `typeof` result of "object". - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Lang - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` is object-like, else `false`. - * @example - * - * _.isObjectLike({}); - * // => true - * - * _.isObjectLike([1, 2, 3]); - * // => true - * - * _.isObjectLike(_.noop); - * // => false - * - * _.isObjectLike(null); - * // => false - */ - function isObjectLike(value) { - return value != null && typeof value == 'object'; - } - - /** - * Checks if `value` is classified as a `Map` object. - * - * @static - * @memberOf _ - * @since 4.3.0 - * @category Lang - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` is a map, else `false`. - * @example - * - * _.isMap(new Map); - * // => true - * - * _.isMap(new WeakMap); - * // => false - */ - var isMap = nodeIsMap ? baseUnary(nodeIsMap) : baseIsMap; - - /** - * Performs a partial deep comparison between `object` and `source` to - * determine if `object` contains equivalent property values. - * - * **Note:** This method is equivalent to `_.matches` when `source` is - * partially applied. - * - * Partial comparisons will match empty array and empty object `source` - * values against any array or object value, respectively. See `_.isEqual` - * for a list of supported value comparisons. - * - * @static - * @memberOf _ - * @since 3.0.0 - * @category Lang - * @param {Object} object The object to inspect. - * @param {Object} source The object of property values to match. - * @returns {boolean} Returns `true` if `object` is a match, else `false`. - * @example - * - * var object = { 'a': 1, 'b': 2 }; - * - * _.isMatch(object, { 'b': 2 }); - * // => true - * - * _.isMatch(object, { 'b': 1 }); - * // => false - */ - function isMatch(object, source) { - return object === source || baseIsMatch(object, source, getMatchData(source)); - } - - /** - * This method is like `_.isMatch` except that it accepts `customizer` which - * is invoked to compare values. If `customizer` returns `undefined`, comparisons - * are handled by the method instead. The `customizer` is invoked with five - * arguments: (objValue, srcValue, index|key, object, source). - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Lang - * @param {Object} object The object to inspect. - * @param {Object} source The object of property values to match. - * @param {Function} [customizer] The function to customize comparisons. - * @returns {boolean} Returns `true` if `object` is a match, else `false`. - * @example - * - * function isGreeting(value) { - * return /^h(?:i|ello)$/.test(value); - * } - * - * function customizer(objValue, srcValue) { - * if (isGreeting(objValue) && isGreeting(srcValue)) { - * return true; - * } - * } - * - * var object = { 'greeting': 'hello' }; - * var source = { 'greeting': 'hi' }; - * - * _.isMatchWith(object, source, customizer); - * // => true - */ - function isMatchWith(object, source, customizer) { - customizer = typeof customizer == 'function' ? customizer : undefined; - return baseIsMatch(object, source, getMatchData(source), customizer); - } - - /** - * Checks if `value` is `NaN`. - * - * **Note:** This method is based on - * [`Number.isNaN`](https://mdn.io/Number/isNaN) and is not the same as - * global [`isNaN`](https://mdn.io/isNaN) which returns `true` for - * `undefined` and other non-number values. - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Lang - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` is `NaN`, else `false`. - * @example - * - * _.isNaN(NaN); - * // => true - * - * _.isNaN(new Number(NaN)); - * // => true - * - * isNaN(undefined); - * // => true - * - * _.isNaN(undefined); - * // => false - */ - function isNaN(value) { - // An `NaN` primitive is the only value that is not equal to itself. - // Perform the `toStringTag` check first to avoid errors with some - // ActiveX objects in IE. - return isNumber(value) && value != +value; - } - - /** - * Checks if `value` is a pristine native function. - * - * **Note:** This method can't reliably detect native functions in the presence - * of the core-js package because core-js circumvents this kind of detection. - * Despite multiple requests, the core-js maintainer has made it clear: any - * attempt to fix the detection will be obstructed. As a result, we're left - * with little choice but to throw an error. Unfortunately, this also affects - * packages, like [babel-polyfill](https://www.npmjs.com/package/babel-polyfill), - * which rely on core-js. - * - * @static - * @memberOf _ - * @since 3.0.0 - * @category Lang - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` is a native function, - * else `false`. - * @example - * - * _.isNative(Array.prototype.push); - * // => true - * - * _.isNative(_); - * // => false - */ - function isNative(value) { - if (isMaskable(value)) { - throw new Error(CORE_ERROR_TEXT); - } - return baseIsNative(value); - } - - /** - * Checks if `value` is `null`. - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Lang - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` is `null`, else `false`. - * @example - * - * _.isNull(null); - * // => true - * - * _.isNull(void 0); - * // => false - */ - function isNull(value) { - return value === null; - } - - /** - * Checks if `value` is `null` or `undefined`. - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Lang - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` is nullish, else `false`. - * @example - * - * _.isNil(null); - * // => true - * - * _.isNil(void 0); - * // => true - * - * _.isNil(NaN); - * // => false - */ - function isNil(value) { - return value == null; - } - - /** - * Checks if `value` is classified as a `Number` primitive or object. - * - * **Note:** To exclude `Infinity`, `-Infinity`, and `NaN`, which are - * classified as numbers, use the `_.isFinite` method. - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Lang - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` is a number, else `false`. - * @example - * - * _.isNumber(3); - * // => true - * - * _.isNumber(Number.MIN_VALUE); - * // => true - * - * _.isNumber(Infinity); - * // => true - * - * _.isNumber('3'); - * // => false - */ - function isNumber(value) { - return typeof value == 'number' || - (isObjectLike(value) && baseGetTag(value) == numberTag); - } - - /** - * Checks if `value` is a plain object, that is, an object created by the - * `Object` constructor or one with a `[[Prototype]]` of `null`. - * - * @static - * @memberOf _ - * @since 0.8.0 - * @category Lang - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` is a plain object, else `false`. - * @example - * - * function Foo() { - * this.a = 1; - * } - * - * _.isPlainObject(new Foo); - * // => false - * - * _.isPlainObject([1, 2, 3]); - * // => false - * - * _.isPlainObject({ 'x': 0, 'y': 0 }); - * // => true - * - * _.isPlainObject(Object.create(null)); - * // => true - */ - function isPlainObject(value) { - if (!isObjectLike(value) || baseGetTag(value) != objectTag) { - return false; - } - var proto = getPrototype(value); - if (proto === null) { - return true; - } - var Ctor = hasOwnProperty.call(proto, 'constructor') && proto.constructor; - return typeof Ctor == 'function' && Ctor instanceof Ctor && - funcToString.call(Ctor) == objectCtorString; - } - - /** - * Checks if `value` is classified as a `RegExp` object. - * - * @static - * @memberOf _ - * @since 0.1.0 - * @category Lang - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` is a regexp, else `false`. - * @example - * - * _.isRegExp(/abc/); - * // => true - * - * _.isRegExp('/abc/'); - * // => false - */ - var isRegExp = nodeIsRegExp ? baseUnary(nodeIsRegExp) : baseIsRegExp; - - /** - * Checks if `value` is a safe integer. An integer is safe if it's an IEEE-754 - * double precision number which isn't the result of a rounded unsafe integer. - * - * **Note:** This method is based on - * [`Number.isSafeInteger`](https://mdn.io/Number/isSafeInteger). - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Lang - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` is a safe integer, else `false`. - * @example - * - * _.isSafeInteger(3); - * // => true - * - * _.isSafeInteger(Number.MIN_VALUE); - * // => false - * - * _.isSafeInteger(Infinity); - * // => false - * - * _.isSafeInteger('3'); - * // => false - */ - function isSafeInteger(value) { - return isInteger(value) && value >= -MAX_SAFE_INTEGER && value <= MAX_SAFE_INTEGER; - } - - /** - * Checks if `value` is classified as a `Set` object. - * - * @static - * @memberOf _ - * @since 4.3.0 - * @category Lang - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` is a set, else `false`. - * @example - * - * _.isSet(new Set); - * // => true - * - * _.isSet(new WeakSet); - * // => false - */ - var isSet = nodeIsSet ? baseUnary(nodeIsSet) : baseIsSet; - - /** - * Checks if `value` is classified as a `String` primitive or object. - * - * @static - * @since 0.1.0 - * @memberOf _ - * @category Lang - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` is a string, else `false`. - * @example - * - * _.isString('abc'); - * // => true - * - * _.isString(1); - * // => false - */ - function isString(value) { - return typeof value == 'string' || - (!isArray(value) && isObjectLike(value) && baseGetTag(value) == stringTag); - } - - /** - * Checks if `value` is classified as a `Symbol` primitive or object. - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Lang - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` is a symbol, else `false`. - * @example - * - * _.isSymbol(Symbol.iterator); - * // => true - * - * _.isSymbol('abc'); - * // => false - */ - function isSymbol(value) { - return typeof value == 'symbol' || - (isObjectLike(value) && baseGetTag(value) == symbolTag); - } - - /** - * Checks if `value` is classified as a typed array. - * - * @static - * @memberOf _ - * @since 3.0.0 - * @category Lang - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` is a typed array, else `false`. - * @example - * - * _.isTypedArray(new Uint8Array); - * // => true - * - * _.isTypedArray([]); - * // => false - */ - var isTypedArray = nodeIsTypedArray ? baseUnary(nodeIsTypedArray) : baseIsTypedArray; - - /** - * Checks if `value` is `undefined`. - * - * @static - * @since 0.1.0 - * @memberOf _ - * @category Lang - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` is `undefined`, else `false`. - * @example - * - * _.isUndefined(void 0); - * // => true - * - * _.isUndefined(null); - * // => false - */ - function isUndefined(value) { - return value === undefined; - } - - /** - * Checks if `value` is classified as a `WeakMap` object. - * - * @static - * @memberOf _ - * @since 4.3.0 - * @category Lang - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` is a weak map, else `false`. - * @example - * - * _.isWeakMap(new WeakMap); - * // => true - * - * _.isWeakMap(new Map); - * // => false - */ - function isWeakMap(value) { - return isObjectLike(value) && getTag(value) == weakMapTag; - } - - /** - * Checks if `value` is classified as a `WeakSet` object. - * - * @static - * @memberOf _ - * @since 4.3.0 - * @category Lang - * @param {*} value The value to check. - * @returns {boolean} Returns `true` if `value` is a weak set, else `false`. - * @example - * - * _.isWeakSet(new WeakSet); - * // => true - * - * _.isWeakSet(new Set); - * // => false - */ - function isWeakSet(value) { - return isObjectLike(value) && baseGetTag(value) == weakSetTag; - } - - /** - * Checks if `value` is less than `other`. - * - * @static - * @memberOf _ - * @since 3.9.0 - * @category Lang - * @param {*} value The value to compare. - * @param {*} other The other value to compare. - * @returns {boolean} Returns `true` if `value` is less than `other`, - * else `false`. - * @see _.gt - * @example - * - * _.lt(1, 3); - * // => true - * - * _.lt(3, 3); - * // => false - * - * _.lt(3, 1); - * // => false - */ - var lt = createRelationalOperation(baseLt); - - /** - * Checks if `value` is less than or equal to `other`. - * - * @static - * @memberOf _ - * @since 3.9.0 - * @category Lang - * @param {*} value The value to compare. - * @param {*} other The other value to compare. - * @returns {boolean} Returns `true` if `value` is less than or equal to - * `other`, else `false`. - * @see _.gte - * @example - * - * _.lte(1, 3); - * // => true - * - * _.lte(3, 3); - * // => true - * - * _.lte(3, 1); - * // => false - */ - var lte = createRelationalOperation(function(value, other) { - return value <= other; - }); - - /** - * Converts `value` to an array. - * - * @static - * @since 0.1.0 - * @memberOf _ - * @category Lang - * @param {*} value The value to convert. - * @returns {Array} Returns the converted array. - * @example - * - * _.toArray({ 'a': 1, 'b': 2 }); - * // => [1, 2] - * - * _.toArray('abc'); - * // => ['a', 'b', 'c'] - * - * _.toArray(1); - * // => [] - * - * _.toArray(null); - * // => [] - */ - function toArray(value) { - if (!value) { - return []; - } - if (isArrayLike(value)) { - return isString(value) ? stringToArray(value) : copyArray(value); - } - if (symIterator && value[symIterator]) { - return iteratorToArray(value[symIterator]()); - } - var tag = getTag(value), - func = tag == mapTag ? mapToArray : (tag == setTag ? setToArray : values); - - return func(value); - } - - /** - * Converts `value` to a finite number. - * - * @static - * @memberOf _ - * @since 4.12.0 - * @category Lang - * @param {*} value The value to convert. - * @returns {number} Returns the converted number. - * @example - * - * _.toFinite(3.2); - * // => 3.2 - * - * _.toFinite(Number.MIN_VALUE); - * // => 5e-324 - * - * _.toFinite(Infinity); - * // => 1.7976931348623157e+308 - * - * _.toFinite('3.2'); - * // => 3.2 - */ - function toFinite(value) { - if (!value) { - return value === 0 ? value : 0; - } - value = toNumber(value); - if (value === INFINITY || value === -INFINITY) { - var sign = (value < 0 ? -1 : 1); - return sign * MAX_INTEGER; - } - return value === value ? value : 0; - } - - /** - * Converts `value` to an integer. - * - * **Note:** This method is loosely based on - * [`ToInteger`](http://www.ecma-international.org/ecma-262/7.0/#sec-tointeger). - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Lang - * @param {*} value The value to convert. - * @returns {number} Returns the converted integer. - * @example - * - * _.toInteger(3.2); - * // => 3 - * - * _.toInteger(Number.MIN_VALUE); - * // => 0 - * - * _.toInteger(Infinity); - * // => 1.7976931348623157e+308 - * - * _.toInteger('3.2'); - * // => 3 - */ - function toInteger(value) { - var result = toFinite(value), - remainder = result % 1; - - return result === result ? (remainder ? result - remainder : result) : 0; - } - - /** - * Converts `value` to an integer suitable for use as the length of an - * array-like object. - * - * **Note:** This method is based on - * [`ToLength`](http://ecma-international.org/ecma-262/7.0/#sec-tolength). - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Lang - * @param {*} value The value to convert. - * @returns {number} Returns the converted integer. - * @example - * - * _.toLength(3.2); - * // => 3 - * - * _.toLength(Number.MIN_VALUE); - * // => 0 - * - * _.toLength(Infinity); - * // => 4294967295 - * - * _.toLength('3.2'); - * // => 3 - */ - function toLength(value) { - return value ? baseClamp(toInteger(value), 0, MAX_ARRAY_LENGTH) : 0; - } - - /** - * Converts `value` to a number. - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Lang - * @param {*} value The value to process. - * @returns {number} Returns the number. - * @example - * - * _.toNumber(3.2); - * // => 3.2 - * - * _.toNumber(Number.MIN_VALUE); - * // => 5e-324 - * - * _.toNumber(Infinity); - * // => Infinity - * - * _.toNumber('3.2'); - * // => 3.2 - */ - function toNumber(value) { - if (typeof value == 'number') { - return value; - } - if (isSymbol(value)) { - return NAN; - } - if (isObject(value)) { - var other = typeof value.valueOf == 'function' ? value.valueOf() : value; - value = isObject(other) ? (other + '') : other; - } - if (typeof value != 'string') { - return value === 0 ? value : +value; - } - value = value.replace(reTrim, ''); - var isBinary = reIsBinary.test(value); - return (isBinary || reIsOctal.test(value)) - ? freeParseInt(value.slice(2), isBinary ? 2 : 8) - : (reIsBadHex.test(value) ? NAN : +value); - } - - /** - * Converts `value` to a plain object flattening inherited enumerable string - * keyed properties of `value` to own properties of the plain object. - * - * @static - * @memberOf _ - * @since 3.0.0 - * @category Lang - * @param {*} value The value to convert. - * @returns {Object} Returns the converted plain object. - * @example - * - * function Foo() { - * this.b = 2; - * } - * - * Foo.prototype.c = 3; - * - * _.assign({ 'a': 1 }, new Foo); - * // => { 'a': 1, 'b': 2 } - * - * _.assign({ 'a': 1 }, _.toPlainObject(new Foo)); - * // => { 'a': 1, 'b': 2, 'c': 3 } - */ - function toPlainObject(value) { - return copyObject(value, keysIn(value)); - } - - /** - * Converts `value` to a safe integer. A safe integer can be compared and - * represented correctly. - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Lang - * @param {*} value The value to convert. - * @returns {number} Returns the converted integer. - * @example - * - * _.toSafeInteger(3.2); - * // => 3 - * - * _.toSafeInteger(Number.MIN_VALUE); - * // => 0 - * - * _.toSafeInteger(Infinity); - * // => 9007199254740991 - * - * _.toSafeInteger('3.2'); - * // => 3 - */ - function toSafeInteger(value) { - return value - ? baseClamp(toInteger(value), -MAX_SAFE_INTEGER, MAX_SAFE_INTEGER) - : (value === 0 ? value : 0); - } - - /** - * Converts `value` to a string. An empty string is returned for `null` - * and `undefined` values. The sign of `-0` is preserved. - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Lang - * @param {*} value The value to convert. - * @returns {string} Returns the converted string. - * @example - * - * _.toString(null); - * // => '' - * - * _.toString(-0); - * // => '-0' - * - * _.toString([1, 2, 3]); - * // => '1,2,3' - */ - function toString(value) { - return value == null ? '' : baseToString(value); - } - - /*------------------------------------------------------------------------*/ - - /** - * Assigns own enumerable string keyed properties of source objects to the - * destination object. Source objects are applied from left to right. - * Subsequent sources overwrite property assignments of previous sources. - * - * **Note:** This method mutates `object` and is loosely based on - * [`Object.assign`](https://mdn.io/Object/assign). - * - * @static - * @memberOf _ - * @since 0.10.0 - * @category Object - * @param {Object} object The destination object. - * @param {...Object} [sources] The source objects. - * @returns {Object} Returns `object`. - * @see _.assignIn - * @example - * - * function Foo() { - * this.a = 1; - * } - * - * function Bar() { - * this.c = 3; - * } - * - * Foo.prototype.b = 2; - * Bar.prototype.d = 4; - * - * _.assign({ 'a': 0 }, new Foo, new Bar); - * // => { 'a': 1, 'c': 3 } - */ - var assign = createAssigner(function(object, source) { - if (isPrototype(source) || isArrayLike(source)) { - copyObject(source, keys(source), object); - return; - } - for (var key in source) { - if (hasOwnProperty.call(source, key)) { - assignValue(object, key, source[key]); - } - } - }); - - /** - * This method is like `_.assign` except that it iterates over own and - * inherited source properties. - * - * **Note:** This method mutates `object`. - * - * @static - * @memberOf _ - * @since 4.0.0 - * @alias extend - * @category Object - * @param {Object} object The destination object. - * @param {...Object} [sources] The source objects. - * @returns {Object} Returns `object`. - * @see _.assign - * @example - * - * function Foo() { - * this.a = 1; - * } - * - * function Bar() { - * this.c = 3; - * } - * - * Foo.prototype.b = 2; - * Bar.prototype.d = 4; - * - * _.assignIn({ 'a': 0 }, new Foo, new Bar); - * // => { 'a': 1, 'b': 2, 'c': 3, 'd': 4 } - */ - var assignIn = createAssigner(function(object, source) { - copyObject(source, keysIn(source), object); - }); - - /** - * This method is like `_.assignIn` except that it accepts `customizer` - * which is invoked to produce the assigned values. If `customizer` returns - * `undefined`, assignment is handled by the method instead. The `customizer` - * is invoked with five arguments: (objValue, srcValue, key, object, source). - * - * **Note:** This method mutates `object`. - * - * @static - * @memberOf _ - * @since 4.0.0 - * @alias extendWith - * @category Object - * @param {Object} object The destination object. - * @param {...Object} sources The source objects. - * @param {Function} [customizer] The function to customize assigned values. - * @returns {Object} Returns `object`. - * @see _.assignWith - * @example - * - * function customizer(objValue, srcValue) { - * return _.isUndefined(objValue) ? srcValue : objValue; - * } - * - * var defaults = _.partialRight(_.assignInWith, customizer); - * - * defaults({ 'a': 1 }, { 'b': 2 }, { 'a': 3 }); - * // => { 'a': 1, 'b': 2 } - */ - var assignInWith = createAssigner(function(object, source, srcIndex, customizer) { - copyObject(source, keysIn(source), object, customizer); - }); - - /** - * This method is like `_.assign` except that it accepts `customizer` - * which is invoked to produce the assigned values. If `customizer` returns - * `undefined`, assignment is handled by the method instead. The `customizer` - * is invoked with five arguments: (objValue, srcValue, key, object, source). - * - * **Note:** This method mutates `object`. - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Object - * @param {Object} object The destination object. - * @param {...Object} sources The source objects. - * @param {Function} [customizer] The function to customize assigned values. - * @returns {Object} Returns `object`. - * @see _.assignInWith - * @example - * - * function customizer(objValue, srcValue) { - * return _.isUndefined(objValue) ? srcValue : objValue; - * } - * - * var defaults = _.partialRight(_.assignWith, customizer); - * - * defaults({ 'a': 1 }, { 'b': 2 }, { 'a': 3 }); - * // => { 'a': 1, 'b': 2 } - */ - var assignWith = createAssigner(function(object, source, srcIndex, customizer) { - copyObject(source, keys(source), object, customizer); - }); - - /** - * Creates an array of values corresponding to `paths` of `object`. - * - * @static - * @memberOf _ - * @since 1.0.0 - * @category Object - * @param {Object} object The object to iterate over. - * @param {...(string|string[])} [paths] The property paths to pick. - * @returns {Array} Returns the picked values. - * @example - * - * var object = { 'a': [{ 'b': { 'c': 3 } }, 4] }; - * - * _.at(object, ['a[0].b.c', 'a[1]']); - * // => [3, 4] - */ - var at = flatRest(baseAt); - - /** - * Creates an object that inherits from the `prototype` object. If a - * `properties` object is given, its own enumerable string keyed properties - * are assigned to the created object. - * - * @static - * @memberOf _ - * @since 2.3.0 - * @category Object - * @param {Object} prototype The object to inherit from. - * @param {Object} [properties] The properties to assign to the object. - * @returns {Object} Returns the new object. - * @example - * - * function Shape() { - * this.x = 0; - * this.y = 0; - * } - * - * function Circle() { - * Shape.call(this); - * } - * - * Circle.prototype = _.create(Shape.prototype, { - * 'constructor': Circle - * }); - * - * var circle = new Circle; - * circle instanceof Circle; - * // => true - * - * circle instanceof Shape; - * // => true - */ - function create(prototype, properties) { - var result = baseCreate(prototype); - return properties == null ? result : baseAssign(result, properties); - } - - /** - * Assigns own and inherited enumerable string keyed properties of source - * objects to the destination object for all destination properties that - * resolve to `undefined`. Source objects are applied from left to right. - * Once a property is set, additional values of the same property are ignored. - * - * **Note:** This method mutates `object`. - * - * @static - * @since 0.1.0 - * @memberOf _ - * @category Object - * @param {Object} object The destination object. - * @param {...Object} [sources] The source objects. - * @returns {Object} Returns `object`. - * @see _.defaultsDeep - * @example - * - * _.defaults({ 'a': 1 }, { 'b': 2 }, { 'a': 3 }); - * // => { 'a': 1, 'b': 2 } - */ - var defaults = baseRest(function(object, sources) { - object = Object(object); - - var index = -1; - var length = sources.length; - var guard = length > 2 ? sources[2] : undefined; - - if (guard && isIterateeCall(sources[0], sources[1], guard)) { - length = 1; - } - - while (++index < length) { - var source = sources[index]; - var props = keysIn(source); - var propsIndex = -1; - var propsLength = props.length; - - while (++propsIndex < propsLength) { - var key = props[propsIndex]; - var value = object[key]; - - if (value === undefined || - (eq(value, objectProto[key]) && !hasOwnProperty.call(object, key))) { - object[key] = source[key]; - } - } - } - - return object; - }); - - /** - * This method is like `_.defaults` except that it recursively assigns - * default properties. - * - * **Note:** This method mutates `object`. - * - * @static - * @memberOf _ - * @since 3.10.0 - * @category Object - * @param {Object} object The destination object. - * @param {...Object} [sources] The source objects. - * @returns {Object} Returns `object`. - * @see _.defaults - * @example - * - * _.defaultsDeep({ 'a': { 'b': 2 } }, { 'a': { 'b': 1, 'c': 3 } }); - * // => { 'a': { 'b': 2, 'c': 3 } } - */ - var defaultsDeep = baseRest(function(args) { - args.push(undefined, customDefaultsMerge); - return apply(mergeWith, undefined, args); - }); - - /** - * This method is like `_.find` except that it returns the key of the first - * element `predicate` returns truthy for instead of the element itself. - * - * @static - * @memberOf _ - * @since 1.1.0 - * @category Object - * @param {Object} object The object to inspect. - * @param {Function} [predicate=_.identity] The function invoked per iteration. - * @returns {string|undefined} Returns the key of the matched element, - * else `undefined`. - * @example - * - * var users = { - * 'barney': { 'age': 36, 'active': true }, - * 'fred': { 'age': 40, 'active': false }, - * 'pebbles': { 'age': 1, 'active': true } - * }; - * - * _.findKey(users, function(o) { return o.age < 40; }); - * // => 'barney' (iteration order is not guaranteed) - * - * // The `_.matches` iteratee shorthand. - * _.findKey(users, { 'age': 1, 'active': true }); - * // => 'pebbles' - * - * // The `_.matchesProperty` iteratee shorthand. - * _.findKey(users, ['active', false]); - * // => 'fred' - * - * // The `_.property` iteratee shorthand. - * _.findKey(users, 'active'); - * // => 'barney' - */ - function findKey(object, predicate) { - return baseFindKey(object, getIteratee(predicate, 3), baseForOwn); - } - - /** - * This method is like `_.findKey` except that it iterates over elements of - * a collection in the opposite order. - * - * @static - * @memberOf _ - * @since 2.0.0 - * @category Object - * @param {Object} object The object to inspect. - * @param {Function} [predicate=_.identity] The function invoked per iteration. - * @returns {string|undefined} Returns the key of the matched element, - * else `undefined`. - * @example - * - * var users = { - * 'barney': { 'age': 36, 'active': true }, - * 'fred': { 'age': 40, 'active': false }, - * 'pebbles': { 'age': 1, 'active': true } - * }; - * - * _.findLastKey(users, function(o) { return o.age < 40; }); - * // => returns 'pebbles' assuming `_.findKey` returns 'barney' - * - * // The `_.matches` iteratee shorthand. - * _.findLastKey(users, { 'age': 36, 'active': true }); - * // => 'barney' - * - * // The `_.matchesProperty` iteratee shorthand. - * _.findLastKey(users, ['active', false]); - * // => 'fred' - * - * // The `_.property` iteratee shorthand. - * _.findLastKey(users, 'active'); - * // => 'pebbles' - */ - function findLastKey(object, predicate) { - return baseFindKey(object, getIteratee(predicate, 3), baseForOwnRight); - } - - /** - * Iterates over own and inherited enumerable string keyed properties of an - * object and invokes `iteratee` for each property. The iteratee is invoked - * with three arguments: (value, key, object). Iteratee functions may exit - * iteration early by explicitly returning `false`. - * - * @static - * @memberOf _ - * @since 0.3.0 - * @category Object - * @param {Object} object The object to iterate over. - * @param {Function} [iteratee=_.identity] The function invoked per iteration. - * @returns {Object} Returns `object`. - * @see _.forInRight - * @example - * - * function Foo() { - * this.a = 1; - * this.b = 2; - * } - * - * Foo.prototype.c = 3; - * - * _.forIn(new Foo, function(value, key) { - * console.log(key); - * }); - * // => Logs 'a', 'b', then 'c' (iteration order is not guaranteed). - */ - function forIn(object, iteratee) { - return object == null - ? object - : baseFor(object, getIteratee(iteratee, 3), keysIn); - } - - /** - * This method is like `_.forIn` except that it iterates over properties of - * `object` in the opposite order. - * - * @static - * @memberOf _ - * @since 2.0.0 - * @category Object - * @param {Object} object The object to iterate over. - * @param {Function} [iteratee=_.identity] The function invoked per iteration. - * @returns {Object} Returns `object`. - * @see _.forIn - * @example - * - * function Foo() { - * this.a = 1; - * this.b = 2; - * } - * - * Foo.prototype.c = 3; - * - * _.forInRight(new Foo, function(value, key) { - * console.log(key); - * }); - * // => Logs 'c', 'b', then 'a' assuming `_.forIn` logs 'a', 'b', then 'c'. - */ - function forInRight(object, iteratee) { - return object == null - ? object - : baseForRight(object, getIteratee(iteratee, 3), keysIn); - } - - /** - * Iterates over own enumerable string keyed properties of an object and - * invokes `iteratee` for each property. The iteratee is invoked with three - * arguments: (value, key, object). Iteratee functions may exit iteration - * early by explicitly returning `false`. - * - * @static - * @memberOf _ - * @since 0.3.0 - * @category Object - * @param {Object} object The object to iterate over. - * @param {Function} [iteratee=_.identity] The function invoked per iteration. - * @returns {Object} Returns `object`. - * @see _.forOwnRight - * @example - * - * function Foo() { - * this.a = 1; - * this.b = 2; - * } - * - * Foo.prototype.c = 3; - * - * _.forOwn(new Foo, function(value, key) { - * console.log(key); - * }); - * // => Logs 'a' then 'b' (iteration order is not guaranteed). - */ - function forOwn(object, iteratee) { - return object && baseForOwn(object, getIteratee(iteratee, 3)); - } - - /** - * This method is like `_.forOwn` except that it iterates over properties of - * `object` in the opposite order. - * - * @static - * @memberOf _ - * @since 2.0.0 - * @category Object - * @param {Object} object The object to iterate over. - * @param {Function} [iteratee=_.identity] The function invoked per iteration. - * @returns {Object} Returns `object`. - * @see _.forOwn - * @example - * - * function Foo() { - * this.a = 1; - * this.b = 2; - * } - * - * Foo.prototype.c = 3; - * - * _.forOwnRight(new Foo, function(value, key) { - * console.log(key); - * }); - * // => Logs 'b' then 'a' assuming `_.forOwn` logs 'a' then 'b'. - */ - function forOwnRight(object, iteratee) { - return object && baseForOwnRight(object, getIteratee(iteratee, 3)); - } - - /** - * Creates an array of function property names from own enumerable properties - * of `object`. - * - * @static - * @since 0.1.0 - * @memberOf _ - * @category Object - * @param {Object} object The object to inspect. - * @returns {Array} Returns the function names. - * @see _.functionsIn - * @example - * - * function Foo() { - * this.a = _.constant('a'); - * this.b = _.constant('b'); - * } - * - * Foo.prototype.c = _.constant('c'); - * - * _.functions(new Foo); - * // => ['a', 'b'] - */ - function functions(object) { - return object == null ? [] : baseFunctions(object, keys(object)); - } - - /** - * Creates an array of function property names from own and inherited - * enumerable properties of `object`. - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Object - * @param {Object} object The object to inspect. - * @returns {Array} Returns the function names. - * @see _.functions - * @example - * - * function Foo() { - * this.a = _.constant('a'); - * this.b = _.constant('b'); - * } - * - * Foo.prototype.c = _.constant('c'); - * - * _.functionsIn(new Foo); - * // => ['a', 'b', 'c'] - */ - function functionsIn(object) { - return object == null ? [] : baseFunctions(object, keysIn(object)); - } - - /** - * Gets the value at `path` of `object`. If the resolved value is - * `undefined`, the `defaultValue` is returned in its place. - * - * @static - * @memberOf _ - * @since 3.7.0 - * @category Object - * @param {Object} object The object to query. - * @param {Array|string} path The path of the property to get. - * @param {*} [defaultValue] The value returned for `undefined` resolved values. - * @returns {*} Returns the resolved value. - * @example - * - * var object = { 'a': [{ 'b': { 'c': 3 } }] }; - * - * _.get(object, 'a[0].b.c'); - * // => 3 - * - * _.get(object, ['a', '0', 'b', 'c']); - * // => 3 - * - * _.get(object, 'a.b.c', 'default'); - * // => 'default' - */ - function get(object, path, defaultValue) { - var result = object == null ? undefined : baseGet(object, path); - return result === undefined ? defaultValue : result; - } - - /** - * Checks if `path` is a direct property of `object`. - * - * @static - * @since 0.1.0 - * @memberOf _ - * @category Object - * @param {Object} object The object to query. - * @param {Array|string} path The path to check. - * @returns {boolean} Returns `true` if `path` exists, else `false`. - * @example - * - * var object = { 'a': { 'b': 2 } }; - * var other = _.create({ 'a': _.create({ 'b': 2 }) }); - * - * _.has(object, 'a'); - * // => true - * - * _.has(object, 'a.b'); - * // => true - * - * _.has(object, ['a', 'b']); - * // => true - * - * _.has(other, 'a'); - * // => false - */ - function has(object, path) { - return object != null && hasPath(object, path, baseHas); - } - - /** - * Checks if `path` is a direct or inherited property of `object`. - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Object - * @param {Object} object The object to query. - * @param {Array|string} path The path to check. - * @returns {boolean} Returns `true` if `path` exists, else `false`. - * @example - * - * var object = _.create({ 'a': _.create({ 'b': 2 }) }); - * - * _.hasIn(object, 'a'); - * // => true - * - * _.hasIn(object, 'a.b'); - * // => true - * - * _.hasIn(object, ['a', 'b']); - * // => true - * - * _.hasIn(object, 'b'); - * // => false - */ - function hasIn(object, path) { - return object != null && hasPath(object, path, baseHasIn); - } - - /** - * Creates an object composed of the inverted keys and values of `object`. - * If `object` contains duplicate values, subsequent values overwrite - * property assignments of previous values. - * - * @static - * @memberOf _ - * @since 0.7.0 - * @category Object - * @param {Object} object The object to invert. - * @returns {Object} Returns the new inverted object. - * @example - * - * var object = { 'a': 1, 'b': 2, 'c': 1 }; - * - * _.invert(object); - * // => { '1': 'c', '2': 'b' } - */ - var invert = createInverter(function(result, value, key) { - if (value != null && - typeof value.toString != 'function') { - value = nativeObjectToString.call(value); - } - - result[value] = key; - }, constant(identity)); - - /** - * This method is like `_.invert` except that the inverted object is generated - * from the results of running each element of `object` thru `iteratee`. The - * corresponding inverted value of each inverted key is an array of keys - * responsible for generating the inverted value. The iteratee is invoked - * with one argument: (value). - * - * @static - * @memberOf _ - * @since 4.1.0 - * @category Object - * @param {Object} object The object to invert. - * @param {Function} [iteratee=_.identity] The iteratee invoked per element. - * @returns {Object} Returns the new inverted object. - * @example - * - * var object = { 'a': 1, 'b': 2, 'c': 1 }; - * - * _.invertBy(object); - * // => { '1': ['a', 'c'], '2': ['b'] } - * - * _.invertBy(object, function(value) { - * return 'group' + value; - * }); - * // => { 'group1': ['a', 'c'], 'group2': ['b'] } - */ - var invertBy = createInverter(function(result, value, key) { - if (value != null && - typeof value.toString != 'function') { - value = nativeObjectToString.call(value); - } - - if (hasOwnProperty.call(result, value)) { - result[value].push(key); - } else { - result[value] = [key]; - } - }, getIteratee); - - /** - * Invokes the method at `path` of `object`. - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Object - * @param {Object} object The object to query. - * @param {Array|string} path The path of the method to invoke. - * @param {...*} [args] The arguments to invoke the method with. - * @returns {*} Returns the result of the invoked method. - * @example - * - * var object = { 'a': [{ 'b': { 'c': [1, 2, 3, 4] } }] }; - * - * _.invoke(object, 'a[0].b.c.slice', 1, 3); - * // => [2, 3] - */ - var invoke = baseRest(baseInvoke); - - /** - * Creates an array of the own enumerable property names of `object`. - * - * **Note:** Non-object values are coerced to objects. See the - * [ES spec](http://ecma-international.org/ecma-262/7.0/#sec-object.keys) - * for more details. - * - * @static - * @since 0.1.0 - * @memberOf _ - * @category Object - * @param {Object} object The object to query. - * @returns {Array} Returns the array of property names. - * @example - * - * function Foo() { - * this.a = 1; - * this.b = 2; - * } - * - * Foo.prototype.c = 3; - * - * _.keys(new Foo); - * // => ['a', 'b'] (iteration order is not guaranteed) - * - * _.keys('hi'); - * // => ['0', '1'] - */ - function keys(object) { - return isArrayLike(object) ? arrayLikeKeys(object) : baseKeys(object); - } - - /** - * Creates an array of the own and inherited enumerable property names of `object`. - * - * **Note:** Non-object values are coerced to objects. - * - * @static - * @memberOf _ - * @since 3.0.0 - * @category Object - * @param {Object} object The object to query. - * @returns {Array} Returns the array of property names. - * @example - * - * function Foo() { - * this.a = 1; - * this.b = 2; - * } - * - * Foo.prototype.c = 3; - * - * _.keysIn(new Foo); - * // => ['a', 'b', 'c'] (iteration order is not guaranteed) - */ - function keysIn(object) { - return isArrayLike(object) ? arrayLikeKeys(object, true) : baseKeysIn(object); - } - - /** - * The opposite of `_.mapValues`; this method creates an object with the - * same values as `object` and keys generated by running each own enumerable - * string keyed property of `object` thru `iteratee`. The iteratee is invoked - * with three arguments: (value, key, object). - * - * @static - * @memberOf _ - * @since 3.8.0 - * @category Object - * @param {Object} object The object to iterate over. - * @param {Function} [iteratee=_.identity] The function invoked per iteration. - * @returns {Object} Returns the new mapped object. - * @see _.mapValues - * @example - * - * _.mapKeys({ 'a': 1, 'b': 2 }, function(value, key) { - * return key + value; - * }); - * // => { 'a1': 1, 'b2': 2 } - */ - function mapKeys(object, iteratee) { - var result = {}; - iteratee = getIteratee(iteratee, 3); - - baseForOwn(object, function(value, key, object) { - baseAssignValue(result, iteratee(value, key, object), value); - }); - return result; - } - - /** - * Creates an object with the same keys as `object` and values generated - * by running each own enumerable string keyed property of `object` thru - * `iteratee`. The iteratee is invoked with three arguments: - * (value, key, object). - * - * @static - * @memberOf _ - * @since 2.4.0 - * @category Object - * @param {Object} object The object to iterate over. - * @param {Function} [iteratee=_.identity] The function invoked per iteration. - * @returns {Object} Returns the new mapped object. - * @see _.mapKeys - * @example - * - * var users = { - * 'fred': { 'user': 'fred', 'age': 40 }, - * 'pebbles': { 'user': 'pebbles', 'age': 1 } - * }; - * - * _.mapValues(users, function(o) { return o.age; }); - * // => { 'fred': 40, 'pebbles': 1 } (iteration order is not guaranteed) - * - * // The `_.property` iteratee shorthand. - * _.mapValues(users, 'age'); - * // => { 'fred': 40, 'pebbles': 1 } (iteration order is not guaranteed) - */ - function mapValues(object, iteratee) { - var result = {}; - iteratee = getIteratee(iteratee, 3); - - baseForOwn(object, function(value, key, object) { - baseAssignValue(result, key, iteratee(value, key, object)); - }); - return result; - } - - /** - * This method is like `_.assign` except that it recursively merges own and - * inherited enumerable string keyed properties of source objects into the - * destination object. Source properties that resolve to `undefined` are - * skipped if a destination value exists. Array and plain object properties - * are merged recursively. Other objects and value types are overridden by - * assignment. Source objects are applied from left to right. Subsequent - * sources overwrite property assignments of previous sources. - * - * **Note:** This method mutates `object`. - * - * @static - * @memberOf _ - * @since 0.5.0 - * @category Object - * @param {Object} object The destination object. - * @param {...Object} [sources] The source objects. - * @returns {Object} Returns `object`. - * @example - * - * var object = { - * 'a': [{ 'b': 2 }, { 'd': 4 }] - * }; - * - * var other = { - * 'a': [{ 'c': 3 }, { 'e': 5 }] - * }; - * - * _.merge(object, other); - * // => { 'a': [{ 'b': 2, 'c': 3 }, { 'd': 4, 'e': 5 }] } - */ - var merge = createAssigner(function(object, source, srcIndex) { - baseMerge(object, source, srcIndex); - }); - - /** - * This method is like `_.merge` except that it accepts `customizer` which - * is invoked to produce the merged values of the destination and source - * properties. If `customizer` returns `undefined`, merging is handled by the - * method instead. The `customizer` is invoked with six arguments: - * (objValue, srcValue, key, object, source, stack). - * - * **Note:** This method mutates `object`. - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Object - * @param {Object} object The destination object. - * @param {...Object} sources The source objects. - * @param {Function} customizer The function to customize assigned values. - * @returns {Object} Returns `object`. - * @example - * - * function customizer(objValue, srcValue) { - * if (_.isArray(objValue)) { - * return objValue.concat(srcValue); - * } - * } - * - * var object = { 'a': [1], 'b': [2] }; - * var other = { 'a': [3], 'b': [4] }; - * - * _.mergeWith(object, other, customizer); - * // => { 'a': [1, 3], 'b': [2, 4] } - */ - var mergeWith = createAssigner(function(object, source, srcIndex, customizer) { - baseMerge(object, source, srcIndex, customizer); - }); - - /** - * The opposite of `_.pick`; this method creates an object composed of the - * own and inherited enumerable property paths of `object` that are not omitted. - * - * **Note:** This method is considerably slower than `_.pick`. - * - * @static - * @since 0.1.0 - * @memberOf _ - * @category Object - * @param {Object} object The source object. - * @param {...(string|string[])} [paths] The property paths to omit. - * @returns {Object} Returns the new object. - * @example - * - * var object = { 'a': 1, 'b': '2', 'c': 3 }; - * - * _.omit(object, ['a', 'c']); - * // => { 'b': '2' } - */ - var omit = flatRest(function(object, paths) { - var result = {}; - if (object == null) { - return result; - } - var isDeep = false; - paths = arrayMap(paths, function(path) { - path = castPath(path, object); - isDeep || (isDeep = path.length > 1); - return path; - }); - copyObject(object, getAllKeysIn(object), result); - if (isDeep) { - result = baseClone(result, CLONE_DEEP_FLAG | CLONE_FLAT_FLAG | CLONE_SYMBOLS_FLAG, customOmitClone); - } - var length = paths.length; - while (length--) { - baseUnset(result, paths[length]); - } - return result; - }); - - /** - * The opposite of `_.pickBy`; this method creates an object composed of - * the own and inherited enumerable string keyed properties of `object` that - * `predicate` doesn't return truthy for. The predicate is invoked with two - * arguments: (value, key). - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Object - * @param {Object} object The source object. - * @param {Function} [predicate=_.identity] The function invoked per property. - * @returns {Object} Returns the new object. - * @example - * - * var object = { 'a': 1, 'b': '2', 'c': 3 }; - * - * _.omitBy(object, _.isNumber); - * // => { 'b': '2' } - */ - function omitBy(object, predicate) { - return pickBy(object, negate(getIteratee(predicate))); - } - - /** - * Creates an object composed of the picked `object` properties. - * - * @static - * @since 0.1.0 - * @memberOf _ - * @category Object - * @param {Object} object The source object. - * @param {...(string|string[])} [paths] The property paths to pick. - * @returns {Object} Returns the new object. - * @example - * - * var object = { 'a': 1, 'b': '2', 'c': 3 }; - * - * _.pick(object, ['a', 'c']); - * // => { 'a': 1, 'c': 3 } - */ - var pick = flatRest(function(object, paths) { - return object == null ? {} : basePick(object, paths); - }); - - /** - * Creates an object composed of the `object` properties `predicate` returns - * truthy for. The predicate is invoked with two arguments: (value, key). - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Object - * @param {Object} object The source object. - * @param {Function} [predicate=_.identity] The function invoked per property. - * @returns {Object} Returns the new object. - * @example - * - * var object = { 'a': 1, 'b': '2', 'c': 3 }; - * - * _.pickBy(object, _.isNumber); - * // => { 'a': 1, 'c': 3 } - */ - function pickBy(object, predicate) { - if (object == null) { - return {}; - } - var props = arrayMap(getAllKeysIn(object), function(prop) { - return [prop]; - }); - predicate = getIteratee(predicate); - return basePickBy(object, props, function(value, path) { - return predicate(value, path[0]); - }); - } - - /** - * This method is like `_.get` except that if the resolved value is a - * function it's invoked with the `this` binding of its parent object and - * its result is returned. - * - * @static - * @since 0.1.0 - * @memberOf _ - * @category Object - * @param {Object} object The object to query. - * @param {Array|string} path The path of the property to resolve. - * @param {*} [defaultValue] The value returned for `undefined` resolved values. - * @returns {*} Returns the resolved value. - * @example - * - * var object = { 'a': [{ 'b': { 'c1': 3, 'c2': _.constant(4) } }] }; - * - * _.result(object, 'a[0].b.c1'); - * // => 3 - * - * _.result(object, 'a[0].b.c2'); - * // => 4 - * - * _.result(object, 'a[0].b.c3', 'default'); - * // => 'default' - * - * _.result(object, 'a[0].b.c3', _.constant('default')); - * // => 'default' - */ - function result(object, path, defaultValue) { - path = castPath(path, object); - - var index = -1, - length = path.length; - - // Ensure the loop is entered when path is empty. - if (!length) { - length = 1; - object = undefined; - } - while (++index < length) { - var value = object == null ? undefined : object[toKey(path[index])]; - if (value === undefined) { - index = length; - value = defaultValue; - } - object = isFunction(value) ? value.call(object) : value; - } - return object; - } - - /** - * Sets the value at `path` of `object`. If a portion of `path` doesn't exist, - * it's created. Arrays are created for missing index properties while objects - * are created for all other missing properties. Use `_.setWith` to customize - * `path` creation. - * - * **Note:** This method mutates `object`. - * - * @static - * @memberOf _ - * @since 3.7.0 - * @category Object - * @param {Object} object The object to modify. - * @param {Array|string} path The path of the property to set. - * @param {*} value The value to set. - * @returns {Object} Returns `object`. - * @example - * - * var object = { 'a': [{ 'b': { 'c': 3 } }] }; - * - * _.set(object, 'a[0].b.c', 4); - * console.log(object.a[0].b.c); - * // => 4 - * - * _.set(object, ['x', '0', 'y', 'z'], 5); - * console.log(object.x[0].y.z); - * // => 5 - */ - function set(object, path, value) { - return object == null ? object : baseSet(object, path, value); - } - - /** - * This method is like `_.set` except that it accepts `customizer` which is - * invoked to produce the objects of `path`. If `customizer` returns `undefined` - * path creation is handled by the method instead. The `customizer` is invoked - * with three arguments: (nsValue, key, nsObject). - * - * **Note:** This method mutates `object`. - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Object - * @param {Object} object The object to modify. - * @param {Array|string} path The path of the property to set. - * @param {*} value The value to set. - * @param {Function} [customizer] The function to customize assigned values. - * @returns {Object} Returns `object`. - * @example - * - * var object = {}; - * - * _.setWith(object, '[0][1]', 'a', Object); - * // => { '0': { '1': 'a' } } - */ - function setWith(object, path, value, customizer) { - customizer = typeof customizer == 'function' ? customizer : undefined; - return object == null ? object : baseSet(object, path, value, customizer); - } - - /** - * Creates an array of own enumerable string keyed-value pairs for `object` - * which can be consumed by `_.fromPairs`. If `object` is a map or set, its - * entries are returned. - * - * @static - * @memberOf _ - * @since 4.0.0 - * @alias entries - * @category Object - * @param {Object} object The object to query. - * @returns {Array} Returns the key-value pairs. - * @example - * - * function Foo() { - * this.a = 1; - * this.b = 2; - * } - * - * Foo.prototype.c = 3; - * - * _.toPairs(new Foo); - * // => [['a', 1], ['b', 2]] (iteration order is not guaranteed) - */ - var toPairs = createToPairs(keys); - - /** - * Creates an array of own and inherited enumerable string keyed-value pairs - * for `object` which can be consumed by `_.fromPairs`. If `object` is a map - * or set, its entries are returned. - * - * @static - * @memberOf _ - * @since 4.0.0 - * @alias entriesIn - * @category Object - * @param {Object} object The object to query. - * @returns {Array} Returns the key-value pairs. - * @example - * - * function Foo() { - * this.a = 1; - * this.b = 2; - * } - * - * Foo.prototype.c = 3; - * - * _.toPairsIn(new Foo); - * // => [['a', 1], ['b', 2], ['c', 3]] (iteration order is not guaranteed) - */ - var toPairsIn = createToPairs(keysIn); - - /** - * An alternative to `_.reduce`; this method transforms `object` to a new - * `accumulator` object which is the result of running each of its own - * enumerable string keyed properties thru `iteratee`, with each invocation - * potentially mutating the `accumulator` object. If `accumulator` is not - * provided, a new object with the same `[[Prototype]]` will be used. The - * iteratee is invoked with four arguments: (accumulator, value, key, object). - * Iteratee functions may exit iteration early by explicitly returning `false`. - * - * @static - * @memberOf _ - * @since 1.3.0 - * @category Object - * @param {Object} object The object to iterate over. - * @param {Function} [iteratee=_.identity] The function invoked per iteration. - * @param {*} [accumulator] The custom accumulator value. - * @returns {*} Returns the accumulated value. - * @example - * - * _.transform([2, 3, 4], function(result, n) { - * result.push(n *= n); - * return n % 2 == 0; - * }, []); - * // => [4, 9] - * - * _.transform({ 'a': 1, 'b': 2, 'c': 1 }, function(result, value, key) { - * (result[value] || (result[value] = [])).push(key); - * }, {}); - * // => { '1': ['a', 'c'], '2': ['b'] } - */ - function transform(object, iteratee, accumulator) { - var isArr = isArray(object), - isArrLike = isArr || isBuffer(object) || isTypedArray(object); - - iteratee = getIteratee(iteratee, 4); - if (accumulator == null) { - var Ctor = object && object.constructor; - if (isArrLike) { - accumulator = isArr ? new Ctor : []; - } - else if (isObject(object)) { - accumulator = isFunction(Ctor) ? baseCreate(getPrototype(object)) : {}; - } - else { - accumulator = {}; - } - } - (isArrLike ? arrayEach : baseForOwn)(object, function(value, index, object) { - return iteratee(accumulator, value, index, object); - }); - return accumulator; - } - - /** - * Removes the property at `path` of `object`. - * - * **Note:** This method mutates `object`. - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Object - * @param {Object} object The object to modify. - * @param {Array|string} path The path of the property to unset. - * @returns {boolean} Returns `true` if the property is deleted, else `false`. - * @example - * - * var object = { 'a': [{ 'b': { 'c': 7 } }] }; - * _.unset(object, 'a[0].b.c'); - * // => true - * - * console.log(object); - * // => { 'a': [{ 'b': {} }] }; - * - * _.unset(object, ['a', '0', 'b', 'c']); - * // => true - * - * console.log(object); - * // => { 'a': [{ 'b': {} }] }; - */ - function unset(object, path) { - return object == null ? true : baseUnset(object, path); - } - - /** - * This method is like `_.set` except that accepts `updater` to produce the - * value to set. Use `_.updateWith` to customize `path` creation. The `updater` - * is invoked with one argument: (value). - * - * **Note:** This method mutates `object`. - * - * @static - * @memberOf _ - * @since 4.6.0 - * @category Object - * @param {Object} object The object to modify. - * @param {Array|string} path The path of the property to set. - * @param {Function} updater The function to produce the updated value. - * @returns {Object} Returns `object`. - * @example - * - * var object = { 'a': [{ 'b': { 'c': 3 } }] }; - * - * _.update(object, 'a[0].b.c', function(n) { return n * n; }); - * console.log(object.a[0].b.c); - * // => 9 - * - * _.update(object, 'x[0].y.z', function(n) { return n ? n + 1 : 0; }); - * console.log(object.x[0].y.z); - * // => 0 - */ - function update(object, path, updater) { - return object == null ? object : baseUpdate(object, path, castFunction(updater)); - } - - /** - * This method is like `_.update` except that it accepts `customizer` which is - * invoked to produce the objects of `path`. If `customizer` returns `undefined` - * path creation is handled by the method instead. The `customizer` is invoked - * with three arguments: (nsValue, key, nsObject). - * - * **Note:** This method mutates `object`. - * - * @static - * @memberOf _ - * @since 4.6.0 - * @category Object - * @param {Object} object The object to modify. - * @param {Array|string} path The path of the property to set. - * @param {Function} updater The function to produce the updated value. - * @param {Function} [customizer] The function to customize assigned values. - * @returns {Object} Returns `object`. - * @example - * - * var object = {}; - * - * _.updateWith(object, '[0][1]', _.constant('a'), Object); - * // => { '0': { '1': 'a' } } - */ - function updateWith(object, path, updater, customizer) { - customizer = typeof customizer == 'function' ? customizer : undefined; - return object == null ? object : baseUpdate(object, path, castFunction(updater), customizer); - } - - /** - * Creates an array of the own enumerable string keyed property values of `object`. - * - * **Note:** Non-object values are coerced to objects. - * - * @static - * @since 0.1.0 - * @memberOf _ - * @category Object - * @param {Object} object The object to query. - * @returns {Array} Returns the array of property values. - * @example - * - * function Foo() { - * this.a = 1; - * this.b = 2; - * } - * - * Foo.prototype.c = 3; - * - * _.values(new Foo); - * // => [1, 2] (iteration order is not guaranteed) - * - * _.values('hi'); - * // => ['h', 'i'] - */ - function values(object) { - return object == null ? [] : baseValues(object, keys(object)); - } - - /** - * Creates an array of the own and inherited enumerable string keyed property - * values of `object`. - * - * **Note:** Non-object values are coerced to objects. - * - * @static - * @memberOf _ - * @since 3.0.0 - * @category Object - * @param {Object} object The object to query. - * @returns {Array} Returns the array of property values. - * @example - * - * function Foo() { - * this.a = 1; - * this.b = 2; - * } - * - * Foo.prototype.c = 3; - * - * _.valuesIn(new Foo); - * // => [1, 2, 3] (iteration order is not guaranteed) - */ - function valuesIn(object) { - return object == null ? [] : baseValues(object, keysIn(object)); - } - - /*------------------------------------------------------------------------*/ - - /** - * Clamps `number` within the inclusive `lower` and `upper` bounds. - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category Number - * @param {number} number The number to clamp. - * @param {number} [lower] The lower bound. - * @param {number} upper The upper bound. - * @returns {number} Returns the clamped number. - * @example - * - * _.clamp(-10, -5, 5); - * // => -5 - * - * _.clamp(10, -5, 5); - * // => 5 - */ - function clamp(number, lower, upper) { - if (upper === undefined) { - upper = lower; - lower = undefined; - } - if (upper !== undefined) { - upper = toNumber(upper); - upper = upper === upper ? upper : 0; - } - if (lower !== undefined) { - lower = toNumber(lower); - lower = lower === lower ? lower : 0; - } - return baseClamp(toNumber(number), lower, upper); - } - - /** - * Checks if `n` is between `start` and up to, but not including, `end`. If - * `end` is not specified, it's set to `start` with `start` then set to `0`. - * If `start` is greater than `end` the params are swapped to support - * negative ranges. - * - * @static - * @memberOf _ - * @since 3.3.0 - * @category Number - * @param {number} number The number to check. - * @param {number} [start=0] The start of the range. - * @param {number} end The end of the range. - * @returns {boolean} Returns `true` if `number` is in the range, else `false`. - * @see _.range, _.rangeRight - * @example - * - * _.inRange(3, 2, 4); - * // => true - * - * _.inRange(4, 8); - * // => true - * - * _.inRange(4, 2); - * // => false - * - * _.inRange(2, 2); - * // => false - * - * _.inRange(1.2, 2); - * // => true - * - * _.inRange(5.2, 4); - * // => false - * - * _.inRange(-3, -2, -6); - * // => true - */ - function inRange(number, start, end) { - start = toFinite(start); - if (end === undefined) { - end = start; - start = 0; - } else { - end = toFinite(end); - } - number = toNumber(number); - return baseInRange(number, start, end); - } - - /** - * Produces a random number between the inclusive `lower` and `upper` bounds. - * If only one argument is provided a number between `0` and the given number - * is returned. If `floating` is `true`, or either `lower` or `upper` are - * floats, a floating-point number is returned instead of an integer. - * - * **Note:** JavaScript follows the IEEE-754 standard for resolving - * floating-point values which can produce unexpected results. - * - * @static - * @memberOf _ - * @since 0.7.0 - * @category Number - * @param {number} [lower=0] The lower bound. - * @param {number} [upper=1] The upper bound. - * @param {boolean} [floating] Specify returning a floating-point number. - * @returns {number} Returns the random number. - * @example - * - * _.random(0, 5); - * // => an integer between 0 and 5 - * - * _.random(5); - * // => also an integer between 0 and 5 - * - * _.random(5, true); - * // => a floating-point number between 0 and 5 - * - * _.random(1.2, 5.2); - * // => a floating-point number between 1.2 and 5.2 - */ - function random(lower, upper, floating) { - if (floating && typeof floating != 'boolean' && isIterateeCall(lower, upper, floating)) { - upper = floating = undefined; - } - if (floating === undefined) { - if (typeof upper == 'boolean') { - floating = upper; - upper = undefined; - } - else if (typeof lower == 'boolean') { - floating = lower; - lower = undefined; - } - } - if (lower === undefined && upper === undefined) { - lower = 0; - upper = 1; - } - else { - lower = toFinite(lower); - if (upper === undefined) { - upper = lower; - lower = 0; - } else { - upper = toFinite(upper); - } - } - if (lower > upper) { - var temp = lower; - lower = upper; - upper = temp; - } - if (floating || lower % 1 || upper % 1) { - var rand = nativeRandom(); - return nativeMin(lower + (rand * (upper - lower + freeParseFloat('1e-' + ((rand + '').length - 1)))), upper); - } - return baseRandom(lower, upper); - } - - /*------------------------------------------------------------------------*/ - - /** - * Converts `string` to [camel case](https://en.wikipedia.org/wiki/CamelCase). - * - * @static - * @memberOf _ - * @since 3.0.0 - * @category String - * @param {string} [string=''] The string to convert. - * @returns {string} Returns the camel cased string. - * @example - * - * _.camelCase('Foo Bar'); - * // => 'fooBar' - * - * _.camelCase('--foo-bar--'); - * // => 'fooBar' - * - * _.camelCase('__FOO_BAR__'); - * // => 'fooBar' - */ - var camelCase = createCompounder(function(result, word, index) { - word = word.toLowerCase(); - return result + (index ? capitalize(word) : word); - }); - - /** - * Converts the first character of `string` to upper case and the remaining - * to lower case. - * - * @static - * @memberOf _ - * @since 3.0.0 - * @category String - * @param {string} [string=''] The string to capitalize. - * @returns {string} Returns the capitalized string. - * @example - * - * _.capitalize('FRED'); - * // => 'Fred' - */ - function capitalize(string) { - return upperFirst(toString(string).toLowerCase()); - } - - /** - * Deburrs `string` by converting - * [Latin-1 Supplement](https://en.wikipedia.org/wiki/Latin-1_Supplement_(Unicode_block)#Character_table) - * and [Latin Extended-A](https://en.wikipedia.org/wiki/Latin_Extended-A) - * letters to basic Latin letters and removing - * [combining diacritical marks](https://en.wikipedia.org/wiki/Combining_Diacritical_Marks). - * - * @static - * @memberOf _ - * @since 3.0.0 - * @category String - * @param {string} [string=''] The string to deburr. - * @returns {string} Returns the deburred string. - * @example - * - * _.deburr('déjà vu'); - * // => 'deja vu' - */ - function deburr(string) { - string = toString(string); - return string && string.replace(reLatin, deburrLetter).replace(reComboMark, ''); - } - - /** - * Checks if `string` ends with the given target string. - * - * @static - * @memberOf _ - * @since 3.0.0 - * @category String - * @param {string} [string=''] The string to inspect. - * @param {string} [target] The string to search for. - * @param {number} [position=string.length] The position to search up to. - * @returns {boolean} Returns `true` if `string` ends with `target`, - * else `false`. - * @example - * - * _.endsWith('abc', 'c'); - * // => true - * - * _.endsWith('abc', 'b'); - * // => false - * - * _.endsWith('abc', 'b', 2); - * // => true - */ - function endsWith(string, target, position) { - string = toString(string); - target = baseToString(target); - - var length = string.length; - position = position === undefined - ? length - : baseClamp(toInteger(position), 0, length); - - var end = position; - position -= target.length; - return position >= 0 && string.slice(position, end) == target; - } - - /** - * Converts the characters "&", "<", ">", '"', and "'" in `string` to their - * corresponding HTML entities. - * - * **Note:** No other characters are escaped. To escape additional - * characters use a third-party library like [_he_](https://mths.be/he). - * - * Though the ">" character is escaped for symmetry, characters like - * ">" and "/" don't need escaping in HTML and have no special meaning - * unless they're part of a tag or unquoted attribute value. See - * [Mathias Bynens's article](https://mathiasbynens.be/notes/ambiguous-ampersands) - * (under "semi-related fun fact") for more details. - * - * When working with HTML you should always - * [quote attribute values](http://wonko.com/post/html-escaping) to reduce - * XSS vectors. - * - * @static - * @since 0.1.0 - * @memberOf _ - * @category String - * @param {string} [string=''] The string to escape. - * @returns {string} Returns the escaped string. - * @example - * - * _.escape('fred, barney, & pebbles'); - * // => 'fred, barney, & pebbles' - */ - function escape(string) { - string = toString(string); - return (string && reHasUnescapedHtml.test(string)) - ? string.replace(reUnescapedHtml, escapeHtmlChar) - : string; - } - - /** - * Escapes the `RegExp` special characters "^", "$", "\", ".", "*", "+", - * "?", "(", ")", "[", "]", "{", "}", and "|" in `string`. - * - * @static - * @memberOf _ - * @since 3.0.0 - * @category String - * @param {string} [string=''] The string to escape. - * @returns {string} Returns the escaped string. - * @example - * - * _.escapeRegExp('[lodash](https://lodash.com/)'); - * // => '\[lodash\]\(https://lodash\.com/\)' - */ - function escapeRegExp(string) { - string = toString(string); - return (string && reHasRegExpChar.test(string)) - ? string.replace(reRegExpChar, '\\$&') - : string; - } - - /** - * Converts `string` to - * [kebab case](https://en.wikipedia.org/wiki/Letter_case#Special_case_styles). - * - * @static - * @memberOf _ - * @since 3.0.0 - * @category String - * @param {string} [string=''] The string to convert. - * @returns {string} Returns the kebab cased string. - * @example - * - * _.kebabCase('Foo Bar'); - * // => 'foo-bar' - * - * _.kebabCase('fooBar'); - * // => 'foo-bar' - * - * _.kebabCase('__FOO_BAR__'); - * // => 'foo-bar' - */ - var kebabCase = createCompounder(function(result, word, index) { - return result + (index ? '-' : '') + word.toLowerCase(); - }); - - /** - * Converts `string`, as space separated words, to lower case. - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category String - * @param {string} [string=''] The string to convert. - * @returns {string} Returns the lower cased string. - * @example - * - * _.lowerCase('--Foo-Bar--'); - * // => 'foo bar' - * - * _.lowerCase('fooBar'); - * // => 'foo bar' - * - * _.lowerCase('__FOO_BAR__'); - * // => 'foo bar' - */ - var lowerCase = createCompounder(function(result, word, index) { - return result + (index ? ' ' : '') + word.toLowerCase(); - }); - - /** - * Converts the first character of `string` to lower case. - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category String - * @param {string} [string=''] The string to convert. - * @returns {string} Returns the converted string. - * @example - * - * _.lowerFirst('Fred'); - * // => 'fred' - * - * _.lowerFirst('FRED'); - * // => 'fRED' - */ - var lowerFirst = createCaseFirst('toLowerCase'); - - /** - * Pads `string` on the left and right sides if it's shorter than `length`. - * Padding characters are truncated if they can't be evenly divided by `length`. - * - * @static - * @memberOf _ - * @since 3.0.0 - * @category String - * @param {string} [string=''] The string to pad. - * @param {number} [length=0] The padding length. - * @param {string} [chars=' '] The string used as padding. - * @returns {string} Returns the padded string. - * @example - * - * _.pad('abc', 8); - * // => ' abc ' - * - * _.pad('abc', 8, '_-'); - * // => '_-abc_-_' - * - * _.pad('abc', 3); - * // => 'abc' - */ - function pad(string, length, chars) { - string = toString(string); - length = toInteger(length); - - var strLength = length ? stringSize(string) : 0; - if (!length || strLength >= length) { - return string; - } - var mid = (length - strLength) / 2; - return ( - createPadding(nativeFloor(mid), chars) + - string + - createPadding(nativeCeil(mid), chars) - ); - } - - /** - * Pads `string` on the right side if it's shorter than `length`. Padding - * characters are truncated if they exceed `length`. - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category String - * @param {string} [string=''] The string to pad. - * @param {number} [length=0] The padding length. - * @param {string} [chars=' '] The string used as padding. - * @returns {string} Returns the padded string. - * @example - * - * _.padEnd('abc', 6); - * // => 'abc ' - * - * _.padEnd('abc', 6, '_-'); - * // => 'abc_-_' - * - * _.padEnd('abc', 3); - * // => 'abc' - */ - function padEnd(string, length, chars) { - string = toString(string); - length = toInteger(length); - - var strLength = length ? stringSize(string) : 0; - return (length && strLength < length) - ? (string + createPadding(length - strLength, chars)) - : string; - } - - /** - * Pads `string` on the left side if it's shorter than `length`. Padding - * characters are truncated if they exceed `length`. - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category String - * @param {string} [string=''] The string to pad. - * @param {number} [length=0] The padding length. - * @param {string} [chars=' '] The string used as padding. - * @returns {string} Returns the padded string. - * @example - * - * _.padStart('abc', 6); - * // => ' abc' - * - * _.padStart('abc', 6, '_-'); - * // => '_-_abc' - * - * _.padStart('abc', 3); - * // => 'abc' - */ - function padStart(string, length, chars) { - string = toString(string); - length = toInteger(length); - - var strLength = length ? stringSize(string) : 0; - return (length && strLength < length) - ? (createPadding(length - strLength, chars) + string) - : string; - } - - /** - * Converts `string` to an integer of the specified radix. If `radix` is - * `undefined` or `0`, a `radix` of `10` is used unless `value` is a - * hexadecimal, in which case a `radix` of `16` is used. - * - * **Note:** This method aligns with the - * [ES5 implementation](https://es5.github.io/#x15.1.2.2) of `parseInt`. - * - * @static - * @memberOf _ - * @since 1.1.0 - * @category String - * @param {string} string The string to convert. - * @param {number} [radix=10] The radix to interpret `value` by. - * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`. - * @returns {number} Returns the converted integer. - * @example - * - * _.parseInt('08'); - * // => 8 - * - * _.map(['6', '08', '10'], _.parseInt); - * // => [6, 8, 10] - */ - function parseInt(string, radix, guard) { - if (guard || radix == null) { - radix = 0; - } else if (radix) { - radix = +radix; - } - return nativeParseInt(toString(string).replace(reTrimStart, ''), radix || 0); - } - - /** - * Repeats the given string `n` times. - * - * @static - * @memberOf _ - * @since 3.0.0 - * @category String - * @param {string} [string=''] The string to repeat. - * @param {number} [n=1] The number of times to repeat the string. - * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`. - * @returns {string} Returns the repeated string. - * @example - * - * _.repeat('*', 3); - * // => '***' - * - * _.repeat('abc', 2); - * // => 'abcabc' - * - * _.repeat('abc', 0); - * // => '' - */ - function repeat(string, n, guard) { - if ((guard ? isIterateeCall(string, n, guard) : n === undefined)) { - n = 1; - } else { - n = toInteger(n); - } - return baseRepeat(toString(string), n); - } - - /** - * Replaces matches for `pattern` in `string` with `replacement`. - * - * **Note:** This method is based on - * [`String#replace`](https://mdn.io/String/replace). - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category String - * @param {string} [string=''] The string to modify. - * @param {RegExp|string} pattern The pattern to replace. - * @param {Function|string} replacement The match replacement. - * @returns {string} Returns the modified string. - * @example - * - * _.replace('Hi Fred', 'Fred', 'Barney'); - * // => 'Hi Barney' - */ - function replace() { - var args = arguments, - string = toString(args[0]); - - return args.length < 3 ? string : string.replace(args[1], args[2]); - } - - /** - * Converts `string` to - * [snake case](https://en.wikipedia.org/wiki/Snake_case). - * - * @static - * @memberOf _ - * @since 3.0.0 - * @category String - * @param {string} [string=''] The string to convert. - * @returns {string} Returns the snake cased string. - * @example - * - * _.snakeCase('Foo Bar'); - * // => 'foo_bar' - * - * _.snakeCase('fooBar'); - * // => 'foo_bar' - * - * _.snakeCase('--FOO-BAR--'); - * // => 'foo_bar' - */ - var snakeCase = createCompounder(function(result, word, index) { - return result + (index ? '_' : '') + word.toLowerCase(); - }); - - /** - * Splits `string` by `separator`. - * - * **Note:** This method is based on - * [`String#split`](https://mdn.io/String/split). - * - * @static - * @memberOf _ - * @since 4.0.0 - * @category String - * @param {string} [string=''] The string to split. - * @param {RegExp|string} separator The separator pattern to split by. - * @param {number} [limit] The length to truncate results to. - * @returns {Array} Returns the string segments. - * @example - * - * _.split('a-b-c', '-', 2); - * // => ['a', 'b'] - */ - function split(string, separator, limit) { - if (limit && typeof limit != 'number' && isIterateeCall(string, separator, limit)) { - separator = limit = undefined; - } - limit = limit === undefined ? MAX_ARRAY_LENGTH : limit >>> 0; - if (!limit) { - return []; - } - string = toString(string); - if (string && ( - typeof separator == 'string' || - (separator != null && !isRegExp(separator)) - )) { - separator = baseToString(separator); - if (!separator && hasUnicode(string)) { - return castSlice(stringToArray(string), 0, limit); - } - } - return string.split(separator, limit); - } - - /** - * Converts `string` to - * [start case](https://en.wikipedia.org/wiki/Letter_case#Stylistic_or_specialised_usage). - * - * @static - * @memberOf _ - * @since 3.1.0 - * @category String - * @param {string} [string=''] The string to convert. - * @returns {string} Returns the start cased string. - * @example - * - * _.startCase('--foo-bar--'); - * // => 'Foo Bar' - * - * _.startCase('fooBar'); - * // => 'Foo Bar' - * - * _.startCase('__FOO_BAR__'); - * // => 'FOO BAR' - */ - var startCase = createCompounder(function(result, word, index) { - return result + (index ? ' ' : '') + upperFirst(word); - }); - - /** - * Checks if `string` starts with the given target string. - * - * @static - * @memberOf _ - * @since 3.0.0 - * @category String - * @param {string} [string=''] The string to inspect. - * @param {string} [target] The string to search for. - * @param {number} [position=0] The position to search from. - * @returns {boolean} Returns `true` if `string` starts with `target`, - * else `false`. - * @example - * - * _.startsWith('abc', 'a'); - * // => true - * - * _.startsWith('abc', 'b'); - * // => false - * - * _.startsWith('abc', 'b', 1); - * // => true - */ - function startsWith(string, target, position) { - string = toString(string); - position = position == null - ? 0 - : baseClamp(toInteger(position), 0, string.length); - - target = baseToString(target); - return string.slice(position, position + target.length) == target; - } - - /** - * Creates a compiled template function that can interpolate data properties - * in "interpolate" delimiters, HTML-escape interpolated data properties in - * "escape" delimiters, and execute JavaScript in "evaluate" delimiters. Data - * properties may be accessed as free variables in the template. If a setting - * object is given, it takes precedence over `_.templateSettings` values. - * - * **Note:** In the development build `_.template` utilizes - * [sourceURLs](http://www.html5rocks.com/en/tutorials/developertools/sourcemaps/#toc-sourceurl) - * for easier debugging. - * - * For more information on precompiling templates see - * [lodash's custom builds documentation](https://lodash.com/custom-builds). - * - * For more information on Chrome extension sandboxes see - * [Chrome's extensions documentation](https://developer.chrome.com/extensions/sandboxingEval). - * - * @static - * @since 0.1.0 - * @memberOf _ - * @category String - * @param {string} [string=''] The template string. - * @param {Object} [options={}] The options object. - * @param {RegExp} [options.escape=_.templateSettings.escape] - * The HTML "escape" delimiter. - * @param {RegExp} [options.evaluate=_.templateSettings.evaluate] - * The "evaluate" delimiter. - * @param {Object} [options.imports=_.templateSettings.imports] - * An object to import into the template as free variables. - * @param {RegExp} [options.interpolate=_.templateSettings.interpolate] - * The "interpolate" delimiter. - * @param {string} [options.sourceURL='lodash.templateSources[n]'] - * The sourceURL of the compiled template. - * @param {string} [options.variable='obj'] - * The data object variable name. - * @param- {Object} [guard] Enables use as an iteratee for methods like `_.map`. - * @returns {Function} Returns the compiled template function. - * @example - * - * // Use the "interpolate" delimiter to create a compiled template. - * var compiled = _.template('hello <%= user %>!'); - * compiled({ 'user': 'fred' }); - * // => 'hello fred!' - * - * // Use the HTML "escape" delimiter to escape data property values. - * var compiled = _.template('<%- value %>'); - * compiled({ 'value': '